/* fp-scss-file */

@import url("https://fonts.googleapis.com/css2?family=Open+Sans:ital,wght@0,400;0,600;1,400;1,600&display=swap");
/*!
 * Bootstrap  v5.3.0-alpha1 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
:root, [data-bs-theme=light] {
  --bs-blue:#0d6efd;
  --bs-indigo:#6610f2;
  --bs-purple:#6f42c1;
  --bs-pink:#d63384;
  --bs-red:#dc3545;
  --bs-orange:#fd7e14;
  --bs-yellow:#ffc107;
  --bs-green:#198754;
  --bs-teal:#20c997;
  --bs-cyan:#0dcaf0;
  --bs-black:#000;
  --bs-white:#fff;
  --bs-gray:#6c757d;
  --bs-gray-dark:#343a40;
  --bs-gray-100:#f8f9fa;
  --bs-gray-200:#e9ecef;
  --bs-gray-300:#dee2e6;
  --bs-gray-400:#ced4da;
  --bs-gray-500:#adb5bd;
  --bs-gray-600:#6c757d;
  --bs-gray-700:#495057;
  --bs-gray-800:#343a40;
  --bs-gray-900:#212529;
  --bs-primary:#0d6efd;
  --bs-secondary:#6c757d;
  --bs-success:#198754;
  --bs-info:#0dcaf0;
  --bs-warning:#ffc107;
  --bs-danger:#dc3545;
  --bs-light:#f8f9fa;
  --bs-dark:#212529;
  --bs-primary-rgb:13,110,253;
  --bs-secondary-rgb:108,117,125;
  --bs-success-rgb:25,135,84;
  --bs-info-rgb:13,202,240;
  --bs-warning-rgb:255,193,7;
  --bs-danger-rgb:220,53,69;
  --bs-light-rgb:248,249,250;
  --bs-dark-rgb:33,37,41;
  --bs-primary-text:#0a58ca;
  --bs-secondary-text:#6c757d;
  --bs-success-text:#146c43;
  --bs-info-text:#087990;
  --bs-warning-text:#997404;
  --bs-danger-text:#b02a37;
  --bs-light-text:#6c757d;
  --bs-dark-text:#495057;
  --bs-primary-bg-subtle:#cfe2ff;
  --bs-secondary-bg-subtle:#f8f9fa;
  --bs-success-bg-subtle:#d1e7dd;
  --bs-info-bg-subtle:#cff4fc;
  --bs-warning-bg-subtle:#fff3cd;
  --bs-danger-bg-subtle:#f8d7da;
  --bs-light-bg-subtle:#fcfcfd;
  --bs-dark-bg-subtle:#ced4da;
  --bs-primary-border-subtle:#9ec5fe;
  --bs-secondary-border-subtle:#e9ecef;
  --bs-success-border-subtle:#a3cfbb;
  --bs-info-border-subtle:#9eeaf9;
  --bs-warning-border-subtle:#ffe69c;
  --bs-danger-border-subtle:#f1aeb5;
  --bs-light-border-subtle:#e9ecef;
  --bs-dark-border-subtle:#adb5bd;
  --bs-white-rgb:255,255,255;
  --bs-black-rgb:0,0,0;
  --bs-body-color-rgb:33,37,41;
  --bs-body-bg-rgb:255,255,255;
  --bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";
  --bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;
  --bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
  --bs-body-font-family:var(--bs-font-sans-serif);
  --bs-body-font-size:1rem;
  --bs-body-font-weight:400;
  --bs-body-line-height:1.5;
  --bs-body-color:#212529;
  --bs-emphasis-color:#000;
  --bs-emphasis-color-rgb:0,0,0;
  --bs-secondary-color:rgba(33, 37, 41, 0.75);
  --bs-secondary-color-rgb:33,37,41;
  --bs-secondary-bg:#e9ecef;
  --bs-secondary-bg-rgb:233,236,239;
  --bs-tertiary-color:rgba(33, 37, 41, 0.5);
  --bs-tertiary-color-rgb:33,37,41;
  --bs-tertiary-bg:#f8f9fa;
  --bs-tertiary-bg-rgb:248,249,250;
  --bs-body-bg:#fff;
  --bs-body-bg-rgb:255,255,255;
  --bs-link-color:#0d6efd;
  --bs-link-color-rgb:13,110,253;
  --bs-link-decoration:underline;
  --bs-link-hover-color:#0a58ca;
  --bs-link-hover-color-rgb:10,88,202;
  --bs-code-color:#d63384;
  --bs-highlight-bg:#fff3cd;
  --bs-border-width:1px;
  --bs-border-style:solid;
  --bs-border-color:#dee2e6;
  --bs-border-color-translucent:rgba(0, 0, 0, 0.175);
  --bs-border-radius:0.375rem;
  --bs-border-radius-sm:0.25rem;
  --bs-border-radius-lg:0.5rem;
  --bs-border-radius-xl:1rem;
  --bs-border-radius-2xl:2rem;
  --bs-border-radius-pill:50rem;
  --bs-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
  --bs-box-shadow-sm:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
  --bs-box-shadow-lg:0 1rem 3rem rgba(var(--bs-body-color-rgb), 0.175);
  --bs-box-shadow-inset:inset 0 1px 2px rgba(var(--bs-body-color-rgb), 0.075);
  --bs-emphasis-color:#000;
  --bs-form-control-bg:var(--bs-body-bg);
  --bs-form-control-disabled-bg:var(--bs-secondary-bg);
  --bs-highlight-bg:#fff3cd;
  --bs-breakpoint-xs:0;
  --bs-breakpoint-sm:576px;
  --bs-breakpoint-md:768px;
  --bs-breakpoint-lg:992px;
  --bs-breakpoint-xl:1200px;
  --bs-breakpoint-xxl:1400px}[data-bs-theme=dark]{--bs-body-color:#adb5bd;
  --bs-body-color-rgb:173,181,189;
  --bs-body-bg:#212529;
  --bs-body-bg-rgb:33,37,41;
  --bs-emphasis-color:#f8f9fa;
  --bs-emphasis-color-rgb:248,249,250;
  --bs-secondary-color:rgba(173, 181, 189, 0.75);
  --bs-secondary-color-rgb:173,181,189;
  --bs-secondary-bg:#343a40;
  --bs-secondary-bg-rgb:52,58,64;
  --bs-tertiary-color:rgba(173, 181, 189, 0.5);
  --bs-tertiary-color-rgb:173,181,189;
  --bs-tertiary-bg:#2b3035;
  --bs-tertiary-bg-rgb:43,48,53;
  --bs-emphasis-color:#fff;
  --bs-primary-text:#6ea8fe;
  --bs-secondary-text:#dee2e6;
  --bs-success-text:#75b798;
  --bs-info-text:#6edff6;
  --bs-warning-text:#ffda6a;
  --bs-danger-text:#ea868f;
  --bs-light-text:#f8f9fa;
  --bs-dark-text:#dee2e6;
  --bs-primary-bg-subtle:#031633;
  --bs-secondary-bg-subtle:#212529;
  --bs-success-bg-subtle:#051b11;
  --bs-info-bg-subtle:#032830;
  --bs-warning-bg-subtle:#332701;
  --bs-danger-bg-subtle:#2c0b0e;
  --bs-light-bg-subtle:#343a40;
  --bs-dark-bg-subtle:#1a1d20;
  --bs-primary-border-subtle:#084298;
  --bs-secondary-border-subtle:#495057;
  --bs-success-border-subtle:#0f5132;
  --bs-info-border-subtle:#055160;
  --bs-warning-border-subtle:#664d03;
  --bs-danger-border-subtle:#842029;
  --bs-light-border-subtle:#495057;
  --bs-dark-border-subtle:#343a40;
  --bs-heading-color:#fff;
  --bs-link-color:#6ea8fe;
  --bs-link-hover-color:#9ec5fe;
  --bs-link-color-rgb:110,168,254;
  --bs-link-hover-color-rgb:158,197,254;
  --bs-code-color:#e685b5;
  --bs-border-color:#495057;
  --bs-border-color-translucent:rgba(255, 255, 255, 0.15)}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;
  font-family: var(--bs-body-font-family);
  font-size: var(--bs-body-font-size);
  font-weight: var(--bs-body-font-weight);
  line-height: var(--bs-body-line-height);
  color: var(--bs-body-color);
  text-align: var(--bs-body-text-align);
  background-color: var(--bs-body-bg);
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: transparent;
}
hr {
  margin: 1rem 0;
  color: inherit;
  border: 0;
  border-top: var(--bs-border-width) solid;
  opacity: 0.25;
}
.h1, .h2, .h3, .h4, .h5, .h6, h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.5rem;
  font-weight: 500;
  line-height: 1.2;
  color: var(--bs-heading-color, inherit);
}
.h1, h1 {
  font-size: calc(1.375rem + 1.5vw);
}
@media (min-width: 1200px) {
  .h1, h1 {
    font-size: 2.5rem;
  }
}
.h2, h2 {
  font-size: calc(1.325rem + .9vw);
}
@media (min-width: 1200px) {
  .h2, h2 {
    font-size: 2rem;
  }
}
.h3, h3 {
  font-size: calc(1.3rem + .6vw);
}
@media (min-width: 1200px) {
  .h3, h3 {
    font-size: 1.75rem;
  }
}
.h4, h4 {
  font-size: calc(1.275rem + .3vw);
}
@media (min-width: 1200px) {
  .h4, h4 {
    font-size: 1.5rem;
  }
}
.h5, h5 {
  font-size: 1.25rem;
}
.h6, h6 {
  font-size: 1rem;
}
p {
  margin-top: 0;
  margin-bottom: 1rem;
}
abbr[title] {
  -webkit-text-decoration: underline dotted;
  text-decoration: underline dotted;
  cursor: help;
  -webkit-text-decoration-skip-ink: none;
  text-decoration-skip-ink: none;
}
address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}
ol, ul {
  padding-left: 2rem;
}
dl, ol, ul {
  margin-top: 0;
  margin-bottom: 1rem;
}
ol ol, ol ul, ul ol, ul ul {
  margin-bottom: 0;
}
dt {
  font-weight: 700;
}
dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}
blockquote {
  margin: 0 0 1rem;
}
b, strong {
  font-weight: bolder;
}
.small, small {
  font-size: 0.875em;
}
.mark, mark {
  padding: 0.1875em;
  background-color: var(--bs-highlight-bg);
}
sub, sup {
  position: relative;
  font-size: 0.75em;
  line-height: 0;
  vertical-align: baseline;
}
sub {
  bottom: -0.25em;
}
sup {
  top: -0.5em;
}
a {
  color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
  text-decoration: underline;
}
a:hover {
  --bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;
  text-decoration: none;
}
code, kbd, pre, samp {
  font-family: var(--bs-font-monospace);
  font-size: 1em;
}
pre {
  display: block;
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  font-size: 0.875em;
}
pre code {
  font-size: inherit;
  color: inherit;
  word-break: normal;
}
code {
  font-size: 0.875em;
  color: var(--bs-code-color);
  word-wrap: break-word;
}
a > code {
  color: inherit;
}
kbd {
  padding: 0.1875rem 0.375rem;
  font-size: 0.875em;
  color: var(--bs-body-bg);
  background-color: var(--bs-body-color);
  border-radius: 0.25rem;
}
kbd kbd {
  padding: 0;
  font-size: 1em;
}
figure {
  margin: 0 0 1rem;
}
img, svg {
  vertical-align: middle;
}
table {
  caption-side: bottom;
  border-collapse: collapse;
}
caption {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  color: var(--bs-secondary-color);
  text-align: left;
}
th {
  text-align: inherit;
  text-align: -webkit-match-parent;
}
tbody, td, tfoot, th, thead, tr {
  border-color: inherit;
  border-style: solid;
  border-width: 0;
}
label {
  display: inline-block;
}
button {
  border-radius: 0;
}
button:focus:not(:focus-visible) {
  outline: 0;
}
button, input, optgroup, select, textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}
button, select {
  text-transform: none;
}
[role=button] {
  cursor: pointer;
}
select {
  word-wrap: normal;
}
select:disabled {
  opacity: 1;
}
[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
  display: none !important;
}
[type=button], [type=reset], [type=submit], button {
  -webkit-appearance: button;
}
[type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled), button:not(:disabled) {
  cursor: pointer;
}
::-moz-focus-inner {
  padding: 0;
  border-style: none;
}
textarea {
  resize: vertical;
}
fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}
legend {
  float: left;
  width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: calc(1.275rem + .3vw);
  line-height: inherit;
}
@media (min-width: 1200px) {
  legend {
    font-size: 1.5rem;
  }
}
legend + * {
  clear: left;
}
::-webkit-datetime-edit-day-field, ::-webkit-datetime-edit-fields-wrapper, ::-webkit-datetime-edit-hour-field, ::-webkit-datetime-edit-minute, ::-webkit-datetime-edit-month-field, ::-webkit-datetime-edit-text, ::-webkit-datetime-edit-year-field {
  padding: 0;
}
::-webkit-inner-spin-button {
  height: auto;
}
[type=search] {
  outline-offset: -2px;
  -webkit-appearance: textfield;
}
::-webkit-search-decoration {
  -webkit-appearance: none;
}
::-webkit-color-swatch-wrapper {
  padding: 0;
}
::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button;
}
::file-selector-button {
  font: inherit;
  -webkit-appearance: button;
}
output {
  display: inline-block;
}
iframe {
  border: 0;
}
summary {
  display: list-item;
  cursor: pointer;
}
progress {
  vertical-align: baseline;
}
[hidden] {
  display: none !important;
}
.lead {
  font-size: 1.25rem;
  font-weight: 300;
}
.display-1 {
  font-size: calc(1.625rem + 4.5vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-1 {
    font-size: 5rem;
  }
}
.display-2 {
  font-size: calc(1.575rem + 3.9vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-2 {
    font-size: 4.5rem;
  }
}
.display-3 {
  font-size: calc(1.525rem + 3.3vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-3 {
    font-size: 4rem;
  }
}
.display-4 {
  font-size: calc(1.475rem + 2.7vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-4 {
    font-size: 3.5rem;
  }
}
.display-5 {
  font-size: calc(1.425rem + 2.1vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-5 {
    font-size: 3rem;
  }
}
.display-6 {
  font-size: calc(1.375rem + 1.5vw);
  font-weight: 300;
  line-height: 1.2;
}
@media (min-width: 1200px) {
  .display-6 {
    font-size: 2.5rem;
  }
}
.list-unstyled {
  padding-left: 0;
  list-style: none;
}
.list-inline {
  padding-left: 0;
  list-style: none;
}
.list-inline-item {
  display: inline-block;
}
.list-inline-item:not(:last-child) {
  margin-right: 0.5rem;
}
.initialism {
  font-size: 0.875em;
  text-transform: uppercase;
}
.blockquote {
  margin-bottom: 1rem;
  font-size: 1.25rem;
}
.blockquote > :last-child {
  margin-bottom: 0;
}
.blockquote-footer {
  margin-top: -1rem;
  margin-bottom: 1rem;
  font-size: 0.875em;
  color: #6c757d;
}
.blockquote-footer::before {
  content: "— ";
}
.img-fluid {
  max-width: 100%;
  height: auto;
}
.img-thumbnail {
  padding: 0.25rem;
  background-color: var(--bs-body-bg);
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: var(--bs-border-radius);
  max-width: 100%;
  height: auto;
}
.figure {
  display: inline-block;
}
.figure-img {
  margin-bottom: 0.5rem;
  line-height: 1;
}
.figure-caption {
  font-size: 0.875em;
  color: var(--bs-secondary-color);
}
.container, .container-fluid, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
  --bs-gutter-x:1.5rem;
  --bs-gutter-y:0;
  width: 100%;
  padding-right: calc(var(--bs-gutter-x) * .5);
  padding-left: calc(var(--bs-gutter-x) * .5);
  margin-right: auto;
  margin-left: auto;
}
@media (min-width: 576px) {
  .container, .container-sm {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container, .container-md, .container-sm {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container, .container-lg, .container-md, .container-sm {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container, .container-lg, .container-md, .container-sm, .container-xl {
    max-width: 1140px;
  }
}
@media (min-width: 1400px) {
  .container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
    max-width: 1320px;
  }
}
.row {
  --bs-gutter-x:1.5rem;
  --bs-gutter-y:0;
  display: flex;
  flex-wrap: wrap;
  margin-top: calc(-1 * var(--bs-gutter-y));
  margin-right: calc(-.5 * var(--bs-gutter-x));
  margin-left: calc(-.5 * var(--bs-gutter-x));
}
.row > * {
  flex-shrink: 0;
  width: 100%;
  max-width: 100%;
  padding-right: calc(var(--bs-gutter-x) * .5);
  padding-left: calc(var(--bs-gutter-x) * .5);
  margin-top: var(--bs-gutter-y);
}
.col {
  flex: 1 0 0%;
}
.row-cols-auto > * {
  flex: 0 0 auto;
  width: auto;
}
.row-cols-1 > * {
  flex: 0 0 auto;
  width: 100%;
}
.row-cols-2 > * {
  flex: 0 0 auto;
  width: 50%;
}
.row-cols-3 > * {
  flex: 0 0 auto;
  width: 33.3333333333%;
}
.row-cols-4 > * {
  flex: 0 0 auto;
  width: 25%;
}
.row-cols-5 > * {
  flex: 0 0 auto;
  width: 20%;
}
.row-cols-6 > * {
  flex: 0 0 auto;
  width: 16.6666666667%;
}
.col-auto {
  flex: 0 0 auto;
  width: auto;
}
.col-1 {
  flex: 0 0 auto;
  width: 8.33333333%;
}
.col-2 {
  flex: 0 0 auto;
  width: 16.66666667%;
}
.col-3 {
  flex: 0 0 auto;
  width: 25%;
}
.col-4 {
  flex: 0 0 auto;
  width: 33.33333333%;
}
.col-5 {
  flex: 0 0 auto;
  width: 41.66666667%;
}
.col-6 {
  flex: 0 0 auto;
  width: 50%;
}
.col-7 {
  flex: 0 0 auto;
  width: 58.33333333%;
}
.col-8 {
  flex: 0 0 auto;
  width: 66.66666667%;
}
.col-9 {
  flex: 0 0 auto;
  width: 75%;
}
.col-10 {
  flex: 0 0 auto;
  width: 83.33333333%;
}
.col-11 {
  flex: 0 0 auto;
  width: 91.66666667%;
}
.col-12 {
  flex: 0 0 auto;
  width: 100%;
}
.offset-1 {
  margin-left: 8.33333333%;
}
.offset-2 {
  margin-left: 16.66666667%;
}
.offset-3 {
  margin-left: 25%;
}
.offset-4 {
  margin-left: 33.33333333%;
}
.offset-5 {
  margin-left: 41.66666667%;
}
.offset-6 {
  margin-left: 50%;
}
.offset-7 {
  margin-left: 58.33333333%;
}
.offset-8 {
  margin-left: 66.66666667%;
}
.offset-9 {
  margin-left: 75%;
}
.offset-10 {
  margin-left: 83.33333333%;
}
.offset-11 {
  margin-left: 91.66666667%;
}
.g-0, .gx-0 {
  --bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);
  --bs-table-bg:transparent;
  --bs-table-border-color:var(--bs-border-color);
  --bs-table-accent-bg:transparent;
  --bs-table-striped-color:var(--bs-body-color);
  --bs-table-striped-bg:rgba(0, 0, 0, 0.05);
  --bs-table-active-color:var(--bs-body-color);
  --bs-table-active-bg:rgba(0, 0, 0, 0.1);
  --bs-table-hover-color:var(--bs-body-color);
  --bs-table-hover-bg:rgba(0, 0, 0, 0.075);
  width: 100%;
  margin-bottom: 1rem;
  color: var(--bs-table-color);
  vertical-align: top;
  border-color: var(--bs-table-border-color);
}
.table > :not(caption) > * > * {
  padding: 0.5rem 0.5rem;
  background-color: var(--bs-table-bg);
  border-bottom-width: var(--bs-border-width);
  box-shadow: inset 0 0 0 9999px var(--bs-table-accent-bg);
}
.table > tbody {
  vertical-align: inherit;
}
.table > thead {
  vertical-align: bottom;
}
.table-group-divider {
  border-top: calc(var(--bs-border-width) * 2) solid currentcolor;
}
.caption-top {
  caption-side: top;
}
.table-sm > :not(caption) > * > * {
  padding: 0.25rem 0.25rem;
}
.table-bordered > :not(caption) > * {
  border-width: var(--bs-border-width) 0;
}
.table-bordered > :not(caption) > * > * {
  border-width: 0 var(--bs-border-width);
}
.table-borderless > :not(caption) > * > * {
  border-bottom-width: 0;
}
.table-borderless > :not(:first-child) {
  border-top-width: 0;
}
.table-striped > tbody > tr:nth-of-type(odd) > * {
  --bs-table-accent-bg:var(--bs-table-striped-bg);
  color: var(--bs-table-striped-color);
}
.table-striped-columns > :not(caption) > tr > :nth-child(2n) {
  --bs-table-accent-bg:var(--bs-table-striped-bg);
  color: var(--bs-table-striped-color);
}
.table-active {
  --bs-table-accent-bg:var(--bs-table-active-bg);
  color: var(--bs-table-active-color);
}
.table-hover > tbody > tr:hover > * {
  --bs-table-accent-bg:var(--bs-table-hover-bg);
  color: var(--bs-table-hover-color);
}
.table-primary {
  --bs-table-color:#000;
  --bs-table-bg:#cfe2ff;
  --bs-table-border-color:#bacbe6;
  --bs-table-striped-bg:#c5d7f2;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#bacbe6;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#bfd1ec;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-secondary {
  --bs-table-color:#000;
  --bs-table-bg:#e2e3e5;
  --bs-table-border-color:#cbccce;
  --bs-table-striped-bg:#d7d8da;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#cbccce;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#d1d2d4;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-success {
  --bs-table-color:#000;
  --bs-table-bg:#d1e7dd;
  --bs-table-border-color:#bcd0c7;
  --bs-table-striped-bg:#c7dbd2;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#bcd0c7;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#c1d6cc;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-info {
  --bs-table-color:#000;
  --bs-table-bg:#cff4fc;
  --bs-table-border-color:#badce3;
  --bs-table-striped-bg:#c5e8ef;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#badce3;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#bfe2e9;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-warning {
  --bs-table-color:#000;
  --bs-table-bg:#fff3cd;
  --bs-table-border-color:#e6dbb9;
  --bs-table-striped-bg:#f2e7c3;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#e6dbb9;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#ece1be;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-danger {
  --bs-table-color:#000;
  --bs-table-bg:#f8d7da;
  --bs-table-border-color:#dfc2c4;
  --bs-table-striped-bg:#eccccf;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#dfc2c4;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#e5c7ca;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-light {
  --bs-table-color:#000;
  --bs-table-bg:#f8f9fa;
  --bs-table-border-color:#dfe0e1;
  --bs-table-striped-bg:#ecedee;
  --bs-table-striped-color:#000;
  --bs-table-active-bg:#dfe0e1;
  --bs-table-active-color:#000;
  --bs-table-hover-bg:#e5e6e7;
  --bs-table-hover-color:#000;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-dark {
  --bs-table-color:#fff;
  --bs-table-bg:#212529;
  --bs-table-border-color:#373b3e;
  --bs-table-striped-bg:#2c3034;
  --bs-table-striped-color:#fff;
  --bs-table-active-bg:#373b3e;
  --bs-table-active-color:#fff;
  --bs-table-hover-bg:#323539;
  --bs-table-hover-color:#fff;
  color: var(--bs-table-color);
  border-color: var(--bs-table-border-color);
}
.table-responsive {
  overflow-x: auto;
  -webkit-overflow-scrolling: touch;
}
@media (max-width: 575.98px) {
  .table-responsive-sm {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 767.98px) {
  .table-responsive-md {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 991.98px) {
  .table-responsive-lg {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 1199.98px) {
  .table-responsive-xl {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
@media (max-width: 1399.98px) {
  .table-responsive-xxl {
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
}
.form-label {
  margin-bottom: 0.5rem;
}
.col-form-label {
  padding-top: calc(.375rem + var(--bs-border-width));
  padding-bottom: calc(.375rem + var(--bs-border-width));
  margin-bottom: 0;
  font-size: inherit;
  line-height: 1.5;
}
.col-form-label-lg {
  padding-top: calc(.5rem + var(--bs-border-width));
  padding-bottom: calc(.5rem + var(--bs-border-width));
  font-size: 1.25rem;
}
.col-form-label-sm {
  padding-top: calc(.25rem + var(--bs-border-width));
  padding-bottom: calc(.25rem + var(--bs-border-width));
  font-size: 0.875rem;
}
.form-text {
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-secondary-color);
}
.form-control {
  display: block;
  width: 100%;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  background-color: var(--bs-form-control-bg);
  background-clip: padding-box;
  border: var(--bs-border-width) solid var(--bs-border-color);
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
  border-radius: 0.375rem;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-control {
    transition: none;
  }
}
.form-control[type=file] {
  overflow: hidden;
}
.form-control[type=file]:not(:disabled):not([readonly]) {
  cursor: pointer;
}
.form-control:focus {
  color: var(--bs-body-color);
  background-color: var(--bs-form-control-bg);
  border-color: #86b7fe;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
}
.form-control::-webkit-date-and-time-value {
  height: 1.5em;
}
.form-control::-webkit-datetime-edit {
  display: block;
  padding: 0;
}
.form-control::-moz-placeholder {
  color: var(--bs-secondary-color);
  opacity: 1;
}
.form-control::placeholder {
  color: var(--bs-secondary-color);
  opacity: 1;
}
.form-control:disabled {
  background-color: var(--bs-form-control-disabled-bg);
  opacity: 1;
}
.form-control::-webkit-file-upload-button {
  padding: 0.375rem 0.75rem;
  margin: -0.375rem -0.75rem;
  -webkit-margin-end: 0.75rem;
  margin-inline-end: 0.75rem;
  color: var(--bs-body-color);
  background-color: var(--bs-tertiary-bg);
  pointer-events: none;
  border-color: inherit;
  border-style: solid;
  border-width: 0;
  border-inline-end-width: var(--bs-border-width);
  border-radius: 0;
  -webkit-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
.form-control::file-selector-button {
  padding: 0.375rem 0.75rem;
  margin: -0.375rem -0.75rem;
  -webkit-margin-end: 0.75rem;
  margin-inline-end: 0.75rem;
  color: var(--bs-body-color);
  background-color: var(--bs-tertiary-bg);
  pointer-events: none;
  border-color: inherit;
  border-style: solid;
  border-width: 0;
  border-inline-end-width: var(--bs-border-width);
  border-radius: 0;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-control::-webkit-file-upload-button {
    -webkit-transition: none;
    transition: none;
  }
  .form-control::file-selector-button {
    transition: none;
  }
}
.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button {
  background-color: var(--bs-secondary-bg);
}
.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
  background-color: var(--bs-secondary-bg);
}
.form-control-plaintext {
  display: block;
  width: 100%;
  padding: 0.375rem 0;
  margin-bottom: 0;
  line-height: 1.5;
  color: var(--bs-body-color);
  background-color: transparent;
  border: solid transparent;
  border-width: var(--bs-border-width) 0;
}
.form-control-plaintext:focus {
  outline: 0;
}
.form-control-plaintext.form-control-lg, .form-control-plaintext.form-control-sm {
  padding-right: 0;
  padding-left: 0;
}
.form-control-sm {
  min-height: calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  border-radius: 0.25rem;
}
.form-control-sm::-webkit-file-upload-button {
  padding: 0.25rem 0.5rem;
  margin: -0.25rem -0.5rem;
  -webkit-margin-end: 0.5rem;
  margin-inline-end: 0.5rem;
}
.form-control-sm::file-selector-button {
  padding: 0.25rem 0.5rem;
  margin: -0.25rem -0.5rem;
  -webkit-margin-end: 0.5rem;
  margin-inline-end: 0.5rem;
}
.form-control-lg {
  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  border-radius: 0.5rem;
}
.form-control-lg::-webkit-file-upload-button {
  padding: 0.5rem 1rem;
  margin: -0.5rem -1rem;
  -webkit-margin-end: 1rem;
  margin-inline-end: 1rem;
}
.form-control-lg::file-selector-button {
  padding: 0.5rem 1rem;
  margin: -0.5rem -1rem;
  -webkit-margin-end: 1rem;
  margin-inline-end: 1rem;
}
textarea.form-control {
  min-height: calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));
}
textarea.form-control-sm {
  min-height: calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));
}
textarea.form-control-lg {
  min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
}
.form-control-color {
  width: 3rem;
  height: calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));
  padding: 0.375rem;
}
.form-control-color:not(:disabled):not([readonly]) {
  cursor: pointer;
}
.form-control-color::-moz-color-swatch {
  border: 0 !important;
  border-radius: 0.375rem;
}
.form-control-color::-webkit-color-swatch {
  border-radius: 0.375rem;
}
.form-control-color.form-control-sm {
  height: calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));
}
.form-control-color.form-control-lg {
  height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
}
.form-select {
  --bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
  display: block;
  width: 100%;
  padding: 0.375rem 2.25rem 0.375rem 0.75rem;
  -moz-padding-start: calc(0.75rem - 3px);
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  background-color: var(--bs-form-control-bg);
  background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
  background-repeat: no-repeat;
  background-position: right 0.75rem center;
  background-size: 16px 12px;
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: 0.375rem;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .form-select {
    transition: none;
  }
}
.form-select:focus {
  border-color: #86b7fe;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
}
.form-select[multiple], .form-select[size]:not([size="1"]) {
  padding-right: 0.75rem;
  background-image: none;
}
.form-select:disabled {
  background-color: var(--bs-form-control-disabled-bg);
}
.form-select:-moz-focusring {
  color: transparent;
  text-shadow: 0 0 0 var(--bs-body-color);
}
.form-select-sm {
  padding-top: 0.25rem;
  padding-bottom: 0.25rem;
  padding-left: 0.5rem;
  font-size: 0.875rem;
  border-radius: 0.25rem;
}
.form-select-lg {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  padding-left: 1rem;
  font-size: 1.25rem;
  border-radius: 0.5rem;
}
[data-bs-theme=dark] .form-select {
  --bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23adb5bd' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;
  min-height: 1.5rem;
  padding-left: 1.5em;
  margin-bottom: 0.125rem;
}
.form-check .form-check-input {
  float: left;
  margin-left: -1.5em;
}
.form-check-reverse {
  padding-right: 1.5em;
  padding-left: 0;
  text-align: right;
}
.form-check-reverse .form-check-input {
  float: right;
  margin-right: -1.5em;
  margin-left: 0;
}
.form-check-input {
  --bs-form-check-bg:var(--bs-form-control-bg);
  width: 1em;
  height: 1em;
  margin-top: 0.25em;
  vertical-align: top;
  background-color: var(--bs-form-check-bg);
  background-image: var(--bs-form-check-bg-image);
  background-repeat: no-repeat;
  background-position: center;
  background-size: contain;
  border: var(--bs-border-width) solid var(--bs-border-color);
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
  -webkit-print-color-adjust: exact;
  color-adjust: exact;
  print-color-adjust: exact;
}
.form-check-input[type=checkbox] {
  border-radius: 0.25em;
}
.form-check-input[type=radio] {
  border-radius: 50%;
}
.form-check-input:active {
  filter: brightness(90%);
}
.form-check-input:focus {
  border-color: #86b7fe;
  outline: 0;
  box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
}
.form-check-input:checked {
  background-color: #0d6efd;
  border-color: #0d6efd;
}
.form-check-input:checked[type=checkbox] {
  --bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;
  border-color: #0d6efd;
  --bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;
  filter: none;
  opacity: 0.5;
}
.form-check-input:disabled ~ .form-check-label, .form-check-input[disabled] ~ .form-check-label {
  cursor: default;
  opacity: 0.5;
}
.form-switch {
  padding-left: 2.5em;
}
.form-switch .form-check-input {
  --bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");
  width: 2em;
  margin-left: -2.5em;
  background-image: var(--bs-form-switch-bg);
  background-position: left center;
  border-radius: 2em;
  transition: background-position 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-switch .form-check-input {
    transition: none;
  }
}
.form-switch .form-check-input:focus {
  --bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;
  --bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;
  padding-left: 0;
}
.form-switch.form-check-reverse .form-check-input {
  margin-right: -2.5em;
  margin-left: 0;
}
.form-check-inline {
  display: inline-block;
  margin-right: 1rem;
}
.btn-check {
  position: absolute;
  clip: rect(0, 0, 0, 0);
  pointer-events: none;
}
.btn-check:disabled + .btn, .btn-check[disabled] + .btn {
  pointer-events: none;
  filter: none;
  opacity: 0.65;
}
[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
  --bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;
  height: 1.5rem;
  padding: 0;
  background-color: transparent;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
}
.form-range:focus {
  outline: 0;
}
.form-range:focus::-webkit-slider-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
}
.form-range:focus::-moz-range-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(13, 110, 253, 0.25);
}
.form-range::-moz-focus-outer {
  border: 0;
}
.form-range::-webkit-slider-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: -0.25rem;
  background-color: #0d6efd;
  border: 0;
  border-radius: 1rem;
  -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  -webkit-appearance: none;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .form-range::-webkit-slider-thumb {
    -webkit-transition: none;
    transition: none;
  }
}
.form-range::-webkit-slider-thumb:active {
  background-color: #b6d4fe;
}
.form-range::-webkit-slider-runnable-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: var(--bs-tertiary-bg);
  border-color: transparent;
  border-radius: 1rem;
}
.form-range::-moz-range-thumb {
  width: 1rem;
  height: 1rem;
  background-color: #0d6efd;
  border: 0;
  border-radius: 1rem;
  -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  -moz-appearance: none;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .form-range::-moz-range-thumb {
    -moz-transition: none;
    transition: none;
  }
}
.form-range::-moz-range-thumb:active {
  background-color: #b6d4fe;
}
.form-range::-moz-range-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: var(--bs-tertiary-bg);
  border-color: transparent;
  border-radius: 1rem;
}
.form-range:disabled {
  pointer-events: none;
}
.form-range:disabled::-webkit-slider-thumb {
  background-color: var(--bs-secondary-color);
}
.form-range:disabled::-moz-range-thumb {
  background-color: var(--bs-secondary-color);
}
.form-floating {
  position: relative;
}
.form-floating::before:not(.form-control:disabled) {
  position: absolute;
  top: var(--bs-border-width);
  left: var(--bs-border-width);
  width: calc(100% - (calc(calc(.375em + .1875rem) + calc(.75em + .375rem))));
  height: 1.875em;
  content: "";
  background-color: var(--bs-form-control-bg);
  border-radius: 0.375rem;
}
.form-floating > .form-control, .form-floating > .form-control-plaintext, .form-floating > .form-select {
  height: calc(3.5rem + calc(var(--bs-border-width) * 2));
  line-height: 1.25;
}
.form-floating > label {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  padding: 1rem 0.75rem;
  overflow: hidden;
  text-align: start;
  text-overflow: ellipsis;
  white-space: nowrap;
  pointer-events: none;
  border: var(--bs-border-width) solid transparent;
  transform-origin: 0 0;
  transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-floating > label {
    transition: none;
  }
}
.form-floating > .form-control, .form-floating > .form-control-plaintext {
  padding: 1rem 0.75rem;
}
.form-floating > .form-control-plaintext::-moz-placeholder, .form-floating > .form-control::-moz-placeholder {
  color: transparent;
}
.form-floating > .form-control-plaintext::placeholder, .form-floating > .form-control::placeholder {
  color: transparent;
}
.form-floating > .form-control-plaintext:not(:-moz-placeholder-shown), .form-floating > .form-control:not(:-moz-placeholder-shown) {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-control-plaintext:focus, .form-floating > .form-control-plaintext:not(:placeholder-shown), .form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown) {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-control-plaintext:-webkit-autofill, .form-floating > .form-control:-webkit-autofill {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-select {
  padding-top: 1.625rem;
  padding-bottom: 0.625rem;
}
.form-floating > .form-control:not(:-moz-placeholder-shown) ~ label {
  opacity: 0.65;
  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
}
.form-floating > .form-control-plaintext ~ label, .form-floating > .form-control:focus ~ label, .form-floating > .form-control:not(:placeholder-shown) ~ label, .form-floating > .form-select ~ label {
  opacity: 0.65;
  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
}
.form-floating > .form-control:-webkit-autofill ~ label {
  opacity: 0.65;
  transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
}
.form-floating > .form-control-plaintext ~ label {
  border-width: var(--bs-border-width) 0;
}
.form-floating > .form-control:disabled ~ label {
  color: #6c757d;
}
.input-group {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: stretch;
  width: 100%;
}
.input-group > .form-control, .input-group > .form-floating, .input-group > .form-select {
  position: relative;
  flex: 1 1 auto;
  width: 1%;
  min-width: 0;
}
.input-group > .form-control:focus, .input-group > .form-floating:focus-within, .input-group > .form-select:focus {
  z-index: 5;
}
.input-group .btn {
  position: relative;
  z-index: 2;
}
.input-group .btn:focus {
  z-index: 5;
}
.input-group-text {
  display: flex;
  align-items: center;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: var(--bs-body-color);
  text-align: center;
  white-space: nowrap;
  background-color: var(--bs-tertiary-bg);
  border: var(--bs-border-width) solid var(--bs-border-color);
  border-radius: 0.375rem;
}
.input-group-lg > .btn, .input-group-lg > .form-control, .input-group-lg > .form-select, .input-group-lg > .input-group-text {
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  border-radius: 0.5rem;
}
.input-group-sm > .btn, .input-group-sm > .form-control, .input-group-sm > .form-select, .input-group-sm > .input-group-text {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  border-radius: 0.25rem;
}
.input-group-lg > .form-select, .input-group-sm > .form-select {
  padding-right: 3rem;
}
.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n+3), .input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control, .input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select, .input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group.has-validation > .dropdown-toggle:nth-last-child(n+4), .input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-control, .input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-select, .input-group.has-validation > :nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
  margin-left: calc(var(--bs-border-width) * -1);
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.input-group > .form-floating:not(:first-child) > .form-control, .input-group > .form-floating:not(:first-child) > .form-select {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.valid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-success-text);
}
.valid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  color: #fff;
  background-color: var(--bs-success);
  border-radius: var(--bs-border-radius);
}
.is-valid ~ .valid-feedback, .is-valid ~ .valid-tooltip, .was-validated :valid ~ .valid-feedback, .was-validated :valid ~ .valid-tooltip {
  display: block;
}
.form-control.is-valid, .was-validated .form-control:valid {
  border-color: var(--bs-success);
  padding-right: calc(1.5em + .75rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(.375em + .1875rem) center;
  background-size: calc(.75em + .375rem) calc(.75em + .375rem);
}
.form-control.is-valid:focus, .was-validated .form-control:valid:focus {
  border-color: var(--bs-success);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}
.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
  padding-right: calc(1.5em + .75rem);
  background-position: top calc(.375em + .1875rem) right calc(.375em + .1875rem);
}
.form-select.is-valid, .was-validated .form-select:valid {
  border-color: var(--bs-success);
}
.form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"], .was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"] {
  --bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
  padding-right: 4.125rem;
  background-position: right 0.75rem center, center right 2.25rem;
  background-size: 16px 12px, calc(.75em + .375rem) calc(.75em + .375rem);
}
.form-select.is-valid:focus, .was-validated .form-select:valid:focus {
  border-color: var(--bs-success);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}
.form-control-color.is-valid, .was-validated .form-control-color:valid {
  width: calc(3rem + calc(1.5em + .75rem));
}
.form-check-input.is-valid, .was-validated .form-check-input:valid {
  border-color: var(--bs-success);
}
.form-check-input.is-valid:checked, .was-validated .form-check-input:valid:checked {
  background-color: var(--bs-success-text);
}
.form-check-input.is-valid:focus, .was-validated .form-check-input:valid:focus {
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
}
.form-check-input.is-valid ~ .form-check-label, .was-validated .form-check-input:valid ~ .form-check-label {
  color: var(--bs-success-text);
}
.form-check-inline .form-check-input ~ .valid-feedback {
  margin-left: 0.5em;
}
.input-group > .form-control:not(:focus).is-valid, .input-group > .form-floating:not(:focus-within).is-valid, .input-group > .form-select:not(:focus).is-valid, .was-validated .input-group > .form-control:not(:focus):valid, .was-validated .input-group > .form-floating:not(:focus-within):valid, .was-validated .input-group > .form-select:not(:focus):valid {
  z-index: 3;
}
.invalid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: var(--bs-danger-text);
}
.invalid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  color: #fff;
  background-color: var(--bs-danger);
  border-radius: var(--bs-border-radius);
}
.is-invalid ~ .invalid-feedback, .is-invalid ~ .invalid-tooltip, .was-validated :invalid ~ .invalid-feedback, .was-validated :invalid ~ .invalid-tooltip {
  display: block;
}
.form-control.is-invalid, .was-validated .form-control:invalid {
  border-color: var(--bs-danger);
  padding-right: calc(1.5em + .75rem);
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(.375em + .1875rem) center;
  background-size: calc(.75em + .375rem) calc(.75em + .375rem);
}
.form-control.is-invalid:focus, .was-validated .form-control:invalid:focus {
  border-color: var(--bs-danger);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}
.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
  padding-right: calc(1.5em + .75rem);
  background-position: top calc(.375em + .1875rem) right calc(.375em + .1875rem);
}
.form-select.is-invalid, .was-validated .form-select:invalid {
  border-color: var(--bs-danger);
}
.form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"], .was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"] {
  --bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
  padding-right: 4.125rem;
  background-position: right 0.75rem center, center right 2.25rem;
  background-size: 16px 12px, calc(.75em + .375rem) calc(.75em + .375rem);
}
.form-select.is-invalid:focus, .was-validated .form-select:invalid:focus {
  border-color: var(--bs-danger);
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}
.form-control-color.is-invalid, .was-validated .form-control-color:invalid {
  width: calc(3rem + calc(1.5em + .75rem));
}
.form-check-input.is-invalid, .was-validated .form-check-input:invalid {
  border-color: var(--bs-danger);
}
.form-check-input.is-invalid:checked, .was-validated .form-check-input:invalid:checked {
  background-color: var(--bs-danger-text);
}
.form-check-input.is-invalid:focus, .was-validated .form-check-input:invalid:focus {
  box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
}
.form-check-input.is-invalid ~ .form-check-label, .was-validated .form-check-input:invalid ~ .form-check-label {
  color: var(--bs-danger-text);
}
.form-check-inline .form-check-input ~ .invalid-feedback {
  margin-left: 0.5em;
}
.input-group > .form-control:not(:focus).is-invalid, .input-group > .form-floating:not(:focus-within).is-invalid, .input-group > .form-select:not(:focus).is-invalid, .was-validated .input-group > .form-control:not(:focus):invalid, .was-validated .input-group > .form-floating:not(:focus-within):invalid, .was-validated .input-group > .form-select:not(:focus):invalid {
  z-index: 4;
}
.btn {
  --bs-btn-padding-x:0.75rem;
  --bs-btn-padding-y:0.375rem;
  --bs-btn-font-family: ;
  --bs-btn-font-size:1rem;
  --bs-btn-font-weight:400;
  --bs-btn-line-height:1.5;
  --bs-btn-color:#212529;
  --bs-btn-bg:transparent;
  --bs-btn-border-width:var(--bs-border-width);
  --bs-btn-border-color:transparent;
  --bs-btn-border-radius:0.375rem;
  --bs-btn-hover-border-color:transparent;
  --bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);
  --bs-btn-disabled-opacity:0.65;
  --bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
  display: inline-block;
  padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
  font-family: var(--bs-btn-font-family);
  font-size: var(--bs-btn-font-size);
  font-weight: var(--bs-btn-font-weight);
  line-height: var(--bs-btn-line-height);
  color: var(--bs-btn-color);
  text-align: center;
  text-decoration: none;
  vertical-align: middle;
  cursor: pointer;
  -webkit-user-select: none;
  -moz-user-select: none;
  user-select: none;
  border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
  border-radius: var(--bs-btn-border-radius);
  background-color: var(--bs-btn-bg);
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .btn {
    transition: none;
  }
}
.btn:hover {
  color: var(--bs-btn-hover-color);
  background-color: var(--bs-btn-hover-bg);
  border-color: var(--bs-btn-hover-border-color);
}
.btn-check + .btn:hover {
  color: var(--bs-btn-color);
  background-color: var(--bs-btn-bg);
  border-color: var(--bs-btn-border-color);
}
.btn:focus-visible {
  color: var(--bs-btn-hover-color);
  background-color: var(--bs-btn-hover-bg);
  border-color: var(--bs-btn-hover-border-color);
  outline: 0;
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn-check:focus-visible + .btn {
  border-color: var(--bs-btn-hover-border-color);
  outline: 0;
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn-check:checked + .btn, .btn.active, .btn.show, .btn:first-child:active, :not(.btn-check) + .btn:active {
  color: var(--bs-btn-active-color);
  background-color: var(--bs-btn-active-bg);
  border-color: var(--bs-btn-active-border-color);
}
.btn-check:checked + .btn:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible, .btn:first-child:active:focus-visible, :not(.btn-check) + .btn:active:focus-visible {
  box-shadow: var(--bs-btn-focus-box-shadow);
}
.btn.disabled, .btn:disabled, fieldset:disabled .btn {
  color: var(--bs-btn-disabled-color);
  pointer-events: none;
  background-color: var(--bs-btn-disabled-bg);
  border-color: var(--bs-btn-disabled-border-color);
  opacity: var(--bs-btn-disabled-opacity);
}
.btn-primary {
  --bs-btn-color:#fff;
  --bs-btn-bg:#0d6efd;
  --bs-btn-border-color:#0d6efd;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#0b5ed7;
  --bs-btn-hover-border-color:#0a58ca;
  --bs-btn-focus-shadow-rgb:49,132,253;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#0a58ca;
  --bs-btn-active-border-color:#0a53be;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#fff;
  --bs-btn-disabled-bg:#0d6efd;
  --bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;
  --bs-btn-bg:#6c757d;
  --bs-btn-border-color:#6c757d;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#5c636a;
  --bs-btn-hover-border-color:#565e64;
  --bs-btn-focus-shadow-rgb:130,138,145;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#565e64;
  --bs-btn-active-border-color:#51585e;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#fff;
  --bs-btn-disabled-bg:#6c757d;
  --bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;
  --bs-btn-bg:#198754;
  --bs-btn-border-color:#198754;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#157347;
  --bs-btn-hover-border-color:#146c43;
  --bs-btn-focus-shadow-rgb:60,153,110;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#146c43;
  --bs-btn-active-border-color:#13653f;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#fff;
  --bs-btn-disabled-bg:#198754;
  --bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;
  --bs-btn-bg:#0dcaf0;
  --bs-btn-border-color:#0dcaf0;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#31d2f2;
  --bs-btn-hover-border-color:#25cff2;
  --bs-btn-focus-shadow-rgb:11,172,204;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#3dd5f3;
  --bs-btn-active-border-color:#25cff2;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#000;
  --bs-btn-disabled-bg:#0dcaf0;
  --bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;
  --bs-btn-bg:#ffc107;
  --bs-btn-border-color:#ffc107;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#ffca2c;
  --bs-btn-hover-border-color:#ffc720;
  --bs-btn-focus-shadow-rgb:217,164,6;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#ffcd39;
  --bs-btn-active-border-color:#ffc720;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#000;
  --bs-btn-disabled-bg:#ffc107;
  --bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;
  --bs-btn-bg:#dc3545;
  --bs-btn-border-color:#dc3545;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#bb2d3b;
  --bs-btn-hover-border-color:#b02a37;
  --bs-btn-focus-shadow-rgb:225,83,97;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#b02a37;
  --bs-btn-active-border-color:#a52834;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#fff;
  --bs-btn-disabled-bg:#dc3545;
  --bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;
  --bs-btn-bg:#f8f9fa;
  --bs-btn-border-color:#f8f9fa;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#d3d4d5;
  --bs-btn-hover-border-color:#c6c7c8;
  --bs-btn-focus-shadow-rgb:211,212,213;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#c6c7c8;
  --bs-btn-active-border-color:#babbbc;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#000;
  --bs-btn-disabled-bg:#f8f9fa;
  --bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;
  --bs-btn-bg:#212529;
  --bs-btn-border-color:#212529;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#424649;
  --bs-btn-hover-border-color:#373b3e;
  --bs-btn-focus-shadow-rgb:66,70,73;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#4d5154;
  --bs-btn-active-border-color:#373b3e;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#fff;
  --bs-btn-disabled-bg:#212529;
  --bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;
  --bs-btn-border-color:#0d6efd;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#0d6efd;
  --bs-btn-hover-border-color:#0d6efd;
  --bs-btn-focus-shadow-rgb:13,110,253;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#0d6efd;
  --bs-btn-active-border-color:#0d6efd;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#0d6efd;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#0d6efd;
  --bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;
  --bs-btn-border-color:#6c757d;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#6c757d;
  --bs-btn-hover-border-color:#6c757d;
  --bs-btn-focus-shadow-rgb:108,117,125;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#6c757d;
  --bs-btn-active-border-color:#6c757d;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#6c757d;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#6c757d;
  --bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;
  --bs-btn-border-color:#198754;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#198754;
  --bs-btn-hover-border-color:#198754;
  --bs-btn-focus-shadow-rgb:25,135,84;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#198754;
  --bs-btn-active-border-color:#198754;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#198754;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#198754;
  --bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;
  --bs-btn-border-color:#0dcaf0;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#0dcaf0;
  --bs-btn-hover-border-color:#0dcaf0;
  --bs-btn-focus-shadow-rgb:13,202,240;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#0dcaf0;
  --bs-btn-active-border-color:#0dcaf0;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#0dcaf0;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#0dcaf0;
  --bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;
  --bs-btn-border-color:#ffc107;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#ffc107;
  --bs-btn-hover-border-color:#ffc107;
  --bs-btn-focus-shadow-rgb:255,193,7;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#ffc107;
  --bs-btn-active-border-color:#ffc107;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#ffc107;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#ffc107;
  --bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;
  --bs-btn-border-color:#dc3545;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#dc3545;
  --bs-btn-hover-border-color:#dc3545;
  --bs-btn-focus-shadow-rgb:220,53,69;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#dc3545;
  --bs-btn-active-border-color:#dc3545;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#dc3545;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#dc3545;
  --bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;
  --bs-btn-border-color:#f8f9fa;
  --bs-btn-hover-color:#000;
  --bs-btn-hover-bg:#f8f9fa;
  --bs-btn-hover-border-color:#f8f9fa;
  --bs-btn-focus-shadow-rgb:248,249,250;
  --bs-btn-active-color:#000;
  --bs-btn-active-bg:#f8f9fa;
  --bs-btn-active-border-color:#f8f9fa;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#f8f9fa;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#f8f9fa;
  --bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;
  --bs-btn-border-color:#212529;
  --bs-btn-hover-color:#fff;
  --bs-btn-hover-bg:#212529;
  --bs-btn-hover-border-color:#212529;
  --bs-btn-focus-shadow-rgb:33,37,41;
  --bs-btn-active-color:#fff;
  --bs-btn-active-bg:#212529;
  --bs-btn-active-border-color:#212529;
  --bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
  --bs-btn-disabled-color:#212529;
  --bs-btn-disabled-bg:transparent;
  --bs-btn-disabled-border-color:#212529;
  --bs-gradient:none}.btn-link{--bs-btn-font-weight:400;
  --bs-btn-color:var(--bs-link-color);
  --bs-btn-bg:transparent;
  --bs-btn-border-color:transparent;
  --bs-btn-hover-color:var(--bs-link-hover-color);
  --bs-btn-hover-border-color:transparent;
  --bs-btn-active-color:var(--bs-link-hover-color);
  --bs-btn-active-border-color:transparent;
  --bs-btn-disabled-color:#6c757d;
  --bs-btn-disabled-border-color:transparent;
  --bs-btn-box-shadow:none;
  --bs-btn-focus-shadow-rgb:49,132,253;
  text-decoration: underline;
}
.btn-link:focus-visible {
  color: var(--bs-btn-color);
}
.btn-link:hover {
  color: var(--bs-btn-hover-color);
}
.btn-group-lg > .btn, .btn-lg {
  --bs-btn-padding-y:0.5rem;
  --bs-btn-padding-x:1rem;
  --bs-btn-font-size:1.25rem;
  --bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;
  --bs-btn-padding-x:0.5rem;
  --bs-btn-font-size:0.875rem;
  --bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;
  overflow: hidden;
  transition: height 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing {
    transition: none;
  }
}
.collapsing.collapse-horizontal {
  width: 0;
  height: auto;
  transition: width 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing.collapse-horizontal {
    transition: none;
  }
}
.dropdown, .dropdown-center, .dropend, .dropstart, .dropup, .dropup-center {
  position: relative;
}
.dropdown-toggle {
  white-space: nowrap;
}
.dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid;
  border-right: 0.3em solid transparent;
  border-bottom: 0;
  border-left: 0.3em solid transparent;
}
.dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropdown-menu {
  --bs-dropdown-zindex:1000;
  --bs-dropdown-min-width:10rem;
  --bs-dropdown-padding-x:0;
  --bs-dropdown-padding-y:0.5rem;
  --bs-dropdown-spacer:0.125rem;
  --bs-dropdown-font-size:1rem;
  --bs-dropdown-color:var(--bs-body-color);
  --bs-dropdown-bg:var(--bs-body-bg);
  --bs-dropdown-border-color:var(--bs-border-color-translucent);
  --bs-dropdown-border-radius:0.375rem;
  --bs-dropdown-border-width:var(--bs-border-width);
  --bs-dropdown-inner-border-radius:calc(0.375rem - var(--bs-border-width));
  --bs-dropdown-divider-bg:var(--bs-border-color-translucent);
  --bs-dropdown-divider-margin-y:0.5rem;
  --bs-dropdown-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
  --bs-dropdown-link-color:var(--bs-body-color);
  --bs-dropdown-link-hover-color:var(--bs-body-color);
  --bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);
  --bs-dropdown-link-active-color:#fff;
  --bs-dropdown-link-active-bg:#0d6efd;
  --bs-dropdown-link-disabled-color:#adb5bd;
  --bs-dropdown-item-padding-x:1rem;
  --bs-dropdown-item-padding-y:0.25rem;
  --bs-dropdown-header-color:#6c757d;
  --bs-dropdown-header-padding-x:1rem;
  --bs-dropdown-header-padding-y:0.5rem;
  position: absolute;
  z-index: var(--bs-dropdown-zindex);
  display: none;
  min-width: var(--bs-dropdown-min-width);
  padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
  margin: 0;
  font-size: var(--bs-dropdown-font-size);
  color: var(--bs-dropdown-color);
  text-align: left;
  list-style: none;
  background-color: var(--bs-dropdown-bg);
  background-clip: padding-box;
  border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
  border-radius: var(--bs-dropdown-border-radius);
}
.dropdown-menu[data-bs-popper] {
  top: 100%;
  left: 0;
  margin-top: var(--bs-dropdown-spacer);
}
.dropdown-menu-start {
  --bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;
  left: 0;
}
.dropdown-menu-end {
  --bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;
  left: auto;
}
@media (min-width: 576px) {
  .dropdown-menu-sm-start {
    --bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;
    left: 0;
  }
  .dropdown-menu-sm-end {
    --bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;
    left: auto;
  }
}
@media (min-width: 768px) {
  .dropdown-menu-md-start {
    --bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;
    left: 0;
  }
  .dropdown-menu-md-end {
    --bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;
    left: auto;
  }
}
@media (min-width: 992px) {
  .dropdown-menu-lg-start {
    --bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;
    left: 0;
  }
  .dropdown-menu-lg-end {
    --bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;
    left: auto;
  }
}
@media (min-width: 1200px) {
  .dropdown-menu-xl-start {
    --bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;
    left: 0;
  }
  .dropdown-menu-xl-end {
    --bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;
    left: auto;
  }
}
@media (min-width: 1400px) {
  .dropdown-menu-xxl-start {
    --bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;
    left: 0;
  }
  .dropdown-menu-xxl-end {
    --bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;
    left: auto;
  }
}
.dropup .dropdown-menu[data-bs-popper] {
  top: auto;
  bottom: 100%;
  margin-top: 0;
  margin-bottom: var(--bs-dropdown-spacer);
}
.dropup .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0;
  border-right: 0.3em solid transparent;
  border-bottom: 0.3em solid;
  border-left: 0.3em solid transparent;
}
.dropup .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropend .dropdown-menu[data-bs-popper] {
  top: 0;
  right: auto;
  left: 100%;
  margin-top: 0;
  margin-left: var(--bs-dropdown-spacer);
}
.dropend .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0;
  border-bottom: 0.3em solid transparent;
  border-left: 0.3em solid;
}
.dropend .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropend .dropdown-toggle::after {
  vertical-align: 0;
}
.dropstart .dropdown-menu[data-bs-popper] {
  top: 0;
  right: 100%;
  left: auto;
  margin-top: 0;
  margin-right: var(--bs-dropdown-spacer);
}
.dropstart .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
}
.dropstart .dropdown-toggle::after {
  display: none;
}
.dropstart .dropdown-toggle::before {
  display: inline-block;
  margin-right: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0.3em solid;
  border-bottom: 0.3em solid transparent;
}
.dropstart .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropstart .dropdown-toggle::before {
  vertical-align: 0;
}
.dropdown-divider {
  height: 0;
  margin: var(--bs-dropdown-divider-margin-y) 0;
  overflow: hidden;
  border-top: 1px solid var(--bs-dropdown-divider-bg);
  opacity: 1;
}
.dropdown-item {
  display: block;
  width: 100%;
  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
  clear: both;
  font-weight: 400;
  color: var(--bs-dropdown-link-color);
  text-align: inherit;
  text-decoration: none;
  white-space: nowrap;
  background-color: transparent;
  border: 0;
  border-radius: var(--bs-dropdown-item-border-radius, 0);
}
.dropdown-item:focus, .dropdown-item:hover {
  color: var(--bs-dropdown-link-hover-color);
  background-color: var(--bs-dropdown-link-hover-bg);
}
.dropdown-item.active, .dropdown-item:active {
  color: var(--bs-dropdown-link-active-color);
  text-decoration: none;
  background-color: var(--bs-dropdown-link-active-bg);
}
.dropdown-item.disabled, .dropdown-item:disabled {
  color: var(--bs-dropdown-link-disabled-color);
  pointer-events: none;
  background-color: transparent;
}
.dropdown-menu.show {
  display: block;
}
.dropdown-header {
  display: block;
  padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
  margin-bottom: 0;
  font-size: 0.875rem;
  color: var(--bs-dropdown-header-color);
  white-space: nowrap;
}
.dropdown-item-text {
  display: block;
  padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
  color: var(--bs-dropdown-link-color);
}
.dropdown-menu-dark {
  --bs-dropdown-color:#dee2e6;
  --bs-dropdown-bg:#343a40;
  --bs-dropdown-border-color:var(--bs-border-color-translucent);
  --bs-dropdown-box-shadow: ;
  --bs-dropdown-link-color:#dee2e6;
  --bs-dropdown-link-hover-color:#fff;
  --bs-dropdown-divider-bg:var(--bs-border-color-translucent);
  --bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);
  --bs-dropdown-link-active-color:#fff;
  --bs-dropdown-link-active-bg:#0d6efd;
  --bs-dropdown-link-disabled-color:#adb5bd;
  --bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;
  display: inline-flex;
  vertical-align: middle;
}
.btn-group-vertical > .btn, .btn-group > .btn {
  position: relative;
  flex: 1 1 auto;
}
.btn-group-vertical > .btn-check:checked + .btn, .btn-group-vertical > .btn-check:focus + .btn, .btn-group-vertical > .btn.active, .btn-group-vertical > .btn:active, .btn-group-vertical > .btn:focus, .btn-group-vertical > .btn:hover, .btn-group > .btn-check:checked + .btn, .btn-group > .btn-check:focus + .btn, .btn-group > .btn.active, .btn-group > .btn:active, .btn-group > .btn:focus, .btn-group > .btn:hover {
  z-index: 1;
}
.btn-toolbar {
  display: flex;
  flex-wrap: wrap;
  justify-content: flex-start;
}
.btn-toolbar .input-group {
  width: auto;
}
.btn-group {
  border-radius: 0.375rem;
}
.btn-group > .btn-group:not(:first-child), .btn-group > :not(.btn-check:first-child) + .btn {
  margin-left: calc(var(--bs-border-width) * -1);
}
.btn-group > .btn-group:not(:last-child) > .btn, .btn-group > .btn.dropdown-toggle-split:first-child, .btn-group > .btn:not(:last-child):not(.dropdown-toggle) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.btn-group > .btn-group:not(:first-child) > .btn, .btn-group > .btn:nth-child(n+3), .btn-group > :not(.btn-check) + .btn {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.dropdown-toggle-split {
  padding-right: 0.5625rem;
  padding-left: 0.5625rem;
}
.dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after {
  margin-left: 0;
}
.dropstart .dropdown-toggle-split::before {
  margin-right: 0;
}
.btn-group-sm > .btn + .dropdown-toggle-split, .btn-sm + .dropdown-toggle-split {
  padding-right: 0.375rem;
  padding-left: 0.375rem;
}
.btn-group-lg > .btn + .dropdown-toggle-split, .btn-lg + .dropdown-toggle-split {
  padding-right: 0.75rem;
  padding-left: 0.75rem;
}
.btn-group-vertical {
  flex-direction: column;
  align-items: flex-start;
  justify-content: center;
}
.btn-group-vertical > .btn, .btn-group-vertical > .btn-group {
  width: 100%;
}
.btn-group-vertical > .btn-group:not(:first-child), .btn-group-vertical > .btn:not(:first-child) {
  margin-top: calc(var(--bs-border-width) * -1);
}
.btn-group-vertical > .btn-group:not(:last-child) > .btn, .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle) {
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}
.btn-group-vertical > .btn-group:not(:first-child) > .btn, .btn-group-vertical > .btn ~ .btn {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}
.nav {
  --bs-nav-link-padding-x:1rem;
  --bs-nav-link-padding-y:0.5rem;
  --bs-nav-link-font-weight: ;
  --bs-nav-link-color:var(--bs-link-color);
  --bs-nav-link-hover-color:var(--bs-link-hover-color);
  --bs-nav-link-disabled-color:var(--bs-secondary-color);
  display: flex;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}
.nav-link {
  display: block;
  padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
  font-size: var(--bs-nav-link-font-size);
  font-weight: var(--bs-nav-link-font-weight);
  color: var(--bs-nav-link-color);
  text-decoration: none;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .nav-link {
    transition: none;
  }
}
.nav-link:focus, .nav-link:hover {
  color: var(--bs-nav-link-hover-color);
}
.nav-link.disabled {
  color: var(--bs-nav-link-disabled-color);
  pointer-events: none;
  cursor: default;
}
.nav-tabs {
  --bs-nav-tabs-border-width:var(--bs-border-width);
  --bs-nav-tabs-border-color:var(--bs-border-color);
  --bs-nav-tabs-border-radius:var(--bs-border-radius);
  --bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
  --bs-nav-tabs-link-active-color:var(--bs-emphasis-color);
  --bs-nav-tabs-link-active-bg:var(--bs-body-bg);
  --bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
  border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color);
}
.nav-tabs .nav-link {
  margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width));
  background: 0 0;
  border: var(--bs-nav-tabs-border-width) solid transparent;
  border-top-left-radius: var(--bs-nav-tabs-border-radius);
  border-top-right-radius: var(--bs-nav-tabs-border-radius);
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
  isolation: isolate;
  border-color: var(--bs-nav-tabs-link-hover-border-color);
}
.nav-tabs .nav-link.disabled, .nav-tabs .nav-link:disabled {
  color: var(--bs-nav-link-disabled-color);
  background-color: transparent;
  border-color: transparent;
}
.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
  color: var(--bs-nav-tabs-link-active-color);
  background-color: var(--bs-nav-tabs-link-active-bg);
  border-color: var(--bs-nav-tabs-link-active-border-color);
}
.nav-tabs .dropdown-menu {
  margin-top: calc(-1 * var(--bs-nav-tabs-border-width));
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}
.nav-pills {
  --bs-nav-pills-border-radius:0.375rem;
  --bs-nav-pills-link-active-color:#fff;
  --bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;
  border: 0;
  border-radius: var(--bs-nav-pills-border-radius);
}
.nav-pills .nav-link:disabled {
  color: var(--bs-nav-link-disabled-color);
  background-color: transparent;
  border-color: transparent;
}
.nav-pills .nav-link.active, .nav-pills .show > .nav-link {
  color: var(--bs-nav-pills-link-active-color);
  background-color: var(--bs-nav-pills-link-active-bg);
}
.nav-fill .nav-item, .nav-fill > .nav-link {
  flex: 1 1 auto;
  text-align: center;
}
.nav-justified .nav-item, .nav-justified > .nav-link {
  flex-basis: 0;
  flex-grow: 1;
  text-align: center;
}
.nav-fill .nav-item .nav-link, .nav-justified .nav-item .nav-link {
  width: 100%;
}
.tab-content > .tab-pane {
  display: none;
}
.tab-content > .active {
  display: block;
}
.navbar {
  --bs-navbar-padding-x:0;
  --bs-navbar-padding-y:0.5rem;
  --bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);
  --bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);
  --bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);
  --bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-brand-padding-y:0.3125rem;
  --bs-navbar-brand-margin-end:1rem;
  --bs-navbar-brand-font-size:1.25rem;
  --bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);
  --bs-navbar-nav-link-padding-x:0.5rem;
  --bs-navbar-toggler-padding-y:0.25rem;
  --bs-navbar-toggler-padding-x:0.75rem;
  --bs-navbar-toggler-font-size:1.25rem;
  --bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
  --bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);
  --bs-navbar-toggler-border-radius:0.375rem;
  --bs-navbar-toggler-focus-width:0.25rem;
  --bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: space-between;
  padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x);
}
.navbar > .container, .navbar > .container-fluid, .navbar > .container-lg, .navbar > .container-md, .navbar > .container-sm, .navbar > .container-xl, .navbar > .container-xxl {
  display: flex;
  flex-wrap: inherit;
  align-items: center;
  justify-content: space-between;
}
.navbar-brand {
  padding-top: var(--bs-navbar-brand-padding-y);
  padding-bottom: var(--bs-navbar-brand-padding-y);
  margin-right: var(--bs-navbar-brand-margin-end);
  font-size: var(--bs-navbar-brand-font-size);
  color: var(--bs-navbar-brand-color);
  text-decoration: none;
  white-space: nowrap;
}
.navbar-brand:focus, .navbar-brand:hover {
  color: var(--bs-navbar-brand-hover-color);
}
.navbar-nav {
  --bs-nav-link-padding-x:0;
  --bs-nav-link-padding-y:0.5rem;
  --bs-nav-link-font-weight: ;
  --bs-nav-link-color:var(--bs-navbar-color);
  --bs-nav-link-hover-color:var(--bs-navbar-hover-color);
  --bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}
.navbar-nav .nav-link.active, .navbar-nav .show > .nav-link {
  color: var(--bs-navbar-active-color);
}
.navbar-nav .dropdown-menu {
  position: static;
}
.navbar-text {
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  color: var(--bs-navbar-color);
}
.navbar-text a, .navbar-text a:focus, .navbar-text a:hover {
  color: var(--bs-navbar-active-color);
}
.navbar-collapse {
  flex-basis: 100%;
  flex-grow: 1;
  align-items: center;
}
.navbar-toggler {
  padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
  font-size: var(--bs-navbar-toggler-font-size);
  line-height: 1;
  color: var(--bs-navbar-color);
  background-color: transparent;
  border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
  border-radius: var(--bs-navbar-toggler-border-radius);
  transition: var(--bs-navbar-toggler-transition);
}
@media (prefers-reduced-motion: reduce) {
  .navbar-toggler {
    transition: none;
  }
}
.navbar-toggler:hover {
  text-decoration: none;
}
.navbar-toggler:focus {
  text-decoration: none;
  outline: 0;
  box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width);
}
.navbar-toggler-icon {
  display: inline-block;
  width: 1.5em;
  height: 1.5em;
  vertical-align: middle;
  background-image: var(--bs-navbar-toggler-icon-bg);
  background-repeat: no-repeat;
  background-position: center;
  background-size: 100%;
}
.navbar-nav-scroll {
  max-height: var(--bs-scroll-height, 75vh);
  overflow-y: auto;
}
@media (min-width: 576px) {
  .navbar-expand-sm {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-sm .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-sm .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-sm .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-sm .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-sm .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-sm .navbar-toggler {
    display: none;
  }
  .navbar-expand-sm .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-sm .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-sm .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 768px) {
  .navbar-expand-md {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-md .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-md .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-md .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-md .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-md .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-md .navbar-toggler {
    display: none;
  }
  .navbar-expand-md .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-md .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-md .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 992px) {
  .navbar-expand-lg {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-lg .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-lg .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-lg .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-lg .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-lg .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-lg .navbar-toggler {
    display: none;
  }
  .navbar-expand-lg .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-lg .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-lg .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 1200px) {
  .navbar-expand-xl {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-xl .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-xl .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-xl .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-xl .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-xl .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-xl .navbar-toggler {
    display: none;
  }
  .navbar-expand-xl .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-xl .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-xl .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
@media (min-width: 1400px) {
  .navbar-expand-xxl {
    flex-wrap: nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-xxl .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-xxl .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-xxl .navbar-nav .nav-link {
    padding-right: var(--bs-navbar-nav-link-padding-x);
    padding-left: var(--bs-navbar-nav-link-padding-x);
  }
  .navbar-expand-xxl .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-xxl .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-xxl .navbar-toggler {
    display: none;
  }
  .navbar-expand-xxl .offcanvas {
    position: static;
    z-index: auto;
    flex-grow: 1;
    width: auto !important;
    height: auto !important;
    visibility: visible !important;
    background-color: transparent !important;
    border: 0 !important;
    transform: none !important;
    transition: none;
  }
  .navbar-expand-xxl .offcanvas .offcanvas-header {
    display: none;
  }
  .navbar-expand-xxl .offcanvas .offcanvas-body {
    display: flex;
    flex-grow: 0;
    padding: 0;
    overflow-y: visible;
  }
}
.navbar-expand {
  flex-wrap: nowrap;
  justify-content: flex-start;
}
.navbar-expand .navbar-nav {
  flex-direction: row;
}
.navbar-expand .navbar-nav .dropdown-menu {
  position: absolute;
}
.navbar-expand .navbar-nav .nav-link {
  padding-right: var(--bs-navbar-nav-link-padding-x);
  padding-left: var(--bs-navbar-nav-link-padding-x);
}
.navbar-expand .navbar-nav-scroll {
  overflow: visible;
}
.navbar-expand .navbar-collapse {
  display: flex !important;
  flex-basis: auto;
}
.navbar-expand .navbar-toggler {
  display: none;
}
.navbar-expand .offcanvas {
  position: static;
  z-index: auto;
  flex-grow: 1;
  width: auto !important;
  height: auto !important;
  visibility: visible !important;
  background-color: transparent !important;
  border: 0 !important;
  transform: none !important;
  transition: none;
}
.navbar-expand .offcanvas .offcanvas-header {
  display: none;
}
.navbar-expand .offcanvas .offcanvas-body {
  display: flex;
  flex-grow: 0;
  padding: 0;
  overflow-y: visible;
}
.navbar-dark {
  --bs-navbar-color:rgba(255, 255, 255, 0.55);
  --bs-navbar-hover-color:rgba(255, 255, 255, 0.75);
  --bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);
  --bs-navbar-active-color:#fff;
  --bs-navbar-brand-color:#fff;
  --bs-navbar-brand-hover-color:#fff;
  --bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);
  --bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;
  --bs-card-spacer-x:1rem;
  --bs-card-title-spacer-y:0.5rem;
  --bs-card-title-color: ;
  --bs-card-subtitle-color: ;
  --bs-card-border-width:var(--bs-border-width);
  --bs-card-border-color:var(--bs-border-color-translucent);
  --bs-card-border-radius:var(--bs-border-radius);
  --bs-card-box-shadow: ;
  --bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
  --bs-card-cap-padding-y:0.5rem;
  --bs-card-cap-padding-x:1rem;
  --bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);
  --bs-card-cap-color: ;
  --bs-card-height: ;
  --bs-card-color: ;
  --bs-card-bg:var(--bs-body-bg);
  --bs-card-img-overlay-padding:1rem;
  --bs-card-group-margin:0.75rem;
  position: relative;
  display: flex;
  flex-direction: column;
  min-width: 0;
  height: var(--bs-card-height);
  word-wrap: break-word;
  background-color: var(--bs-card-bg);
  background-clip: border-box;
  border: var(--bs-card-border-width) solid var(--bs-card-border-color);
  border-radius: var(--bs-card-border-radius);
}
.card > hr {
  margin-right: 0;
  margin-left: 0;
}
.card > .list-group {
  border-top: inherit;
  border-bottom: inherit;
}
.card > .list-group:first-child {
  border-top-width: 0;
  border-top-left-radius: var(--bs-card-inner-border-radius);
  border-top-right-radius: var(--bs-card-inner-border-radius);
}
.card > .list-group:last-child {
  border-bottom-width: 0;
  border-bottom-right-radius: var(--bs-card-inner-border-radius);
  border-bottom-left-radius: var(--bs-card-inner-border-radius);
}
.card > .card-header + .list-group, .card > .list-group + .card-footer {
  border-top: 0;
}
.card-body {
  flex: 1 1 auto;
  padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
  color: var(--bs-card-color);
}
.card-title {
  margin-bottom: var(--bs-card-title-spacer-y);
  color: var(--bs-card-title-color);
}
.card-subtitle {
  margin-top: calc(-.5 * var(--bs-card-title-spacer-y));
  margin-bottom: 0;
  color: var(--bs-card-subtitle-color);
}
.card-text:last-child {
  margin-bottom: 0;
}
.card-link + .card-link {
  margin-left: var(--bs-card-spacer-x);
}
.card-header {
  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
  margin-bottom: 0;
  color: var(--bs-card-cap-color);
  background-color: var(--bs-card-cap-bg);
  border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-header:first-child {
  border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0;
}
.card-footer {
  padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
  color: var(--bs-card-cap-color);
  background-color: var(--bs-card-cap-bg);
  border-top: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-footer:last-child {
  border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius);
}
.card-header-tabs {
  margin-right: calc(-.5 * var(--bs-card-cap-padding-x));
  margin-bottom: calc(-1 * var(--bs-card-cap-padding-y));
  margin-left: calc(-.5 * var(--bs-card-cap-padding-x));
  border-bottom: 0;
}
.card-header-tabs .nav-link.active {
  background-color: var(--bs-card-bg);
  border-bottom-color: var(--bs-card-bg);
}
.card-header-pills {
  margin-right: calc(-.5 * var(--bs-card-cap-padding-x));
  margin-left: calc(-.5 * var(--bs-card-cap-padding-x));
}
.card-img-overlay {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  padding: var(--bs-card-img-overlay-padding);
  border-radius: var(--bs-card-inner-border-radius);
}
.card-img, .card-img-bottom, .card-img-top {
  width: 100%;
}
.card-img, .card-img-top {
  border-top-left-radius: var(--bs-card-inner-border-radius);
  border-top-right-radius: var(--bs-card-inner-border-radius);
}
.card-img, .card-img-bottom {
  border-bottom-right-radius: var(--bs-card-inner-border-radius);
  border-bottom-left-radius: var(--bs-card-inner-border-radius);
}
.card-group > .card {
  margin-bottom: var(--bs-card-group-margin);
}
@media (min-width: 576px) {
  .card-group {
    display: flex;
    flex-flow: row wrap;
  }
  .card-group > .card {
    flex: 1 0 0%;
    margin-bottom: 0;
  }
  .card-group > .card + .card {
    margin-left: 0;
    border-left: 0;
  }
  .card-group > .card:not(:last-child) {
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-header, .card-group > .card:not(:last-child) .card-img-top {
    border-top-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-footer, .card-group > .card:not(:last-child) .card-img-bottom {
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:first-child) {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-header, .card-group > .card:not(:first-child) .card-img-top {
    border-top-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-footer, .card-group > .card:not(:first-child) .card-img-bottom {
    border-bottom-left-radius: 0;
  }
}
.accordion {
  --bs-accordion-color:var(--bs-body-color);
  --bs-accordion-bg:var(--bs-body-bg);
  --bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;
  --bs-accordion-border-color:var(--bs-border-color);
  --bs-accordion-border-width:var(--bs-border-width);
  --bs-accordion-border-radius:var(--bs-border-radius);
  --bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
  --bs-accordion-btn-padding-x:1.25rem;
  --bs-accordion-btn-padding-y:1rem;
  --bs-accordion-btn-color:var(--bs-body-color);
  --bs-accordion-btn-bg:var(--bs-accordion-bg);
  --bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
  --bs-accordion-btn-icon-width:1.25rem;
  --bs-accordion-btn-icon-transform:rotate(-180deg);
  --bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;
  --bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230a58ca'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
  --bs-accordion-btn-focus-border-color:#86b7fe;
  --bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
  --bs-accordion-body-padding-x:1.25rem;
  --bs-accordion-body-padding-y:1rem;
  --bs-accordion-active-color:var(--bs-primary-text);
  --bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;
  display: flex;
  align-items: center;
  width: 100%;
  padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
  font-size: 1rem;
  color: var(--bs-accordion-btn-color);
  text-align: left;
  background-color: var(--bs-accordion-btn-bg);
  border: 0;
  border-radius: 0;
  overflow-anchor: none;
  transition: var(--bs-accordion-transition);
}
@media (prefers-reduced-motion: reduce) {
  .accordion-button {
    transition: none;
  }
}
.accordion-button:not(.collapsed) {
  color: var(--bs-accordion-active-color);
  background-color: var(--bs-accordion-active-bg);
  box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color);
}
.accordion-button:not(.collapsed)::after {
  background-image: var(--bs-accordion-btn-active-icon);
  transform: var(--bs-accordion-btn-icon-transform);
}
.accordion-button::after {
  flex-shrink: 0;
  width: var(--bs-accordion-btn-icon-width);
  height: var(--bs-accordion-btn-icon-width);
  margin-left: auto;
  content: "";
  background-image: var(--bs-accordion-btn-icon);
  background-repeat: no-repeat;
  background-size: var(--bs-accordion-btn-icon-width);
  transition: var(--bs-accordion-btn-icon-transition);
}
@media (prefers-reduced-motion: reduce) {
  .accordion-button::after {
    transition: none;
  }
}
.accordion-button:hover {
  z-index: 2;
}
.accordion-button:focus {
  z-index: 3;
  border-color: var(--bs-accordion-btn-focus-border-color);
  outline: 0;
  box-shadow: var(--bs-accordion-btn-focus-box-shadow);
}
.accordion-header {
  margin-bottom: 0;
}
.accordion-item {
  color: var(--bs-accordion-color);
  background-color: var(--bs-accordion-bg);
  border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color);
}
.accordion-item:first-of-type {
  border-top-left-radius: var(--bs-accordion-border-radius);
  border-top-right-radius: var(--bs-accordion-border-radius);
}
.accordion-item:first-of-type .accordion-button {
  border-top-left-radius: var(--bs-accordion-inner-border-radius);
  border-top-right-radius: var(--bs-accordion-inner-border-radius);
}
.accordion-item:not(:first-of-type) {
  border-top: 0;
}
.accordion-item:last-of-type {
  border-bottom-right-radius: var(--bs-accordion-border-radius);
  border-bottom-left-radius: var(--bs-accordion-border-radius);
}
.accordion-item:last-of-type .accordion-button.collapsed {
  border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
  border-bottom-left-radius: var(--bs-accordion-inner-border-radius);
}
.accordion-item:last-of-type .accordion-collapse {
  border-bottom-right-radius: var(--bs-accordion-border-radius);
  border-bottom-left-radius: var(--bs-accordion-border-radius);
}
.accordion-body {
  padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x);
}
.accordion-flush .accordion-collapse {
  border-width: 0;
}
.accordion-flush .accordion-item {
  border-right: 0;
  border-left: 0;
  border-radius: 0;
}
.accordion-flush .accordion-item:first-child {
  border-top: 0;
}
.accordion-flush .accordion-item:last-child {
  border-bottom: 0;
}
.accordion-flush .accordion-item .accordion-button, .accordion-flush .accordion-item .accordion-button.collapsed {
  border-radius: 0;
}
[data-bs-theme=dark] .accordion-button::after {
  --bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
  --bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;
  --bs-breadcrumb-padding-y:0;
  --bs-breadcrumb-margin-bottom:1rem;
  --bs-breadcrumb-bg: ;
  --bs-breadcrumb-border-radius: ;
  --bs-breadcrumb-divider-color:var(--bs-secondary-color);
  --bs-breadcrumb-item-padding-x:0.5rem;
  --bs-breadcrumb-item-active-color:var(--bs-secondary-color);
  display: flex;
  flex-wrap: wrap;
  padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
  margin-bottom: var(--bs-breadcrumb-margin-bottom);
  font-size: var(--bs-breadcrumb-font-size);
  list-style: none;
  background-color: var(--bs-breadcrumb-bg);
  border-radius: var(--bs-breadcrumb-border-radius);
}
.breadcrumb-item + .breadcrumb-item {
  padding-left: var(--bs-breadcrumb-item-padding-x);
}
.breadcrumb-item + .breadcrumb-item::before {
  float: left;
  padding-right: var(--bs-breadcrumb-item-padding-x);
  color: var(--bs-breadcrumb-divider-color);
  content: var(--bs-breadcrumb-divider, "/");
}
.breadcrumb-item.active {
  color: var(--bs-breadcrumb-item-active-color);
}
.pagination {
  --bs-pagination-padding-x:0.75rem;
  --bs-pagination-padding-y:0.375rem;
  --bs-pagination-font-size:1rem;
  --bs-pagination-color:var(--bs-link-color);
  --bs-pagination-bg:var(--bs-body-bg);
  --bs-pagination-border-width:var(--bs-border-width);
  --bs-pagination-border-color:var(--bs-border-color);
  --bs-pagination-border-radius:var(--bs-border-radius);
  --bs-pagination-hover-color:var(--bs-link-hover-color);
  --bs-pagination-hover-bg:var(--bs-tertiary-bg);
  --bs-pagination-hover-border-color:var(--bs-border-color);
  --bs-pagination-focus-color:var(--bs-link-hover-color);
  --bs-pagination-focus-bg:var(--bs-secondary-bg);
  --bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
  --bs-pagination-active-color:#fff;
  --bs-pagination-active-bg:#0d6efd;
  --bs-pagination-active-border-color:#0d6efd;
  --bs-pagination-disabled-color:var(--bs-secondary-color);
  --bs-pagination-disabled-bg:var(--bs-secondary-bg);
  --bs-pagination-disabled-border-color:var(--bs-border-color);
  display: flex;
  padding-left: 0;
  list-style: none;
}
.page-link {
  position: relative;
  display: block;
  padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
  font-size: var(--bs-pagination-font-size);
  color: var(--bs-pagination-color);
  text-decoration: none;
  background-color: var(--bs-pagination-bg);
  border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .page-link {
    transition: none;
  }
}
.page-link:hover {
  z-index: 2;
  color: var(--bs-pagination-hover-color);
  background-color: var(--bs-pagination-hover-bg);
  border-color: var(--bs-pagination-hover-border-color);
}
.page-link:focus {
  z-index: 3;
  color: var(--bs-pagination-focus-color);
  background-color: var(--bs-pagination-focus-bg);
  outline: 0;
  box-shadow: var(--bs-pagination-focus-box-shadow);
}
.active > .page-link, .page-link.active {
  z-index: 3;
  color: var(--bs-pagination-active-color);
  background-color: var(--bs-pagination-active-bg);
  border-color: var(--bs-pagination-active-border-color);
}
.disabled > .page-link, .page-link.disabled {
  color: var(--bs-pagination-disabled-color);
  pointer-events: none;
  background-color: var(--bs-pagination-disabled-bg);
  border-color: var(--bs-pagination-disabled-border-color);
}
.page-item:not(:first-child) .page-link {
  margin-left: calc(var(--bs-border-width) * -1);
}
.page-item:first-child .page-link {
  border-top-left-radius: var(--bs-pagination-border-radius);
  border-bottom-left-radius: var(--bs-pagination-border-radius);
}
.page-item:last-child .page-link {
  border-top-right-radius: var(--bs-pagination-border-radius);
  border-bottom-right-radius: var(--bs-pagination-border-radius);
}
.pagination-lg {
  --bs-pagination-padding-x:1.5rem;
  --bs-pagination-padding-y:0.75rem;
  --bs-pagination-font-size:1.25rem;
  --bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;
  --bs-pagination-padding-y:0.25rem;
  --bs-pagination-font-size:0.875rem;
  --bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;
  --bs-badge-padding-y:0.35em;
  --bs-badge-font-size:0.75em;
  --bs-badge-font-weight:700;
  --bs-badge-color:#fff;
  --bs-badge-border-radius:0.375rem;
  display: inline-block;
  padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
  font-size: var(--bs-badge-font-size);
  font-weight: var(--bs-badge-font-weight);
  line-height: 1;
  color: var(--bs-badge-color);
  text-align: center;
  white-space: nowrap;
  vertical-align: baseline;
  border-radius: var(--bs-badge-border-radius);
}
.badge:empty {
  display: none;
}
.btn .badge {
  position: relative;
  top: -1px;
}
.alert {
  --bs-alert-bg:transparent;
  --bs-alert-padding-x:1rem;
  --bs-alert-padding-y:1rem;
  --bs-alert-margin-bottom:1rem;
  --bs-alert-color:inherit;
  --bs-alert-border-color:transparent;
  --bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);
  --bs-alert-border-radius:0.375rem;
  --bs-alert-link-color:inherit;
  position: relative;
  padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
  margin-bottom: var(--bs-alert-margin-bottom);
  color: var(--bs-alert-color);
  background-color: var(--bs-alert-bg);
  border: var(--bs-alert-border);
  border-radius: var(--bs-alert-border-radius);
}
.alert-heading {
  color: inherit;
}
.alert-link {
  font-weight: 700;
  color: var(--bs-alert-link-color);
}
.alert-dismissible {
  padding-right: 3rem;
}
.alert-dismissible .btn-close {
  position: absolute;
  top: 0;
  right: 0;
  z-index: 2;
  padding: 1.25rem 1rem;
}
.alert-primary {
  --bs-alert-color:var(--bs-primary-text);
  --bs-alert-bg:var(--bs-primary-bg-subtle);
  --bs-alert-border-color:var(--bs-primary-border-subtle);
  --bs-alert-link-color:var(--bs-primary-text)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text);
  --bs-alert-bg:var(--bs-secondary-bg-subtle);
  --bs-alert-border-color:var(--bs-secondary-border-subtle);
  --bs-alert-link-color:var(--bs-secondary-text)}.alert-success{--bs-alert-color:var(--bs-success-text);
  --bs-alert-bg:var(--bs-success-bg-subtle);
  --bs-alert-border-color:var(--bs-success-border-subtle);
  --bs-alert-link-color:var(--bs-success-text)}.alert-info{--bs-alert-color:var(--bs-info-text);
  --bs-alert-bg:var(--bs-info-bg-subtle);
  --bs-alert-border-color:var(--bs-info-border-subtle);
  --bs-alert-link-color:var(--bs-info-text)}.alert-warning{--bs-alert-color:var(--bs-warning-text);
  --bs-alert-bg:var(--bs-warning-bg-subtle);
  --bs-alert-border-color:var(--bs-warning-border-subtle);
  --bs-alert-link-color:var(--bs-warning-text)}.alert-danger{--bs-alert-color:var(--bs-danger-text);
  --bs-alert-bg:var(--bs-danger-bg-subtle);
  --bs-alert-border-color:var(--bs-danger-border-subtle);
  --bs-alert-link-color:var(--bs-danger-text)}.alert-light{--bs-alert-color:var(--bs-light-text);
  --bs-alert-bg:var(--bs-light-bg-subtle);
  --bs-alert-border-color:var(--bs-light-border-subtle);
  --bs-alert-link-color:var(--bs-light-text)}.alert-dark{--bs-alert-color:var(--bs-dark-text);
  --bs-alert-bg:var(--bs-dark-bg-subtle);
  --bs-alert-border-color:var(--bs-dark-border-subtle);
  --bs-alert-link-color:var(--bs-dark-text)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;
  --bs-progress-font-size:0.75rem;
  --bs-progress-bg:var(--bs-secondary-bg);
  --bs-progress-border-radius:var(--bs-border-radius);
  --bs-progress-box-shadow:var(--bs-box-shadow-inset);
  --bs-progress-bar-color:#fff;
  --bs-progress-bar-bg:#0d6efd;
  --bs-progress-bar-transition:width 0.6s ease;
  display: flex;
  height: var(--bs-progress-height);
  overflow: hidden;
  font-size: var(--bs-progress-font-size);
  background-color: var(--bs-progress-bg);
  border-radius: var(--bs-progress-border-radius);
}
.progress-bar {
  display: flex;
  flex-direction: column;
  justify-content: center;
  overflow: hidden;
  color: var(--bs-progress-bar-color);
  text-align: center;
  white-space: nowrap;
  background-color: var(--bs-progress-bar-bg);
  transition: var(--bs-progress-bar-transition);
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar {
    transition: none;
  }
}
.progress-bar-striped {
  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
  background-size: var(--bs-progress-height) var(--bs-progress-height);
}
.progress-stacked > .progress {
  overflow: visible;
}
.progress-stacked > .progress > .progress-bar {
  width: 100%;
}
.progress-bar-animated {
  animation: 1s linear infinite progress-bar-stripes;
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar-animated {
    animation: none;
  }
}
.list-group {
  --bs-list-group-color:var(--bs-body-color);
  --bs-list-group-bg:var(--bs-body-bg);
  --bs-list-group-border-color:var(--bs-border-color);
  --bs-list-group-border-width:var(--bs-border-width);
  --bs-list-group-border-radius:var(--bs-border-radius);
  --bs-list-group-item-padding-x:1rem;
  --bs-list-group-item-padding-y:0.5rem;
  --bs-list-group-action-color:var(--bs-secondary-color);
  --bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-tertiary-bg);
  --bs-list-group-action-active-color:var(--bs-body-color);
  --bs-list-group-action-active-bg:var(--bs-secondary-bg);
  --bs-list-group-disabled-color:var(--bs-secondary-color);
  --bs-list-group-disabled-bg:var(--bs-body-bg);
  --bs-list-group-active-color:#fff;
  --bs-list-group-active-bg:#0d6efd;
  --bs-list-group-active-border-color:#0d6efd;
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  border-radius: var(--bs-list-group-border-radius);
}
.list-group-numbered {
  list-style-type: none;
  counter-reset: section;
}
.list-group-numbered > .list-group-item::before {
  content: counters(section, ".") ". ";
  counter-increment: section;
}
.list-group-item-action {
  width: 100%;
  color: var(--bs-list-group-action-color);
  text-align: inherit;
}
.list-group-item-action:focus, .list-group-item-action:hover {
  z-index: 1;
  color: var(--bs-list-group-action-hover-color);
  text-decoration: none;
  background-color: var(--bs-list-group-action-hover-bg);
}
.list-group-item-action:active {
  color: var(--bs-list-group-action-active-color);
  background-color: var(--bs-list-group-action-active-bg);
}
.list-group-item {
  position: relative;
  display: block;
  padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
  color: var(--bs-list-group-color);
  text-decoration: none;
  background-color: var(--bs-list-group-bg);
  border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color);
}
.list-group-item:first-child {
  border-top-left-radius: inherit;
  border-top-right-radius: inherit;
}
.list-group-item:last-child {
  border-bottom-right-radius: inherit;
  border-bottom-left-radius: inherit;
}
.list-group-item.disabled, .list-group-item:disabled {
  color: var(--bs-list-group-disabled-color);
  pointer-events: none;
  background-color: var(--bs-list-group-disabled-bg);
}
.list-group-item.active {
  z-index: 2;
  color: var(--bs-list-group-active-color);
  background-color: var(--bs-list-group-active-bg);
  border-color: var(--bs-list-group-active-border-color);
}
.list-group-item + .list-group-item {
  border-top-width: 0;
}
.list-group-item + .list-group-item.active {
  margin-top: calc(-1 * var(--bs-list-group-border-width));
  border-top-width: var(--bs-list-group-border-width);
}
.list-group-horizontal {
  flex-direction: row;
}
.list-group-horizontal > .list-group-item:first-child:not(:last-child) {
  border-bottom-left-radius: var(--bs-list-group-border-radius);
  border-top-right-radius: 0;
}
.list-group-horizontal > .list-group-item:last-child:not(:first-child) {
  border-top-right-radius: var(--bs-list-group-border-radius);
  border-bottom-left-radius: 0;
}
.list-group-horizontal > .list-group-item.active {
  margin-top: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item {
  border-top-width: var(--bs-list-group-border-width);
  border-left-width: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item.active {
  margin-left: calc(-1 * var(--bs-list-group-border-width));
  border-left-width: var(--bs-list-group-border-width);
}
@media (min-width: 576px) {
  .list-group-horizontal-sm {
    flex-direction: row;
  }
  .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 768px) {
  .list-group-horizontal-md {
    flex-direction: row;
  }
  .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 992px) {
  .list-group-horizontal-lg {
    flex-direction: row;
  }
  .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 1200px) {
  .list-group-horizontal-xl {
    flex-direction: row;
  }
  .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
@media (min-width: 1400px) {
  .list-group-horizontal-xxl {
    flex-direction: row;
  }
  .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) {
    border-bottom-left-radius: var(--bs-list-group-border-radius);
    border-top-right-radius: 0;
  }
  .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) {
    border-top-right-radius: var(--bs-list-group-border-radius);
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-xxl > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-xxl > .list-group-item + .list-group-item {
    border-top-width: var(--bs-list-group-border-width);
    border-left-width: 0;
  }
  .list-group-horizontal-xxl > .list-group-item + .list-group-item.active {
    margin-left: calc(-1 * var(--bs-list-group-border-width));
    border-left-width: var(--bs-list-group-border-width);
  }
}
.list-group-flush {
  border-radius: 0;
}
.list-group-flush > .list-group-item {
  border-width: 0 0 var(--bs-list-group-border-width);
}
.list-group-flush > .list-group-item:last-child {
  border-bottom-width: 0;
}
.list-group-item-primary {
  --bs-list-group-color:var(--bs-primary-text);
  --bs-list-group-bg:var(--bs-primary-bg-subtle);
  --bs-list-group-border-color:var(--bs-primary-border-subtle)}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-primary-border-subtle)}.list-group-item-primary.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-primary-text);
  --bs-list-group-active-border-color:var(--bs-primary-text)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text);
  --bs-list-group-bg:var(--bs-secondary-bg-subtle);
  --bs-list-group-border-color:var(--bs-secondary-border-subtle)}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle)}.list-group-item-secondary.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-secondary-text);
  --bs-list-group-active-border-color:var(--bs-secondary-text)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text);
  --bs-list-group-bg:var(--bs-success-bg-subtle);
  --bs-list-group-border-color:var(--bs-success-border-subtle)}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-success-border-subtle)}.list-group-item-success.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-success-text);
  --bs-list-group-active-border-color:var(--bs-success-text)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text);
  --bs-list-group-bg:var(--bs-info-bg-subtle);
  --bs-list-group-border-color:var(--bs-info-border-subtle)}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-info-border-subtle)}.list-group-item-info.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-info-text);
  --bs-list-group-active-border-color:var(--bs-info-text)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text);
  --bs-list-group-bg:var(--bs-warning-bg-subtle);
  --bs-list-group-border-color:var(--bs-warning-border-subtle)}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-warning-border-subtle)}.list-group-item-warning.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-warning-text);
  --bs-list-group-active-border-color:var(--bs-warning-text)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text);
  --bs-list-group-bg:var(--bs-danger-bg-subtle);
  --bs-list-group-border-color:var(--bs-danger-border-subtle)}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-danger-border-subtle)}.list-group-item-danger.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-danger-text);
  --bs-list-group-active-border-color:var(--bs-danger-text)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text);
  --bs-list-group-bg:var(--bs-light-bg-subtle);
  --bs-list-group-border-color:var(--bs-light-border-subtle)}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-light-border-subtle)}.list-group-item-light.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-light-text);
  --bs-list-group-active-border-color:var(--bs-light-text)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text);
  --bs-list-group-bg:var(--bs-dark-bg-subtle);
  --bs-list-group-border-color:var(--bs-dark-border-subtle)}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{--bs-list-group-action-hover-color:var(--bs-emphasis-color);
  --bs-list-group-action-hover-bg:var(--bs-dark-border-subtle)}.list-group-item-dark.list-group-item-action:active{--bs-list-group-active-color:var(--bs-emphasis-color);
  --bs-list-group-active-bg:var(--bs-dark-text);
  --bs-list-group-active-border-color:var(--bs-dark-text)}.btn-close{--bs-btn-close-color:#000;
  --bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");
  --bs-btn-close-opacity:0.5;
  --bs-btn-close-hover-opacity:0.75;
  --bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
  --bs-btn-close-focus-opacity:1;
  --bs-btn-close-disabled-opacity:0.25;
  --bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);
  box-sizing: content-box;
  width: 1em;
  height: 1em;
  padding: 0.25em 0.25em;
  color: var(--bs-btn-close-color);
  background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
  border: 0;
  border-radius: 0.375rem;
  opacity: var(--bs-btn-close-opacity);
}
.btn-close:hover {
  color: var(--bs-btn-close-color);
  text-decoration: none;
  opacity: var(--bs-btn-close-hover-opacity);
}
.btn-close:focus {
  outline: 0;
  box-shadow: var(--bs-btn-close-focus-shadow);
  opacity: var(--bs-btn-close-focus-opacity);
}
.btn-close.disabled, .btn-close:disabled {
  pointer-events: none;
  -webkit-user-select: none;
  -moz-user-select: none;
  user-select: none;
  opacity: var(--bs-btn-close-disabled-opacity);
}
.btn-close-white {
  filter: var(--bs-btn-close-white-filter);
}
[data-bs-theme=dark] .btn-close {
  filter: var(--bs-btn-close-white-filter);
}
.toast {
  --bs-toast-zindex:1090;
  --bs-toast-padding-x:0.75rem;
  --bs-toast-padding-y:0.5rem;
  --bs-toast-spacing:1.5rem;
  --bs-toast-max-width:350px;
  --bs-toast-font-size:0.875rem;
  --bs-toast-color: ;
  --bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);
  --bs-toast-border-width:var(--bs-border-width);
  --bs-toast-border-color:var(--bs-border-color-translucent);
  --bs-toast-border-radius:var(--bs-border-radius);
  --bs-toast-box-shadow:var(--bs-box-shadow);
  --bs-toast-header-color:var(--bs-secondary-color);
  --bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);
  --bs-toast-header-border-color:var(--bs-border-color-translucent);
  width: var(--bs-toast-max-width);
  max-width: 100%;
  font-size: var(--bs-toast-font-size);
  color: var(--bs-toast-color);
  pointer-events: auto;
  background-color: var(--bs-toast-bg);
  background-clip: padding-box;
  border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
  box-shadow: var(--bs-toast-box-shadow);
  border-radius: var(--bs-toast-border-radius);
}
.toast.showing {
  opacity: 0;
}
.toast:not(.show) {
  display: none;
}
.toast-container {
  --bs-toast-zindex:1090;
  position: absolute;
  z-index: var(--bs-toast-zindex);
  width: -webkit-max-content;
  width: -moz-max-content;
  width: max-content;
  max-width: 100%;
  pointer-events: none;
}
.toast-container > :not(:last-child) {
  margin-bottom: var(--bs-toast-spacing);
}
.toast-header {
  display: flex;
  align-items: center;
  padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
  color: var(--bs-toast-header-color);
  background-color: var(--bs-toast-header-bg);
  background-clip: padding-box;
  border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
  border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
  border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
}
.toast-header .btn-close {
  margin-right: calc(-.5 * var(--bs-toast-padding-x));
  margin-left: var(--bs-toast-padding-x);
}
.toast-body {
  padding: var(--bs-toast-padding-x);
  word-wrap: break-word;
}
.modal {
  --bs-modal-zindex:1055;
  --bs-modal-width:500px;
  --bs-modal-padding:1rem;
  --bs-modal-margin:0.5rem;
  --bs-modal-color: ;
  --bs-modal-bg:var(--bs-body-bg);
  --bs-modal-border-color:var(--bs-border-color-translucent);
  --bs-modal-border-width:var(--bs-border-width);
  --bs-modal-border-radius:var(--bs-border-radius-lg);
  --bs-modal-box-shadow:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
  --bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
  --bs-modal-header-padding-x:1rem;
  --bs-modal-header-padding-y:1rem;
  --bs-modal-header-padding:1rem 1rem;
  --bs-modal-header-border-color:var(--bs-border-color);
  --bs-modal-header-border-width:var(--bs-border-width);
  --bs-modal-title-line-height:1.5;
  --bs-modal-footer-gap:0.5rem;
  --bs-modal-footer-bg: ;
  --bs-modal-footer-border-color:var(--bs-border-color);
  --bs-modal-footer-border-width:var(--bs-border-width);
  position: fixed;
  top: 0;
  left: 0;
  z-index: var(--bs-modal-zindex);
  display: none;
  width: 100%;
  height: 100%;
  overflow-x: hidden;
  overflow-y: auto;
  outline: 0;
}
.modal-dialog {
  position: relative;
  width: auto;
  margin: var(--bs-modal-margin);
  pointer-events: none;
}
.modal.fade .modal-dialog {
  transition: transform 0.3s ease-out;
  transform: translate(0, -50px);
}
@media (prefers-reduced-motion: reduce) {
  .modal.fade .modal-dialog {
    transition: none;
  }
}
.modal.show .modal-dialog {
  transform: none;
}
.modal.modal-static .modal-dialog {
  transform: scale(1.02);
}
.modal-dialog-scrollable {
  height: calc(100% - var(--bs-modal-margin) * 2);
}
.modal-dialog-scrollable .modal-content {
  max-height: 100%;
  overflow: hidden;
}
.modal-dialog-scrollable .modal-body {
  overflow-y: auto;
}
.modal-dialog-centered {
  display: flex;
  align-items: center;
  min-height: calc(100% - var(--bs-modal-margin) * 2);
}
.modal-content {
  position: relative;
  display: flex;
  flex-direction: column;
  width: 100%;
  color: var(--bs-modal-color);
  pointer-events: auto;
  background-color: var(--bs-modal-bg);
  background-clip: padding-box;
  border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
  border-radius: var(--bs-modal-border-radius);
  outline: 0;
}
.modal-backdrop {
  --bs-backdrop-zindex:1050;
  --bs-backdrop-bg:#000;
  --bs-backdrop-opacity:0.5;
  position: fixed;
  top: 0;
  left: 0;
  z-index: var(--bs-backdrop-zindex);
  width: 100vw;
  height: 100vh;
  background-color: var(--bs-backdrop-bg);
}
.modal-backdrop.fade {
  opacity: 0;
}
.modal-backdrop.show {
  opacity: var(--bs-backdrop-opacity);
}
.modal-header {
  display: flex;
  flex-shrink: 0;
  align-items: center;
  justify-content: space-between;
  padding: var(--bs-modal-header-padding);
  border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
  border-top-left-radius: var(--bs-modal-inner-border-radius);
  border-top-right-radius: var(--bs-modal-inner-border-radius);
}
.modal-header .btn-close {
  padding: calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);
  margin: calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto;
}
.modal-title {
  margin-bottom: 0;
  line-height: var(--bs-modal-title-line-height);
}
.modal-body {
  position: relative;
  flex: 1 1 auto;
  padding: var(--bs-modal-padding);
}
.modal-footer {
  display: flex;
  flex-shrink: 0;
  flex-wrap: wrap;
  align-items: center;
  justify-content: flex-end;
  padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);
  background-color: var(--bs-modal-footer-bg);
  border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
  border-bottom-right-radius: var(--bs-modal-inner-border-radius);
  border-bottom-left-radius: var(--bs-modal-inner-border-radius);
}
.modal-footer > * {
  margin: calc(var(--bs-modal-footer-gap) * .5);
}
@media (min-width: 576px) {
  .modal {
    --bs-modal-margin:1.75rem;
    --bs-modal-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15)}.modal-dialog{max-width:var(--bs-modal-width);
    margin-right: auto;
    margin-left: auto;
  }
  .modal-sm {
    --bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-sm-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-sm-down .modal-footer, .modal-fullscreen-sm-down .modal-header {
    border-radius: 0;
  }
  .modal-fullscreen-sm-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 767.98px) {
  .modal-fullscreen-md-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-md-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-md-down .modal-footer, .modal-fullscreen-md-down .modal-header {
    border-radius: 0;
  }
  .modal-fullscreen-md-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 991.98px) {
  .modal-fullscreen-lg-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-lg-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-lg-down .modal-footer, .modal-fullscreen-lg-down .modal-header {
    border-radius: 0;
  }
  .modal-fullscreen-lg-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 1199.98px) {
  .modal-fullscreen-xl-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-xl-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-xl-down .modal-footer, .modal-fullscreen-xl-down .modal-header {
    border-radius: 0;
  }
  .modal-fullscreen-xl-down .modal-body {
    overflow-y: auto;
  }
}
@media (max-width: 1399.98px) {
  .modal-fullscreen-xxl-down {
    width: 100vw;
    max-width: none;
    height: 100%;
    margin: 0;
  }
  .modal-fullscreen-xxl-down .modal-content {
    height: 100%;
    border: 0;
    border-radius: 0;
  }
  .modal-fullscreen-xxl-down .modal-footer, .modal-fullscreen-xxl-down .modal-header {
    border-radius: 0;
  }
  .modal-fullscreen-xxl-down .modal-body {
    overflow-y: auto;
  }
}
.tooltip {
  --bs-tooltip-zindex:1080;
  --bs-tooltip-max-width:200px;
  --bs-tooltip-padding-x:0.5rem;
  --bs-tooltip-padding-y:0.25rem;
  --bs-tooltip-margin: ;
  --bs-tooltip-font-size:0.875rem;
  --bs-tooltip-color:var(--bs-body-bg);
  --bs-tooltip-bg:var(--bs-emphasis-color);
  --bs-tooltip-border-radius:var(--bs-border-radius);
  --bs-tooltip-opacity:0.9;
  --bs-tooltip-arrow-width:0.8rem;
  --bs-tooltip-arrow-height:0.4rem;
  z-index: var(--bs-tooltip-zindex);
  display: block;
  padding: var(--bs-tooltip-arrow-height);
  margin: var(--bs-tooltip-margin);
  font-family: var(--bs-font-sans-serif);
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: var(--bs-tooltip-font-size);
  word-wrap: break-word;
  opacity: 0;
}
.tooltip.show {
  opacity: var(--bs-tooltip-opacity);
}
.tooltip .tooltip-arrow {
  display: block;
  width: var(--bs-tooltip-arrow-width);
  height: var(--bs-tooltip-arrow-height);
}
.tooltip .tooltip-arrow::before {
  position: absolute;
  content: "";
  border-color: transparent;
  border-style: solid;
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow, .bs-tooltip-top .tooltip-arrow {
  bottom: 0;
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before, .bs-tooltip-top .tooltip-arrow::before {
  top: -1px;
  border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
  border-top-color: var(--bs-tooltip-bg);
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow, .bs-tooltip-end .tooltip-arrow {
  left: 0;
  width: var(--bs-tooltip-arrow-height);
  height: var(--bs-tooltip-arrow-width);
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before, .bs-tooltip-end .tooltip-arrow::before {
  right: -1px;
  border-width: calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
  border-right-color: var(--bs-tooltip-bg);
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow, .bs-tooltip-bottom .tooltip-arrow {
  top: 0;
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before, .bs-tooltip-bottom .tooltip-arrow::before {
  bottom: -1px;
  border-width: 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
  border-bottom-color: var(--bs-tooltip-bg);
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow, .bs-tooltip-start .tooltip-arrow {
  right: 0;
  width: var(--bs-tooltip-arrow-height);
  height: var(--bs-tooltip-arrow-width);
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before, .bs-tooltip-start .tooltip-arrow::before {
  left: -1px;
  border-width: calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
  border-left-color: var(--bs-tooltip-bg);
}
.tooltip-inner {
  max-width: var(--bs-tooltip-max-width);
  padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
  color: var(--bs-tooltip-color);
  text-align: center;
  background-color: var(--bs-tooltip-bg);
  border-radius: var(--bs-tooltip-border-radius);
}
.popover {
  --bs-popover-zindex:1070;
  --bs-popover-max-width:276px;
  --bs-popover-font-size:0.875rem;
  --bs-popover-bg:var(--bs-body-bg);
  --bs-popover-border-width:var(--bs-border-width);
  --bs-popover-border-color:var(--bs-border-color-translucent);
  --bs-popover-border-radius:var(--bs-border-radius-lg);
  --bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));
  --bs-popover-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
  --bs-popover-header-padding-x:1rem;
  --bs-popover-header-padding-y:0.5rem;
  --bs-popover-header-font-size:1rem;
  --bs-popover-header-color: ;
  --bs-popover-header-bg:var(--bs-secondary-bg);
  --bs-popover-body-padding-x:1rem;
  --bs-popover-body-padding-y:1rem;
  --bs-popover-body-color:var(--bs-body-color);
  --bs-popover-arrow-width:1rem;
  --bs-popover-arrow-height:0.5rem;
  --bs-popover-arrow-border:var(--bs-popover-border-color);
  z-index: var(--bs-popover-zindex);
  display: block;
  max-width: var(--bs-popover-max-width);
  font-family: var(--bs-font-sans-serif);
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: var(--bs-popover-font-size);
  word-wrap: break-word;
  background-color: var(--bs-popover-bg);
  background-clip: padding-box;
  border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
  border-radius: var(--bs-popover-border-radius);
}
.popover .popover-arrow {
  display: block;
  width: var(--bs-popover-arrow-width);
  height: var(--bs-popover-arrow-height);
}
.popover .popover-arrow::after, .popover .popover-arrow::before {
  position: absolute;
  display: block;
  content: "";
  border-color: transparent;
  border-style: solid;
  border-width: 0;
}
.bs-popover-auto[data-popper-placement^=top] > .popover-arrow, .bs-popover-top > .popover-arrow {
  bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
}
.bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-top > .popover-arrow::before {
  border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0;
}
.bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::before {
  bottom: 0;
  border-top-color: var(--bs-popover-arrow-border);
}
.bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after, .bs-popover-top > .popover-arrow::after {
  bottom: var(--bs-popover-border-width);
  border-top-color: var(--bs-popover-bg);
}
.bs-popover-auto[data-popper-placement^=right] > .popover-arrow, .bs-popover-end > .popover-arrow {
  left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
  width: var(--bs-popover-arrow-height);
  height: var(--bs-popover-arrow-width);
}
.bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-end > .popover-arrow::before {
  border-width: calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0;
}
.bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::before {
  left: 0;
  border-right-color: var(--bs-popover-arrow-border);
}
.bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after, .bs-popover-end > .popover-arrow::after {
  left: var(--bs-popover-border-width);
  border-right-color: var(--bs-popover-bg);
}
.bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow, .bs-popover-bottom > .popover-arrow {
  top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
}
.bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-bottom > .popover-arrow::before {
  border-width: 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height);
}
.bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::before {
  top: 0;
  border-bottom-color: var(--bs-popover-arrow-border);
}
.bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after, .bs-popover-bottom > .popover-arrow::after {
  top: var(--bs-popover-border-width);
  border-bottom-color: var(--bs-popover-bg);
}
.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before, .bs-popover-bottom .popover-header::before {
  position: absolute;
  top: 0;
  left: 50%;
  display: block;
  width: var(--bs-popover-arrow-width);
  margin-left: calc(-.5 * var(--bs-popover-arrow-width));
  content: "";
  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg);
}
.bs-popover-auto[data-popper-placement^=left] > .popover-arrow, .bs-popover-start > .popover-arrow {
  right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
  width: var(--bs-popover-arrow-height);
  height: var(--bs-popover-arrow-width);
}
.bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-start > .popover-arrow::before {
  border-width: calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height);
}
.bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::before {
  right: 0;
  border-left-color: var(--bs-popover-arrow-border);
}
.bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after, .bs-popover-start > .popover-arrow::after {
  right: var(--bs-popover-border-width);
  border-left-color: var(--bs-popover-bg);
}
.popover-header {
  padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
  margin-bottom: 0;
  font-size: var(--bs-popover-header-font-size);
  color: var(--bs-popover-header-color);
  background-color: var(--bs-popover-header-bg);
  border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
  border-top-left-radius: var(--bs-popover-inner-border-radius);
  border-top-right-radius: var(--bs-popover-inner-border-radius);
}
.popover-header:empty {
  display: none;
}
.popover-body {
  padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
  color: var(--bs-popover-body-color);
}
.carousel {
  position: relative;
}
.carousel.pointer-event {
  touch-action: pan-y;
}
.carousel-inner {
  position: relative;
  width: 100%;
  overflow: hidden;
}
.carousel-inner::after {
  display: block;
  clear: both;
  content: "";
}
.carousel-item {
  position: relative;
  display: none;
  float: left;
  width: 100%;
  margin-right: -100%;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
  transition: transform 0.6s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-item {
    transition: none;
  }
}
.carousel-item-next, .carousel-item-prev, .carousel-item.active {
  display: block;
}
.active.carousel-item-end, .carousel-item-next:not(.carousel-item-start) {
  transform: translateX(100%);
}
.active.carousel-item-start, .carousel-item-prev:not(.carousel-item-end) {
  transform: translateX(-100%);
}
.carousel-fade .carousel-item {
  opacity: 0;
  transition-property: opacity;
  transform: none;
}
.carousel-fade .carousel-item-next.carousel-item-start, .carousel-fade .carousel-item-prev.carousel-item-end, .carousel-fade .carousel-item.active {
  z-index: 1;
  opacity: 1;
}
.carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
  z-index: 0;
  opacity: 0;
  transition: opacity 0s 0.6s;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
    transition: none;
  }
}
.carousel-control-next, .carousel-control-prev {
  position: absolute;
  top: 0;
  bottom: 0;
  z-index: 1;
  display: flex;
  align-items: center;
  justify-content: center;
  width: 15%;
  padding: 0;
  color: #fff;
  text-align: center;
  background: 0 0;
  border: 0;
  opacity: 0.5;
  transition: opacity 0.15s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-control-next, .carousel-control-prev {
    transition: none;
  }
}
.carousel-control-next:focus, .carousel-control-next:hover, .carousel-control-prev:focus, .carousel-control-prev:hover {
  color: #fff;
  text-decoration: none;
  outline: 0;
  opacity: 0.9;
}
.carousel-control-prev {
  left: 0;
}
.carousel-control-next {
  right: 0;
}
.carousel-control-next-icon, .carousel-control-prev-icon {
  display: inline-block;
  width: 2rem;
  height: 2rem;
  background-repeat: no-repeat;
  background-position: 50%;
  background-size: 100% 100%;
}
.carousel-control-prev-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e");
}
.carousel-control-next-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
}
.carousel-indicators {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 2;
  display: flex;
  justify-content: center;
  padding: 0;
  margin-right: 15%;
  margin-bottom: 1rem;
  margin-left: 15%;
  list-style: none;
}
.carousel-indicators [data-bs-target] {
  box-sizing: content-box;
  flex: 0 1 auto;
  width: 30px;
  height: 3px;
  padding: 0;
  margin-right: 3px;
  margin-left: 3px;
  text-indent: -999px;
  cursor: pointer;
  background-color: #fff;
  background-clip: padding-box;
  border: 0;
  border-top: 10px solid transparent;
  border-bottom: 10px solid transparent;
  opacity: 0.5;
  transition: opacity 0.6s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-indicators [data-bs-target] {
    transition: none;
  }
}
.carousel-indicators .active {
  opacity: 1;
}
.carousel-caption {
  position: absolute;
  right: 15%;
  bottom: 1.25rem;
  left: 15%;
  padding-top: 1.25rem;
  padding-bottom: 1.25rem;
  color: #fff;
  text-align: center;
}
.carousel-dark .carousel-control-next-icon, .carousel-dark .carousel-control-prev-icon {
  filter: invert(1) grayscale(100);
}
.carousel-dark .carousel-indicators [data-bs-target] {
  background-color: #000;
}
.carousel-dark .carousel-caption {
  color: #000;
}
[data-bs-theme=dark] .carousel .carousel-control-next-icon, [data-bs-theme=dark] .carousel .carousel-control-prev-icon {
  filter: invert(1) grayscale(100);
}
[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target] {
  background-color: #000;
}
[data-bs-theme=dark] .carousel .carousel-caption {
  color: #000;
}
.spinner-border, .spinner-grow {
  display: inline-block;
  width: var(--bs-spinner-width);
  height: var(--bs-spinner-height);
  vertical-align: var(--bs-spinner-vertical-align);
  border-radius: 50%;
  animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);
}
@keyframes spinner-border {
  to {
    transform: rotate(360deg);
  }
}
.spinner-border {
  --bs-spinner-width:2rem;
  --bs-spinner-height:2rem;
  --bs-spinner-vertical-align:-0.125em;
  --bs-spinner-border-width:0.25em;
  --bs-spinner-animation-speed:0.75s;
  --bs-spinner-animation-name:spinner-border;
  border: var(--bs-spinner-border-width) solid currentcolor;
  border-right-color: transparent;
}
.spinner-border-sm {
  --bs-spinner-width:1rem;
  --bs-spinner-height:1rem;
  --bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;
  --bs-spinner-height:2rem;
  --bs-spinner-vertical-align:-0.125em;
  --bs-spinner-animation-speed:0.75s;
  --bs-spinner-animation-name:spinner-grow;
  background-color: currentcolor;
  opacity: 0;
}
.spinner-grow-sm {
  --bs-spinner-width:1rem;
  --bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;
  --bs-offcanvas-width:400px;
  --bs-offcanvas-height:30vh;
  --bs-offcanvas-padding-x:1rem;
  --bs-offcanvas-padding-y:1rem;
  --bs-offcanvas-color:var(--bs-body-color);
  --bs-offcanvas-bg:var(--bs-body-bg);
  --bs-offcanvas-border-width:var(--bs-border-width);
  --bs-offcanvas-border-color:var(--bs-border-color-translucent);
  --bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
  --bs-offcanvas-transition:transform 0.3s ease-in-out;
  --bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;
  bottom: 0;
  z-index: var(--bs-offcanvas-zindex);
  display: flex;
  flex-direction: column;
  max-width: 100%;
  color: var(--bs-offcanvas-color);
  visibility: hidden;
  background-color: var(--bs-offcanvas-bg);
  background-clip: padding-box;
  outline: 0;
  transition: var(--bs-offcanvas-transition);
}
@media (prefers-reduced-motion: reduce) {
  .offcanvas {
    transition: none;
  }
}
.offcanvas.offcanvas-start {
  top: 0;
  left: 0;
  width: var(--bs-offcanvas-width);
  border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateX(-100%);
}
.offcanvas.offcanvas-end {
  top: 0;
  right: 0;
  width: var(--bs-offcanvas-width);
  border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateX(100%);
}
.offcanvas.offcanvas-top {
  top: 0;
  right: 0;
  left: 0;
  height: var(--bs-offcanvas-height);
  max-height: 100%;
  border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateY(-100%);
}
.offcanvas.offcanvas-bottom {
  right: 0;
  left: 0;
  height: var(--bs-offcanvas-height);
  max-height: 100%;
  border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
  transform: translateY(100%);
}
.offcanvas.show:not(.hiding), .offcanvas.showing {
  transform: none;
}
.offcanvas.hiding, .offcanvas.show, .offcanvas.showing {
  visibility: visible;
}
.offcanvas-backdrop {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1040;
  width: 100vw;
  height: 100vh;
  background-color: #000;
}
.offcanvas-backdrop.fade {
  opacity: 0;
}
.offcanvas-backdrop.show {
  opacity: 0.5;
}
.offcanvas-header {
  display: flex;
  align-items: center;
  justify-content: space-between;
  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
}
.offcanvas-header .btn-close {
  padding: calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);
  margin-top: calc(-.5 * var(--bs-offcanvas-padding-y));
  margin-right: calc(-.5 * var(--bs-offcanvas-padding-x));
  margin-bottom: calc(-.5 * var(--bs-offcanvas-padding-y));
}
.offcanvas-title {
  margin-bottom: 0;
  line-height: var(--bs-offcanvas-title-line-height);
}
.offcanvas-body {
  flex-grow: 1;
  padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
  overflow-y: auto;
}
.placeholder {
  display: inline-block;
  min-height: 1em;
  vertical-align: middle;
  cursor: wait;
  background-color: currentcolor;
  opacity: 0.5;
}
.placeholder.btn::before {
  display: inline-block;
  content: "";
}
.placeholder-xs {
  min-height: 0.6em;
}
.placeholder-sm {
  min-height: 0.8em;
}
.placeholder-lg {
  min-height: 1.2em;
}
.placeholder-glow .placeholder {
  animation: placeholder-glow 2s ease-in-out infinite;
}
@keyframes placeholder-glow {
  50% {
    opacity: 0.2;
  }
}
.placeholder-wave {
  -webkit-mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
  mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
  -webkit-mask-size: 200% 100%;
  mask-size: 200% 100%;
  animation: placeholder-wave 2s linear infinite;
}
@keyframes placeholder-wave {
  100% {
    -webkit-mask-position: -200% 0%;
    mask-position: -200% 0%;
  }
}
.clearfix::after {
  display: block;
  clear: both;
  content: "";
}
.text-bg-primary {
  color: #fff !important;
  background-color: rgba(13, 110, 253, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-secondary {
  color: #fff !important;
  background-color: rgba(108, 117, 125, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-success {
  color: #fff !important;
  background-color: rgba(25, 135, 84, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-info {
  color: #000 !important;
  background-color: rgba(13, 202, 240, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-warning {
  color: #000 !important;
  background-color: rgba(255, 193, 7, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-danger {
  color: #fff !important;
  background-color: rgba(220, 53, 69, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-light {
  color: #000 !important;
  background-color: rgba(248, 249, 250, var(--bs-bg-opacity, 1)) !important;
}
.text-bg-dark {
  color: #fff !important;
  background-color: rgba(33, 37, 41, var(--bs-bg-opacity, 1)) !important;
}
.link-primary {
  color: #0d6efd !important;
}
.link-primary:focus, .link-primary:hover {
  color: #0a58ca !important;
}
.link-secondary {
  color: #6c757d !important;
}
.link-secondary:focus, .link-secondary:hover {
  color: #565e64 !important;
}
.link-success {
  color: #198754 !important;
}
.link-success:focus, .link-success:hover {
  color: #146c43 !important;
}
.link-info {
  color: #0dcaf0 !important;
}
.link-info:focus, .link-info:hover {
  color: #3dd5f3 !important;
}
.link-warning {
  color: #ffc107 !important;
}
.link-warning:focus, .link-warning:hover {
  color: #ffcd39 !important;
}
.link-danger {
  color: #dc3545 !important;
}
.link-danger:focus, .link-danger:hover {
  color: #b02a37 !important;
}
.link-light {
  color: #f8f9fa !important;
}
.link-light:focus, .link-light:hover {
  color: #f9fafb !important;
}
.link-dark {
  color: #212529 !important;
}
.link-dark:focus, .link-dark:hover {
  color: #1a1e21 !important;
}
.ratio {
  position: relative;
  width: 100%;
}
.ratio::before {
  display: block;
  padding-top: var(--bs-aspect-ratio);
  content: "";
}
.ratio > * {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}
.ratio-1x1 {
  --bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1030;
}
.fixed-bottom {
  position: fixed;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1030;
}
.sticky-top {
  position: -webkit-sticky;
  position: sticky;
  top: 0;
  z-index: 1020;
}
.sticky-bottom {
  position: -webkit-sticky;
  position: sticky;
  bottom: 0;
  z-index: 1020;
}
@media (min-width: 576px) {
  .sticky-sm-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-sm-bottom {
    position: -webkit-sticky;
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 768px) {
  .sticky-md-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-md-bottom {
    position: -webkit-sticky;
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 992px) {
  .sticky-lg-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-lg-bottom {
    position: -webkit-sticky;
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 1200px) {
  .sticky-xl-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-xl-bottom {
    position: -webkit-sticky;
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
@media (min-width: 1400px) {
  .sticky-xxl-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
  .sticky-xxl-bottom {
    position: -webkit-sticky;
    position: sticky;
    bottom: 0;
    z-index: 1020;
  }
}
.hstack {
  display: flex;
  flex-direction: row;
  align-items: center;
  align-self: stretch;
}
.vstack {
  display: flex;
  flex: 1 1 auto;
  flex-direction: column;
  align-self: stretch;
}
.visually-hidden, .visually-hidden-focusable:not(:focus):not(:focus-within) {
  position: absolute !important;
  width: 1px !important;
  height: 1px !important;
  padding: 0 !important;
  margin: -1px !important;
  overflow: hidden !important;
  clip: rect(0, 0, 0, 0) !important;
  white-space: nowrap !important;
  border: 0 !important;
}
.stretched-link::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  content: "";
}
.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}
.vr {
  display: inline-block;
  align-self: stretch;
  width: 1px;
  min-height: 1em;
  background-color: currentcolor;
  opacity: 0.25;
}
.align-baseline {
  vertical-align: baseline !important;
}
.align-top {
  vertical-align: top !important;
}
.align-middle {
  vertical-align: middle !important;
}
.align-bottom {
  vertical-align: bottom !important;
}
.align-text-bottom {
  vertical-align: text-bottom !important;
}
.align-text-top {
  vertical-align: text-top !important;
}
.float-start {
  float: left !important;
}
.float-end {
  float: right !important;
}
.float-none {
  float: none !important;
}
.object-fit-contain {
  -o-object-fit: contain !important;
  object-fit: contain !important;
}
.object-fit-cover {
  -o-object-fit: cover !important;
  object-fit: cover !important;
}
.object-fit-fill {
  -o-object-fit: fill !important;
  object-fit: fill !important;
}
.object-fit-scale {
  -o-object-fit: scale-down !important;
  object-fit: scale-down !important;
}
.object-fit-none {
  -o-object-fit: none !important;
  object-fit: none !important;
}
.opacity-0 {
  opacity: 0 !important;
}
.opacity-25 {
  opacity: 0.25 !important;
}
.opacity-50 {
  opacity: 0.5 !important;
}
.opacity-75 {
  opacity: 0.75 !important;
}
.opacity-100 {
  opacity: 1 !important;
}
.overflow-auto {
  overflow: auto !important;
}
.overflow-hidden {
  overflow: hidden !important;
}
.overflow-visible {
  overflow: visible !important;
}
.overflow-scroll {
  overflow: scroll !important;
}
.overflow-x-auto {
  overflow-x: auto !important;
}
.overflow-x-hidden {
  overflow-x: hidden !important;
}
.overflow-x-visible {
  overflow-x: visible !important;
}
.overflow-x-scroll {
  overflow-x: scroll !important;
}
.overflow-y-auto {
  overflow-y: auto !important;
}
.overflow-y-hidden {
  overflow-y: hidden !important;
}
.overflow-y-visible {
  overflow-y: visible !important;
}
.overflow-y-scroll {
  overflow-y: scroll !important;
}
.d-inline {
  display: inline !important;
}
.d-inline-block {
  display: inline-block !important;
}
.d-block {
  display: block !important;
}
.d-grid {
  display: grid !important;
}
.d-table {
  display: table !important;
}
.d-table-row {
  display: table-row !important;
}
.d-table-cell {
  display: table-cell !important;
}
.d-flex {
  display: flex !important;
}
.d-inline-flex {
  display: inline-flex !important;
}
.d-none {
  display: none !important;
}
.shadow {
  box-shadow: 0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15) !important;
}
.shadow-sm {
  box-shadow: 0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075) !important;
}
.shadow-lg {
  box-shadow: 0 1rem 3rem rgba(var(--bs-body-color-rgb), 0.175) !important;
}
.shadow-none {
  box-shadow: none !important;
}
.position-static {
  position: static !important;
}
.position-relative {
  position: relative !important;
}
.position-absolute {
  position: absolute !important;
}
.position-fixed {
  position: fixed !important;
}
.position-sticky {
  position: -webkit-sticky !important;
  position: sticky !important;
}
.top-0 {
  top: 0 !important;
}
.top-50 {
  top: 50% !important;
}
.top-100 {
  top: 100% !important;
}
.bottom-0 {
  bottom: 0 !important;
}
.bottom-50 {
  bottom: 50% !important;
}
.bottom-100 {
  bottom: 100% !important;
}
.start-0 {
  left: 0 !important;
}
.start-50 {
  left: 50% !important;
}
.start-100 {
  left: 100% !important;
}
.end-0 {
  right: 0 !important;
}
.end-50 {
  right: 50% !important;
}
.end-100 {
  right: 100% !important;
}
.translate-middle {
  transform: translate(-50%, -50%) !important;
}
.translate-middle-x {
  transform: translateX(-50%) !important;
}
.translate-middle-y {
  transform: translateY(-50%) !important;
}
.border {
  border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}
.border-0 {
  border: 0 !important;
}
.border-top {
  border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}
.border-top-0 {
  border-top: 0 !important;
}
.border-end {
  border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}
.border-end-0 {
  border-right: 0 !important;
}
.border-bottom {
  border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}
.border-bottom-0 {
  border-bottom: 0 !important;
}
.border-start {
  border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
}
.border-start-0 {
  border-left: 0 !important;
}
.border-primary {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important;
}
.border-secondary {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important;
}
.border-success {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important;
}
.border-info {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important;
}
.border-warning {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important;
}
.border-danger {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important;
}
.border-light {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important;
}
.border-dark {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important;
}
.border-white {
  --bs-border-opacity:1;
  border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important;
}
.border-primary-subtle {
  border-color: var(--bs-primary-border-subtle) !important;
}
.border-secondary-subtle {
  border-color: var(--bs-secondary-border-subtle) !important;
}
.border-success-subtle {
  border-color: var(--bs-success-border-subtle) !important;
}
.border-info-subtle {
  border-color: var(--bs-info-border-subtle) !important;
}
.border-warning-subtle {
  border-color: var(--bs-warning-border-subtle) !important;
}
.border-danger-subtle {
  border-color: var(--bs-danger-border-subtle) !important;
}
.border-light-subtle {
  border-color: var(--bs-light-border-subtle) !important;
}
.border-dark-subtle {
  border-color: var(--bs-dark-border-subtle) !important;
}
.border-1 {
  --bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;
  margin-left: 0 !important;
}
.mx-1 {
  margin-right: 0.25rem !important;
  margin-left: 0.25rem !important;
}
.mx-2 {
  margin-right: 0.5rem !important;
  margin-left: 0.5rem !important;
}
.mx-3 {
  margin-right: 1rem !important;
  margin-left: 1rem !important;
}
.mx-4 {
  margin-right: 1.5rem !important;
  margin-left: 1.5rem !important;
}
.mx-5 {
  margin-right: 3rem !important;
  margin-left: 3rem !important;
}
.mx-auto {
  margin-right: auto !important;
  margin-left: auto !important;
}
.my-0 {
  margin-top: 0 !important;
  margin-bottom: 0 !important;
}
.my-1 {
  margin-top: 0.25rem !important;
  margin-bottom: 0.25rem !important;
}
.my-2 {
  margin-top: 0.5rem !important;
  margin-bottom: 0.5rem !important;
}
.my-3 {
  margin-top: 1rem !important;
  margin-bottom: 1rem !important;
}
.my-4 {
  margin-top: 1.5rem !important;
  margin-bottom: 1.5rem !important;
}
.my-5 {
  margin-top: 3rem !important;
  margin-bottom: 3rem !important;
}
.my-auto {
  margin-top: auto !important;
  margin-bottom: auto !important;
}
.mt-0 {
  margin-top: 0 !important;
}
.mt-1 {
  margin-top: 0.25rem !important;
}
.mt-2 {
  margin-top: 0.5rem !important;
}
.mt-3 {
  margin-top: 1rem !important;
}
.mt-4 {
  margin-top: 1.5rem !important;
}
.mt-5 {
  margin-top: 3rem !important;
}
.mt-auto {
  margin-top: auto !important;
}
.me-0 {
  margin-right: 0 !important;
}
.me-1 {
  margin-right: 0.25rem !important;
}
.me-2 {
  margin-right: 0.5rem !important;
}
.me-3 {
  margin-right: 1rem !important;
}
.me-4 {
  margin-right: 1.5rem !important;
}
.me-5 {
  margin-right: 3rem !important;
}
.me-auto {
  margin-right: auto !important;
}
.mb-0 {
  margin-bottom: 0 !important;
}
.mb-1 {
  margin-bottom: 0.25rem !important;
}
.mb-2 {
  margin-bottom: 0.5rem !important;
}
.mb-3 {
  margin-bottom: 1rem !important;
}
.mb-4 {
  margin-bottom: 1.5rem !important;
}
.mb-5 {
  margin-bottom: 3rem !important;
}
.mb-auto {
  margin-bottom: auto !important;
}
.ms-0 {
  margin-left: 0 !important;
}
.ms-1 {
  margin-left: 0.25rem !important;
}
.ms-2 {
  margin-left: 0.5rem !important;
}
.ms-3 {
  margin-left: 1rem !important;
}
.ms-4 {
  margin-left: 1.5rem !important;
}
.ms-5 {
  margin-left: 3rem !important;
}
.ms-auto {
  margin-left: auto !important;
}
.p-0 {
  padding: 0 !important;
}
.p-1 {
  padding: 0.25rem !important;
}
.p-2 {
  padding: 0.5rem !important;
}
.p-3 {
  padding: 1rem !important;
}
.p-4 {
  padding: 1.5rem !important;
}
.p-5 {
  padding: 3rem !important;
}
.px-0 {
  padding-right: 0 !important;
  padding-left: 0 !important;
}
.px-1 {
  padding-right: 0.25rem !important;
  padding-left: 0.25rem !important;
}
.px-2 {
  padding-right: 0.5rem !important;
  padding-left: 0.5rem !important;
}
.px-3 {
  padding-right: 1rem !important;
  padding-left: 1rem !important;
}
.px-4 {
  padding-right: 1.5rem !important;
  padding-left: 1.5rem !important;
}
.px-5 {
  padding-right: 3rem !important;
  padding-left: 3rem !important;
}
.py-0 {
  padding-top: 0 !important;
  padding-bottom: 0 !important;
}
.py-1 {
  padding-top: 0.25rem !important;
  padding-bottom: 0.25rem !important;
}
.py-2 {
  padding-top: 0.5rem !important;
  padding-bottom: 0.5rem !important;
}
.py-3 {
  padding-top: 1rem !important;
  padding-bottom: 1rem !important;
}
.py-4 {
  padding-top: 1.5rem !important;
  padding-bottom: 1.5rem !important;
}
.py-5 {
  padding-top: 3rem !important;
  padding-bottom: 3rem !important;
}
.pt-0 {
  padding-top: 0 !important;
}
.pt-1 {
  padding-top: 0.25rem !important;
}
.pt-2 {
  padding-top: 0.5rem !important;
}
.pt-3 {
  padding-top: 1rem !important;
}
.pt-4 {
  padding-top: 1.5rem !important;
}
.pt-5 {
  padding-top: 3rem !important;
}
.pe-0 {
  padding-right: 0 !important;
}
.pe-1 {
  padding-right: 0.25rem !important;
}
.pe-2 {
  padding-right: 0.5rem !important;
}
.pe-3 {
  padding-right: 1rem !important;
}
.pe-4 {
  padding-right: 1.5rem !important;
}
.pe-5 {
  padding-right: 3rem !important;
}
.pb-0 {
  padding-bottom: 0 !important;
}
.pb-1 {
  padding-bottom: 0.25rem !important;
}
.pb-2 {
  padding-bottom: 0.5rem !important;
}
.pb-3 {
  padding-bottom: 1rem !important;
}
.pb-4 {
  padding-bottom: 1.5rem !important;
}
.pb-5 {
  padding-bottom: 3rem !important;
}
.ps-0 {
  padding-left: 0 !important;
}
.ps-1 {
  padding-left: 0.25rem !important;
}
.ps-2 {
  padding-left: 0.5rem !important;
}
.ps-3 {
  padding-left: 1rem !important;
}
.ps-4 {
  padding-left: 1.5rem !important;
}
.ps-5 {
  padding-left: 3rem !important;
}
.gap-0 {
  gap: 0 !important;
}
.gap-1 {
  gap: 0.25rem !important;
}
.gap-2 {
  gap: 0.5rem !important;
}
.gap-3 {
  gap: 1rem !important;
}
.gap-4 {
  gap: 1.5rem !important;
}
.gap-5 {
  gap: 3rem !important;
}
.row-gap-0 {
  row-gap: 0 !important;
}
.row-gap-1 {
  row-gap: 0.25rem !important;
}
.row-gap-2 {
  row-gap: 0.5rem !important;
}
.row-gap-3 {
  row-gap: 1rem !important;
}
.row-gap-4 {
  row-gap: 1.5rem !important;
}
.row-gap-5 {
  row-gap: 3rem !important;
}
.column-gap-0 {
  -moz-column-gap: 0 !important;
  column-gap: 0 !important;
}
.column-gap-1 {
  -moz-column-gap: 0.25rem !important;
  column-gap: 0.25rem !important;
}
.column-gap-2 {
  -moz-column-gap: 0.5rem !important;
  column-gap: 0.5rem !important;
}
.column-gap-3 {
  -moz-column-gap: 1rem !important;
  column-gap: 1rem !important;
}
.column-gap-4 {
  -moz-column-gap: 1.5rem !important;
  column-gap: 1.5rem !important;
}
.column-gap-5 {
  -moz-column-gap: 3rem !important;
  column-gap: 3rem !important;
}
.font-monospace {
  font-family: var(--bs-font-monospace) !important;
}
.fs-1 {
  font-size: calc(1.375rem + 1.5vw) !important;
}
.fs-2 {
  font-size: calc(1.325rem + .9vw) !important;
}
.fs-3 {
  font-size: calc(1.3rem + .6vw) !important;
}
.fs-4 {
  font-size: calc(1.275rem + .3vw) !important;
}
.fs-5 {
  font-size: 1.25rem !important;
}
.fs-6 {
  font-size: 1rem !important;
}
.fst-italic {
  font-style: italic !important;
}
.fst-normal {
  font-style: normal !important;
}
.fw-lighter {
  font-weight: lighter !important;
}
.fw-light {
  font-weight: 300 !important;
}
.fw-normal {
  font-weight: 400 !important;
}
.fw-medium {
  font-weight: 500 !important;
}
.fw-semibold {
  font-weight: 600 !important;
}
.fw-bold {
  font-weight: 700 !important;
}
.fw-bolder {
  font-weight: bolder !important;
}
.lh-1 {
  line-height: 1 !important;
}
.lh-sm {
  line-height: 1.25 !important;
}
.lh-base {
  line-height: 1.5 !important;
}
.lh-lg {
  line-height: 2 !important;
}
.text-start {
  text-align: left !important;
}
.text-end {
  text-align: right !important;
}
.text-center {
  text-align: center !important;
}
.text-decoration-none {
  text-decoration: none !important;
}
.text-decoration-underline {
  text-decoration: underline !important;
}
.text-decoration-line-through {
  text-decoration: line-through !important;
}
.text-lowercase {
  text-transform: lowercase !important;
}
.text-uppercase {
  text-transform: uppercase !important;
}
.text-capitalize {
  text-transform: capitalize !important;
}
.text-wrap {
  white-space: normal !important;
}
.text-nowrap {
  white-space: nowrap !important;
}
.text-break {
  word-wrap: break-word !important;
  word-break: break-word !important;
}
.text-primary {
  --bs-text-opacity:1;
  color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important;
}
.text-secondary {
  --bs-text-opacity:1;
  color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important;
}
.text-success {
  --bs-text-opacity:1;
  color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important;
}
.text-info {
  --bs-text-opacity:1;
  color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important;
}
.text-warning {
  --bs-text-opacity:1;
  color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important;
}
.text-danger {
  --bs-text-opacity:1;
  color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important;
}
.text-light {
  --bs-text-opacity:1;
  color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important;
}
.text-dark {
  --bs-text-opacity:1;
  color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important;
}
.text-black {
  --bs-text-opacity:1;
  color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important;
}
.text-white {
  --bs-text-opacity:1;
  color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important;
}
.text-body {
  --bs-text-opacity:1;
  color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important;
}
.text-muted {
  --bs-text-opacity:1;
  color: var(--bs-secondary-color) !important;
}
.text-black-50 {
  --bs-text-opacity:1;
  color: rgba(0, 0, 0, 0.5) !important;
}
.text-white-50 {
  --bs-text-opacity:1;
  color: rgba(255, 255, 255, 0.5) !important;
}
.text-body-secondary {
  --bs-text-opacity:1;
  color: var(--bs-secondary-color) !important;
}
.text-body-tertiary {
  --bs-text-opacity:1;
  color: var(--bs-tertiary-color) !important;
}
.text-body-emphasis {
  --bs-text-opacity:1;
  color: var(--bs-emphasis-color) !important;
}
.text-reset {
  --bs-text-opacity:1;
  color: inherit !important;
}
.text-opacity-25 {
  --bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text)!important}.text-secondary-emphasis{color:var(--bs-secondary-text)!important}.text-success-emphasis{color:var(--bs-success-text)!important}.text-info-emphasis{color:var(--bs-info-text)!important}.text-warning-emphasis{color:var(--bs-warning-text)!important}.text-danger-emphasis{color:var(--bs-danger-text)!important}.text-light-emphasis{color:var(--bs-light-text)!important}.text-dark-emphasis{color:var(--bs-dark-text)!important}.bg-primary{--bs-bg-opacity:1;
  background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important;
}
.bg-secondary {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important;
}
.bg-success {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important;
}
.bg-info {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important;
}
.bg-warning {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important;
}
.bg-danger {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important;
}
.bg-light {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important;
}
.bg-dark {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important;
}
.bg-black {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important;
}
.bg-white {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important;
}
.bg-body {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important;
}
.bg-transparent {
  --bs-bg-opacity:1;
  background-color: transparent !important;
}
.bg-body-secondary {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important;
}
.bg-body-tertiary {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important;
}
.bg-body-emphasis {
  --bs-bg-opacity:1;
  background-color: rgba(var(--bs-emphasis-bg-rgb), var(--bs-bg-opacity)) !important;
}
.bg-opacity-10 {
  --bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;
  -moz-user-select: all !important;
  user-select: all !important;
}
.user-select-auto {
  -webkit-user-select: auto !important;
  -moz-user-select: auto !important;
  user-select: auto !important;
}
.user-select-none {
  -webkit-user-select: none !important;
  -moz-user-select: none !important;
  user-select: none !important;
}
.pe-none {
  pointer-events: none !important;
}
.pe-auto {
  pointer-events: auto !important;
}
.rounded {
  border-radius: var(--bs-border-radius) !important;
}
.rounded-0 {
  border-radius: 0 !important;
}
.rounded-1 {
  border-radius: var(--bs-border-radius-sm) !important;
}
.rounded-2 {
  border-radius: var(--bs-border-radius) !important;
}
.rounded-3 {
  border-radius: var(--bs-border-radius-lg) !important;
}
.rounded-4 {
  border-radius: var(--bs-border-radius-xl) !important;
}
.rounded-5 {
  border-radius: var(--bs-border-radius-2xl) !important;
}
.rounded-circle {
  border-radius: 50% !important;
}
.rounded-pill {
  border-radius: var(--bs-border-radius-pill) !important;
}
.rounded-top {
  border-top-left-radius: var(--bs-border-radius) !important;
  border-top-right-radius: var(--bs-border-radius) !important;
}
.rounded-top-0 {
  border-top-left-radius: 0 !important;
  border-top-right-radius: 0 !important;
}
.rounded-top-1 {
  border-top-left-radius: var(--bs-border-radius-sm) !important;
  border-top-right-radius: var(--bs-border-radius-sm) !important;
}
.rounded-top-2 {
  border-top-left-radius: var(--bs-border-radius) !important;
  border-top-right-radius: var(--bs-border-radius) !important;
}
.rounded-top-3 {
  border-top-left-radius: var(--bs-border-radius-lg) !important;
  border-top-right-radius: var(--bs-border-radius-lg) !important;
}
.rounded-top-4 {
  border-top-left-radius: var(--bs-border-radius-xl) !important;
  border-top-right-radius: var(--bs-border-radius-xl) !important;
}
.rounded-top-5 {
  border-top-left-radius: var(--bs-border-radius-2xl) !important;
  border-top-right-radius: var(--bs-border-radius-2xl) !important;
}
.rounded-top-circle {
  border-top-left-radius: 50% !important;
  border-top-right-radius: 50% !important;
}
.rounded-top-pill {
  border-top-left-radius: var(--bs-border-radius-pill) !important;
  border-top-right-radius: var(--bs-border-radius-pill) !important;
}
.rounded-end {
  border-top-right-radius: var(--bs-border-radius) !important;
  border-bottom-right-radius: var(--bs-border-radius) !important;
}
.rounded-end-0 {
  border-top-right-radius: 0 !important;
  border-bottom-right-radius: 0 !important;
}
.rounded-end-1 {
  border-top-right-radius: var(--bs-border-radius-sm) !important;
  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
}
.rounded-end-2 {
  border-top-right-radius: var(--bs-border-radius) !important;
  border-bottom-right-radius: var(--bs-border-radius) !important;
}
.rounded-end-3 {
  border-top-right-radius: var(--bs-border-radius-lg) !important;
  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
}
.rounded-end-4 {
  border-top-right-radius: var(--bs-border-radius-xl) !important;
  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
}
.rounded-end-5 {
  border-top-right-radius: var(--bs-border-radius-2xl) !important;
  border-bottom-right-radius: var(--bs-border-radius-2xl) !important;
}
.rounded-end-circle {
  border-top-right-radius: 50% !important;
  border-bottom-right-radius: 50% !important;
}
.rounded-end-pill {
  border-top-right-radius: var(--bs-border-radius-pill) !important;
  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
}
.rounded-bottom {
  border-bottom-right-radius: var(--bs-border-radius) !important;
  border-bottom-left-radius: var(--bs-border-radius) !important;
}
.rounded-bottom-0 {
  border-bottom-right-radius: 0 !important;
  border-bottom-left-radius: 0 !important;
}
.rounded-bottom-1 {
  border-bottom-right-radius: var(--bs-border-radius-sm) !important;
  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
}
.rounded-bottom-2 {
  border-bottom-right-radius: var(--bs-border-radius) !important;
  border-bottom-left-radius: var(--bs-border-radius) !important;
}
.rounded-bottom-3 {
  border-bottom-right-radius: var(--bs-border-radius-lg) !important;
  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
}
.rounded-bottom-4 {
  border-bottom-right-radius: var(--bs-border-radius-xl) !important;
  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
}
.rounded-bottom-5 {
  border-bottom-right-radius: var(--bs-border-radius-2xl) !important;
  border-bottom-left-radius: var(--bs-border-radius-2xl) !important;
}
.rounded-bottom-circle {
  border-bottom-right-radius: 50% !important;
  border-bottom-left-radius: 50% !important;
}
.rounded-bottom-pill {
  border-bottom-right-radius: var(--bs-border-radius-pill) !important;
  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
}
.rounded-start {
  border-bottom-left-radius: var(--bs-border-radius) !important;
  border-top-left-radius: var(--bs-border-radius) !important;
}
.rounded-start-0 {
  border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important;
}
.rounded-start-1 {
  border-bottom-left-radius: var(--bs-border-radius-sm) !important;
  border-top-left-radius: var(--bs-border-radius-sm) !important;
}
.rounded-start-2 {
  border-bottom-left-radius: var(--bs-border-radius) !important;
  border-top-left-radius: var(--bs-border-radius) !important;
}
.rounded-start-3 {
  border-bottom-left-radius: var(--bs-border-radius-lg) !important;
  border-top-left-radius: var(--bs-border-radius-lg) !important;
}
.rounded-start-4 {
  border-bottom-left-radius: var(--bs-border-radius-xl) !important;
  border-top-left-radius: var(--bs-border-radius-xl) !important;
}
.rounded-start-5 {
  border-bottom-left-radius: var(--bs-border-radius-2xl) !important;
  border-top-left-radius: var(--bs-border-radius-2xl) !important;
}
.rounded-start-circle {
  border-bottom-left-radius: 50% !important;
  border-top-left-radius: 50% !important;
}
.rounded-start-pill {
  border-bottom-left-radius: var(--bs-border-radius-pill) !important;
  border-top-left-radius: var(--bs-border-radius-pill) !important;
}
.visible {
  visibility: visible !important;
}
.invisible {
  visibility: hidden !important;
}
.z-n1 {
  z-index: -1 !important;
}
.z-0 {
  z-index: 0 !important;
}
.z-1 {
  z-index: 1 !important;
}
.z-2 {
  z-index: 2 !important;
}
.z-3 {
  z-index: 3 !important;
}
@media (min-width: 576px) {
  .float-sm-start {
    float: left !important;
  }
  .float-sm-end {
    float: right !important;
  }
  .float-sm-none {
    float: none !important;
  }
  .object-fit-sm-contain {
    -o-object-fit: contain !important;
    object-fit: contain !important;
  }
  .object-fit-sm-cover {
    -o-object-fit: cover !important;
    object-fit: cover !important;
  }
  .object-fit-sm-fill {
    -o-object-fit: fill !important;
    object-fit: fill !important;
  }
  .object-fit-sm-scale {
    -o-object-fit: scale-down !important;
    object-fit: scale-down !important;
  }
  .object-fit-sm-none {
    -o-object-fit: none !important;
    object-fit: none !important;
  }
  .d-sm-inline {
    display: inline !important;
  }
  .d-sm-inline-block {
    display: inline-block !important;
  }
  .d-sm-block {
    display: block !important;
  }
  .d-sm-grid {
    display: grid !important;
  }
  .d-sm-table {
    display: table !important;
  }
  .d-sm-table-row {
    display: table-row !important;
  }
  .d-sm-table-cell {
    display: table-cell !important;
  }
  .d-sm-flex {
    display: flex !important;
  }
  .d-sm-inline-flex {
    display: inline-flex !important;
  }
  .d-sm-none {
    display: none !important;
  }
  .flex-sm-fill {
    flex: 1 1 auto !important;
  }
  .flex-sm-row {
    flex-direction: row !important;
  }
  .flex-sm-column {
    flex-direction: column !important;
  }
  .flex-sm-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-sm-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-sm-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-sm-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-sm-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-sm-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-sm-wrap {
    flex-wrap: wrap !important;
  }
  .flex-sm-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-sm-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-sm-start {
    justify-content: flex-start !important;
  }
  .justify-content-sm-end {
    justify-content: flex-end !important;
  }
  .justify-content-sm-center {
    justify-content: center !important;
  }
  .justify-content-sm-between {
    justify-content: space-between !important;
  }
  .justify-content-sm-around {
    justify-content: space-around !important;
  }
  .justify-content-sm-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-sm-start {
    align-items: flex-start !important;
  }
  .align-items-sm-end {
    align-items: flex-end !important;
  }
  .align-items-sm-center {
    align-items: center !important;
  }
  .align-items-sm-baseline {
    align-items: baseline !important;
  }
  .align-items-sm-stretch {
    align-items: stretch !important;
  }
  .align-content-sm-start {
    align-content: flex-start !important;
  }
  .align-content-sm-end {
    align-content: flex-end !important;
  }
  .align-content-sm-center {
    align-content: center !important;
  }
  .align-content-sm-between {
    align-content: space-between !important;
  }
  .align-content-sm-around {
    align-content: space-around !important;
  }
  .align-content-sm-stretch {
    align-content: stretch !important;
  }
  .align-self-sm-auto {
    align-self: auto !important;
  }
  .align-self-sm-start {
    align-self: flex-start !important;
  }
  .align-self-sm-end {
    align-self: flex-end !important;
  }
  .align-self-sm-center {
    align-self: center !important;
  }
  .align-self-sm-baseline {
    align-self: baseline !important;
  }
  .align-self-sm-stretch {
    align-self: stretch !important;
  }
  .order-sm-first {
    order: -1 !important;
  }
  .order-sm-0 {
    order: 0 !important;
  }
  .order-sm-1 {
    order: 1 !important;
  }
  .order-sm-2 {
    order: 2 !important;
  }
  .order-sm-3 {
    order: 3 !important;
  }
  .order-sm-4 {
    order: 4 !important;
  }
  .order-sm-5 {
    order: 5 !important;
  }
  .order-sm-last {
    order: 6 !important;
  }
  .m-sm-0 {
    margin: 0 !important;
  }
  .m-sm-1 {
    margin: 0.25rem !important;
  }
  .m-sm-2 {
    margin: 0.5rem !important;
  }
  .m-sm-3 {
    margin: 1rem !important;
  }
  .m-sm-4 {
    margin: 1.5rem !important;
  }
  .m-sm-5 {
    margin: 3rem !important;
  }
  .m-sm-auto {
    margin: auto !important;
  }
  .mx-sm-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-sm-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-sm-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-sm-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-sm-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-sm-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-sm-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-sm-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-sm-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-sm-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-sm-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-sm-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-sm-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-sm-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-sm-0 {
    margin-top: 0 !important;
  }
  .mt-sm-1 {
    margin-top: 0.25rem !important;
  }
  .mt-sm-2 {
    margin-top: 0.5rem !important;
  }
  .mt-sm-3 {
    margin-top: 1rem !important;
  }
  .mt-sm-4 {
    margin-top: 1.5rem !important;
  }
  .mt-sm-5 {
    margin-top: 3rem !important;
  }
  .mt-sm-auto {
    margin-top: auto !important;
  }
  .me-sm-0 {
    margin-right: 0 !important;
  }
  .me-sm-1 {
    margin-right: 0.25rem !important;
  }
  .me-sm-2 {
    margin-right: 0.5rem !important;
  }
  .me-sm-3 {
    margin-right: 1rem !important;
  }
  .me-sm-4 {
    margin-right: 1.5rem !important;
  }
  .me-sm-5 {
    margin-right: 3rem !important;
  }
  .me-sm-auto {
    margin-right: auto !important;
  }
  .mb-sm-0 {
    margin-bottom: 0 !important;
  }
  .mb-sm-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-sm-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-sm-3 {
    margin-bottom: 1rem !important;
  }
  .mb-sm-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-sm-5 {
    margin-bottom: 3rem !important;
  }
  .mb-sm-auto {
    margin-bottom: auto !important;
  }
  .ms-sm-0 {
    margin-left: 0 !important;
  }
  .ms-sm-1 {
    margin-left: 0.25rem !important;
  }
  .ms-sm-2 {
    margin-left: 0.5rem !important;
  }
  .ms-sm-3 {
    margin-left: 1rem !important;
  }
  .ms-sm-4 {
    margin-left: 1.5rem !important;
  }
  .ms-sm-5 {
    margin-left: 3rem !important;
  }
  .ms-sm-auto {
    margin-left: auto !important;
  }
  .p-sm-0 {
    padding: 0 !important;
  }
  .p-sm-1 {
    padding: 0.25rem !important;
  }
  .p-sm-2 {
    padding: 0.5rem !important;
  }
  .p-sm-3 {
    padding: 1rem !important;
  }
  .p-sm-4 {
    padding: 1.5rem !important;
  }
  .p-sm-5 {
    padding: 3rem !important;
  }
  .px-sm-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-sm-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-sm-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-sm-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-sm-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-sm-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .py-sm-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-sm-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-sm-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-sm-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-sm-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-sm-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .pt-sm-0 {
    padding-top: 0 !important;
  }
  .pt-sm-1 {
    padding-top: 0.25rem !important;
  }
  .pt-sm-2 {
    padding-top: 0.5rem !important;
  }
  .pt-sm-3 {
    padding-top: 1rem !important;
  }
  .pt-sm-4 {
    padding-top: 1.5rem !important;
  }
  .pt-sm-5 {
    padding-top: 3rem !important;
  }
  .pe-sm-0 {
    padding-right: 0 !important;
  }
  .pe-sm-1 {
    padding-right: 0.25rem !important;
  }
  .pe-sm-2 {
    padding-right: 0.5rem !important;
  }
  .pe-sm-3 {
    padding-right: 1rem !important;
  }
  .pe-sm-4 {
    padding-right: 1.5rem !important;
  }
  .pe-sm-5 {
    padding-right: 3rem !important;
  }
  .pb-sm-0 {
    padding-bottom: 0 !important;
  }
  .pb-sm-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-sm-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-sm-3 {
    padding-bottom: 1rem !important;
  }
  .pb-sm-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-sm-5 {
    padding-bottom: 3rem !important;
  }
  .ps-sm-0 {
    padding-left: 0 !important;
  }
  .ps-sm-1 {
    padding-left: 0.25rem !important;
  }
  .ps-sm-2 {
    padding-left: 0.5rem !important;
  }
  .ps-sm-3 {
    padding-left: 1rem !important;
  }
  .ps-sm-4 {
    padding-left: 1.5rem !important;
  }
  .ps-sm-5 {
    padding-left: 3rem !important;
  }
  .gap-sm-0 {
    gap: 0 !important;
  }
  .gap-sm-1 {
    gap: 0.25rem !important;
  }
  .gap-sm-2 {
    gap: 0.5rem !important;
  }
  .gap-sm-3 {
    gap: 1rem !important;
  }
  .gap-sm-4 {
    gap: 1.5rem !important;
  }
  .gap-sm-5 {
    gap: 3rem !important;
  }
  .row-gap-sm-0 {
    row-gap: 0 !important;
  }
  .row-gap-sm-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-sm-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-sm-3 {
    row-gap: 1rem !important;
  }
  .row-gap-sm-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-sm-5 {
    row-gap: 3rem !important;
  }
  .column-gap-sm-0 {
    -moz-column-gap: 0 !important;
    column-gap: 0 !important;
  }
  .column-gap-sm-1 {
    -moz-column-gap: 0.25rem !important;
    column-gap: 0.25rem !important;
  }
  .column-gap-sm-2 {
    -moz-column-gap: 0.5rem !important;
    column-gap: 0.5rem !important;
  }
  .column-gap-sm-3 {
    -moz-column-gap: 1rem !important;
    column-gap: 1rem !important;
  }
  .column-gap-sm-4 {
    -moz-column-gap: 1.5rem !important;
    column-gap: 1.5rem !important;
  }
  .column-gap-sm-5 {
    -moz-column-gap: 3rem !important;
    column-gap: 3rem !important;
  }
  .text-sm-start {
    text-align: left !important;
  }
  .text-sm-end {
    text-align: right !important;
  }
  .text-sm-center {
    text-align: center !important;
  }
}
@media (min-width: 768px) {
  .float-md-start {
    float: left !important;
  }
  .float-md-end {
    float: right !important;
  }
  .float-md-none {
    float: none !important;
  }
  .object-fit-md-contain {
    -o-object-fit: contain !important;
    object-fit: contain !important;
  }
  .object-fit-md-cover {
    -o-object-fit: cover !important;
    object-fit: cover !important;
  }
  .object-fit-md-fill {
    -o-object-fit: fill !important;
    object-fit: fill !important;
  }
  .object-fit-md-scale {
    -o-object-fit: scale-down !important;
    object-fit: scale-down !important;
  }
  .object-fit-md-none {
    -o-object-fit: none !important;
    object-fit: none !important;
  }
  .d-md-inline {
    display: inline !important;
  }
  .d-md-inline-block {
    display: inline-block !important;
  }
  .d-md-block {
    display: block !important;
  }
  .d-md-grid {
    display: grid !important;
  }
  .d-md-table {
    display: table !important;
  }
  .d-md-table-row {
    display: table-row !important;
  }
  .d-md-table-cell {
    display: table-cell !important;
  }
  .d-md-flex {
    display: flex !important;
  }
  .d-md-inline-flex {
    display: inline-flex !important;
  }
  .d-md-none {
    display: none !important;
  }
  .flex-md-fill {
    flex: 1 1 auto !important;
  }
  .flex-md-row {
    flex-direction: row !important;
  }
  .flex-md-column {
    flex-direction: column !important;
  }
  .flex-md-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-md-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-md-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-md-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-md-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-md-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-md-wrap {
    flex-wrap: wrap !important;
  }
  .flex-md-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-md-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-md-start {
    justify-content: flex-start !important;
  }
  .justify-content-md-end {
    justify-content: flex-end !important;
  }
  .justify-content-md-center {
    justify-content: center !important;
  }
  .justify-content-md-between {
    justify-content: space-between !important;
  }
  .justify-content-md-around {
    justify-content: space-around !important;
  }
  .justify-content-md-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-md-start {
    align-items: flex-start !important;
  }
  .align-items-md-end {
    align-items: flex-end !important;
  }
  .align-items-md-center {
    align-items: center !important;
  }
  .align-items-md-baseline {
    align-items: baseline !important;
  }
  .align-items-md-stretch {
    align-items: stretch !important;
  }
  .align-content-md-start {
    align-content: flex-start !important;
  }
  .align-content-md-end {
    align-content: flex-end !important;
  }
  .align-content-md-center {
    align-content: center !important;
  }
  .align-content-md-between {
    align-content: space-between !important;
  }
  .align-content-md-around {
    align-content: space-around !important;
  }
  .align-content-md-stretch {
    align-content: stretch !important;
  }
  .align-self-md-auto {
    align-self: auto !important;
  }
  .align-self-md-start {
    align-self: flex-start !important;
  }
  .align-self-md-end {
    align-self: flex-end !important;
  }
  .align-self-md-center {
    align-self: center !important;
  }
  .align-self-md-baseline {
    align-self: baseline !important;
  }
  .align-self-md-stretch {
    align-self: stretch !important;
  }
  .order-md-first {
    order: -1 !important;
  }
  .order-md-0 {
    order: 0 !important;
  }
  .order-md-1 {
    order: 1 !important;
  }
  .order-md-2 {
    order: 2 !important;
  }
  .order-md-3 {
    order: 3 !important;
  }
  .order-md-4 {
    order: 4 !important;
  }
  .order-md-5 {
    order: 5 !important;
  }
  .order-md-last {
    order: 6 !important;
  }
  .m-md-0 {
    margin: 0 !important;
  }
  .m-md-1 {
    margin: 0.25rem !important;
  }
  .m-md-2 {
    margin: 0.5rem !important;
  }
  .m-md-3 {
    margin: 1rem !important;
  }
  .m-md-4 {
    margin: 1.5rem !important;
  }
  .m-md-5 {
    margin: 3rem !important;
  }
  .m-md-auto {
    margin: auto !important;
  }
  .mx-md-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-md-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-md-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-md-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-md-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-md-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-md-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-md-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-md-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-md-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-md-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-md-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-md-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-md-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-md-0 {
    margin-top: 0 !important;
  }
  .mt-md-1 {
    margin-top: 0.25rem !important;
  }
  .mt-md-2 {
    margin-top: 0.5rem !important;
  }
  .mt-md-3 {
    margin-top: 1rem !important;
  }
  .mt-md-4 {
    margin-top: 1.5rem !important;
  }
  .mt-md-5 {
    margin-top: 3rem !important;
  }
  .mt-md-auto {
    margin-top: auto !important;
  }
  .me-md-0 {
    margin-right: 0 !important;
  }
  .me-md-1 {
    margin-right: 0.25rem !important;
  }
  .me-md-2 {
    margin-right: 0.5rem !important;
  }
  .me-md-3 {
    margin-right: 1rem !important;
  }
  .me-md-4 {
    margin-right: 1.5rem !important;
  }
  .me-md-5 {
    margin-right: 3rem !important;
  }
  .me-md-auto {
    margin-right: auto !important;
  }
  .mb-md-0 {
    margin-bottom: 0 !important;
  }
  .mb-md-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-md-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-md-3 {
    margin-bottom: 1rem !important;
  }
  .mb-md-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-md-5 {
    margin-bottom: 3rem !important;
  }
  .mb-md-auto {
    margin-bottom: auto !important;
  }
  .ms-md-0 {
    margin-left: 0 !important;
  }
  .ms-md-1 {
    margin-left: 0.25rem !important;
  }
  .ms-md-2 {
    margin-left: 0.5rem !important;
  }
  .ms-md-3 {
    margin-left: 1rem !important;
  }
  .ms-md-4 {
    margin-left: 1.5rem !important;
  }
  .ms-md-5 {
    margin-left: 3rem !important;
  }
  .ms-md-auto {
    margin-left: auto !important;
  }
  .p-md-0 {
    padding: 0 !important;
  }
  .p-md-1 {
    padding: 0.25rem !important;
  }
  .p-md-2 {
    padding: 0.5rem !important;
  }
  .p-md-3 {
    padding: 1rem !important;
  }
  .p-md-4 {
    padding: 1.5rem !important;
  }
  .p-md-5 {
    padding: 3rem !important;
  }
  .px-md-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-md-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-md-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-md-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-md-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-md-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .py-md-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-md-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-md-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-md-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-md-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-md-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .pt-md-0 {
    padding-top: 0 !important;
  }
  .pt-md-1 {
    padding-top: 0.25rem !important;
  }
  .pt-md-2 {
    padding-top: 0.5rem !important;
  }
  .pt-md-3 {
    padding-top: 1rem !important;
  }
  .pt-md-4 {
    padding-top: 1.5rem !important;
  }
  .pt-md-5 {
    padding-top: 3rem !important;
  }
  .pe-md-0 {
    padding-right: 0 !important;
  }
  .pe-md-1 {
    padding-right: 0.25rem !important;
  }
  .pe-md-2 {
    padding-right: 0.5rem !important;
  }
  .pe-md-3 {
    padding-right: 1rem !important;
  }
  .pe-md-4 {
    padding-right: 1.5rem !important;
  }
  .pe-md-5 {
    padding-right: 3rem !important;
  }
  .pb-md-0 {
    padding-bottom: 0 !important;
  }
  .pb-md-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-md-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-md-3 {
    padding-bottom: 1rem !important;
  }
  .pb-md-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-md-5 {
    padding-bottom: 3rem !important;
  }
  .ps-md-0 {
    padding-left: 0 !important;
  }
  .ps-md-1 {
    padding-left: 0.25rem !important;
  }
  .ps-md-2 {
    padding-left: 0.5rem !important;
  }
  .ps-md-3 {
    padding-left: 1rem !important;
  }
  .ps-md-4 {
    padding-left: 1.5rem !important;
  }
  .ps-md-5 {
    padding-left: 3rem !important;
  }
  .gap-md-0 {
    gap: 0 !important;
  }
  .gap-md-1 {
    gap: 0.25rem !important;
  }
  .gap-md-2 {
    gap: 0.5rem !important;
  }
  .gap-md-3 {
    gap: 1rem !important;
  }
  .gap-md-4 {
    gap: 1.5rem !important;
  }
  .gap-md-5 {
    gap: 3rem !important;
  }
  .row-gap-md-0 {
    row-gap: 0 !important;
  }
  .row-gap-md-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-md-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-md-3 {
    row-gap: 1rem !important;
  }
  .row-gap-md-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-md-5 {
    row-gap: 3rem !important;
  }
  .column-gap-md-0 {
    -moz-column-gap: 0 !important;
    column-gap: 0 !important;
  }
  .column-gap-md-1 {
    -moz-column-gap: 0.25rem !important;
    column-gap: 0.25rem !important;
  }
  .column-gap-md-2 {
    -moz-column-gap: 0.5rem !important;
    column-gap: 0.5rem !important;
  }
  .column-gap-md-3 {
    -moz-column-gap: 1rem !important;
    column-gap: 1rem !important;
  }
  .column-gap-md-4 {
    -moz-column-gap: 1.5rem !important;
    column-gap: 1.5rem !important;
  }
  .column-gap-md-5 {
    -moz-column-gap: 3rem !important;
    column-gap: 3rem !important;
  }
  .text-md-start {
    text-align: left !important;
  }
  .text-md-end {
    text-align: right !important;
  }
  .text-md-center {
    text-align: center !important;
  }
}
@media (min-width: 992px) {
  .float-lg-start {
    float: left !important;
  }
  .float-lg-end {
    float: right !important;
  }
  .float-lg-none {
    float: none !important;
  }
  .object-fit-lg-contain {
    -o-object-fit: contain !important;
    object-fit: contain !important;
  }
  .object-fit-lg-cover {
    -o-object-fit: cover !important;
    object-fit: cover !important;
  }
  .object-fit-lg-fill {
    -o-object-fit: fill !important;
    object-fit: fill !important;
  }
  .object-fit-lg-scale {
    -o-object-fit: scale-down !important;
    object-fit: scale-down !important;
  }
  .object-fit-lg-none {
    -o-object-fit: none !important;
    object-fit: none !important;
  }
  .d-lg-inline {
    display: inline !important;
  }
  .d-lg-inline-block {
    display: inline-block !important;
  }
  .d-lg-block {
    display: block !important;
  }
  .d-lg-grid {
    display: grid !important;
  }
  .d-lg-table {
    display: table !important;
  }
  .d-lg-table-row {
    display: table-row !important;
  }
  .d-lg-table-cell {
    display: table-cell !important;
  }
  .d-lg-flex {
    display: flex !important;
  }
  .d-lg-inline-flex {
    display: inline-flex !important;
  }
  .d-lg-none {
    display: none !important;
  }
  .flex-lg-fill {
    flex: 1 1 auto !important;
  }
  .flex-lg-row {
    flex-direction: row !important;
  }
  .flex-lg-column {
    flex-direction: column !important;
  }
  .flex-lg-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-lg-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-lg-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-lg-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-lg-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-lg-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-lg-wrap {
    flex-wrap: wrap !important;
  }
  .flex-lg-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-lg-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-lg-start {
    justify-content: flex-start !important;
  }
  .justify-content-lg-end {
    justify-content: flex-end !important;
  }
  .justify-content-lg-center {
    justify-content: center !important;
  }
  .justify-content-lg-between {
    justify-content: space-between !important;
  }
  .justify-content-lg-around {
    justify-content: space-around !important;
  }
  .justify-content-lg-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-lg-start {
    align-items: flex-start !important;
  }
  .align-items-lg-end {
    align-items: flex-end !important;
  }
  .align-items-lg-center {
    align-items: center !important;
  }
  .align-items-lg-baseline {
    align-items: baseline !important;
  }
  .align-items-lg-stretch {
    align-items: stretch !important;
  }
  .align-content-lg-start {
    align-content: flex-start !important;
  }
  .align-content-lg-end {
    align-content: flex-end !important;
  }
  .align-content-lg-center {
    align-content: center !important;
  }
  .align-content-lg-between {
    align-content: space-between !important;
  }
  .align-content-lg-around {
    align-content: space-around !important;
  }
  .align-content-lg-stretch {
    align-content: stretch !important;
  }
  .align-self-lg-auto {
    align-self: auto !important;
  }
  .align-self-lg-start {
    align-self: flex-start !important;
  }
  .align-self-lg-end {
    align-self: flex-end !important;
  }
  .align-self-lg-center {
    align-self: center !important;
  }
  .align-self-lg-baseline {
    align-self: baseline !important;
  }
  .align-self-lg-stretch {
    align-self: stretch !important;
  }
  .order-lg-first {
    order: -1 !important;
  }
  .order-lg-0 {
    order: 0 !important;
  }
  .order-lg-1 {
    order: 1 !important;
  }
  .order-lg-2 {
    order: 2 !important;
  }
  .order-lg-3 {
    order: 3 !important;
  }
  .order-lg-4 {
    order: 4 !important;
  }
  .order-lg-5 {
    order: 5 !important;
  }
  .order-lg-last {
    order: 6 !important;
  }
  .m-lg-0 {
    margin: 0 !important;
  }
  .m-lg-1 {
    margin: 0.25rem !important;
  }
  .m-lg-2 {
    margin: 0.5rem !important;
  }
  .m-lg-3 {
    margin: 1rem !important;
  }
  .m-lg-4 {
    margin: 1.5rem !important;
  }
  .m-lg-5 {
    margin: 3rem !important;
  }
  .m-lg-auto {
    margin: auto !important;
  }
  .mx-lg-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-lg-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-lg-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-lg-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-lg-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-lg-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-lg-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-lg-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-lg-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-lg-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-lg-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-lg-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-lg-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-lg-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-lg-0 {
    margin-top: 0 !important;
  }
  .mt-lg-1 {
    margin-top: 0.25rem !important;
  }
  .mt-lg-2 {
    margin-top: 0.5rem !important;
  }
  .mt-lg-3 {
    margin-top: 1rem !important;
  }
  .mt-lg-4 {
    margin-top: 1.5rem !important;
  }
  .mt-lg-5 {
    margin-top: 3rem !important;
  }
  .mt-lg-auto {
    margin-top: auto !important;
  }
  .me-lg-0 {
    margin-right: 0 !important;
  }
  .me-lg-1 {
    margin-right: 0.25rem !important;
  }
  .me-lg-2 {
    margin-right: 0.5rem !important;
  }
  .me-lg-3 {
    margin-right: 1rem !important;
  }
  .me-lg-4 {
    margin-right: 1.5rem !important;
  }
  .me-lg-5 {
    margin-right: 3rem !important;
  }
  .me-lg-auto {
    margin-right: auto !important;
  }
  .mb-lg-0 {
    margin-bottom: 0 !important;
  }
  .mb-lg-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-lg-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-lg-3 {
    margin-bottom: 1rem !important;
  }
  .mb-lg-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-lg-5 {
    margin-bottom: 3rem !important;
  }
  .mb-lg-auto {
    margin-bottom: auto !important;
  }
  .ms-lg-0 {
    margin-left: 0 !important;
  }
  .ms-lg-1 {
    margin-left: 0.25rem !important;
  }
  .ms-lg-2 {
    margin-left: 0.5rem !important;
  }
  .ms-lg-3 {
    margin-left: 1rem !important;
  }
  .ms-lg-4 {
    margin-left: 1.5rem !important;
  }
  .ms-lg-5 {
    margin-left: 3rem !important;
  }
  .ms-lg-auto {
    margin-left: auto !important;
  }
  .p-lg-0 {
    padding: 0 !important;
  }
  .p-lg-1 {
    padding: 0.25rem !important;
  }
  .p-lg-2 {
    padding: 0.5rem !important;
  }
  .p-lg-3 {
    padding: 1rem !important;
  }
  .p-lg-4 {
    padding: 1.5rem !important;
  }
  .p-lg-5 {
    padding: 3rem !important;
  }
  .px-lg-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-lg-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-lg-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-lg-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-lg-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-lg-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .py-lg-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-lg-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-lg-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-lg-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-lg-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-lg-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .pt-lg-0 {
    padding-top: 0 !important;
  }
  .pt-lg-1 {
    padding-top: 0.25rem !important;
  }
  .pt-lg-2 {
    padding-top: 0.5rem !important;
  }
  .pt-lg-3 {
    padding-top: 1rem !important;
  }
  .pt-lg-4 {
    padding-top: 1.5rem !important;
  }
  .pt-lg-5 {
    padding-top: 3rem !important;
  }
  .pe-lg-0 {
    padding-right: 0 !important;
  }
  .pe-lg-1 {
    padding-right: 0.25rem !important;
  }
  .pe-lg-2 {
    padding-right: 0.5rem !important;
  }
  .pe-lg-3 {
    padding-right: 1rem !important;
  }
  .pe-lg-4 {
    padding-right: 1.5rem !important;
  }
  .pe-lg-5 {
    padding-right: 3rem !important;
  }
  .pb-lg-0 {
    padding-bottom: 0 !important;
  }
  .pb-lg-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-lg-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-lg-3 {
    padding-bottom: 1rem !important;
  }
  .pb-lg-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-lg-5 {
    padding-bottom: 3rem !important;
  }
  .ps-lg-0 {
    padding-left: 0 !important;
  }
  .ps-lg-1 {
    padding-left: 0.25rem !important;
  }
  .ps-lg-2 {
    padding-left: 0.5rem !important;
  }
  .ps-lg-3 {
    padding-left: 1rem !important;
  }
  .ps-lg-4 {
    padding-left: 1.5rem !important;
  }
  .ps-lg-5 {
    padding-left: 3rem !important;
  }
  .gap-lg-0 {
    gap: 0 !important;
  }
  .gap-lg-1 {
    gap: 0.25rem !important;
  }
  .gap-lg-2 {
    gap: 0.5rem !important;
  }
  .gap-lg-3 {
    gap: 1rem !important;
  }
  .gap-lg-4 {
    gap: 1.5rem !important;
  }
  .gap-lg-5 {
    gap: 3rem !important;
  }
  .row-gap-lg-0 {
    row-gap: 0 !important;
  }
  .row-gap-lg-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-lg-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-lg-3 {
    row-gap: 1rem !important;
  }
  .row-gap-lg-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-lg-5 {
    row-gap: 3rem !important;
  }
  .column-gap-lg-0 {
    -moz-column-gap: 0 !important;
    column-gap: 0 !important;
  }
  .column-gap-lg-1 {
    -moz-column-gap: 0.25rem !important;
    column-gap: 0.25rem !important;
  }
  .column-gap-lg-2 {
    -moz-column-gap: 0.5rem !important;
    column-gap: 0.5rem !important;
  }
  .column-gap-lg-3 {
    -moz-column-gap: 1rem !important;
    column-gap: 1rem !important;
  }
  .column-gap-lg-4 {
    -moz-column-gap: 1.5rem !important;
    column-gap: 1.5rem !important;
  }
  .column-gap-lg-5 {
    -moz-column-gap: 3rem !important;
    column-gap: 3rem !important;
  }
  .text-lg-start {
    text-align: left !important;
  }
  .text-lg-end {
    text-align: right !important;
  }
  .text-lg-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .float-xl-start {
    float: left !important;
  }
  .float-xl-end {
    float: right !important;
  }
  .float-xl-none {
    float: none !important;
  }
  .object-fit-xl-contain {
    -o-object-fit: contain !important;
    object-fit: contain !important;
  }
  .object-fit-xl-cover {
    -o-object-fit: cover !important;
    object-fit: cover !important;
  }
  .object-fit-xl-fill {
    -o-object-fit: fill !important;
    object-fit: fill !important;
  }
  .object-fit-xl-scale {
    -o-object-fit: scale-down !important;
    object-fit: scale-down !important;
  }
  .object-fit-xl-none {
    -o-object-fit: none !important;
    object-fit: none !important;
  }
  .d-xl-inline {
    display: inline !important;
  }
  .d-xl-inline-block {
    display: inline-block !important;
  }
  .d-xl-block {
    display: block !important;
  }
  .d-xl-grid {
    display: grid !important;
  }
  .d-xl-table {
    display: table !important;
  }
  .d-xl-table-row {
    display: table-row !important;
  }
  .d-xl-table-cell {
    display: table-cell !important;
  }
  .d-xl-flex {
    display: flex !important;
  }
  .d-xl-inline-flex {
    display: inline-flex !important;
  }
  .d-xl-none {
    display: none !important;
  }
  .flex-xl-fill {
    flex: 1 1 auto !important;
  }
  .flex-xl-row {
    flex-direction: row !important;
  }
  .flex-xl-column {
    flex-direction: column !important;
  }
  .flex-xl-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-xl-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-xl-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-xl-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-xl-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-xl-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-xl-wrap {
    flex-wrap: wrap !important;
  }
  .flex-xl-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-xl-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-xl-start {
    justify-content: flex-start !important;
  }
  .justify-content-xl-end {
    justify-content: flex-end !important;
  }
  .justify-content-xl-center {
    justify-content: center !important;
  }
  .justify-content-xl-between {
    justify-content: space-between !important;
  }
  .justify-content-xl-around {
    justify-content: space-around !important;
  }
  .justify-content-xl-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-xl-start {
    align-items: flex-start !important;
  }
  .align-items-xl-end {
    align-items: flex-end !important;
  }
  .align-items-xl-center {
    align-items: center !important;
  }
  .align-items-xl-baseline {
    align-items: baseline !important;
  }
  .align-items-xl-stretch {
    align-items: stretch !important;
  }
  .align-content-xl-start {
    align-content: flex-start !important;
  }
  .align-content-xl-end {
    align-content: flex-end !important;
  }
  .align-content-xl-center {
    align-content: center !important;
  }
  .align-content-xl-between {
    align-content: space-between !important;
  }
  .align-content-xl-around {
    align-content: space-around !important;
  }
  .align-content-xl-stretch {
    align-content: stretch !important;
  }
  .align-self-xl-auto {
    align-self: auto !important;
  }
  .align-self-xl-start {
    align-self: flex-start !important;
  }
  .align-self-xl-end {
    align-self: flex-end !important;
  }
  .align-self-xl-center {
    align-self: center !important;
  }
  .align-self-xl-baseline {
    align-self: baseline !important;
  }
  .align-self-xl-stretch {
    align-self: stretch !important;
  }
  .order-xl-first {
    order: -1 !important;
  }
  .order-xl-0 {
    order: 0 !important;
  }
  .order-xl-1 {
    order: 1 !important;
  }
  .order-xl-2 {
    order: 2 !important;
  }
  .order-xl-3 {
    order: 3 !important;
  }
  .order-xl-4 {
    order: 4 !important;
  }
  .order-xl-5 {
    order: 5 !important;
  }
  .order-xl-last {
    order: 6 !important;
  }
  .m-xl-0 {
    margin: 0 !important;
  }
  .m-xl-1 {
    margin: 0.25rem !important;
  }
  .m-xl-2 {
    margin: 0.5rem !important;
  }
  .m-xl-3 {
    margin: 1rem !important;
  }
  .m-xl-4 {
    margin: 1.5rem !important;
  }
  .m-xl-5 {
    margin: 3rem !important;
  }
  .m-xl-auto {
    margin: auto !important;
  }
  .mx-xl-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-xl-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-xl-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-xl-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-xl-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-xl-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-xl-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-xl-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-xl-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-xl-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-xl-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-xl-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-xl-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-xl-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-xl-0 {
    margin-top: 0 !important;
  }
  .mt-xl-1 {
    margin-top: 0.25rem !important;
  }
  .mt-xl-2 {
    margin-top: 0.5rem !important;
  }
  .mt-xl-3 {
    margin-top: 1rem !important;
  }
  .mt-xl-4 {
    margin-top: 1.5rem !important;
  }
  .mt-xl-5 {
    margin-top: 3rem !important;
  }
  .mt-xl-auto {
    margin-top: auto !important;
  }
  .me-xl-0 {
    margin-right: 0 !important;
  }
  .me-xl-1 {
    margin-right: 0.25rem !important;
  }
  .me-xl-2 {
    margin-right: 0.5rem !important;
  }
  .me-xl-3 {
    margin-right: 1rem !important;
  }
  .me-xl-4 {
    margin-right: 1.5rem !important;
  }
  .me-xl-5 {
    margin-right: 3rem !important;
  }
  .me-xl-auto {
    margin-right: auto !important;
  }
  .mb-xl-0 {
    margin-bottom: 0 !important;
  }
  .mb-xl-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-xl-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-xl-3 {
    margin-bottom: 1rem !important;
  }
  .mb-xl-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-xl-5 {
    margin-bottom: 3rem !important;
  }
  .mb-xl-auto {
    margin-bottom: auto !important;
  }
  .ms-xl-0 {
    margin-left: 0 !important;
  }
  .ms-xl-1 {
    margin-left: 0.25rem !important;
  }
  .ms-xl-2 {
    margin-left: 0.5rem !important;
  }
  .ms-xl-3 {
    margin-left: 1rem !important;
  }
  .ms-xl-4 {
    margin-left: 1.5rem !important;
  }
  .ms-xl-5 {
    margin-left: 3rem !important;
  }
  .ms-xl-auto {
    margin-left: auto !important;
  }
  .p-xl-0 {
    padding: 0 !important;
  }
  .p-xl-1 {
    padding: 0.25rem !important;
  }
  .p-xl-2 {
    padding: 0.5rem !important;
  }
  .p-xl-3 {
    padding: 1rem !important;
  }
  .p-xl-4 {
    padding: 1.5rem !important;
  }
  .p-xl-5 {
    padding: 3rem !important;
  }
  .px-xl-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-xl-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-xl-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-xl-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-xl-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-xl-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .py-xl-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-xl-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-xl-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-xl-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-xl-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-xl-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .pt-xl-0 {
    padding-top: 0 !important;
  }
  .pt-xl-1 {
    padding-top: 0.25rem !important;
  }
  .pt-xl-2 {
    padding-top: 0.5rem !important;
  }
  .pt-xl-3 {
    padding-top: 1rem !important;
  }
  .pt-xl-4 {
    padding-top: 1.5rem !important;
  }
  .pt-xl-5 {
    padding-top: 3rem !important;
  }
  .pe-xl-0 {
    padding-right: 0 !important;
  }
  .pe-xl-1 {
    padding-right: 0.25rem !important;
  }
  .pe-xl-2 {
    padding-right: 0.5rem !important;
  }
  .pe-xl-3 {
    padding-right: 1rem !important;
  }
  .pe-xl-4 {
    padding-right: 1.5rem !important;
  }
  .pe-xl-5 {
    padding-right: 3rem !important;
  }
  .pb-xl-0 {
    padding-bottom: 0 !important;
  }
  .pb-xl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-xl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-xl-3 {
    padding-bottom: 1rem !important;
  }
  .pb-xl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-xl-5 {
    padding-bottom: 3rem !important;
  }
  .ps-xl-0 {
    padding-left: 0 !important;
  }
  .ps-xl-1 {
    padding-left: 0.25rem !important;
  }
  .ps-xl-2 {
    padding-left: 0.5rem !important;
  }
  .ps-xl-3 {
    padding-left: 1rem !important;
  }
  .ps-xl-4 {
    padding-left: 1.5rem !important;
  }
  .ps-xl-5 {
    padding-left: 3rem !important;
  }
  .gap-xl-0 {
    gap: 0 !important;
  }
  .gap-xl-1 {
    gap: 0.25rem !important;
  }
  .gap-xl-2 {
    gap: 0.5rem !important;
  }
  .gap-xl-3 {
    gap: 1rem !important;
  }
  .gap-xl-4 {
    gap: 1.5rem !important;
  }
  .gap-xl-5 {
    gap: 3rem !important;
  }
  .row-gap-xl-0 {
    row-gap: 0 !important;
  }
  .row-gap-xl-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-xl-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-xl-3 {
    row-gap: 1rem !important;
  }
  .row-gap-xl-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-xl-5 {
    row-gap: 3rem !important;
  }
  .column-gap-xl-0 {
    -moz-column-gap: 0 !important;
    column-gap: 0 !important;
  }
  .column-gap-xl-1 {
    -moz-column-gap: 0.25rem !important;
    column-gap: 0.25rem !important;
  }
  .column-gap-xl-2 {
    -moz-column-gap: 0.5rem !important;
    column-gap: 0.5rem !important;
  }
  .column-gap-xl-3 {
    -moz-column-gap: 1rem !important;
    column-gap: 1rem !important;
  }
  .column-gap-xl-4 {
    -moz-column-gap: 1.5rem !important;
    column-gap: 1.5rem !important;
  }
  .column-gap-xl-5 {
    -moz-column-gap: 3rem !important;
    column-gap: 3rem !important;
  }
  .text-xl-start {
    text-align: left !important;
  }
  .text-xl-end {
    text-align: right !important;
  }
  .text-xl-center {
    text-align: center !important;
  }
}
@media (min-width: 1400px) {
  .float-xxl-start {
    float: left !important;
  }
  .float-xxl-end {
    float: right !important;
  }
  .float-xxl-none {
    float: none !important;
  }
  .object-fit-xxl-contain {
    -o-object-fit: contain !important;
    object-fit: contain !important;
  }
  .object-fit-xxl-cover {
    -o-object-fit: cover !important;
    object-fit: cover !important;
  }
  .object-fit-xxl-fill {
    -o-object-fit: fill !important;
    object-fit: fill !important;
  }
  .object-fit-xxl-scale {
    -o-object-fit: scale-down !important;
    object-fit: scale-down !important;
  }
  .object-fit-xxl-none {
    -o-object-fit: none !important;
    object-fit: none !important;
  }
  .d-xxl-inline {
    display: inline !important;
  }
  .d-xxl-inline-block {
    display: inline-block !important;
  }
  .d-xxl-block {
    display: block !important;
  }
  .d-xxl-grid {
    display: grid !important;
  }
  .d-xxl-table {
    display: table !important;
  }
  .d-xxl-table-row {
    display: table-row !important;
  }
  .d-xxl-table-cell {
    display: table-cell !important;
  }
  .d-xxl-flex {
    display: flex !important;
  }
  .d-xxl-inline-flex {
    display: inline-flex !important;
  }
  .d-xxl-none {
    display: none !important;
  }
  .flex-xxl-fill {
    flex: 1 1 auto !important;
  }
  .flex-xxl-row {
    flex-direction: row !important;
  }
  .flex-xxl-column {
    flex-direction: column !important;
  }
  .flex-xxl-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-xxl-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-xxl-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-xxl-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-xxl-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-xxl-shrink-1 {
    flex-shrink: 1 !important;
  }
  .flex-xxl-wrap {
    flex-wrap: wrap !important;
  }
  .flex-xxl-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-xxl-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .justify-content-xxl-start {
    justify-content: flex-start !important;
  }
  .justify-content-xxl-end {
    justify-content: flex-end !important;
  }
  .justify-content-xxl-center {
    justify-content: center !important;
  }
  .justify-content-xxl-between {
    justify-content: space-between !important;
  }
  .justify-content-xxl-around {
    justify-content: space-around !important;
  }
  .justify-content-xxl-evenly {
    justify-content: space-evenly !important;
  }
  .align-items-xxl-start {
    align-items: flex-start !important;
  }
  .align-items-xxl-end {
    align-items: flex-end !important;
  }
  .align-items-xxl-center {
    align-items: center !important;
  }
  .align-items-xxl-baseline {
    align-items: baseline !important;
  }
  .align-items-xxl-stretch {
    align-items: stretch !important;
  }
  .align-content-xxl-start {
    align-content: flex-start !important;
  }
  .align-content-xxl-end {
    align-content: flex-end !important;
  }
  .align-content-xxl-center {
    align-content: center !important;
  }
  .align-content-xxl-between {
    align-content: space-between !important;
  }
  .align-content-xxl-around {
    align-content: space-around !important;
  }
  .align-content-xxl-stretch {
    align-content: stretch !important;
  }
  .align-self-xxl-auto {
    align-self: auto !important;
  }
  .align-self-xxl-start {
    align-self: flex-start !important;
  }
  .align-self-xxl-end {
    align-self: flex-end !important;
  }
  .align-self-xxl-center {
    align-self: center !important;
  }
  .align-self-xxl-baseline {
    align-self: baseline !important;
  }
  .align-self-xxl-stretch {
    align-self: stretch !important;
  }
  .order-xxl-first {
    order: -1 !important;
  }
  .order-xxl-0 {
    order: 0 !important;
  }
  .order-xxl-1 {
    order: 1 !important;
  }
  .order-xxl-2 {
    order: 2 !important;
  }
  .order-xxl-3 {
    order: 3 !important;
  }
  .order-xxl-4 {
    order: 4 !important;
  }
  .order-xxl-5 {
    order: 5 !important;
  }
  .order-xxl-last {
    order: 6 !important;
  }
  .m-xxl-0 {
    margin: 0 !important;
  }
  .m-xxl-1 {
    margin: 0.25rem !important;
  }
  .m-xxl-2 {
    margin: 0.5rem !important;
  }
  .m-xxl-3 {
    margin: 1rem !important;
  }
  .m-xxl-4 {
    margin: 1.5rem !important;
  }
  .m-xxl-5 {
    margin: 3rem !important;
  }
  .m-xxl-auto {
    margin: auto !important;
  }
  .mx-xxl-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
  .mx-xxl-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
  }
  .mx-xxl-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
  }
  .mx-xxl-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
  }
  .mx-xxl-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
  }
  .mx-xxl-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
  }
  .mx-xxl-auto {
    margin-right: auto !important;
    margin-left: auto !important;
  }
  .my-xxl-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
  }
  .my-xxl-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
  }
  .my-xxl-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
  }
  .my-xxl-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
  }
  .my-xxl-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
  }
  .my-xxl-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
  }
  .my-xxl-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
  }
  .mt-xxl-0 {
    margin-top: 0 !important;
  }
  .mt-xxl-1 {
    margin-top: 0.25rem !important;
  }
  .mt-xxl-2 {
    margin-top: 0.5rem !important;
  }
  .mt-xxl-3 {
    margin-top: 1rem !important;
  }
  .mt-xxl-4 {
    margin-top: 1.5rem !important;
  }
  .mt-xxl-5 {
    margin-top: 3rem !important;
  }
  .mt-xxl-auto {
    margin-top: auto !important;
  }
  .me-xxl-0 {
    margin-right: 0 !important;
  }
  .me-xxl-1 {
    margin-right: 0.25rem !important;
  }
  .me-xxl-2 {
    margin-right: 0.5rem !important;
  }
  .me-xxl-3 {
    margin-right: 1rem !important;
  }
  .me-xxl-4 {
    margin-right: 1.5rem !important;
  }
  .me-xxl-5 {
    margin-right: 3rem !important;
  }
  .me-xxl-auto {
    margin-right: auto !important;
  }
  .mb-xxl-0 {
    margin-bottom: 0 !important;
  }
  .mb-xxl-1 {
    margin-bottom: 0.25rem !important;
  }
  .mb-xxl-2 {
    margin-bottom: 0.5rem !important;
  }
  .mb-xxl-3 {
    margin-bottom: 1rem !important;
  }
  .mb-xxl-4 {
    margin-bottom: 1.5rem !important;
  }
  .mb-xxl-5 {
    margin-bottom: 3rem !important;
  }
  .mb-xxl-auto {
    margin-bottom: auto !important;
  }
  .ms-xxl-0 {
    margin-left: 0 !important;
  }
  .ms-xxl-1 {
    margin-left: 0.25rem !important;
  }
  .ms-xxl-2 {
    margin-left: 0.5rem !important;
  }
  .ms-xxl-3 {
    margin-left: 1rem !important;
  }
  .ms-xxl-4 {
    margin-left: 1.5rem !important;
  }
  .ms-xxl-5 {
    margin-left: 3rem !important;
  }
  .ms-xxl-auto {
    margin-left: auto !important;
  }
  .p-xxl-0 {
    padding: 0 !important;
  }
  .p-xxl-1 {
    padding: 0.25rem !important;
  }
  .p-xxl-2 {
    padding: 0.5rem !important;
  }
  .p-xxl-3 {
    padding: 1rem !important;
  }
  .p-xxl-4 {
    padding: 1.5rem !important;
  }
  .p-xxl-5 {
    padding: 3rem !important;
  }
  .px-xxl-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
  }
  .px-xxl-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
  }
  .px-xxl-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
  }
  .px-xxl-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
  }
  .px-xxl-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
  }
  .px-xxl-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
  }
  .py-xxl-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
  }
  .py-xxl-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
  }
  .py-xxl-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
  }
  .py-xxl-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
  }
  .py-xxl-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
  }
  .py-xxl-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
  }
  .pt-xxl-0 {
    padding-top: 0 !important;
  }
  .pt-xxl-1 {
    padding-top: 0.25rem !important;
  }
  .pt-xxl-2 {
    padding-top: 0.5rem !important;
  }
  .pt-xxl-3 {
    padding-top: 1rem !important;
  }
  .pt-xxl-4 {
    padding-top: 1.5rem !important;
  }
  .pt-xxl-5 {
    padding-top: 3rem !important;
  }
  .pe-xxl-0 {
    padding-right: 0 !important;
  }
  .pe-xxl-1 {
    padding-right: 0.25rem !important;
  }
  .pe-xxl-2 {
    padding-right: 0.5rem !important;
  }
  .pe-xxl-3 {
    padding-right: 1rem !important;
  }
  .pe-xxl-4 {
    padding-right: 1.5rem !important;
  }
  .pe-xxl-5 {
    padding-right: 3rem !important;
  }
  .pb-xxl-0 {
    padding-bottom: 0 !important;
  }
  .pb-xxl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pb-xxl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pb-xxl-3 {
    padding-bottom: 1rem !important;
  }
  .pb-xxl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pb-xxl-5 {
    padding-bottom: 3rem !important;
  }
  .ps-xxl-0 {
    padding-left: 0 !important;
  }
  .ps-xxl-1 {
    padding-left: 0.25rem !important;
  }
  .ps-xxl-2 {
    padding-left: 0.5rem !important;
  }
  .ps-xxl-3 {
    padding-left: 1rem !important;
  }
  .ps-xxl-4 {
    padding-left: 1.5rem !important;
  }
  .ps-xxl-5 {
    padding-left: 3rem !important;
  }
  .gap-xxl-0 {
    gap: 0 !important;
  }
  .gap-xxl-1 {
    gap: 0.25rem !important;
  }
  .gap-xxl-2 {
    gap: 0.5rem !important;
  }
  .gap-xxl-3 {
    gap: 1rem !important;
  }
  .gap-xxl-4 {
    gap: 1.5rem !important;
  }
  .gap-xxl-5 {
    gap: 3rem !important;
  }
  .row-gap-xxl-0 {
    row-gap: 0 !important;
  }
  .row-gap-xxl-1 {
    row-gap: 0.25rem !important;
  }
  .row-gap-xxl-2 {
    row-gap: 0.5rem !important;
  }
  .row-gap-xxl-3 {
    row-gap: 1rem !important;
  }
  .row-gap-xxl-4 {
    row-gap: 1.5rem !important;
  }
  .row-gap-xxl-5 {
    row-gap: 3rem !important;
  }
  .column-gap-xxl-0 {
    -moz-column-gap: 0 !important;
    column-gap: 0 !important;
  }
  .column-gap-xxl-1 {
    -moz-column-gap: 0.25rem !important;
    column-gap: 0.25rem !important;
  }
  .column-gap-xxl-2 {
    -moz-column-gap: 0.5rem !important;
    column-gap: 0.5rem !important;
  }
  .column-gap-xxl-3 {
    -moz-column-gap: 1rem !important;
    column-gap: 1rem !important;
  }
  .column-gap-xxl-4 {
    -moz-column-gap: 1.5rem !important;
    column-gap: 1.5rem !important;
  }
  .column-gap-xxl-5 {
    -moz-column-gap: 3rem !important;
    column-gap: 3rem !important;
  }
  .text-xxl-start {
    text-align: left !important;
  }
  .text-xxl-end {
    text-align: right !important;
  }
  .text-xxl-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .fs-1 {
    font-size: 2.5rem !important;
  }
  .fs-2 {
    font-size: 2rem !important;
  }
  .fs-3 {
    font-size: 1.75rem !important;
  }
  .fs-4 {
    font-size: 1.5rem !important;
  }
}
@media print {
  .d-print-inline {
    display: inline !important;
  }
  .d-print-inline-block {
    display: inline-block !important;
  }
  .d-print-block {
    display: block !important;
  }
  .d-print-grid {
    display: grid !important;
  }
  .d-print-table {
    display: table !important;
  }
  .d-print-table-row {
    display: table-row !important;
  }
  .d-print-table-cell {
    display: table-cell !important;
  }
  .d-print-flex {
    display: flex !important;
  }
  .d-print-inline-flex {
    display: inline-flex !important;
  }
  .d-print-none {
    display: none !important;
  }
}
/*# sourceMappingURL=bootstrap.min.css.map */
:root {
  --font-family: "Open Sans", sans-serif;
  --times-new-roman: "Times New Roman";
  --blue:$blue;
  --light-blue: $lightblue;
}
header#header .custom-logo {
  max-width: 100%;
  max-height: 100%;
  width: auto !important;
  height: auto !important;
}
@media (max-width: 992px) {
  nav#nav {
    margin-left: -30px;
    margin-right: -30px;
    display: none;
  }
  nav#nav ul {
    list-style-type: none;
    padding: 0;
    margin: 0;
  }
  nav#nav > div > ul {
    background-color: #222;
    font-size: 0;
  }
  nav#nav > div > ul > li {
    font-size: 1rem;
  }
  nav#nav > div > ul > li > a {
    color: #fff;
    display: block;
    padding: 10px 12px;
    border-bottom: 1px solid #151515;
  }
  nav#nav > div > ul > li > a:any-link {
    color: #fff;
    text-decoration: none;
  }
}
@media (min-width: 992px) {
  nav#nav {
    border-top: 1px solid #555;
    border-bottom: 1px solid #555;
    box-shadow: 0 -5px 5px rgba(0, 0, 0, 0.4);
    text-transform: uppercase;
  }
  nav#nav ul {
    list-style-type: none;
    padding: 0;
    margin: 0;
  }
  nav#nav > div > ul {
    background-color: #222;
    font-size: 0;
  }
  nav#nav > div > ul > li {
    font-size: 1rem;
    display: inline-block;
  }
  nav#nav > div > ul > li > a {
    color: #fff;
    display: block;
    padding: 8px 12px;
  }
  nav#nav > div > ul > li > a:any-link {
    color: #fff;
    text-decoration: none;
  }
}
#mobile-menu {
  border-top: 1px solid #555;
  border-bottom: 1px solid #555;
  box-shadow: 0 -5px 5px rgba(0, 0, 0, 0.4);
  text-transform: uppercase;
  background-color: #141514;
  margin-left: -30px;
  margin-right: -30px;
  cursor: pointer;
}
#mobile-menu > div > span {
  background-color: #28282A;
}
#mobile-menu > div > span > span {
  transform: scale(1, 0.9);
}
#mobile-menu > div > span > span > span {
  background-color: rgba(255, 255, 255, 0.65);
}
footer#footer {
  background-color: #111011;
  color: #fff;
  border-top: 5px solid #000;
  margin-left: -15px;
  margin-right: -15px;
}
@media (min-width: 992px) {
  footer#footer {
    margin-left: -1.5rem !important;
    margin-right: -1.5rem !important;
  }
}
footer#footer a {
  text-decoration: none;
}
footer#footer a:link, footer#footer a:visited, footer#footer a:hover, footer#footer a:active {
  text-decoration: none;
}
footer#footer .social a {
  background-color: #28282A;
  color: #fff;
  height: 45px;
  width: 45px;
  display: inline-block;
  text-align: Center;
  line-height: 45px;
  font-size: 1.25rem;
  transition: all 0.25s;
}
footer#footer .social a:link, footer#footer .social a:visited {
  background-color: #28282A;
  color: #fff;
  height: 45px;
  width: 45px;
  display: inline-block;
  text-align: Center;
  line-height: 45px;
  font-size: 1.25rem;
  transition: all 0.25s;
}
footer#footer .social a:hover, footer#footer .social a:active {
  color: #fff;
  height: 45px;
  width: 45px;
  display: inline-block;
  text-align: Center;
  line-height: 45px;
  font-size: 1.25rem;
  background-color: #aa1d1b;
}
html, body {
  width: 100%;
  overflow-x: hidden;
}
body {
  font-family: var(--font-family);
  background-color: #3B3B3C;
  background-image: url(https://foxwoodkennels.com/wp-content/themes/foxwood/assets/css/../../../../uploads/2024/01/foxwood-background.jpg);
}
.container, .container-lg {
  width: 100%;
  max-width: initial !important;
}
@media (min-width: 992px) {
  .container, .container-lg {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
}
#wrapper {
  width: 100%;
  overflow-x: hidden;
  background-color: #28292B;
  max-width: 1200px;
  padding-left: 25px;
  padding-right: 25px;
  margin-left: auto;
  margin-right: auto;
}
.text-blue {
  color: #194B79 !important;
}
.text-light-blue {
  color: #02A6E1 !important;
}
.text-dark-blue {
  color: #10314f !important;
}
.btn {
  border-radius: 20px;
}
.btn.btn-sm {
  border-radius: 16px;
}
.bg-black {
  background-color: #111110 !important;
}
.bg-black:hover, .bg-black:active, .bg-black:focus {
  background-color: #111110 !important;
}
.bg-blue {
  background-color: #194B79 !important;
}
.bg-blue:hover, .bg-blue:active, .bg-blue:focus {
  background-color: #153e64;
}
.bg-dark-blue {
  background-color: #10314f !important;
}
.bg-dark-blue:hover, .bg-dark-blue:active, .bg-dark-blue:focus {
  background-color: #10314f;
}
.bg-light-blue {
  background-color: #02A6E1 !important;
}
.bg-light-blue:hover, .bg-light-blue:active, .bg-light-blue:focus {
  background-color: #0293c8;
}
.font-times-new-roman {
  font-family: var(--times-new-roman);
}
a:not([class*="button"], [class*="btn"]):link, a:not([class*="button"], [class*="btn"]):visited {
  color: #194B79;
  text-decoration: underline;
}
a:not([class*="button"], [class*="btn"]):hover, a:not([class*="button"], [class*="btn"]):active {
  color: #194B79;
  text-decoration: underline;
}
[class*="button"], [class*="btn"] {
  text-decoration: none !important;
}
body:not(.page, .home) main#main {
  padding-top: 1rem;
  padding-bottom: 1rem;
}
[class*="w-xl-"], [class*="w-lg-"], [class*="w-md"], [class*="w-sm-"] {
  width: initial;
}
[class*="h-xl-"], [class*="h-lg-"], [class*="h-md"], [class*="h-sm-"] {
  height: initial;
}
.w-1-px {
  width: 1px;
}
.h-1-px {
  height: 1px;
}
.w-1-perc {
  width: 1%;;
}
.h-1-perc {
  height: 1%;;
}
.w-2-px {
  width: 2px;
}
.h-2-px {
  height: 2px;
}
.w-2-perc {
  width: 2%;;
}
.h-2-perc {
  height: 2%;;
}
.w-3-px {
  width: 3px;
}
.h-3-px {
  height: 3px;
}
.w-3-perc {
  width: 3%;;
}
.h-3-perc {
  height: 3%;;
}
.w-4-px {
  width: 4px;
}
.h-4-px {
  height: 4px;
}
.w-4-perc {
  width: 4%;;
}
.h-4-perc {
  height: 4%;;
}
.w-5-px {
  width: 5px;
}
.h-5-px {
  height: 5px;
}
.w-5-perc {
  width: 5%;;
}
.h-5-perc {
  height: 5%;;
}
.w-6-px {
  width: 6px;
}
.h-6-px {
  height: 6px;
}
.w-6-perc {
  width: 6%;;
}
.h-6-perc {
  height: 6%;;
}
.w-7-px {
  width: 7px;
}
.h-7-px {
  height: 7px;
}
.w-7-perc {
  width: 7%;;
}
.h-7-perc {
  height: 7%;;
}
.w-8-px {
  width: 8px;
}
.h-8-px {
  height: 8px;
}
.w-8-perc {
  width: 8%;;
}
.h-8-perc {
  height: 8%;;
}
.w-9-px {
  width: 9px;
}
.h-9-px {
  height: 9px;
}
.w-9-perc {
  width: 9%;;
}
.h-9-perc {
  height: 9%;;
}
.w-10-px {
  width: 10px;
}
.h-10-px {
  height: 10px;
}
.w-10-perc {
  width: 10%;;
}
.h-10-perc {
  height: 10%;;
}
.w-11-px {
  width: 11px;
}
.h-11-px {
  height: 11px;
}
.w-11-perc {
  width: 11%;;
}
.h-11-perc {
  height: 11%;;
}
.w-12-px {
  width: 12px;
}
.h-12-px {
  height: 12px;
}
.w-12-perc {
  width: 12%;;
}
.h-12-perc {
  height: 12%;;
}
.w-13-px {
  width: 13px;
}
.h-13-px {
  height: 13px;
}
.w-13-perc {
  width: 13%;;
}
.h-13-perc {
  height: 13%;;
}
.w-14-px {
  width: 14px;
}
.h-14-px {
  height: 14px;
}
.w-14-perc {
  width: 14%;;
}
.h-14-perc {
  height: 14%;;
}
.w-15-px {
  width: 15px;
}
.h-15-px {
  height: 15px;
}
.w-15-perc {
  width: 15%;;
}
.h-15-perc {
  height: 15%;;
}
.w-16-px {
  width: 16px;
}
.h-16-px {
  height: 16px;
}
.w-16-perc {
  width: 16%;;
}
.h-16-perc {
  height: 16%;;
}
.w-17-px {
  width: 17px;
}
.h-17-px {
  height: 17px;
}
.w-17-perc {
  width: 17%;;
}
.h-17-perc {
  height: 17%;;
}
.w-18-px {
  width: 18px;
}
.h-18-px {
  height: 18px;
}
.w-18-perc {
  width: 18%;;
}
.h-18-perc {
  height: 18%;;
}
.w-19-px {
  width: 19px;
}
.h-19-px {
  height: 19px;
}
.w-19-perc {
  width: 19%;;
}
.h-19-perc {
  height: 19%;;
}
.w-20-px {
  width: 20px;
}
.h-20-px {
  height: 20px;
}
.w-20-perc {
  width: 20%;;
}
.h-20-perc {
  height: 20%;;
}
.w-21-px {
  width: 21px;
}
.h-21-px {
  height: 21px;
}
.w-21-perc {
  width: 21%;;
}
.h-21-perc {
  height: 21%;;
}
.w-22-px {
  width: 22px;
}
.h-22-px {
  height: 22px;
}
.w-22-perc {
  width: 22%;;
}
.h-22-perc {
  height: 22%;;
}
.w-23-px {
  width: 23px;
}
.h-23-px {
  height: 23px;
}
.w-23-perc {
  width: 23%;;
}
.h-23-perc {
  height: 23%;;
}
.w-24-px {
  width: 24px;
}
.h-24-px {
  height: 24px;
}
.w-24-perc {
  width: 24%;;
}
.h-24-perc {
  height: 24%;;
}
.w-25-px {
  width: 25px;
}
.h-25-px {
  height: 25px;
}
.w-25-perc {
  width: 25%;;
}
.h-25-perc {
  height: 25%;;
}
.w-26-px {
  width: 26px;
}
.h-26-px {
  height: 26px;
}
.w-26-perc {
  width: 26%;;
}
.h-26-perc {
  height: 26%;;
}
.w-27-px {
  width: 27px;
}
.h-27-px {
  height: 27px;
}
.w-27-perc {
  width: 27%;;
}
.h-27-perc {
  height: 27%;;
}
.w-28-px {
  width: 28px;
}
.h-28-px {
  height: 28px;
}
.w-28-perc {
  width: 28%;;
}
.h-28-perc {
  height: 28%;;
}
.w-29-px {
  width: 29px;
}
.h-29-px {
  height: 29px;
}
.w-29-perc {
  width: 29%;;
}
.h-29-perc {
  height: 29%;;
}
.w-30-px {
  width: 30px;
}
.h-30-px {
  height: 30px;
}
.w-30-perc {
  width: 30%;;
}
.h-30-perc {
  height: 30%;;
}
.w-31-px {
  width: 31px;
}
.h-31-px {
  height: 31px;
}
.w-31-perc {
  width: 31%;;
}
.h-31-perc {
  height: 31%;;
}
.w-32-px {
  width: 32px;
}
.h-32-px {
  height: 32px;
}
.w-32-perc {
  width: 32%;;
}
.h-32-perc {
  height: 32%;;
}
.w-33-px {
  width: 33px;
}
.h-33-px {
  height: 33px;
}
.w-33-perc {
  width: 33%;;
}
.h-33-perc {
  height: 33%;;
}
.w-34-px {
  width: 34px;
}
.h-34-px {
  height: 34px;
}
.w-34-perc {
  width: 34%;;
}
.h-34-perc {
  height: 34%;;
}
.w-35-px {
  width: 35px;
}
.h-35-px {
  height: 35px;
}
.w-35-perc {
  width: 35%;;
}
.h-35-perc {
  height: 35%;;
}
.w-36-px {
  width: 36px;
}
.h-36-px {
  height: 36px;
}
.w-36-perc {
  width: 36%;;
}
.h-36-perc {
  height: 36%;;
}
.w-37-px {
  width: 37px;
}
.h-37-px {
  height: 37px;
}
.w-37-perc {
  width: 37%;;
}
.h-37-perc {
  height: 37%;;
}
.w-38-px {
  width: 38px;
}
.h-38-px {
  height: 38px;
}
.w-38-perc {
  width: 38%;;
}
.h-38-perc {
  height: 38%;;
}
.w-39-px {
  width: 39px;
}
.h-39-px {
  height: 39px;
}
.w-39-perc {
  width: 39%;;
}
.h-39-perc {
  height: 39%;;
}
.w-40-px {
  width: 40px;
}
.h-40-px {
  height: 40px;
}
.w-40-perc {
  width: 40%;;
}
.h-40-perc {
  height: 40%;;
}
.w-41-px {
  width: 41px;
}
.h-41-px {
  height: 41px;
}
.w-41-perc {
  width: 41%;;
}
.h-41-perc {
  height: 41%;;
}
.w-42-px {
  width: 42px;
}
.h-42-px {
  height: 42px;
}
.w-42-perc {
  width: 42%;;
}
.h-42-perc {
  height: 42%;;
}
.w-43-px {
  width: 43px;
}
.h-43-px {
  height: 43px;
}
.w-43-perc {
  width: 43%;;
}
.h-43-perc {
  height: 43%;;
}
.w-44-px {
  width: 44px;
}
.h-44-px {
  height: 44px;
}
.w-44-perc {
  width: 44%;;
}
.h-44-perc {
  height: 44%;;
}
.w-45-px {
  width: 45px;
}
.h-45-px {
  height: 45px;
}
.w-45-perc {
  width: 45%;;
}
.h-45-perc {
  height: 45%;;
}
.w-46-px {
  width: 46px;
}
.h-46-px {
  height: 46px;
}
.w-46-perc {
  width: 46%;;
}
.h-46-perc {
  height: 46%;;
}
.w-47-px {
  width: 47px;
}
.h-47-px {
  height: 47px;
}
.w-47-perc {
  width: 47%;;
}
.h-47-perc {
  height: 47%;;
}
.w-48-px {
  width: 48px;
}
.h-48-px {
  height: 48px;
}
.w-48-perc {
  width: 48%;;
}
.h-48-perc {
  height: 48%;;
}
.w-49-px {
  width: 49px;
}
.h-49-px {
  height: 49px;
}
.w-49-perc {
  width: 49%;;
}
.h-49-perc {
  height: 49%;;
}
.w-50-px {
  width: 50px;
}
.h-50-px {
  height: 50px;
}
.w-50-perc {
  width: 50%;;
}
.h-50-perc {
  height: 50%;;
}
.w-51-px {
  width: 51px;
}
.h-51-px {
  height: 51px;
}
.w-51-perc {
  width: 51%;;
}
.h-51-perc {
  height: 51%;;
}
.w-52-px {
  width: 52px;
}
.h-52-px {
  height: 52px;
}
.w-52-perc {
  width: 52%;;
}
.h-52-perc {
  height: 52%;;
}
.w-53-px {
  width: 53px;
}
.h-53-px {
  height: 53px;
}
.w-53-perc {
  width: 53%;;
}
.h-53-perc {
  height: 53%;;
}
.w-54-px {
  width: 54px;
}
.h-54-px {
  height: 54px;
}
.w-54-perc {
  width: 54%;;
}
.h-54-perc {
  height: 54%;;
}
.w-55-px {
  width: 55px;
}
.h-55-px {
  height: 55px;
}
.w-55-perc {
  width: 55%;;
}
.h-55-perc {
  height: 55%;;
}
.w-56-px {
  width: 56px;
}
.h-56-px {
  height: 56px;
}
.w-56-perc {
  width: 56%;;
}
.h-56-perc {
  height: 56%;;
}
.w-57-px {
  width: 57px;
}
.h-57-px {
  height: 57px;
}
.w-57-perc {
  width: 57%;;
}
.h-57-perc {
  height: 57%;;
}
.w-58-px {
  width: 58px;
}
.h-58-px {
  height: 58px;
}
.w-58-perc {
  width: 58%;;
}
.h-58-perc {
  height: 58%;;
}
.w-59-px {
  width: 59px;
}
.h-59-px {
  height: 59px;
}
.w-59-perc {
  width: 59%;;
}
.h-59-perc {
  height: 59%;;
}
.w-60-px {
  width: 60px;
}
.h-60-px {
  height: 60px;
}
.w-60-perc {
  width: 60%;;
}
.h-60-perc {
  height: 60%;;
}
.w-61-px {
  width: 61px;
}
.h-61-px {
  height: 61px;
}
.w-61-perc {
  width: 61%;;
}
.h-61-perc {
  height: 61%;;
}
.w-62-px {
  width: 62px;
}
.h-62-px {
  height: 62px;
}
.w-62-perc {
  width: 62%;;
}
.h-62-perc {
  height: 62%;;
}
.w-63-px {
  width: 63px;
}
.h-63-px {
  height: 63px;
}
.w-63-perc {
  width: 63%;;
}
.h-63-perc {
  height: 63%;;
}
.w-64-px {
  width: 64px;
}
.h-64-px {
  height: 64px;
}
.w-64-perc {
  width: 64%;;
}
.h-64-perc {
  height: 64%;;
}
.w-65-px {
  width: 65px;
}
.h-65-px {
  height: 65px;
}
.w-65-perc {
  width: 65%;;
}
.h-65-perc {
  height: 65%;;
}
.w-66-px {
  width: 66px;
}
.h-66-px {
  height: 66px;
}
.w-66-perc {
  width: 66%;;
}
.h-66-perc {
  height: 66%;;
}
.w-67-px {
  width: 67px;
}
.h-67-px {
  height: 67px;
}
.w-67-perc {
  width: 67%;;
}
.h-67-perc {
  height: 67%;;
}
.w-68-px {
  width: 68px;
}
.h-68-px {
  height: 68px;
}
.w-68-perc {
  width: 68%;;
}
.h-68-perc {
  height: 68%;;
}
.w-69-px {
  width: 69px;
}
.h-69-px {
  height: 69px;
}
.w-69-perc {
  width: 69%;;
}
.h-69-perc {
  height: 69%;;
}
.w-70-px {
  width: 70px;
}
.h-70-px {
  height: 70px;
}
.w-70-perc {
  width: 70%;;
}
.h-70-perc {
  height: 70%;;
}
.w-71-px {
  width: 71px;
}
.h-71-px {
  height: 71px;
}
.w-71-perc {
  width: 71%;;
}
.h-71-perc {
  height: 71%;;
}
.w-72-px {
  width: 72px;
}
.h-72-px {
  height: 72px;
}
.w-72-perc {
  width: 72%;;
}
.h-72-perc {
  height: 72%;;
}
.w-73-px {
  width: 73px;
}
.h-73-px {
  height: 73px;
}
.w-73-perc {
  width: 73%;;
}
.h-73-perc {
  height: 73%;;
}
.w-74-px {
  width: 74px;
}
.h-74-px {
  height: 74px;
}
.w-74-perc {
  width: 74%;;
}
.h-74-perc {
  height: 74%;;
}
.w-75-px {
  width: 75px;
}
.h-75-px {
  height: 75px;
}
.w-75-perc {
  width: 75%;;
}
.h-75-perc {
  height: 75%;;
}
.w-76-px {
  width: 76px;
}
.h-76-px {
  height: 76px;
}
.w-76-perc {
  width: 76%;;
}
.h-76-perc {
  height: 76%;;
}
.w-77-px {
  width: 77px;
}
.h-77-px {
  height: 77px;
}
.w-77-perc {
  width: 77%;;
}
.h-77-perc {
  height: 77%;;
}
.w-78-px {
  width: 78px;
}
.h-78-px {
  height: 78px;
}
.w-78-perc {
  width: 78%;;
}
.h-78-perc {
  height: 78%;;
}
.w-79-px {
  width: 79px;
}
.h-79-px {
  height: 79px;
}
.w-79-perc {
  width: 79%;;
}
.h-79-perc {
  height: 79%;;
}
.w-80-px {
  width: 80px;
}
.h-80-px {
  height: 80px;
}
.w-80-perc {
  width: 80%;;
}
.h-80-perc {
  height: 80%;;
}
.w-81-px {
  width: 81px;
}
.h-81-px {
  height: 81px;
}
.w-81-perc {
  width: 81%;;
}
.h-81-perc {
  height: 81%;;
}
.w-82-px {
  width: 82px;
}
.h-82-px {
  height: 82px;
}
.w-82-perc {
  width: 82%;;
}
.h-82-perc {
  height: 82%;;
}
.w-83-px {
  width: 83px;
}
.h-83-px {
  height: 83px;
}
.w-83-perc {
  width: 83%;;
}
.h-83-perc {
  height: 83%;;
}
.w-84-px {
  width: 84px;
}
.h-84-px {
  height: 84px;
}
.w-84-perc {
  width: 84%;;
}
.h-84-perc {
  height: 84%;;
}
.w-85-px {
  width: 85px;
}
.h-85-px {
  height: 85px;
}
.w-85-perc {
  width: 85%;;
}
.h-85-perc {
  height: 85%;;
}
.w-86-px {
  width: 86px;
}
.h-86-px {
  height: 86px;
}
.w-86-perc {
  width: 86%;;
}
.h-86-perc {
  height: 86%;;
}
.w-87-px {
  width: 87px;
}
.h-87-px {
  height: 87px;
}
.w-87-perc {
  width: 87%;;
}
.h-87-perc {
  height: 87%;;
}
.w-88-px {
  width: 88px;
}
.h-88-px {
  height: 88px;
}
.w-88-perc {
  width: 88%;;
}
.h-88-perc {
  height: 88%;;
}
.w-89-px {
  width: 89px;
}
.h-89-px {
  height: 89px;
}
.w-89-perc {
  width: 89%;;
}
.h-89-perc {
  height: 89%;;
}
.w-90-px {
  width: 90px;
}
.h-90-px {
  height: 90px;
}
.w-90-perc {
  width: 90%;;
}
.h-90-perc {
  height: 90%;;
}
.w-91-px {
  width: 91px;
}
.h-91-px {
  height: 91px;
}
.w-91-perc {
  width: 91%;;
}
.h-91-perc {
  height: 91%;;
}
.w-92-px {
  width: 92px;
}
.h-92-px {
  height: 92px;
}
.w-92-perc {
  width: 92%;;
}
.h-92-perc {
  height: 92%;;
}
.w-93-px {
  width: 93px;
}
.h-93-px {
  height: 93px;
}
.w-93-perc {
  width: 93%;;
}
.h-93-perc {
  height: 93%;;
}
.w-94-px {
  width: 94px;
}
.h-94-px {
  height: 94px;
}
.w-94-perc {
  width: 94%;;
}
.h-94-perc {
  height: 94%;;
}
.w-95-px {
  width: 95px;
}
.h-95-px {
  height: 95px;
}
.w-95-perc {
  width: 95%;;
}
.h-95-perc {
  height: 95%;;
}
.w-96-px {
  width: 96px;
}
.h-96-px {
  height: 96px;
}
.w-96-perc {
  width: 96%;;
}
.h-96-perc {
  height: 96%;;
}
.w-97-px {
  width: 97px;
}
.h-97-px {
  height: 97px;
}
.w-97-perc {
  width: 97%;;
}
.h-97-perc {
  height: 97%;;
}
.w-98-px {
  width: 98px;
}
.h-98-px {
  height: 98px;
}
.w-98-perc {
  width: 98%;;
}
.h-98-perc {
  height: 98%;;
}
.w-99-px {
  width: 99px;
}
.h-99-px {
  height: 99px;
}
.w-99-perc {
  width: 99%;;
}
.h-99-perc {
  height: 99%;;
}
.w-100-px {
  width: 100px;
}
.h-100-px {
  height: 100px;
}
.w-100-perc {
  width: 100%;;
}
.h-100-perc {
  height: 100%;;
}
.w-101-px {
  width: 101px;
}
.h-101-px {
  height: 101px;
}
.w-101-perc {
  width: 101%;;
}
.h-101-perc {
  height: 101%;;
}
.w-102-px {
  width: 102px;
}
.h-102-px {
  height: 102px;
}
.w-102-perc {
  width: 102%;;
}
.h-102-perc {
  height: 102%;;
}
.w-103-px {
  width: 103px;
}
.h-103-px {
  height: 103px;
}
.w-103-perc {
  width: 103%;;
}
.h-103-perc {
  height: 103%;;
}
.w-104-px {
  width: 104px;
}
.h-104-px {
  height: 104px;
}
.w-104-perc {
  width: 104%;;
}
.h-104-perc {
  height: 104%;;
}
.w-105-px {
  width: 105px;
}
.h-105-px {
  height: 105px;
}
.w-105-perc {
  width: 105%;;
}
.h-105-perc {
  height: 105%;;
}
.w-106-px {
  width: 106px;
}
.h-106-px {
  height: 106px;
}
.w-106-perc {
  width: 106%;;
}
.h-106-perc {
  height: 106%;;
}
.w-107-px {
  width: 107px;
}
.h-107-px {
  height: 107px;
}
.w-107-perc {
  width: 107%;;
}
.h-107-perc {
  height: 107%;;
}
.w-108-px {
  width: 108px;
}
.h-108-px {
  height: 108px;
}
.w-108-perc {
  width: 108%;;
}
.h-108-perc {
  height: 108%;;
}
.w-109-px {
  width: 109px;
}
.h-109-px {
  height: 109px;
}
.w-109-perc {
  width: 109%;;
}
.h-109-perc {
  height: 109%;;
}
.w-110-px {
  width: 110px;
}
.h-110-px {
  height: 110px;
}
.w-110-perc {
  width: 110%;;
}
.h-110-perc {
  height: 110%;;
}
.w-111-px {
  width: 111px;
}
.h-111-px {
  height: 111px;
}
.w-111-perc {
  width: 111%;;
}
.h-111-perc {
  height: 111%;;
}
.w-112-px {
  width: 112px;
}
.h-112-px {
  height: 112px;
}
.w-112-perc {
  width: 112%;;
}
.h-112-perc {
  height: 112%;;
}
.w-113-px {
  width: 113px;
}
.h-113-px {
  height: 113px;
}
.w-113-perc {
  width: 113%;;
}
.h-113-perc {
  height: 113%;;
}
.w-114-px {
  width: 114px;
}
.h-114-px {
  height: 114px;
}
.w-114-perc {
  width: 114%;;
}
.h-114-perc {
  height: 114%;;
}
.w-115-px {
  width: 115px;
}
.h-115-px {
  height: 115px;
}
.w-115-perc {
  width: 115%;;
}
.h-115-perc {
  height: 115%;;
}
.w-116-px {
  width: 116px;
}
.h-116-px {
  height: 116px;
}
.w-116-perc {
  width: 116%;;
}
.h-116-perc {
  height: 116%;;
}
.w-117-px {
  width: 117px;
}
.h-117-px {
  height: 117px;
}
.w-117-perc {
  width: 117%;;
}
.h-117-perc {
  height: 117%;;
}
.w-118-px {
  width: 118px;
}
.h-118-px {
  height: 118px;
}
.w-118-perc {
  width: 118%;;
}
.h-118-perc {
  height: 118%;;
}
.w-119-px {
  width: 119px;
}
.h-119-px {
  height: 119px;
}
.w-119-perc {
  width: 119%;;
}
.h-119-perc {
  height: 119%;;
}
.w-120-px {
  width: 120px;
}
.h-120-px {
  height: 120px;
}
.w-120-perc {
  width: 120%;;
}
.h-120-perc {
  height: 120%;;
}
.w-121-px {
  width: 121px;
}
.h-121-px {
  height: 121px;
}
.w-121-perc {
  width: 121%;;
}
.h-121-perc {
  height: 121%;;
}
.w-122-px {
  width: 122px;
}
.h-122-px {
  height: 122px;
}
.w-122-perc {
  width: 122%;;
}
.h-122-perc {
  height: 122%;;
}
.w-123-px {
  width: 123px;
}
.h-123-px {
  height: 123px;
}
.w-123-perc {
  width: 123%;;
}
.h-123-perc {
  height: 123%;;
}
.w-124-px {
  width: 124px;
}
.h-124-px {
  height: 124px;
}
.w-124-perc {
  width: 124%;;
}
.h-124-perc {
  height: 124%;;
}
.w-125-px {
  width: 125px;
}
.h-125-px {
  height: 125px;
}
.w-125-perc {
  width: 125%;;
}
.h-125-perc {
  height: 125%;;
}
.w-126-px {
  width: 126px;
}
.h-126-px {
  height: 126px;
}
.w-126-perc {
  width: 126%;;
}
.h-126-perc {
  height: 126%;;
}
.w-127-px {
  width: 127px;
}
.h-127-px {
  height: 127px;
}
.w-127-perc {
  width: 127%;;
}
.h-127-perc {
  height: 127%;;
}
.w-128-px {
  width: 128px;
}
.h-128-px {
  height: 128px;
}
.w-128-perc {
  width: 128%;;
}
.h-128-perc {
  height: 128%;;
}
.w-129-px {
  width: 129px;
}
.h-129-px {
  height: 129px;
}
.w-129-perc {
  width: 129%;;
}
.h-129-perc {
  height: 129%;;
}
.w-130-px {
  width: 130px;
}
.h-130-px {
  height: 130px;
}
.w-130-perc {
  width: 130%;;
}
.h-130-perc {
  height: 130%;;
}
.w-131-px {
  width: 131px;
}
.h-131-px {
  height: 131px;
}
.w-131-perc {
  width: 131%;;
}
.h-131-perc {
  height: 131%;;
}
.w-132-px {
  width: 132px;
}
.h-132-px {
  height: 132px;
}
.w-132-perc {
  width: 132%;;
}
.h-132-perc {
  height: 132%;;
}
.w-133-px {
  width: 133px;
}
.h-133-px {
  height: 133px;
}
.w-133-perc {
  width: 133%;;
}
.h-133-perc {
  height: 133%;;
}
.w-134-px {
  width: 134px;
}
.h-134-px {
  height: 134px;
}
.w-134-perc {
  width: 134%;;
}
.h-134-perc {
  height: 134%;;
}
.w-135-px {
  width: 135px;
}
.h-135-px {
  height: 135px;
}
.w-135-perc {
  width: 135%;;
}
.h-135-perc {
  height: 135%;;
}
.w-136-px {
  width: 136px;
}
.h-136-px {
  height: 136px;
}
.w-136-perc {
  width: 136%;;
}
.h-136-perc {
  height: 136%;;
}
.w-137-px {
  width: 137px;
}
.h-137-px {
  height: 137px;
}
.w-137-perc {
  width: 137%;;
}
.h-137-perc {
  height: 137%;;
}
.w-138-px {
  width: 138px;
}
.h-138-px {
  height: 138px;
}
.w-138-perc {
  width: 138%;;
}
.h-138-perc {
  height: 138%;;
}
.w-139-px {
  width: 139px;
}
.h-139-px {
  height: 139px;
}
.w-139-perc {
  width: 139%;;
}
.h-139-perc {
  height: 139%;;
}
.w-140-px {
  width: 140px;
}
.h-140-px {
  height: 140px;
}
.w-140-perc {
  width: 140%;;
}
.h-140-perc {
  height: 140%;;
}
.w-141-px {
  width: 141px;
}
.h-141-px {
  height: 141px;
}
.w-141-perc {
  width: 141%;;
}
.h-141-perc {
  height: 141%;;
}
.w-142-px {
  width: 142px;
}
.h-142-px {
  height: 142px;
}
.w-142-perc {
  width: 142%;;
}
.h-142-perc {
  height: 142%;;
}
.w-143-px {
  width: 143px;
}
.h-143-px {
  height: 143px;
}
.w-143-perc {
  width: 143%;;
}
.h-143-perc {
  height: 143%;;
}
.w-144-px {
  width: 144px;
}
.h-144-px {
  height: 144px;
}
.w-144-perc {
  width: 144%;;
}
.h-144-perc {
  height: 144%;;
}
.w-145-px {
  width: 145px;
}
.h-145-px {
  height: 145px;
}
.w-145-perc {
  width: 145%;;
}
.h-145-perc {
  height: 145%;;
}
.w-146-px {
  width: 146px;
}
.h-146-px {
  height: 146px;
}
.w-146-perc {
  width: 146%;;
}
.h-146-perc {
  height: 146%;;
}
.w-147-px {
  width: 147px;
}
.h-147-px {
  height: 147px;
}
.w-147-perc {
  width: 147%;;
}
.h-147-perc {
  height: 147%;;
}
.w-148-px {
  width: 148px;
}
.h-148-px {
  height: 148px;
}
.w-148-perc {
  width: 148%;;
}
.h-148-perc {
  height: 148%;;
}
.w-149-px {
  width: 149px;
}
.h-149-px {
  height: 149px;
}
.w-149-perc {
  width: 149%;;
}
.h-149-perc {
  height: 149%;;
}
.w-150-px {
  width: 150px;
}
.h-150-px {
  height: 150px;
}
.w-150-perc {
  width: 150%;;
}
.h-150-perc {
  height: 150%;;
}
.w-151-px {
  width: 151px;
}
.h-151-px {
  height: 151px;
}
.w-151-perc {
  width: 151%;;
}
.h-151-perc {
  height: 151%;;
}
.w-152-px {
  width: 152px;
}
.h-152-px {
  height: 152px;
}
.w-152-perc {
  width: 152%;;
}
.h-152-perc {
  height: 152%;;
}
.w-153-px {
  width: 153px;
}
.h-153-px {
  height: 153px;
}
.w-153-perc {
  width: 153%;;
}
.h-153-perc {
  height: 153%;;
}
.w-154-px {
  width: 154px;
}
.h-154-px {
  height: 154px;
}
.w-154-perc {
  width: 154%;;
}
.h-154-perc {
  height: 154%;;
}
.w-155-px {
  width: 155px;
}
.h-155-px {
  height: 155px;
}
.w-155-perc {
  width: 155%;;
}
.h-155-perc {
  height: 155%;;
}
.w-156-px {
  width: 156px;
}
.h-156-px {
  height: 156px;
}
.w-156-perc {
  width: 156%;;
}
.h-156-perc {
  height: 156%;;
}
.w-157-px {
  width: 157px;
}
.h-157-px {
  height: 157px;
}
.w-157-perc {
  width: 157%;;
}
.h-157-perc {
  height: 157%;;
}
.w-158-px {
  width: 158px;
}
.h-158-px {
  height: 158px;
}
.w-158-perc {
  width: 158%;;
}
.h-158-perc {
  height: 158%;;
}
.w-159-px {
  width: 159px;
}
.h-159-px {
  height: 159px;
}
.w-159-perc {
  width: 159%;;
}
.h-159-perc {
  height: 159%;;
}
.w-160-px {
  width: 160px;
}
.h-160-px {
  height: 160px;
}
.w-160-perc {
  width: 160%;;
}
.h-160-perc {
  height: 160%;;
}
.w-161-px {
  width: 161px;
}
.h-161-px {
  height: 161px;
}
.w-161-perc {
  width: 161%;;
}
.h-161-perc {
  height: 161%;;
}
.w-162-px {
  width: 162px;
}
.h-162-px {
  height: 162px;
}
.w-162-perc {
  width: 162%;;
}
.h-162-perc {
  height: 162%;;
}
.w-163-px {
  width: 163px;
}
.h-163-px {
  height: 163px;
}
.w-163-perc {
  width: 163%;;
}
.h-163-perc {
  height: 163%;;
}
.w-164-px {
  width: 164px;
}
.h-164-px {
  height: 164px;
}
.w-164-perc {
  width: 164%;;
}
.h-164-perc {
  height: 164%;;
}
.w-165-px {
  width: 165px;
}
.h-165-px {
  height: 165px;
}
.w-165-perc {
  width: 165%;;
}
.h-165-perc {
  height: 165%;;
}
.w-166-px {
  width: 166px;
}
.h-166-px {
  height: 166px;
}
.w-166-perc {
  width: 166%;;
}
.h-166-perc {
  height: 166%;;
}
.w-167-px {
  width: 167px;
}
.h-167-px {
  height: 167px;
}
.w-167-perc {
  width: 167%;;
}
.h-167-perc {
  height: 167%;;
}
.w-168-px {
  width: 168px;
}
.h-168-px {
  height: 168px;
}
.w-168-perc {
  width: 168%;;
}
.h-168-perc {
  height: 168%;;
}
.w-169-px {
  width: 169px;
}
.h-169-px {
  height: 169px;
}
.w-169-perc {
  width: 169%;;
}
.h-169-perc {
  height: 169%;;
}
.w-170-px {
  width: 170px;
}
.h-170-px {
  height: 170px;
}
.w-170-perc {
  width: 170%;;
}
.h-170-perc {
  height: 170%;;
}
.w-171-px {
  width: 171px;
}
.h-171-px {
  height: 171px;
}
.w-171-perc {
  width: 171%;;
}
.h-171-perc {
  height: 171%;;
}
.w-172-px {
  width: 172px;
}
.h-172-px {
  height: 172px;
}
.w-172-perc {
  width: 172%;;
}
.h-172-perc {
  height: 172%;;
}
.w-173-px {
  width: 173px;
}
.h-173-px {
  height: 173px;
}
.w-173-perc {
  width: 173%;;
}
.h-173-perc {
  height: 173%;;
}
.w-174-px {
  width: 174px;
}
.h-174-px {
  height: 174px;
}
.w-174-perc {
  width: 174%;;
}
.h-174-perc {
  height: 174%;;
}
.w-175-px {
  width: 175px;
}
.h-175-px {
  height: 175px;
}
.w-175-perc {
  width: 175%;;
}
.h-175-perc {
  height: 175%;;
}
.w-176-px {
  width: 176px;
}
.h-176-px {
  height: 176px;
}
.w-176-perc {
  width: 176%;;
}
.h-176-perc {
  height: 176%;;
}
.w-177-px {
  width: 177px;
}
.h-177-px {
  height: 177px;
}
.w-177-perc {
  width: 177%;;
}
.h-177-perc {
  height: 177%;;
}
.w-178-px {
  width: 178px;
}
.h-178-px {
  height: 178px;
}
.w-178-perc {
  width: 178%;;
}
.h-178-perc {
  height: 178%;;
}
.w-179-px {
  width: 179px;
}
.h-179-px {
  height: 179px;
}
.w-179-perc {
  width: 179%;;
}
.h-179-perc {
  height: 179%;;
}
.w-180-px {
  width: 180px;
}
.h-180-px {
  height: 180px;
}
.w-180-perc {
  width: 180%;;
}
.h-180-perc {
  height: 180%;;
}
.w-181-px {
  width: 181px;
}
.h-181-px {
  height: 181px;
}
.w-181-perc {
  width: 181%;;
}
.h-181-perc {
  height: 181%;;
}
.w-182-px {
  width: 182px;
}
.h-182-px {
  height: 182px;
}
.w-182-perc {
  width: 182%;;
}
.h-182-perc {
  height: 182%;;
}
.w-183-px {
  width: 183px;
}
.h-183-px {
  height: 183px;
}
.w-183-perc {
  width: 183%;;
}
.h-183-perc {
  height: 183%;;
}
.w-184-px {
  width: 184px;
}
.h-184-px {
  height: 184px;
}
.w-184-perc {
  width: 184%;;
}
.h-184-perc {
  height: 184%;;
}
.w-185-px {
  width: 185px;
}
.h-185-px {
  height: 185px;
}
.w-185-perc {
  width: 185%;;
}
.h-185-perc {
  height: 185%;;
}
.w-186-px {
  width: 186px;
}
.h-186-px {
  height: 186px;
}
.w-186-perc {
  width: 186%;;
}
.h-186-perc {
  height: 186%;;
}
.w-187-px {
  width: 187px;
}
.h-187-px {
  height: 187px;
}
.w-187-perc {
  width: 187%;;
}
.h-187-perc {
  height: 187%;;
}
.w-188-px {
  width: 188px;
}
.h-188-px {
  height: 188px;
}
.w-188-perc {
  width: 188%;;
}
.h-188-perc {
  height: 188%;;
}
.w-189-px {
  width: 189px;
}
.h-189-px {
  height: 189px;
}
.w-189-perc {
  width: 189%;;
}
.h-189-perc {
  height: 189%;;
}
.w-190-px {
  width: 190px;
}
.h-190-px {
  height: 190px;
}
.w-190-perc {
  width: 190%;;
}
.h-190-perc {
  height: 190%;;
}
.w-191-px {
  width: 191px;
}
.h-191-px {
  height: 191px;
}
.w-191-perc {
  width: 191%;;
}
.h-191-perc {
  height: 191%;;
}
.w-192-px {
  width: 192px;
}
.h-192-px {
  height: 192px;
}
.w-192-perc {
  width: 192%;;
}
.h-192-perc {
  height: 192%;;
}
.w-193-px {
  width: 193px;
}
.h-193-px {
  height: 193px;
}
.w-193-perc {
  width: 193%;;
}
.h-193-perc {
  height: 193%;;
}
.w-194-px {
  width: 194px;
}
.h-194-px {
  height: 194px;
}
.w-194-perc {
  width: 194%;;
}
.h-194-perc {
  height: 194%;;
}
.w-195-px {
  width: 195px;
}
.h-195-px {
  height: 195px;
}
.w-195-perc {
  width: 195%;;
}
.h-195-perc {
  height: 195%;;
}
.w-196-px {
  width: 196px;
}
.h-196-px {
  height: 196px;
}
.w-196-perc {
  width: 196%;;
}
.h-196-perc {
  height: 196%;;
}
.w-197-px {
  width: 197px;
}
.h-197-px {
  height: 197px;
}
.w-197-perc {
  width: 197%;;
}
.h-197-perc {
  height: 197%;;
}
.w-198-px {
  width: 198px;
}
.h-198-px {
  height: 198px;
}
.w-198-perc {
  width: 198%;;
}
.h-198-perc {
  height: 198%;;
}
.w-199-px {
  width: 199px;
}
.h-199-px {
  height: 199px;
}
.w-199-perc {
  width: 199%;;
}
.h-199-perc {
  height: 199%;;
}
.w-200-px {
  width: 200px;
}
.h-200-px {
  height: 200px;
}
.w-200-perc {
  width: 200%;;
}
.h-200-perc {
  height: 200%;;
}
.w-201-px {
  width: 201px;
}
.h-201-px {
  height: 201px;
}
.w-201-perc {
  width: 201%;;
}
.h-201-perc {
  height: 201%;;
}
.w-202-px {
  width: 202px;
}
.h-202-px {
  height: 202px;
}
.w-202-perc {
  width: 202%;;
}
.h-202-perc {
  height: 202%;;
}
.w-203-px {
  width: 203px;
}
.h-203-px {
  height: 203px;
}
.w-203-perc {
  width: 203%;;
}
.h-203-perc {
  height: 203%;;
}
.w-204-px {
  width: 204px;
}
.h-204-px {
  height: 204px;
}
.w-204-perc {
  width: 204%;;
}
.h-204-perc {
  height: 204%;;
}
.w-205-px {
  width: 205px;
}
.h-205-px {
  height: 205px;
}
.w-205-perc {
  width: 205%;;
}
.h-205-perc {
  height: 205%;;
}
.w-206-px {
  width: 206px;
}
.h-206-px {
  height: 206px;
}
.w-206-perc {
  width: 206%;;
}
.h-206-perc {
  height: 206%;;
}
.w-207-px {
  width: 207px;
}
.h-207-px {
  height: 207px;
}
.w-207-perc {
  width: 207%;;
}
.h-207-perc {
  height: 207%;;
}
.w-208-px {
  width: 208px;
}
.h-208-px {
  height: 208px;
}
.w-208-perc {
  width: 208%;;
}
.h-208-perc {
  height: 208%;;
}
.w-209-px {
  width: 209px;
}
.h-209-px {
  height: 209px;
}
.w-209-perc {
  width: 209%;;
}
.h-209-perc {
  height: 209%;;
}
.w-210-px {
  width: 210px;
}
.h-210-px {
  height: 210px;
}
.w-210-perc {
  width: 210%;;
}
.h-210-perc {
  height: 210%;;
}
.w-211-px {
  width: 211px;
}
.h-211-px {
  height: 211px;
}
.w-211-perc {
  width: 211%;;
}
.h-211-perc {
  height: 211%;;
}
.w-212-px {
  width: 212px;
}
.h-212-px {
  height: 212px;
}
.w-212-perc {
  width: 212%;;
}
.h-212-perc {
  height: 212%;;
}
.w-213-px {
  width: 213px;
}
.h-213-px {
  height: 213px;
}
.w-213-perc {
  width: 213%;;
}
.h-213-perc {
  height: 213%;;
}
.w-214-px {
  width: 214px;
}
.h-214-px {
  height: 214px;
}
.w-214-perc {
  width: 214%;;
}
.h-214-perc {
  height: 214%;;
}
.w-215-px {
  width: 215px;
}
.h-215-px {
  height: 215px;
}
.w-215-perc {
  width: 215%;;
}
.h-215-perc {
  height: 215%;;
}
.w-216-px {
  width: 216px;
}
.h-216-px {
  height: 216px;
}
.w-216-perc {
  width: 216%;;
}
.h-216-perc {
  height: 216%;;
}
.w-217-px {
  width: 217px;
}
.h-217-px {
  height: 217px;
}
.w-217-perc {
  width: 217%;;
}
.h-217-perc {
  height: 217%;;
}
.w-218-px {
  width: 218px;
}
.h-218-px {
  height: 218px;
}
.w-218-perc {
  width: 218%;;
}
.h-218-perc {
  height: 218%;;
}
.w-219-px {
  width: 219px;
}
.h-219-px {
  height: 219px;
}
.w-219-perc {
  width: 219%;;
}
.h-219-perc {
  height: 219%;;
}
.w-220-px {
  width: 220px;
}
.h-220-px {
  height: 220px;
}
.w-220-perc {
  width: 220%;;
}
.h-220-perc {
  height: 220%;;
}
.w-221-px {
  width: 221px;
}
.h-221-px {
  height: 221px;
}
.w-221-perc {
  width: 221%;;
}
.h-221-perc {
  height: 221%;;
}
.w-222-px {
  width: 222px;
}
.h-222-px {
  height: 222px;
}
.w-222-perc {
  width: 222%;;
}
.h-222-perc {
  height: 222%;;
}
.w-223-px {
  width: 223px;
}
.h-223-px {
  height: 223px;
}
.w-223-perc {
  width: 223%;;
}
.h-223-perc {
  height: 223%;;
}
.w-224-px {
  width: 224px;
}
.h-224-px {
  height: 224px;
}
.w-224-perc {
  width: 224%;;
}
.h-224-perc {
  height: 224%;;
}
.w-225-px {
  width: 225px;
}
.h-225-px {
  height: 225px;
}
.w-225-perc {
  width: 225%;;
}
.h-225-perc {
  height: 225%;;
}
.w-226-px {
  width: 226px;
}
.h-226-px {
  height: 226px;
}
.w-226-perc {
  width: 226%;;
}
.h-226-perc {
  height: 226%;;
}
.w-227-px {
  width: 227px;
}
.h-227-px {
  height: 227px;
}
.w-227-perc {
  width: 227%;;
}
.h-227-perc {
  height: 227%;;
}
.w-228-px {
  width: 228px;
}
.h-228-px {
  height: 228px;
}
.w-228-perc {
  width: 228%;;
}
.h-228-perc {
  height: 228%;;
}
.w-229-px {
  width: 229px;
}
.h-229-px {
  height: 229px;
}
.w-229-perc {
  width: 229%;;
}
.h-229-perc {
  height: 229%;;
}
.w-230-px {
  width: 230px;
}
.h-230-px {
  height: 230px;
}
.w-230-perc {
  width: 230%;;
}
.h-230-perc {
  height: 230%;;
}
.w-231-px {
  width: 231px;
}
.h-231-px {
  height: 231px;
}
.w-231-perc {
  width: 231%;;
}
.h-231-perc {
  height: 231%;;
}
.w-232-px {
  width: 232px;
}
.h-232-px {
  height: 232px;
}
.w-232-perc {
  width: 232%;;
}
.h-232-perc {
  height: 232%;;
}
.w-233-px {
  width: 233px;
}
.h-233-px {
  height: 233px;
}
.w-233-perc {
  width: 233%;;
}
.h-233-perc {
  height: 233%;;
}
.w-234-px {
  width: 234px;
}
.h-234-px {
  height: 234px;
}
.w-234-perc {
  width: 234%;;
}
.h-234-perc {
  height: 234%;;
}
.w-235-px {
  width: 235px;
}
.h-235-px {
  height: 235px;
}
.w-235-perc {
  width: 235%;;
}
.h-235-perc {
  height: 235%;;
}
.w-236-px {
  width: 236px;
}
.h-236-px {
  height: 236px;
}
.w-236-perc {
  width: 236%;;
}
.h-236-perc {
  height: 236%;;
}
.w-237-px {
  width: 237px;
}
.h-237-px {
  height: 237px;
}
.w-237-perc {
  width: 237%;;
}
.h-237-perc {
  height: 237%;;
}
.w-238-px {
  width: 238px;
}
.h-238-px {
  height: 238px;
}
.w-238-perc {
  width: 238%;;
}
.h-238-perc {
  height: 238%;;
}
.w-239-px {
  width: 239px;
}
.h-239-px {
  height: 239px;
}
.w-239-perc {
  width: 239%;;
}
.h-239-perc {
  height: 239%;;
}
.w-240-px {
  width: 240px;
}
.h-240-px {
  height: 240px;
}
.w-240-perc {
  width: 240%;;
}
.h-240-perc {
  height: 240%;;
}
.w-241-px {
  width: 241px;
}
.h-241-px {
  height: 241px;
}
.w-241-perc {
  width: 241%;;
}
.h-241-perc {
  height: 241%;;
}
.w-242-px {
  width: 242px;
}
.h-242-px {
  height: 242px;
}
.w-242-perc {
  width: 242%;;
}
.h-242-perc {
  height: 242%;;
}
.w-243-px {
  width: 243px;
}
.h-243-px {
  height: 243px;
}
.w-243-perc {
  width: 243%;;
}
.h-243-perc {
  height: 243%;;
}
.w-244-px {
  width: 244px;
}
.h-244-px {
  height: 244px;
}
.w-244-perc {
  width: 244%;;
}
.h-244-perc {
  height: 244%;;
}
.w-245-px {
  width: 245px;
}
.h-245-px {
  height: 245px;
}
.w-245-perc {
  width: 245%;;
}
.h-245-perc {
  height: 245%;;
}
.w-246-px {
  width: 246px;
}
.h-246-px {
  height: 246px;
}
.w-246-perc {
  width: 246%;;
}
.h-246-perc {
  height: 246%;;
}
.w-247-px {
  width: 247px;
}
.h-247-px {
  height: 247px;
}
.w-247-perc {
  width: 247%;;
}
.h-247-perc {
  height: 247%;;
}
.w-248-px {
  width: 248px;
}
.h-248-px {
  height: 248px;
}
.w-248-perc {
  width: 248%;;
}
.h-248-perc {
  height: 248%;;
}
.w-249-px {
  width: 249px;
}
.h-249-px {
  height: 249px;
}
.w-249-perc {
  width: 249%;;
}
.h-249-perc {
  height: 249%;;
}
.w-250-px {
  width: 250px;
}
.h-250-px {
  height: 250px;
}
.w-250-perc {
  width: 250%;;
}
.h-250-perc {
  height: 250%;;
}
.w-251-px {
  width: 251px;
}
.h-251-px {
  height: 251px;
}
.w-251-perc {
  width: 251%;;
}
.h-251-perc {
  height: 251%;;
}
.w-252-px {
  width: 252px;
}
.h-252-px {
  height: 252px;
}
.w-252-perc {
  width: 252%;;
}
.h-252-perc {
  height: 252%;;
}
.w-253-px {
  width: 253px;
}
.h-253-px {
  height: 253px;
}
.w-253-perc {
  width: 253%;;
}
.h-253-perc {
  height: 253%;;
}
.w-254-px {
  width: 254px;
}
.h-254-px {
  height: 254px;
}
.w-254-perc {
  width: 254%;;
}
.h-254-perc {
  height: 254%;;
}
.w-255-px {
  width: 255px;
}
.h-255-px {
  height: 255px;
}
.w-255-perc {
  width: 255%;;
}
.h-255-perc {
  height: 255%;;
}
.w-256-px {
  width: 256px;
}
.h-256-px {
  height: 256px;
}
.w-256-perc {
  width: 256%;;
}
.h-256-perc {
  height: 256%;;
}
.w-257-px {
  width: 257px;
}
.h-257-px {
  height: 257px;
}
.w-257-perc {
  width: 257%;;
}
.h-257-perc {
  height: 257%;;
}
.w-258-px {
  width: 258px;
}
.h-258-px {
  height: 258px;
}
.w-258-perc {
  width: 258%;;
}
.h-258-perc {
  height: 258%;;
}
.w-259-px {
  width: 259px;
}
.h-259-px {
  height: 259px;
}
.w-259-perc {
  width: 259%;;
}
.h-259-perc {
  height: 259%;;
}
.w-260-px {
  width: 260px;
}
.h-260-px {
  height: 260px;
}
.w-260-perc {
  width: 260%;;
}
.h-260-perc {
  height: 260%;;
}
.w-261-px {
  width: 261px;
}
.h-261-px {
  height: 261px;
}
.w-261-perc {
  width: 261%;;
}
.h-261-perc {
  height: 261%;;
}
.w-262-px {
  width: 262px;
}
.h-262-px {
  height: 262px;
}
.w-262-perc {
  width: 262%;;
}
.h-262-perc {
  height: 262%;;
}
.w-263-px {
  width: 263px;
}
.h-263-px {
  height: 263px;
}
.w-263-perc {
  width: 263%;;
}
.h-263-perc {
  height: 263%;;
}
.w-264-px {
  width: 264px;
}
.h-264-px {
  height: 264px;
}
.w-264-perc {
  width: 264%;;
}
.h-264-perc {
  height: 264%;;
}
.w-265-px {
  width: 265px;
}
.h-265-px {
  height: 265px;
}
.w-265-perc {
  width: 265%;;
}
.h-265-perc {
  height: 265%;;
}
.w-266-px {
  width: 266px;
}
.h-266-px {
  height: 266px;
}
.w-266-perc {
  width: 266%;;
}
.h-266-perc {
  height: 266%;;
}
.w-267-px {
  width: 267px;
}
.h-267-px {
  height: 267px;
}
.w-267-perc {
  width: 267%;;
}
.h-267-perc {
  height: 267%;;
}
.w-268-px {
  width: 268px;
}
.h-268-px {
  height: 268px;
}
.w-268-perc {
  width: 268%;;
}
.h-268-perc {
  height: 268%;;
}
.w-269-px {
  width: 269px;
}
.h-269-px {
  height: 269px;
}
.w-269-perc {
  width: 269%;;
}
.h-269-perc {
  height: 269%;;
}
.w-270-px {
  width: 270px;
}
.h-270-px {
  height: 270px;
}
.w-270-perc {
  width: 270%;;
}
.h-270-perc {
  height: 270%;;
}
.w-271-px {
  width: 271px;
}
.h-271-px {
  height: 271px;
}
.w-271-perc {
  width: 271%;;
}
.h-271-perc {
  height: 271%;;
}
.w-272-px {
  width: 272px;
}
.h-272-px {
  height: 272px;
}
.w-272-perc {
  width: 272%;;
}
.h-272-perc {
  height: 272%;;
}
.w-273-px {
  width: 273px;
}
.h-273-px {
  height: 273px;
}
.w-273-perc {
  width: 273%;;
}
.h-273-perc {
  height: 273%;;
}
.w-274-px {
  width: 274px;
}
.h-274-px {
  height: 274px;
}
.w-274-perc {
  width: 274%;;
}
.h-274-perc {
  height: 274%;;
}
.w-275-px {
  width: 275px;
}
.h-275-px {
  height: 275px;
}
.w-275-perc {
  width: 275%;;
}
.h-275-perc {
  height: 275%;;
}
.w-276-px {
  width: 276px;
}
.h-276-px {
  height: 276px;
}
.w-276-perc {
  width: 276%;;
}
.h-276-perc {
  height: 276%;;
}
.w-277-px {
  width: 277px;
}
.h-277-px {
  height: 277px;
}
.w-277-perc {
  width: 277%;;
}
.h-277-perc {
  height: 277%;;
}
.w-278-px {
  width: 278px;
}
.h-278-px {
  height: 278px;
}
.w-278-perc {
  width: 278%;;
}
.h-278-perc {
  height: 278%;;
}
.w-279-px {
  width: 279px;
}
.h-279-px {
  height: 279px;
}
.w-279-perc {
  width: 279%;;
}
.h-279-perc {
  height: 279%;;
}
.w-280-px {
  width: 280px;
}
.h-280-px {
  height: 280px;
}
.w-280-perc {
  width: 280%;;
}
.h-280-perc {
  height: 280%;;
}
.w-281-px {
  width: 281px;
}
.h-281-px {
  height: 281px;
}
.w-281-perc {
  width: 281%;;
}
.h-281-perc {
  height: 281%;;
}
.w-282-px {
  width: 282px;
}
.h-282-px {
  height: 282px;
}
.w-282-perc {
  width: 282%;;
}
.h-282-perc {
  height: 282%;;
}
.w-283-px {
  width: 283px;
}
.h-283-px {
  height: 283px;
}
.w-283-perc {
  width: 283%;;
}
.h-283-perc {
  height: 283%;;
}
.w-284-px {
  width: 284px;
}
.h-284-px {
  height: 284px;
}
.w-284-perc {
  width: 284%;;
}
.h-284-perc {
  height: 284%;;
}
.w-285-px {
  width: 285px;
}
.h-285-px {
  height: 285px;
}
.w-285-perc {
  width: 285%;;
}
.h-285-perc {
  height: 285%;;
}
.w-286-px {
  width: 286px;
}
.h-286-px {
  height: 286px;
}
.w-286-perc {
  width: 286%;;
}
.h-286-perc {
  height: 286%;;
}
.w-287-px {
  width: 287px;
}
.h-287-px {
  height: 287px;
}
.w-287-perc {
  width: 287%;;
}
.h-287-perc {
  height: 287%;;
}
.w-288-px {
  width: 288px;
}
.h-288-px {
  height: 288px;
}
.w-288-perc {
  width: 288%;;
}
.h-288-perc {
  height: 288%;;
}
.w-289-px {
  width: 289px;
}
.h-289-px {
  height: 289px;
}
.w-289-perc {
  width: 289%;;
}
.h-289-perc {
  height: 289%;;
}
.w-290-px {
  width: 290px;
}
.h-290-px {
  height: 290px;
}
.w-290-perc {
  width: 290%;;
}
.h-290-perc {
  height: 290%;;
}
.w-291-px {
  width: 291px;
}
.h-291-px {
  height: 291px;
}
.w-291-perc {
  width: 291%;;
}
.h-291-perc {
  height: 291%;;
}
.w-292-px {
  width: 292px;
}
.h-292-px {
  height: 292px;
}
.w-292-perc {
  width: 292%;;
}
.h-292-perc {
  height: 292%;;
}
.w-293-px {
  width: 293px;
}
.h-293-px {
  height: 293px;
}
.w-293-perc {
  width: 293%;;
}
.h-293-perc {
  height: 293%;;
}
.w-294-px {
  width: 294px;
}
.h-294-px {
  height: 294px;
}
.w-294-perc {
  width: 294%;;
}
.h-294-perc {
  height: 294%;;
}
.w-295-px {
  width: 295px;
}
.h-295-px {
  height: 295px;
}
.w-295-perc {
  width: 295%;;
}
.h-295-perc {
  height: 295%;;
}
.w-296-px {
  width: 296px;
}
.h-296-px {
  height: 296px;
}
.w-296-perc {
  width: 296%;;
}
.h-296-perc {
  height: 296%;;
}
.w-297-px {
  width: 297px;
}
.h-297-px {
  height: 297px;
}
.w-297-perc {
  width: 297%;;
}
.h-297-perc {
  height: 297%;;
}
.w-298-px {
  width: 298px;
}
.h-298-px {
  height: 298px;
}
.w-298-perc {
  width: 298%;;
}
.h-298-perc {
  height: 298%;;
}
.w-299-px {
  width: 299px;
}
.h-299-px {
  height: 299px;
}
.w-299-perc {
  width: 299%;;
}
.h-299-perc {
  height: 299%;;
}
.w-300-px {
  width: 300px;
}
.h-300-px {
  height: 300px;
}
.w-300-perc {
  width: 300%;;
}
.h-300-perc {
  height: 300%;;
}
.w-301-px {
  width: 301px;
}
.h-301-px {
  height: 301px;
}
.w-301-perc {
  width: 301%;;
}
.h-301-perc {
  height: 301%;;
}
.w-302-px {
  width: 302px;
}
.h-302-px {
  height: 302px;
}
.w-302-perc {
  width: 302%;;
}
.h-302-perc {
  height: 302%;;
}
.w-303-px {
  width: 303px;
}
.h-303-px {
  height: 303px;
}
.w-303-perc {
  width: 303%;;
}
.h-303-perc {
  height: 303%;;
}
.w-304-px {
  width: 304px;
}
.h-304-px {
  height: 304px;
}
.w-304-perc {
  width: 304%;;
}
.h-304-perc {
  height: 304%;;
}
.w-305-px {
  width: 305px;
}
.h-305-px {
  height: 305px;
}
.w-305-perc {
  width: 305%;;
}
.h-305-perc {
  height: 305%;;
}
.w-306-px {
  width: 306px;
}
.h-306-px {
  height: 306px;
}
.w-306-perc {
  width: 306%;;
}
.h-306-perc {
  height: 306%;;
}
.w-307-px {
  width: 307px;
}
.h-307-px {
  height: 307px;
}
.w-307-perc {
  width: 307%;;
}
.h-307-perc {
  height: 307%;;
}
.w-308-px {
  width: 308px;
}
.h-308-px {
  height: 308px;
}
.w-308-perc {
  width: 308%;;
}
.h-308-perc {
  height: 308%;;
}
.w-309-px {
  width: 309px;
}
.h-309-px {
  height: 309px;
}
.w-309-perc {
  width: 309%;;
}
.h-309-perc {
  height: 309%;;
}
.w-310-px {
  width: 310px;
}
.h-310-px {
  height: 310px;
}
.w-310-perc {
  width: 310%;;
}
.h-310-perc {
  height: 310%;;
}
.w-311-px {
  width: 311px;
}
.h-311-px {
  height: 311px;
}
.w-311-perc {
  width: 311%;;
}
.h-311-perc {
  height: 311%;;
}
.w-312-px {
  width: 312px;
}
.h-312-px {
  height: 312px;
}
.w-312-perc {
  width: 312%;;
}
.h-312-perc {
  height: 312%;;
}
.w-313-px {
  width: 313px;
}
.h-313-px {
  height: 313px;
}
.w-313-perc {
  width: 313%;;
}
.h-313-perc {
  height: 313%;;
}
.w-314-px {
  width: 314px;
}
.h-314-px {
  height: 314px;
}
.w-314-perc {
  width: 314%;;
}
.h-314-perc {
  height: 314%;;
}
.w-315-px {
  width: 315px;
}
.h-315-px {
  height: 315px;
}
.w-315-perc {
  width: 315%;;
}
.h-315-perc {
  height: 315%;;
}
.w-316-px {
  width: 316px;
}
.h-316-px {
  height: 316px;
}
.w-316-perc {
  width: 316%;;
}
.h-316-perc {
  height: 316%;;
}
.w-317-px {
  width: 317px;
}
.h-317-px {
  height: 317px;
}
.w-317-perc {
  width: 317%;;
}
.h-317-perc {
  height: 317%;;
}
.w-318-px {
  width: 318px;
}
.h-318-px {
  height: 318px;
}
.w-318-perc {
  width: 318%;;
}
.h-318-perc {
  height: 318%;;
}
.w-319-px {
  width: 319px;
}
.h-319-px {
  height: 319px;
}
.w-319-perc {
  width: 319%;;
}
.h-319-perc {
  height: 319%;;
}
.w-320-px {
  width: 320px;
}
.h-320-px {
  height: 320px;
}
.w-320-perc {
  width: 320%;;
}
.h-320-perc {
  height: 320%;;
}
.w-321-px {
  width: 321px;
}
.h-321-px {
  height: 321px;
}
.w-321-perc {
  width: 321%;;
}
.h-321-perc {
  height: 321%;;
}
.w-322-px {
  width: 322px;
}
.h-322-px {
  height: 322px;
}
.w-322-perc {
  width: 322%;;
}
.h-322-perc {
  height: 322%;;
}
.w-323-px {
  width: 323px;
}
.h-323-px {
  height: 323px;
}
.w-323-perc {
  width: 323%;;
}
.h-323-perc {
  height: 323%;;
}
.w-324-px {
  width: 324px;
}
.h-324-px {
  height: 324px;
}
.w-324-perc {
  width: 324%;;
}
.h-324-perc {
  height: 324%;;
}
.w-325-px {
  width: 325px;
}
.h-325-px {
  height: 325px;
}
.w-325-perc {
  width: 325%;;
}
.h-325-perc {
  height: 325%;;
}
.w-326-px {
  width: 326px;
}
.h-326-px {
  height: 326px;
}
.w-326-perc {
  width: 326%;;
}
.h-326-perc {
  height: 326%;;
}
.w-327-px {
  width: 327px;
}
.h-327-px {
  height: 327px;
}
.w-327-perc {
  width: 327%;;
}
.h-327-perc {
  height: 327%;;
}
.w-328-px {
  width: 328px;
}
.h-328-px {
  height: 328px;
}
.w-328-perc {
  width: 328%;;
}
.h-328-perc {
  height: 328%;;
}
.w-329-px {
  width: 329px;
}
.h-329-px {
  height: 329px;
}
.w-329-perc {
  width: 329%;;
}
.h-329-perc {
  height: 329%;;
}
.w-330-px {
  width: 330px;
}
.h-330-px {
  height: 330px;
}
.w-330-perc {
  width: 330%;;
}
.h-330-perc {
  height: 330%;;
}
.w-331-px {
  width: 331px;
}
.h-331-px {
  height: 331px;
}
.w-331-perc {
  width: 331%;;
}
.h-331-perc {
  height: 331%;;
}
.w-332-px {
  width: 332px;
}
.h-332-px {
  height: 332px;
}
.w-332-perc {
  width: 332%;;
}
.h-332-perc {
  height: 332%;;
}
.w-333-px {
  width: 333px;
}
.h-333-px {
  height: 333px;
}
.w-333-perc {
  width: 333%;;
}
.h-333-perc {
  height: 333%;;
}
.w-334-px {
  width: 334px;
}
.h-334-px {
  height: 334px;
}
.w-334-perc {
  width: 334%;;
}
.h-334-perc {
  height: 334%;;
}
.w-335-px {
  width: 335px;
}
.h-335-px {
  height: 335px;
}
.w-335-perc {
  width: 335%;;
}
.h-335-perc {
  height: 335%;;
}
.w-336-px {
  width: 336px;
}
.h-336-px {
  height: 336px;
}
.w-336-perc {
  width: 336%;;
}
.h-336-perc {
  height: 336%;;
}
.w-337-px {
  width: 337px;
}
.h-337-px {
  height: 337px;
}
.w-337-perc {
  width: 337%;;
}
.h-337-perc {
  height: 337%;;
}
.w-338-px {
  width: 338px;
}
.h-338-px {
  height: 338px;
}
.w-338-perc {
  width: 338%;;
}
.h-338-perc {
  height: 338%;;
}
.w-339-px {
  width: 339px;
}
.h-339-px {
  height: 339px;
}
.w-339-perc {
  width: 339%;;
}
.h-339-perc {
  height: 339%;;
}
.w-340-px {
  width: 340px;
}
.h-340-px {
  height: 340px;
}
.w-340-perc {
  width: 340%;;
}
.h-340-perc {
  height: 340%;;
}
.w-341-px {
  width: 341px;
}
.h-341-px {
  height: 341px;
}
.w-341-perc {
  width: 341%;;
}
.h-341-perc {
  height: 341%;;
}
.w-342-px {
  width: 342px;
}
.h-342-px {
  height: 342px;
}
.w-342-perc {
  width: 342%;;
}
.h-342-perc {
  height: 342%;;
}
.w-343-px {
  width: 343px;
}
.h-343-px {
  height: 343px;
}
.w-343-perc {
  width: 343%;;
}
.h-343-perc {
  height: 343%;;
}
.w-344-px {
  width: 344px;
}
.h-344-px {
  height: 344px;
}
.w-344-perc {
  width: 344%;;
}
.h-344-perc {
  height: 344%;;
}
.w-345-px {
  width: 345px;
}
.h-345-px {
  height: 345px;
}
.w-345-perc {
  width: 345%;;
}
.h-345-perc {
  height: 345%;;
}
.w-346-px {
  width: 346px;
}
.h-346-px {
  height: 346px;
}
.w-346-perc {
  width: 346%;;
}
.h-346-perc {
  height: 346%;;
}
.w-347-px {
  width: 347px;
}
.h-347-px {
  height: 347px;
}
.w-347-perc {
  width: 347%;;
}
.h-347-perc {
  height: 347%;;
}
.w-348-px {
  width: 348px;
}
.h-348-px {
  height: 348px;
}
.w-348-perc {
  width: 348%;;
}
.h-348-perc {
  height: 348%;;
}
.w-349-px {
  width: 349px;
}
.h-349-px {
  height: 349px;
}
.w-349-perc {
  width: 349%;;
}
.h-349-perc {
  height: 349%;;
}
.w-350-px {
  width: 350px;
}
.h-350-px {
  height: 350px;
}
.w-350-perc {
  width: 350%;;
}
.h-350-perc {
  height: 350%;;
}
.w-351-px {
  width: 351px;
}
.h-351-px {
  height: 351px;
}
.w-351-perc {
  width: 351%;;
}
.h-351-perc {
  height: 351%;;
}
.w-352-px {
  width: 352px;
}
.h-352-px {
  height: 352px;
}
.w-352-perc {
  width: 352%;;
}
.h-352-perc {
  height: 352%;;
}
.w-353-px {
  width: 353px;
}
.h-353-px {
  height: 353px;
}
.w-353-perc {
  width: 353%;;
}
.h-353-perc {
  height: 353%;;
}
.w-354-px {
  width: 354px;
}
.h-354-px {
  height: 354px;
}
.w-354-perc {
  width: 354%;;
}
.h-354-perc {
  height: 354%;;
}
.w-355-px {
  width: 355px;
}
.h-355-px {
  height: 355px;
}
.w-355-perc {
  width: 355%;;
}
.h-355-perc {
  height: 355%;;
}
.w-356-px {
  width: 356px;
}
.h-356-px {
  height: 356px;
}
.w-356-perc {
  width: 356%;;
}
.h-356-perc {
  height: 356%;;
}
.w-357-px {
  width: 357px;
}
.h-357-px {
  height: 357px;
}
.w-357-perc {
  width: 357%;;
}
.h-357-perc {
  height: 357%;;
}
.w-358-px {
  width: 358px;
}
.h-358-px {
  height: 358px;
}
.w-358-perc {
  width: 358%;;
}
.h-358-perc {
  height: 358%;;
}
.w-359-px {
  width: 359px;
}
.h-359-px {
  height: 359px;
}
.w-359-perc {
  width: 359%;;
}
.h-359-perc {
  height: 359%;;
}
.w-360-px {
  width: 360px;
}
.h-360-px {
  height: 360px;
}
.w-360-perc {
  width: 360%;;
}
.h-360-perc {
  height: 360%;;
}
.w-361-px {
  width: 361px;
}
.h-361-px {
  height: 361px;
}
.w-361-perc {
  width: 361%;;
}
.h-361-perc {
  height: 361%;;
}
.w-362-px {
  width: 362px;
}
.h-362-px {
  height: 362px;
}
.w-362-perc {
  width: 362%;;
}
.h-362-perc {
  height: 362%;;
}
.w-363-px {
  width: 363px;
}
.h-363-px {
  height: 363px;
}
.w-363-perc {
  width: 363%;;
}
.h-363-perc {
  height: 363%;;
}
.w-364-px {
  width: 364px;
}
.h-364-px {
  height: 364px;
}
.w-364-perc {
  width: 364%;;
}
.h-364-perc {
  height: 364%;;
}
.w-365-px {
  width: 365px;
}
.h-365-px {
  height: 365px;
}
.w-365-perc {
  width: 365%;;
}
.h-365-perc {
  height: 365%;;
}
.w-366-px {
  width: 366px;
}
.h-366-px {
  height: 366px;
}
.w-366-perc {
  width: 366%;;
}
.h-366-perc {
  height: 366%;;
}
.w-367-px {
  width: 367px;
}
.h-367-px {
  height: 367px;
}
.w-367-perc {
  width: 367%;;
}
.h-367-perc {
  height: 367%;;
}
.w-368-px {
  width: 368px;
}
.h-368-px {
  height: 368px;
}
.w-368-perc {
  width: 368%;;
}
.h-368-perc {
  height: 368%;;
}
.w-369-px {
  width: 369px;
}
.h-369-px {
  height: 369px;
}
.w-369-perc {
  width: 369%;;
}
.h-369-perc {
  height: 369%;;
}
.w-370-px {
  width: 370px;
}
.h-370-px {
  height: 370px;
}
.w-370-perc {
  width: 370%;;
}
.h-370-perc {
  height: 370%;;
}
.w-371-px {
  width: 371px;
}
.h-371-px {
  height: 371px;
}
.w-371-perc {
  width: 371%;;
}
.h-371-perc {
  height: 371%;;
}
.w-372-px {
  width: 372px;
}
.h-372-px {
  height: 372px;
}
.w-372-perc {
  width: 372%;;
}
.h-372-perc {
  height: 372%;;
}
.w-373-px {
  width: 373px;
}
.h-373-px {
  height: 373px;
}
.w-373-perc {
  width: 373%;;
}
.h-373-perc {
  height: 373%;;
}
.w-374-px {
  width: 374px;
}
.h-374-px {
  height: 374px;
}
.w-374-perc {
  width: 374%;;
}
.h-374-perc {
  height: 374%;;
}
.w-375-px {
  width: 375px;
}
.h-375-px {
  height: 375px;
}
.w-375-perc {
  width: 375%;;
}
.h-375-perc {
  height: 375%;;
}
.w-376-px {
  width: 376px;
}
.h-376-px {
  height: 376px;
}
.w-376-perc {
  width: 376%;;
}
.h-376-perc {
  height: 376%;;
}
.w-377-px {
  width: 377px;
}
.h-377-px {
  height: 377px;
}
.w-377-perc {
  width: 377%;;
}
.h-377-perc {
  height: 377%;;
}
.w-378-px {
  width: 378px;
}
.h-378-px {
  height: 378px;
}
.w-378-perc {
  width: 378%;;
}
.h-378-perc {
  height: 378%;;
}
.w-379-px {
  width: 379px;
}
.h-379-px {
  height: 379px;
}
.w-379-perc {
  width: 379%;;
}
.h-379-perc {
  height: 379%;;
}
.w-380-px {
  width: 380px;
}
.h-380-px {
  height: 380px;
}
.w-380-perc {
  width: 380%;;
}
.h-380-perc {
  height: 380%;;
}
.w-381-px {
  width: 381px;
}
.h-381-px {
  height: 381px;
}
.w-381-perc {
  width: 381%;;
}
.h-381-perc {
  height: 381%;;
}
.w-382-px {
  width: 382px;
}
.h-382-px {
  height: 382px;
}
.w-382-perc {
  width: 382%;;
}
.h-382-perc {
  height: 382%;;
}
.w-383-px {
  width: 383px;
}
.h-383-px {
  height: 383px;
}
.w-383-perc {
  width: 383%;;
}
.h-383-perc {
  height: 383%;;
}
.w-384-px {
  width: 384px;
}
.h-384-px {
  height: 384px;
}
.w-384-perc {
  width: 384%;;
}
.h-384-perc {
  height: 384%;;
}
.w-385-px {
  width: 385px;
}
.h-385-px {
  height: 385px;
}
.w-385-perc {
  width: 385%;;
}
.h-385-perc {
  height: 385%;;
}
.w-386-px {
  width: 386px;
}
.h-386-px {
  height: 386px;
}
.w-386-perc {
  width: 386%;;
}
.h-386-perc {
  height: 386%;;
}
.w-387-px {
  width: 387px;
}
.h-387-px {
  height: 387px;
}
.w-387-perc {
  width: 387%;;
}
.h-387-perc {
  height: 387%;;
}
.w-388-px {
  width: 388px;
}
.h-388-px {
  height: 388px;
}
.w-388-perc {
  width: 388%;;
}
.h-388-perc {
  height: 388%;;
}
.w-389-px {
  width: 389px;
}
.h-389-px {
  height: 389px;
}
.w-389-perc {
  width: 389%;;
}
.h-389-perc {
  height: 389%;;
}
.w-390-px {
  width: 390px;
}
.h-390-px {
  height: 390px;
}
.w-390-perc {
  width: 390%;;
}
.h-390-perc {
  height: 390%;;
}
.w-391-px {
  width: 391px;
}
.h-391-px {
  height: 391px;
}
.w-391-perc {
  width: 391%;;
}
.h-391-perc {
  height: 391%;;
}
.w-392-px {
  width: 392px;
}
.h-392-px {
  height: 392px;
}
.w-392-perc {
  width: 392%;;
}
.h-392-perc {
  height: 392%;;
}
.w-393-px {
  width: 393px;
}
.h-393-px {
  height: 393px;
}
.w-393-perc {
  width: 393%;;
}
.h-393-perc {
  height: 393%;;
}
.w-394-px {
  width: 394px;
}
.h-394-px {
  height: 394px;
}
.w-394-perc {
  width: 394%;;
}
.h-394-perc {
  height: 394%;;
}
.w-395-px {
  width: 395px;
}
.h-395-px {
  height: 395px;
}
.w-395-perc {
  width: 395%;;
}
.h-395-perc {
  height: 395%;;
}
.w-396-px {
  width: 396px;
}
.h-396-px {
  height: 396px;
}
.w-396-perc {
  width: 396%;;
}
.h-396-perc {
  height: 396%;;
}
.w-397-px {
  width: 397px;
}
.h-397-px {
  height: 397px;
}
.w-397-perc {
  width: 397%;;
}
.h-397-perc {
  height: 397%;;
}
.w-398-px {
  width: 398px;
}
.h-398-px {
  height: 398px;
}
.w-398-perc {
  width: 398%;;
}
.h-398-perc {
  height: 398%;;
}
.w-399-px {
  width: 399px;
}
.h-399-px {
  height: 399px;
}
.w-399-perc {
  width: 399%;;
}
.h-399-perc {
  height: 399%;;
}
.w-400-px {
  width: 400px;
}
.h-400-px {
  height: 400px;
}
.w-400-perc {
  width: 400%;;
}
.h-400-perc {
  height: 400%;;
}
@media (min-width: 480px) {
  [class*="w-xl-"], [class*="w-lg-"], [class*="w-md"] {
    width: initial;
  }
  [class*="h-xl-"], [class*="h-lg-"], [class*="h-md"] {
    height: initial;
  }
  .w-sm-1-px {
    width: 1px;
  }
  .h-sm-1-px {
    height: 1px;
  }
  .w-sm-1-perc {
    width: 1%;;
  }
  .h-sm-1-perc {
    height: 1%;;
  }
  .w-sm-2-px {
    width: 2px;
  }
  .h-sm-2-px {
    height: 2px;
  }
  .w-sm-2-perc {
    width: 2%;;
  }
  .h-sm-2-perc {
    height: 2%;;
  }
  .w-sm-3-px {
    width: 3px;
  }
  .h-sm-3-px {
    height: 3px;
  }
  .w-sm-3-perc {
    width: 3%;;
  }
  .h-sm-3-perc {
    height: 3%;;
  }
  .w-sm-4-px {
    width: 4px;
  }
  .h-sm-4-px {
    height: 4px;
  }
  .w-sm-4-perc {
    width: 4%;;
  }
  .h-sm-4-perc {
    height: 4%;;
  }
  .w-sm-5-px {
    width: 5px;
  }
  .h-sm-5-px {
    height: 5px;
  }
  .w-sm-5-perc {
    width: 5%;;
  }
  .h-sm-5-perc {
    height: 5%;;
  }
  .w-sm-6-px {
    width: 6px;
  }
  .h-sm-6-px {
    height: 6px;
  }
  .w-sm-6-perc {
    width: 6%;;
  }
  .h-sm-6-perc {
    height: 6%;;
  }
  .w-sm-7-px {
    width: 7px;
  }
  .h-sm-7-px {
    height: 7px;
  }
  .w-sm-7-perc {
    width: 7%;;
  }
  .h-sm-7-perc {
    height: 7%;;
  }
  .w-sm-8-px {
    width: 8px;
  }
  .h-sm-8-px {
    height: 8px;
  }
  .w-sm-8-perc {
    width: 8%;;
  }
  .h-sm-8-perc {
    height: 8%;;
  }
  .w-sm-9-px {
    width: 9px;
  }
  .h-sm-9-px {
    height: 9px;
  }
  .w-sm-9-perc {
    width: 9%;;
  }
  .h-sm-9-perc {
    height: 9%;;
  }
  .w-sm-10-px {
    width: 10px;
  }
  .h-sm-10-px {
    height: 10px;
  }
  .w-sm-10-perc {
    width: 10%;;
  }
  .h-sm-10-perc {
    height: 10%;;
  }
  .w-sm-11-px {
    width: 11px;
  }
  .h-sm-11-px {
    height: 11px;
  }
  .w-sm-11-perc {
    width: 11%;;
  }
  .h-sm-11-perc {
    height: 11%;;
  }
  .w-sm-12-px {
    width: 12px;
  }
  .h-sm-12-px {
    height: 12px;
  }
  .w-sm-12-perc {
    width: 12%;;
  }
  .h-sm-12-perc {
    height: 12%;;
  }
  .w-sm-13-px {
    width: 13px;
  }
  .h-sm-13-px {
    height: 13px;
  }
  .w-sm-13-perc {
    width: 13%;;
  }
  .h-sm-13-perc {
    height: 13%;;
  }
  .w-sm-14-px {
    width: 14px;
  }
  .h-sm-14-px {
    height: 14px;
  }
  .w-sm-14-perc {
    width: 14%;;
  }
  .h-sm-14-perc {
    height: 14%;;
  }
  .w-sm-15-px {
    width: 15px;
  }
  .h-sm-15-px {
    height: 15px;
  }
  .w-sm-15-perc {
    width: 15%;;
  }
  .h-sm-15-perc {
    height: 15%;;
  }
  .w-sm-16-px {
    width: 16px;
  }
  .h-sm-16-px {
    height: 16px;
  }
  .w-sm-16-perc {
    width: 16%;;
  }
  .h-sm-16-perc {
    height: 16%;;
  }
  .w-sm-17-px {
    width: 17px;
  }
  .h-sm-17-px {
    height: 17px;
  }
  .w-sm-17-perc {
    width: 17%;;
  }
  .h-sm-17-perc {
    height: 17%;;
  }
  .w-sm-18-px {
    width: 18px;
  }
  .h-sm-18-px {
    height: 18px;
  }
  .w-sm-18-perc {
    width: 18%;;
  }
  .h-sm-18-perc {
    height: 18%;;
  }
  .w-sm-19-px {
    width: 19px;
  }
  .h-sm-19-px {
    height: 19px;
  }
  .w-sm-19-perc {
    width: 19%;;
  }
  .h-sm-19-perc {
    height: 19%;;
  }
  .w-sm-20-px {
    width: 20px;
  }
  .h-sm-20-px {
    height: 20px;
  }
  .w-sm-20-perc {
    width: 20%;;
  }
  .h-sm-20-perc {
    height: 20%;;
  }
  .w-sm-21-px {
    width: 21px;
  }
  .h-sm-21-px {
    height: 21px;
  }
  .w-sm-21-perc {
    width: 21%;;
  }
  .h-sm-21-perc {
    height: 21%;;
  }
  .w-sm-22-px {
    width: 22px;
  }
  .h-sm-22-px {
    height: 22px;
  }
  .w-sm-22-perc {
    width: 22%;;
  }
  .h-sm-22-perc {
    height: 22%;;
  }
  .w-sm-23-px {
    width: 23px;
  }
  .h-sm-23-px {
    height: 23px;
  }
  .w-sm-23-perc {
    width: 23%;;
  }
  .h-sm-23-perc {
    height: 23%;;
  }
  .w-sm-24-px {
    width: 24px;
  }
  .h-sm-24-px {
    height: 24px;
  }
  .w-sm-24-perc {
    width: 24%;;
  }
  .h-sm-24-perc {
    height: 24%;;
  }
  .w-sm-25-px {
    width: 25px;
  }
  .h-sm-25-px {
    height: 25px;
  }
  .w-sm-25-perc {
    width: 25%;;
  }
  .h-sm-25-perc {
    height: 25%;;
  }
  .w-sm-26-px {
    width: 26px;
  }
  .h-sm-26-px {
    height: 26px;
  }
  .w-sm-26-perc {
    width: 26%;;
  }
  .h-sm-26-perc {
    height: 26%;;
  }
  .w-sm-27-px {
    width: 27px;
  }
  .h-sm-27-px {
    height: 27px;
  }
  .w-sm-27-perc {
    width: 27%;;
  }
  .h-sm-27-perc {
    height: 27%;;
  }
  .w-sm-28-px {
    width: 28px;
  }
  .h-sm-28-px {
    height: 28px;
  }
  .w-sm-28-perc {
    width: 28%;;
  }
  .h-sm-28-perc {
    height: 28%;;
  }
  .w-sm-29-px {
    width: 29px;
  }
  .h-sm-29-px {
    height: 29px;
  }
  .w-sm-29-perc {
    width: 29%;;
  }
  .h-sm-29-perc {
    height: 29%;;
  }
  .w-sm-30-px {
    width: 30px;
  }
  .h-sm-30-px {
    height: 30px;
  }
  .w-sm-30-perc {
    width: 30%;;
  }
  .h-sm-30-perc {
    height: 30%;;
  }
  .w-sm-31-px {
    width: 31px;
  }
  .h-sm-31-px {
    height: 31px;
  }
  .w-sm-31-perc {
    width: 31%;;
  }
  .h-sm-31-perc {
    height: 31%;;
  }
  .w-sm-32-px {
    width: 32px;
  }
  .h-sm-32-px {
    height: 32px;
  }
  .w-sm-32-perc {
    width: 32%;;
  }
  .h-sm-32-perc {
    height: 32%;;
  }
  .w-sm-33-px {
    width: 33px;
  }
  .h-sm-33-px {
    height: 33px;
  }
  .w-sm-33-perc {
    width: 33%;;
  }
  .h-sm-33-perc {
    height: 33%;;
  }
  .w-sm-34-px {
    width: 34px;
  }
  .h-sm-34-px {
    height: 34px;
  }
  .w-sm-34-perc {
    width: 34%;;
  }
  .h-sm-34-perc {
    height: 34%;;
  }
  .w-sm-35-px {
    width: 35px;
  }
  .h-sm-35-px {
    height: 35px;
  }
  .w-sm-35-perc {
    width: 35%;;
  }
  .h-sm-35-perc {
    height: 35%;;
  }
  .w-sm-36-px {
    width: 36px;
  }
  .h-sm-36-px {
    height: 36px;
  }
  .w-sm-36-perc {
    width: 36%;;
  }
  .h-sm-36-perc {
    height: 36%;;
  }
  .w-sm-37-px {
    width: 37px;
  }
  .h-sm-37-px {
    height: 37px;
  }
  .w-sm-37-perc {
    width: 37%;;
  }
  .h-sm-37-perc {
    height: 37%;;
  }
  .w-sm-38-px {
    width: 38px;
  }
  .h-sm-38-px {
    height: 38px;
  }
  .w-sm-38-perc {
    width: 38%;;
  }
  .h-sm-38-perc {
    height: 38%;;
  }
  .w-sm-39-px {
    width: 39px;
  }
  .h-sm-39-px {
    height: 39px;
  }
  .w-sm-39-perc {
    width: 39%;;
  }
  .h-sm-39-perc {
    height: 39%;;
  }
  .w-sm-40-px {
    width: 40px;
  }
  .h-sm-40-px {
    height: 40px;
  }
  .w-sm-40-perc {
    width: 40%;;
  }
  .h-sm-40-perc {
    height: 40%;;
  }
  .w-sm-41-px {
    width: 41px;
  }
  .h-sm-41-px {
    height: 41px;
  }
  .w-sm-41-perc {
    width: 41%;;
  }
  .h-sm-41-perc {
    height: 41%;;
  }
  .w-sm-42-px {
    width: 42px;
  }
  .h-sm-42-px {
    height: 42px;
  }
  .w-sm-42-perc {
    width: 42%;;
  }
  .h-sm-42-perc {
    height: 42%;;
  }
  .w-sm-43-px {
    width: 43px;
  }
  .h-sm-43-px {
    height: 43px;
  }
  .w-sm-43-perc {
    width: 43%;;
  }
  .h-sm-43-perc {
    height: 43%;;
  }
  .w-sm-44-px {
    width: 44px;
  }
  .h-sm-44-px {
    height: 44px;
  }
  .w-sm-44-perc {
    width: 44%;;
  }
  .h-sm-44-perc {
    height: 44%;;
  }
  .w-sm-45-px {
    width: 45px;
  }
  .h-sm-45-px {
    height: 45px;
  }
  .w-sm-45-perc {
    width: 45%;;
  }
  .h-sm-45-perc {
    height: 45%;;
  }
  .w-sm-46-px {
    width: 46px;
  }
  .h-sm-46-px {
    height: 46px;
  }
  .w-sm-46-perc {
    width: 46%;;
  }
  .h-sm-46-perc {
    height: 46%;;
  }
  .w-sm-47-px {
    width: 47px;
  }
  .h-sm-47-px {
    height: 47px;
  }
  .w-sm-47-perc {
    width: 47%;;
  }
  .h-sm-47-perc {
    height: 47%;;
  }
  .w-sm-48-px {
    width: 48px;
  }
  .h-sm-48-px {
    height: 48px;
  }
  .w-sm-48-perc {
    width: 48%;;
  }
  .h-sm-48-perc {
    height: 48%;;
  }
  .w-sm-49-px {
    width: 49px;
  }
  .h-sm-49-px {
    height: 49px;
  }
  .w-sm-49-perc {
    width: 49%;;
  }
  .h-sm-49-perc {
    height: 49%;;
  }
  .w-sm-50-px {
    width: 50px;
  }
  .h-sm-50-px {
    height: 50px;
  }
  .w-sm-50-perc {
    width: 50%;;
  }
  .h-sm-50-perc {
    height: 50%;;
  }
  .w-sm-51-px {
    width: 51px;
  }
  .h-sm-51-px {
    height: 51px;
  }
  .w-sm-51-perc {
    width: 51%;;
  }
  .h-sm-51-perc {
    height: 51%;;
  }
  .w-sm-52-px {
    width: 52px;
  }
  .h-sm-52-px {
    height: 52px;
  }
  .w-sm-52-perc {
    width: 52%;;
  }
  .h-sm-52-perc {
    height: 52%;;
  }
  .w-sm-53-px {
    width: 53px;
  }
  .h-sm-53-px {
    height: 53px;
  }
  .w-sm-53-perc {
    width: 53%;;
  }
  .h-sm-53-perc {
    height: 53%;;
  }
  .w-sm-54-px {
    width: 54px;
  }
  .h-sm-54-px {
    height: 54px;
  }
  .w-sm-54-perc {
    width: 54%;;
  }
  .h-sm-54-perc {
    height: 54%;;
  }
  .w-sm-55-px {
    width: 55px;
  }
  .h-sm-55-px {
    height: 55px;
  }
  .w-sm-55-perc {
    width: 55%;;
  }
  .h-sm-55-perc {
    height: 55%;;
  }
  .w-sm-56-px {
    width: 56px;
  }
  .h-sm-56-px {
    height: 56px;
  }
  .w-sm-56-perc {
    width: 56%;;
  }
  .h-sm-56-perc {
    height: 56%;;
  }
  .w-sm-57-px {
    width: 57px;
  }
  .h-sm-57-px {
    height: 57px;
  }
  .w-sm-57-perc {
    width: 57%;;
  }
  .h-sm-57-perc {
    height: 57%;;
  }
  .w-sm-58-px {
    width: 58px;
  }
  .h-sm-58-px {
    height: 58px;
  }
  .w-sm-58-perc {
    width: 58%;;
  }
  .h-sm-58-perc {
    height: 58%;;
  }
  .w-sm-59-px {
    width: 59px;
  }
  .h-sm-59-px {
    height: 59px;
  }
  .w-sm-59-perc {
    width: 59%;;
  }
  .h-sm-59-perc {
    height: 59%;;
  }
  .w-sm-60-px {
    width: 60px;
  }
  .h-sm-60-px {
    height: 60px;
  }
  .w-sm-60-perc {
    width: 60%;;
  }
  .h-sm-60-perc {
    height: 60%;;
  }
  .w-sm-61-px {
    width: 61px;
  }
  .h-sm-61-px {
    height: 61px;
  }
  .w-sm-61-perc {
    width: 61%;;
  }
  .h-sm-61-perc {
    height: 61%;;
  }
  .w-sm-62-px {
    width: 62px;
  }
  .h-sm-62-px {
    height: 62px;
  }
  .w-sm-62-perc {
    width: 62%;;
  }
  .h-sm-62-perc {
    height: 62%;;
  }
  .w-sm-63-px {
    width: 63px;
  }
  .h-sm-63-px {
    height: 63px;
  }
  .w-sm-63-perc {
    width: 63%;;
  }
  .h-sm-63-perc {
    height: 63%;;
  }
  .w-sm-64-px {
    width: 64px;
  }
  .h-sm-64-px {
    height: 64px;
  }
  .w-sm-64-perc {
    width: 64%;;
  }
  .h-sm-64-perc {
    height: 64%;;
  }
  .w-sm-65-px {
    width: 65px;
  }
  .h-sm-65-px {
    height: 65px;
  }
  .w-sm-65-perc {
    width: 65%;;
  }
  .h-sm-65-perc {
    height: 65%;;
  }
  .w-sm-66-px {
    width: 66px;
  }
  .h-sm-66-px {
    height: 66px;
  }
  .w-sm-66-perc {
    width: 66%;;
  }
  .h-sm-66-perc {
    height: 66%;;
  }
  .w-sm-67-px {
    width: 67px;
  }
  .h-sm-67-px {
    height: 67px;
  }
  .w-sm-67-perc {
    width: 67%;;
  }
  .h-sm-67-perc {
    height: 67%;;
  }
  .w-sm-68-px {
    width: 68px;
  }
  .h-sm-68-px {
    height: 68px;
  }
  .w-sm-68-perc {
    width: 68%;;
  }
  .h-sm-68-perc {
    height: 68%;;
  }
  .w-sm-69-px {
    width: 69px;
  }
  .h-sm-69-px {
    height: 69px;
  }
  .w-sm-69-perc {
    width: 69%;;
  }
  .h-sm-69-perc {
    height: 69%;;
  }
  .w-sm-70-px {
    width: 70px;
  }
  .h-sm-70-px {
    height: 70px;
  }
  .w-sm-70-perc {
    width: 70%;;
  }
  .h-sm-70-perc {
    height: 70%;;
  }
  .w-sm-71-px {
    width: 71px;
  }
  .h-sm-71-px {
    height: 71px;
  }
  .w-sm-71-perc {
    width: 71%;;
  }
  .h-sm-71-perc {
    height: 71%;;
  }
  .w-sm-72-px {
    width: 72px;
  }
  .h-sm-72-px {
    height: 72px;
  }
  .w-sm-72-perc {
    width: 72%;;
  }
  .h-sm-72-perc {
    height: 72%;;
  }
  .w-sm-73-px {
    width: 73px;
  }
  .h-sm-73-px {
    height: 73px;
  }
  .w-sm-73-perc {
    width: 73%;;
  }
  .h-sm-73-perc {
    height: 73%;;
  }
  .w-sm-74-px {
    width: 74px;
  }
  .h-sm-74-px {
    height: 74px;
  }
  .w-sm-74-perc {
    width: 74%;;
  }
  .h-sm-74-perc {
    height: 74%;;
  }
  .w-sm-75-px {
    width: 75px;
  }
  .h-sm-75-px {
    height: 75px;
  }
  .w-sm-75-perc {
    width: 75%;;
  }
  .h-sm-75-perc {
    height: 75%;;
  }
  .w-sm-76-px {
    width: 76px;
  }
  .h-sm-76-px {
    height: 76px;
  }
  .w-sm-76-perc {
    width: 76%;;
  }
  .h-sm-76-perc {
    height: 76%;;
  }
  .w-sm-77-px {
    width: 77px;
  }
  .h-sm-77-px {
    height: 77px;
  }
  .w-sm-77-perc {
    width: 77%;;
  }
  .h-sm-77-perc {
    height: 77%;;
  }
  .w-sm-78-px {
    width: 78px;
  }
  .h-sm-78-px {
    height: 78px;
  }
  .w-sm-78-perc {
    width: 78%;;
  }
  .h-sm-78-perc {
    height: 78%;;
  }
  .w-sm-79-px {
    width: 79px;
  }
  .h-sm-79-px {
    height: 79px;
  }
  .w-sm-79-perc {
    width: 79%;;
  }
  .h-sm-79-perc {
    height: 79%;;
  }
  .w-sm-80-px {
    width: 80px;
  }
  .h-sm-80-px {
    height: 80px;
  }
  .w-sm-80-perc {
    width: 80%;;
  }
  .h-sm-80-perc {
    height: 80%;;
  }
  .w-sm-81-px {
    width: 81px;
  }
  .h-sm-81-px {
    height: 81px;
  }
  .w-sm-81-perc {
    width: 81%;;
  }
  .h-sm-81-perc {
    height: 81%;;
  }
  .w-sm-82-px {
    width: 82px;
  }
  .h-sm-82-px {
    height: 82px;
  }
  .w-sm-82-perc {
    width: 82%;;
  }
  .h-sm-82-perc {
    height: 82%;;
  }
  .w-sm-83-px {
    width: 83px;
  }
  .h-sm-83-px {
    height: 83px;
  }
  .w-sm-83-perc {
    width: 83%;;
  }
  .h-sm-83-perc {
    height: 83%;;
  }
  .w-sm-84-px {
    width: 84px;
  }
  .h-sm-84-px {
    height: 84px;
  }
  .w-sm-84-perc {
    width: 84%;;
  }
  .h-sm-84-perc {
    height: 84%;;
  }
  .w-sm-85-px {
    width: 85px;
  }
  .h-sm-85-px {
    height: 85px;
  }
  .w-sm-85-perc {
    width: 85%;;
  }
  .h-sm-85-perc {
    height: 85%;;
  }
  .w-sm-86-px {
    width: 86px;
  }
  .h-sm-86-px {
    height: 86px;
  }
  .w-sm-86-perc {
    width: 86%;;
  }
  .h-sm-86-perc {
    height: 86%;;
  }
  .w-sm-87-px {
    width: 87px;
  }
  .h-sm-87-px {
    height: 87px;
  }
  .w-sm-87-perc {
    width: 87%;;
  }
  .h-sm-87-perc {
    height: 87%;;
  }
  .w-sm-88-px {
    width: 88px;
  }
  .h-sm-88-px {
    height: 88px;
  }
  .w-sm-88-perc {
    width: 88%;;
  }
  .h-sm-88-perc {
    height: 88%;;
  }
  .w-sm-89-px {
    width: 89px;
  }
  .h-sm-89-px {
    height: 89px;
  }
  .w-sm-89-perc {
    width: 89%;;
  }
  .h-sm-89-perc {
    height: 89%;;
  }
  .w-sm-90-px {
    width: 90px;
  }
  .h-sm-90-px {
    height: 90px;
  }
  .w-sm-90-perc {
    width: 90%;;
  }
  .h-sm-90-perc {
    height: 90%;;
  }
  .w-sm-91-px {
    width: 91px;
  }
  .h-sm-91-px {
    height: 91px;
  }
  .w-sm-91-perc {
    width: 91%;;
  }
  .h-sm-91-perc {
    height: 91%;;
  }
  .w-sm-92-px {
    width: 92px;
  }
  .h-sm-92-px {
    height: 92px;
  }
  .w-sm-92-perc {
    width: 92%;;
  }
  .h-sm-92-perc {
    height: 92%;;
  }
  .w-sm-93-px {
    width: 93px;
  }
  .h-sm-93-px {
    height: 93px;
  }
  .w-sm-93-perc {
    width: 93%;;
  }
  .h-sm-93-perc {
    height: 93%;;
  }
  .w-sm-94-px {
    width: 94px;
  }
  .h-sm-94-px {
    height: 94px;
  }
  .w-sm-94-perc {
    width: 94%;;
  }
  .h-sm-94-perc {
    height: 94%;;
  }
  .w-sm-95-px {
    width: 95px;
  }
  .h-sm-95-px {
    height: 95px;
  }
  .w-sm-95-perc {
    width: 95%;;
  }
  .h-sm-95-perc {
    height: 95%;;
  }
  .w-sm-96-px {
    width: 96px;
  }
  .h-sm-96-px {
    height: 96px;
  }
  .w-sm-96-perc {
    width: 96%;;
  }
  .h-sm-96-perc {
    height: 96%;;
  }
  .w-sm-97-px {
    width: 97px;
  }
  .h-sm-97-px {
    height: 97px;
  }
  .w-sm-97-perc {
    width: 97%;;
  }
  .h-sm-97-perc {
    height: 97%;;
  }
  .w-sm-98-px {
    width: 98px;
  }
  .h-sm-98-px {
    height: 98px;
  }
  .w-sm-98-perc {
    width: 98%;;
  }
  .h-sm-98-perc {
    height: 98%;;
  }
  .w-sm-99-px {
    width: 99px;
  }
  .h-sm-99-px {
    height: 99px;
  }
  .w-sm-99-perc {
    width: 99%;;
  }
  .h-sm-99-perc {
    height: 99%;;
  }
  .w-sm-100-px {
    width: 100px;
  }
  .h-sm-100-px {
    height: 100px;
  }
  .w-sm-100-perc {
    width: 100%;;
  }
  .h-sm-100-perc {
    height: 100%;;
  }
  .w-sm-101-px {
    width: 101px;
  }
  .h-sm-101-px {
    height: 101px;
  }
  .w-sm-101-perc {
    width: 101%;;
  }
  .h-sm-101-perc {
    height: 101%;;
  }
  .w-sm-102-px {
    width: 102px;
  }
  .h-sm-102-px {
    height: 102px;
  }
  .w-sm-102-perc {
    width: 102%;;
  }
  .h-sm-102-perc {
    height: 102%;;
  }
  .w-sm-103-px {
    width: 103px;
  }
  .h-sm-103-px {
    height: 103px;
  }
  .w-sm-103-perc {
    width: 103%;;
  }
  .h-sm-103-perc {
    height: 103%;;
  }
  .w-sm-104-px {
    width: 104px;
  }
  .h-sm-104-px {
    height: 104px;
  }
  .w-sm-104-perc {
    width: 104%;;
  }
  .h-sm-104-perc {
    height: 104%;;
  }
  .w-sm-105-px {
    width: 105px;
  }
  .h-sm-105-px {
    height: 105px;
  }
  .w-sm-105-perc {
    width: 105%;;
  }
  .h-sm-105-perc {
    height: 105%;;
  }
  .w-sm-106-px {
    width: 106px;
  }
  .h-sm-106-px {
    height: 106px;
  }
  .w-sm-106-perc {
    width: 106%;;
  }
  .h-sm-106-perc {
    height: 106%;;
  }
  .w-sm-107-px {
    width: 107px;
  }
  .h-sm-107-px {
    height: 107px;
  }
  .w-sm-107-perc {
    width: 107%;;
  }
  .h-sm-107-perc {
    height: 107%;;
  }
  .w-sm-108-px {
    width: 108px;
  }
  .h-sm-108-px {
    height: 108px;
  }
  .w-sm-108-perc {
    width: 108%;;
  }
  .h-sm-108-perc {
    height: 108%;;
  }
  .w-sm-109-px {
    width: 109px;
  }
  .h-sm-109-px {
    height: 109px;
  }
  .w-sm-109-perc {
    width: 109%;;
  }
  .h-sm-109-perc {
    height: 109%;;
  }
  .w-sm-110-px {
    width: 110px;
  }
  .h-sm-110-px {
    height: 110px;
  }
  .w-sm-110-perc {
    width: 110%;;
  }
  .h-sm-110-perc {
    height: 110%;;
  }
  .w-sm-111-px {
    width: 111px;
  }
  .h-sm-111-px {
    height: 111px;
  }
  .w-sm-111-perc {
    width: 111%;;
  }
  .h-sm-111-perc {
    height: 111%;;
  }
  .w-sm-112-px {
    width: 112px;
  }
  .h-sm-112-px {
    height: 112px;
  }
  .w-sm-112-perc {
    width: 112%;;
  }
  .h-sm-112-perc {
    height: 112%;;
  }
  .w-sm-113-px {
    width: 113px;
  }
  .h-sm-113-px {
    height: 113px;
  }
  .w-sm-113-perc {
    width: 113%;;
  }
  .h-sm-113-perc {
    height: 113%;;
  }
  .w-sm-114-px {
    width: 114px;
  }
  .h-sm-114-px {
    height: 114px;
  }
  .w-sm-114-perc {
    width: 114%;;
  }
  .h-sm-114-perc {
    height: 114%;;
  }
  .w-sm-115-px {
    width: 115px;
  }
  .h-sm-115-px {
    height: 115px;
  }
  .w-sm-115-perc {
    width: 115%;;
  }
  .h-sm-115-perc {
    height: 115%;;
  }
  .w-sm-116-px {
    width: 116px;
  }
  .h-sm-116-px {
    height: 116px;
  }
  .w-sm-116-perc {
    width: 116%;;
  }
  .h-sm-116-perc {
    height: 116%;;
  }
  .w-sm-117-px {
    width: 117px;
  }
  .h-sm-117-px {
    height: 117px;
  }
  .w-sm-117-perc {
    width: 117%;;
  }
  .h-sm-117-perc {
    height: 117%;;
  }
  .w-sm-118-px {
    width: 118px;
  }
  .h-sm-118-px {
    height: 118px;
  }
  .w-sm-118-perc {
    width: 118%;;
  }
  .h-sm-118-perc {
    height: 118%;;
  }
  .w-sm-119-px {
    width: 119px;
  }
  .h-sm-119-px {
    height: 119px;
  }
  .w-sm-119-perc {
    width: 119%;;
  }
  .h-sm-119-perc {
    height: 119%;;
  }
  .w-sm-120-px {
    width: 120px;
  }
  .h-sm-120-px {
    height: 120px;
  }
  .w-sm-120-perc {
    width: 120%;;
  }
  .h-sm-120-perc {
    height: 120%;;
  }
  .w-sm-121-px {
    width: 121px;
  }
  .h-sm-121-px {
    height: 121px;
  }
  .w-sm-121-perc {
    width: 121%;;
  }
  .h-sm-121-perc {
    height: 121%;;
  }
  .w-sm-122-px {
    width: 122px;
  }
  .h-sm-122-px {
    height: 122px;
  }
  .w-sm-122-perc {
    width: 122%;;
  }
  .h-sm-122-perc {
    height: 122%;;
  }
  .w-sm-123-px {
    width: 123px;
  }
  .h-sm-123-px {
    height: 123px;
  }
  .w-sm-123-perc {
    width: 123%;;
  }
  .h-sm-123-perc {
    height: 123%;;
  }
  .w-sm-124-px {
    width: 124px;
  }
  .h-sm-124-px {
    height: 124px;
  }
  .w-sm-124-perc {
    width: 124%;;
  }
  .h-sm-124-perc {
    height: 124%;;
  }
  .w-sm-125-px {
    width: 125px;
  }
  .h-sm-125-px {
    height: 125px;
  }
  .w-sm-125-perc {
    width: 125%;;
  }
  .h-sm-125-perc {
    height: 125%;;
  }
  .w-sm-126-px {
    width: 126px;
  }
  .h-sm-126-px {
    height: 126px;
  }
  .w-sm-126-perc {
    width: 126%;;
  }
  .h-sm-126-perc {
    height: 126%;;
  }
  .w-sm-127-px {
    width: 127px;
  }
  .h-sm-127-px {
    height: 127px;
  }
  .w-sm-127-perc {
    width: 127%;;
  }
  .h-sm-127-perc {
    height: 127%;;
  }
  .w-sm-128-px {
    width: 128px;
  }
  .h-sm-128-px {
    height: 128px;
  }
  .w-sm-128-perc {
    width: 128%;;
  }
  .h-sm-128-perc {
    height: 128%;;
  }
  .w-sm-129-px {
    width: 129px;
  }
  .h-sm-129-px {
    height: 129px;
  }
  .w-sm-129-perc {
    width: 129%;;
  }
  .h-sm-129-perc {
    height: 129%;;
  }
  .w-sm-130-px {
    width: 130px;
  }
  .h-sm-130-px {
    height: 130px;
  }
  .w-sm-130-perc {
    width: 130%;;
  }
  .h-sm-130-perc {
    height: 130%;;
  }
  .w-sm-131-px {
    width: 131px;
  }
  .h-sm-131-px {
    height: 131px;
  }
  .w-sm-131-perc {
    width: 131%;;
  }
  .h-sm-131-perc {
    height: 131%;;
  }
  .w-sm-132-px {
    width: 132px;
  }
  .h-sm-132-px {
    height: 132px;
  }
  .w-sm-132-perc {
    width: 132%;;
  }
  .h-sm-132-perc {
    height: 132%;;
  }
  .w-sm-133-px {
    width: 133px;
  }
  .h-sm-133-px {
    height: 133px;
  }
  .w-sm-133-perc {
    width: 133%;;
  }
  .h-sm-133-perc {
    height: 133%;;
  }
  .w-sm-134-px {
    width: 134px;
  }
  .h-sm-134-px {
    height: 134px;
  }
  .w-sm-134-perc {
    width: 134%;;
  }
  .h-sm-134-perc {
    height: 134%;;
  }
  .w-sm-135-px {
    width: 135px;
  }
  .h-sm-135-px {
    height: 135px;
  }
  .w-sm-135-perc {
    width: 135%;;
  }
  .h-sm-135-perc {
    height: 135%;;
  }
  .w-sm-136-px {
    width: 136px;
  }
  .h-sm-136-px {
    height: 136px;
  }
  .w-sm-136-perc {
    width: 136%;;
  }
  .h-sm-136-perc {
    height: 136%;;
  }
  .w-sm-137-px {
    width: 137px;
  }
  .h-sm-137-px {
    height: 137px;
  }
  .w-sm-137-perc {
    width: 137%;;
  }
  .h-sm-137-perc {
    height: 137%;;
  }
  .w-sm-138-px {
    width: 138px;
  }
  .h-sm-138-px {
    height: 138px;
  }
  .w-sm-138-perc {
    width: 138%;;
  }
  .h-sm-138-perc {
    height: 138%;;
  }
  .w-sm-139-px {
    width: 139px;
  }
  .h-sm-139-px {
    height: 139px;
  }
  .w-sm-139-perc {
    width: 139%;;
  }
  .h-sm-139-perc {
    height: 139%;;
  }
  .w-sm-140-px {
    width: 140px;
  }
  .h-sm-140-px {
    height: 140px;
  }
  .w-sm-140-perc {
    width: 140%;;
  }
  .h-sm-140-perc {
    height: 140%;;
  }
  .w-sm-141-px {
    width: 141px;
  }
  .h-sm-141-px {
    height: 141px;
  }
  .w-sm-141-perc {
    width: 141%;;
  }
  .h-sm-141-perc {
    height: 141%;;
  }
  .w-sm-142-px {
    width: 142px;
  }
  .h-sm-142-px {
    height: 142px;
  }
  .w-sm-142-perc {
    width: 142%;;
  }
  .h-sm-142-perc {
    height: 142%;;
  }
  .w-sm-143-px {
    width: 143px;
  }
  .h-sm-143-px {
    height: 143px;
  }
  .w-sm-143-perc {
    width: 143%;;
  }
  .h-sm-143-perc {
    height: 143%;;
  }
  .w-sm-144-px {
    width: 144px;
  }
  .h-sm-144-px {
    height: 144px;
  }
  .w-sm-144-perc {
    width: 144%;;
  }
  .h-sm-144-perc {
    height: 144%;;
  }
  .w-sm-145-px {
    width: 145px;
  }
  .h-sm-145-px {
    height: 145px;
  }
  .w-sm-145-perc {
    width: 145%;;
  }
  .h-sm-145-perc {
    height: 145%;;
  }
  .w-sm-146-px {
    width: 146px;
  }
  .h-sm-146-px {
    height: 146px;
  }
  .w-sm-146-perc {
    width: 146%;;
  }
  .h-sm-146-perc {
    height: 146%;;
  }
  .w-sm-147-px {
    width: 147px;
  }
  .h-sm-147-px {
    height: 147px;
  }
  .w-sm-147-perc {
    width: 147%;;
  }
  .h-sm-147-perc {
    height: 147%;;
  }
  .w-sm-148-px {
    width: 148px;
  }
  .h-sm-148-px {
    height: 148px;
  }
  .w-sm-148-perc {
    width: 148%;;
  }
  .h-sm-148-perc {
    height: 148%;;
  }
  .w-sm-149-px {
    width: 149px;
  }
  .h-sm-149-px {
    height: 149px;
  }
  .w-sm-149-perc {
    width: 149%;;
  }
  .h-sm-149-perc {
    height: 149%;;
  }
  .w-sm-150-px {
    width: 150px;
  }
  .h-sm-150-px {
    height: 150px;
  }
  .w-sm-150-perc {
    width: 150%;;
  }
  .h-sm-150-perc {
    height: 150%;;
  }
  .w-sm-151-px {
    width: 151px;
  }
  .h-sm-151-px {
    height: 151px;
  }
  .w-sm-151-perc {
    width: 151%;;
  }
  .h-sm-151-perc {
    height: 151%;;
  }
  .w-sm-152-px {
    width: 152px;
  }
  .h-sm-152-px {
    height: 152px;
  }
  .w-sm-152-perc {
    width: 152%;;
  }
  .h-sm-152-perc {
    height: 152%;;
  }
  .w-sm-153-px {
    width: 153px;
  }
  .h-sm-153-px {
    height: 153px;
  }
  .w-sm-153-perc {
    width: 153%;;
  }
  .h-sm-153-perc {
    height: 153%;;
  }
  .w-sm-154-px {
    width: 154px;
  }
  .h-sm-154-px {
    height: 154px;
  }
  .w-sm-154-perc {
    width: 154%;;
  }
  .h-sm-154-perc {
    height: 154%;;
  }
  .w-sm-155-px {
    width: 155px;
  }
  .h-sm-155-px {
    height: 155px;
  }
  .w-sm-155-perc {
    width: 155%;;
  }
  .h-sm-155-perc {
    height: 155%;;
  }
  .w-sm-156-px {
    width: 156px;
  }
  .h-sm-156-px {
    height: 156px;
  }
  .w-sm-156-perc {
    width: 156%;;
  }
  .h-sm-156-perc {
    height: 156%;;
  }
  .w-sm-157-px {
    width: 157px;
  }
  .h-sm-157-px {
    height: 157px;
  }
  .w-sm-157-perc {
    width: 157%;;
  }
  .h-sm-157-perc {
    height: 157%;;
  }
  .w-sm-158-px {
    width: 158px;
  }
  .h-sm-158-px {
    height: 158px;
  }
  .w-sm-158-perc {
    width: 158%;;
  }
  .h-sm-158-perc {
    height: 158%;;
  }
  .w-sm-159-px {
    width: 159px;
  }
  .h-sm-159-px {
    height: 159px;
  }
  .w-sm-159-perc {
    width: 159%;;
  }
  .h-sm-159-perc {
    height: 159%;;
  }
  .w-sm-160-px {
    width: 160px;
  }
  .h-sm-160-px {
    height: 160px;
  }
  .w-sm-160-perc {
    width: 160%;;
  }
  .h-sm-160-perc {
    height: 160%;;
  }
  .w-sm-161-px {
    width: 161px;
  }
  .h-sm-161-px {
    height: 161px;
  }
  .w-sm-161-perc {
    width: 161%;;
  }
  .h-sm-161-perc {
    height: 161%;;
  }
  .w-sm-162-px {
    width: 162px;
  }
  .h-sm-162-px {
    height: 162px;
  }
  .w-sm-162-perc {
    width: 162%;;
  }
  .h-sm-162-perc {
    height: 162%;;
  }
  .w-sm-163-px {
    width: 163px;
  }
  .h-sm-163-px {
    height: 163px;
  }
  .w-sm-163-perc {
    width: 163%;;
  }
  .h-sm-163-perc {
    height: 163%;;
  }
  .w-sm-164-px {
    width: 164px;
  }
  .h-sm-164-px {
    height: 164px;
  }
  .w-sm-164-perc {
    width: 164%;;
  }
  .h-sm-164-perc {
    height: 164%;;
  }
  .w-sm-165-px {
    width: 165px;
  }
  .h-sm-165-px {
    height: 165px;
  }
  .w-sm-165-perc {
    width: 165%;;
  }
  .h-sm-165-perc {
    height: 165%;;
  }
  .w-sm-166-px {
    width: 166px;
  }
  .h-sm-166-px {
    height: 166px;
  }
  .w-sm-166-perc {
    width: 166%;;
  }
  .h-sm-166-perc {
    height: 166%;;
  }
  .w-sm-167-px {
    width: 167px;
  }
  .h-sm-167-px {
    height: 167px;
  }
  .w-sm-167-perc {
    width: 167%;;
  }
  .h-sm-167-perc {
    height: 167%;;
  }
  .w-sm-168-px {
    width: 168px;
  }
  .h-sm-168-px {
    height: 168px;
  }
  .w-sm-168-perc {
    width: 168%;;
  }
  .h-sm-168-perc {
    height: 168%;;
  }
  .w-sm-169-px {
    width: 169px;
  }
  .h-sm-169-px {
    height: 169px;
  }
  .w-sm-169-perc {
    width: 169%;;
  }
  .h-sm-169-perc {
    height: 169%;;
  }
  .w-sm-170-px {
    width: 170px;
  }
  .h-sm-170-px {
    height: 170px;
  }
  .w-sm-170-perc {
    width: 170%;;
  }
  .h-sm-170-perc {
    height: 170%;;
  }
  .w-sm-171-px {
    width: 171px;
  }
  .h-sm-171-px {
    height: 171px;
  }
  .w-sm-171-perc {
    width: 171%;;
  }
  .h-sm-171-perc {
    height: 171%;;
  }
  .w-sm-172-px {
    width: 172px;
  }
  .h-sm-172-px {
    height: 172px;
  }
  .w-sm-172-perc {
    width: 172%;;
  }
  .h-sm-172-perc {
    height: 172%;;
  }
  .w-sm-173-px {
    width: 173px;
  }
  .h-sm-173-px {
    height: 173px;
  }
  .w-sm-173-perc {
    width: 173%;;
  }
  .h-sm-173-perc {
    height: 173%;;
  }
  .w-sm-174-px {
    width: 174px;
  }
  .h-sm-174-px {
    height: 174px;
  }
  .w-sm-174-perc {
    width: 174%;;
  }
  .h-sm-174-perc {
    height: 174%;;
  }
  .w-sm-175-px {
    width: 175px;
  }
  .h-sm-175-px {
    height: 175px;
  }
  .w-sm-175-perc {
    width: 175%;;
  }
  .h-sm-175-perc {
    height: 175%;;
  }
  .w-sm-176-px {
    width: 176px;
  }
  .h-sm-176-px {
    height: 176px;
  }
  .w-sm-176-perc {
    width: 176%;;
  }
  .h-sm-176-perc {
    height: 176%;;
  }
  .w-sm-177-px {
    width: 177px;
  }
  .h-sm-177-px {
    height: 177px;
  }
  .w-sm-177-perc {
    width: 177%;;
  }
  .h-sm-177-perc {
    height: 177%;;
  }
  .w-sm-178-px {
    width: 178px;
  }
  .h-sm-178-px {
    height: 178px;
  }
  .w-sm-178-perc {
    width: 178%;;
  }
  .h-sm-178-perc {
    height: 178%;;
  }
  .w-sm-179-px {
    width: 179px;
  }
  .h-sm-179-px {
    height: 179px;
  }
  .w-sm-179-perc {
    width: 179%;;
  }
  .h-sm-179-perc {
    height: 179%;;
  }
  .w-sm-180-px {
    width: 180px;
  }
  .h-sm-180-px {
    height: 180px;
  }
  .w-sm-180-perc {
    width: 180%;;
  }
  .h-sm-180-perc {
    height: 180%;;
  }
  .w-sm-181-px {
    width: 181px;
  }
  .h-sm-181-px {
    height: 181px;
  }
  .w-sm-181-perc {
    width: 181%;;
  }
  .h-sm-181-perc {
    height: 181%;;
  }
  .w-sm-182-px {
    width: 182px;
  }
  .h-sm-182-px {
    height: 182px;
  }
  .w-sm-182-perc {
    width: 182%;;
  }
  .h-sm-182-perc {
    height: 182%;;
  }
  .w-sm-183-px {
    width: 183px;
  }
  .h-sm-183-px {
    height: 183px;
  }
  .w-sm-183-perc {
    width: 183%;;
  }
  .h-sm-183-perc {
    height: 183%;;
  }
  .w-sm-184-px {
    width: 184px;
  }
  .h-sm-184-px {
    height: 184px;
  }
  .w-sm-184-perc {
    width: 184%;;
  }
  .h-sm-184-perc {
    height: 184%;;
  }
  .w-sm-185-px {
    width: 185px;
  }
  .h-sm-185-px {
    height: 185px;
  }
  .w-sm-185-perc {
    width: 185%;;
  }
  .h-sm-185-perc {
    height: 185%;;
  }
  .w-sm-186-px {
    width: 186px;
  }
  .h-sm-186-px {
    height: 186px;
  }
  .w-sm-186-perc {
    width: 186%;;
  }
  .h-sm-186-perc {
    height: 186%;;
  }
  .w-sm-187-px {
    width: 187px;
  }
  .h-sm-187-px {
    height: 187px;
  }
  .w-sm-187-perc {
    width: 187%;;
  }
  .h-sm-187-perc {
    height: 187%;;
  }
  .w-sm-188-px {
    width: 188px;
  }
  .h-sm-188-px {
    height: 188px;
  }
  .w-sm-188-perc {
    width: 188%;;
  }
  .h-sm-188-perc {
    height: 188%;;
  }
  .w-sm-189-px {
    width: 189px;
  }
  .h-sm-189-px {
    height: 189px;
  }
  .w-sm-189-perc {
    width: 189%;;
  }
  .h-sm-189-perc {
    height: 189%;;
  }
  .w-sm-190-px {
    width: 190px;
  }
  .h-sm-190-px {
    height: 190px;
  }
  .w-sm-190-perc {
    width: 190%;;
  }
  .h-sm-190-perc {
    height: 190%;;
  }
  .w-sm-191-px {
    width: 191px;
  }
  .h-sm-191-px {
    height: 191px;
  }
  .w-sm-191-perc {
    width: 191%;;
  }
  .h-sm-191-perc {
    height: 191%;;
  }
  .w-sm-192-px {
    width: 192px;
  }
  .h-sm-192-px {
    height: 192px;
  }
  .w-sm-192-perc {
    width: 192%;;
  }
  .h-sm-192-perc {
    height: 192%;;
  }
  .w-sm-193-px {
    width: 193px;
  }
  .h-sm-193-px {
    height: 193px;
  }
  .w-sm-193-perc {
    width: 193%;;
  }
  .h-sm-193-perc {
    height: 193%;;
  }
  .w-sm-194-px {
    width: 194px;
  }
  .h-sm-194-px {
    height: 194px;
  }
  .w-sm-194-perc {
    width: 194%;;
  }
  .h-sm-194-perc {
    height: 194%;;
  }
  .w-sm-195-px {
    width: 195px;
  }
  .h-sm-195-px {
    height: 195px;
  }
  .w-sm-195-perc {
    width: 195%;;
  }
  .h-sm-195-perc {
    height: 195%;;
  }
  .w-sm-196-px {
    width: 196px;
  }
  .h-sm-196-px {
    height: 196px;
  }
  .w-sm-196-perc {
    width: 196%;;
  }
  .h-sm-196-perc {
    height: 196%;;
  }
  .w-sm-197-px {
    width: 197px;
  }
  .h-sm-197-px {
    height: 197px;
  }
  .w-sm-197-perc {
    width: 197%;;
  }
  .h-sm-197-perc {
    height: 197%;;
  }
  .w-sm-198-px {
    width: 198px;
  }
  .h-sm-198-px {
    height: 198px;
  }
  .w-sm-198-perc {
    width: 198%;;
  }
  .h-sm-198-perc {
    height: 198%;;
  }
  .w-sm-199-px {
    width: 199px;
  }
  .h-sm-199-px {
    height: 199px;
  }
  .w-sm-199-perc {
    width: 199%;;
  }
  .h-sm-199-perc {
    height: 199%;;
  }
  .w-sm-200-px {
    width: 200px;
  }
  .h-sm-200-px {
    height: 200px;
  }
  .w-sm-200-perc {
    width: 200%;;
  }
  .h-sm-200-perc {
    height: 200%;;
  }
  .w-sm-201-px {
    width: 201px;
  }
  .h-sm-201-px {
    height: 201px;
  }
  .w-sm-201-perc {
    width: 201%;;
  }
  .h-sm-201-perc {
    height: 201%;;
  }
  .w-sm-202-px {
    width: 202px;
  }
  .h-sm-202-px {
    height: 202px;
  }
  .w-sm-202-perc {
    width: 202%;;
  }
  .h-sm-202-perc {
    height: 202%;;
  }
  .w-sm-203-px {
    width: 203px;
  }
  .h-sm-203-px {
    height: 203px;
  }
  .w-sm-203-perc {
    width: 203%;;
  }
  .h-sm-203-perc {
    height: 203%;;
  }
  .w-sm-204-px {
    width: 204px;
  }
  .h-sm-204-px {
    height: 204px;
  }
  .w-sm-204-perc {
    width: 204%;;
  }
  .h-sm-204-perc {
    height: 204%;;
  }
  .w-sm-205-px {
    width: 205px;
  }
  .h-sm-205-px {
    height: 205px;
  }
  .w-sm-205-perc {
    width: 205%;;
  }
  .h-sm-205-perc {
    height: 205%;;
  }
  .w-sm-206-px {
    width: 206px;
  }
  .h-sm-206-px {
    height: 206px;
  }
  .w-sm-206-perc {
    width: 206%;;
  }
  .h-sm-206-perc {
    height: 206%;;
  }
  .w-sm-207-px {
    width: 207px;
  }
  .h-sm-207-px {
    height: 207px;
  }
  .w-sm-207-perc {
    width: 207%;;
  }
  .h-sm-207-perc {
    height: 207%;;
  }
  .w-sm-208-px {
    width: 208px;
  }
  .h-sm-208-px {
    height: 208px;
  }
  .w-sm-208-perc {
    width: 208%;;
  }
  .h-sm-208-perc {
    height: 208%;;
  }
  .w-sm-209-px {
    width: 209px;
  }
  .h-sm-209-px {
    height: 209px;
  }
  .w-sm-209-perc {
    width: 209%;;
  }
  .h-sm-209-perc {
    height: 209%;;
  }
  .w-sm-210-px {
    width: 210px;
  }
  .h-sm-210-px {
    height: 210px;
  }
  .w-sm-210-perc {
    width: 210%;;
  }
  .h-sm-210-perc {
    height: 210%;;
  }
  .w-sm-211-px {
    width: 211px;
  }
  .h-sm-211-px {
    height: 211px;
  }
  .w-sm-211-perc {
    width: 211%;;
  }
  .h-sm-211-perc {
    height: 211%;;
  }
  .w-sm-212-px {
    width: 212px;
  }
  .h-sm-212-px {
    height: 212px;
  }
  .w-sm-212-perc {
    width: 212%;;
  }
  .h-sm-212-perc {
    height: 212%;;
  }
  .w-sm-213-px {
    width: 213px;
  }
  .h-sm-213-px {
    height: 213px;
  }
  .w-sm-213-perc {
    width: 213%;;
  }
  .h-sm-213-perc {
    height: 213%;;
  }
  .w-sm-214-px {
    width: 214px;
  }
  .h-sm-214-px {
    height: 214px;
  }
  .w-sm-214-perc {
    width: 214%;;
  }
  .h-sm-214-perc {
    height: 214%;;
  }
  .w-sm-215-px {
    width: 215px;
  }
  .h-sm-215-px {
    height: 215px;
  }
  .w-sm-215-perc {
    width: 215%;;
  }
  .h-sm-215-perc {
    height: 215%;;
  }
  .w-sm-216-px {
    width: 216px;
  }
  .h-sm-216-px {
    height: 216px;
  }
  .w-sm-216-perc {
    width: 216%;;
  }
  .h-sm-216-perc {
    height: 216%;;
  }
  .w-sm-217-px {
    width: 217px;
  }
  .h-sm-217-px {
    height: 217px;
  }
  .w-sm-217-perc {
    width: 217%;;
  }
  .h-sm-217-perc {
    height: 217%;;
  }
  .w-sm-218-px {
    width: 218px;
  }
  .h-sm-218-px {
    height: 218px;
  }
  .w-sm-218-perc {
    width: 218%;;
  }
  .h-sm-218-perc {
    height: 218%;;
  }
  .w-sm-219-px {
    width: 219px;
  }
  .h-sm-219-px {
    height: 219px;
  }
  .w-sm-219-perc {
    width: 219%;;
  }
  .h-sm-219-perc {
    height: 219%;;
  }
  .w-sm-220-px {
    width: 220px;
  }
  .h-sm-220-px {
    height: 220px;
  }
  .w-sm-220-perc {
    width: 220%;;
  }
  .h-sm-220-perc {
    height: 220%;;
  }
  .w-sm-221-px {
    width: 221px;
  }
  .h-sm-221-px {
    height: 221px;
  }
  .w-sm-221-perc {
    width: 221%;;
  }
  .h-sm-221-perc {
    height: 221%;;
  }
  .w-sm-222-px {
    width: 222px;
  }
  .h-sm-222-px {
    height: 222px;
  }
  .w-sm-222-perc {
    width: 222%;;
  }
  .h-sm-222-perc {
    height: 222%;;
  }
  .w-sm-223-px {
    width: 223px;
  }
  .h-sm-223-px {
    height: 223px;
  }
  .w-sm-223-perc {
    width: 223%;;
  }
  .h-sm-223-perc {
    height: 223%;;
  }
  .w-sm-224-px {
    width: 224px;
  }
  .h-sm-224-px {
    height: 224px;
  }
  .w-sm-224-perc {
    width: 224%;;
  }
  .h-sm-224-perc {
    height: 224%;;
  }
  .w-sm-225-px {
    width: 225px;
  }
  .h-sm-225-px {
    height: 225px;
  }
  .w-sm-225-perc {
    width: 225%;;
  }
  .h-sm-225-perc {
    height: 225%;;
  }
  .w-sm-226-px {
    width: 226px;
  }
  .h-sm-226-px {
    height: 226px;
  }
  .w-sm-226-perc {
    width: 226%;;
  }
  .h-sm-226-perc {
    height: 226%;;
  }
  .w-sm-227-px {
    width: 227px;
  }
  .h-sm-227-px {
    height: 227px;
  }
  .w-sm-227-perc {
    width: 227%;;
  }
  .h-sm-227-perc {
    height: 227%;;
  }
  .w-sm-228-px {
    width: 228px;
  }
  .h-sm-228-px {
    height: 228px;
  }
  .w-sm-228-perc {
    width: 228%;;
  }
  .h-sm-228-perc {
    height: 228%;;
  }
  .w-sm-229-px {
    width: 229px;
  }
  .h-sm-229-px {
    height: 229px;
  }
  .w-sm-229-perc {
    width: 229%;;
  }
  .h-sm-229-perc {
    height: 229%;;
  }
  .w-sm-230-px {
    width: 230px;
  }
  .h-sm-230-px {
    height: 230px;
  }
  .w-sm-230-perc {
    width: 230%;;
  }
  .h-sm-230-perc {
    height: 230%;;
  }
  .w-sm-231-px {
    width: 231px;
  }
  .h-sm-231-px {
    height: 231px;
  }
  .w-sm-231-perc {
    width: 231%;;
  }
  .h-sm-231-perc {
    height: 231%;;
  }
  .w-sm-232-px {
    width: 232px;
  }
  .h-sm-232-px {
    height: 232px;
  }
  .w-sm-232-perc {
    width: 232%;;
  }
  .h-sm-232-perc {
    height: 232%;;
  }
  .w-sm-233-px {
    width: 233px;
  }
  .h-sm-233-px {
    height: 233px;
  }
  .w-sm-233-perc {
    width: 233%;;
  }
  .h-sm-233-perc {
    height: 233%;;
  }
  .w-sm-234-px {
    width: 234px;
  }
  .h-sm-234-px {
    height: 234px;
  }
  .w-sm-234-perc {
    width: 234%;;
  }
  .h-sm-234-perc {
    height: 234%;;
  }
  .w-sm-235-px {
    width: 235px;
  }
  .h-sm-235-px {
    height: 235px;
  }
  .w-sm-235-perc {
    width: 235%;;
  }
  .h-sm-235-perc {
    height: 235%;;
  }
  .w-sm-236-px {
    width: 236px;
  }
  .h-sm-236-px {
    height: 236px;
  }
  .w-sm-236-perc {
    width: 236%;;
  }
  .h-sm-236-perc {
    height: 236%;;
  }
  .w-sm-237-px {
    width: 237px;
  }
  .h-sm-237-px {
    height: 237px;
  }
  .w-sm-237-perc {
    width: 237%;;
  }
  .h-sm-237-perc {
    height: 237%;;
  }
  .w-sm-238-px {
    width: 238px;
  }
  .h-sm-238-px {
    height: 238px;
  }
  .w-sm-238-perc {
    width: 238%;;
  }
  .h-sm-238-perc {
    height: 238%;;
  }
  .w-sm-239-px {
    width: 239px;
  }
  .h-sm-239-px {
    height: 239px;
  }
  .w-sm-239-perc {
    width: 239%;;
  }
  .h-sm-239-perc {
    height: 239%;;
  }
  .w-sm-240-px {
    width: 240px;
  }
  .h-sm-240-px {
    height: 240px;
  }
  .w-sm-240-perc {
    width: 240%;;
  }
  .h-sm-240-perc {
    height: 240%;;
  }
  .w-sm-241-px {
    width: 241px;
  }
  .h-sm-241-px {
    height: 241px;
  }
  .w-sm-241-perc {
    width: 241%;;
  }
  .h-sm-241-perc {
    height: 241%;;
  }
  .w-sm-242-px {
    width: 242px;
  }
  .h-sm-242-px {
    height: 242px;
  }
  .w-sm-242-perc {
    width: 242%;;
  }
  .h-sm-242-perc {
    height: 242%;;
  }
  .w-sm-243-px {
    width: 243px;
  }
  .h-sm-243-px {
    height: 243px;
  }
  .w-sm-243-perc {
    width: 243%;;
  }
  .h-sm-243-perc {
    height: 243%;;
  }
  .w-sm-244-px {
    width: 244px;
  }
  .h-sm-244-px {
    height: 244px;
  }
  .w-sm-244-perc {
    width: 244%;;
  }
  .h-sm-244-perc {
    height: 244%;;
  }
  .w-sm-245-px {
    width: 245px;
  }
  .h-sm-245-px {
    height: 245px;
  }
  .w-sm-245-perc {
    width: 245%;;
  }
  .h-sm-245-perc {
    height: 245%;;
  }
  .w-sm-246-px {
    width: 246px;
  }
  .h-sm-246-px {
    height: 246px;
  }
  .w-sm-246-perc {
    width: 246%;;
  }
  .h-sm-246-perc {
    height: 246%;;
  }
  .w-sm-247-px {
    width: 247px;
  }
  .h-sm-247-px {
    height: 247px;
  }
  .w-sm-247-perc {
    width: 247%;;
  }
  .h-sm-247-perc {
    height: 247%;;
  }
  .w-sm-248-px {
    width: 248px;
  }
  .h-sm-248-px {
    height: 248px;
  }
  .w-sm-248-perc {
    width: 248%;;
  }
  .h-sm-248-perc {
    height: 248%;;
  }
  .w-sm-249-px {
    width: 249px;
  }
  .h-sm-249-px {
    height: 249px;
  }
  .w-sm-249-perc {
    width: 249%;;
  }
  .h-sm-249-perc {
    height: 249%;;
  }
  .w-sm-250-px {
    width: 250px;
  }
  .h-sm-250-px {
    height: 250px;
  }
  .w-sm-250-perc {
    width: 250%;;
  }
  .h-sm-250-perc {
    height: 250%;;
  }
  .w-sm-251-px {
    width: 251px;
  }
  .h-sm-251-px {
    height: 251px;
  }
  .w-sm-251-perc {
    width: 251%;;
  }
  .h-sm-251-perc {
    height: 251%;;
  }
  .w-sm-252-px {
    width: 252px;
  }
  .h-sm-252-px {
    height: 252px;
  }
  .w-sm-252-perc {
    width: 252%;;
  }
  .h-sm-252-perc {
    height: 252%;;
  }
  .w-sm-253-px {
    width: 253px;
  }
  .h-sm-253-px {
    height: 253px;
  }
  .w-sm-253-perc {
    width: 253%;;
  }
  .h-sm-253-perc {
    height: 253%;;
  }
  .w-sm-254-px {
    width: 254px;
  }
  .h-sm-254-px {
    height: 254px;
  }
  .w-sm-254-perc {
    width: 254%;;
  }
  .h-sm-254-perc {
    height: 254%;;
  }
  .w-sm-255-px {
    width: 255px;
  }
  .h-sm-255-px {
    height: 255px;
  }
  .w-sm-255-perc {
    width: 255%;;
  }
  .h-sm-255-perc {
    height: 255%;;
  }
  .w-sm-256-px {
    width: 256px;
  }
  .h-sm-256-px {
    height: 256px;
  }
  .w-sm-256-perc {
    width: 256%;;
  }
  .h-sm-256-perc {
    height: 256%;;
  }
  .w-sm-257-px {
    width: 257px;
  }
  .h-sm-257-px {
    height: 257px;
  }
  .w-sm-257-perc {
    width: 257%;;
  }
  .h-sm-257-perc {
    height: 257%;;
  }
  .w-sm-258-px {
    width: 258px;
  }
  .h-sm-258-px {
    height: 258px;
  }
  .w-sm-258-perc {
    width: 258%;;
  }
  .h-sm-258-perc {
    height: 258%;;
  }
  .w-sm-259-px {
    width: 259px;
  }
  .h-sm-259-px {
    height: 259px;
  }
  .w-sm-259-perc {
    width: 259%;;
  }
  .h-sm-259-perc {
    height: 259%;;
  }
  .w-sm-260-px {
    width: 260px;
  }
  .h-sm-260-px {
    height: 260px;
  }
  .w-sm-260-perc {
    width: 260%;;
  }
  .h-sm-260-perc {
    height: 260%;;
  }
  .w-sm-261-px {
    width: 261px;
  }
  .h-sm-261-px {
    height: 261px;
  }
  .w-sm-261-perc {
    width: 261%;;
  }
  .h-sm-261-perc {
    height: 261%;;
  }
  .w-sm-262-px {
    width: 262px;
  }
  .h-sm-262-px {
    height: 262px;
  }
  .w-sm-262-perc {
    width: 262%;;
  }
  .h-sm-262-perc {
    height: 262%;;
  }
  .w-sm-263-px {
    width: 263px;
  }
  .h-sm-263-px {
    height: 263px;
  }
  .w-sm-263-perc {
    width: 263%;;
  }
  .h-sm-263-perc {
    height: 263%;;
  }
  .w-sm-264-px {
    width: 264px;
  }
  .h-sm-264-px {
    height: 264px;
  }
  .w-sm-264-perc {
    width: 264%;;
  }
  .h-sm-264-perc {
    height: 264%;;
  }
  .w-sm-265-px {
    width: 265px;
  }
  .h-sm-265-px {
    height: 265px;
  }
  .w-sm-265-perc {
    width: 265%;;
  }
  .h-sm-265-perc {
    height: 265%;;
  }
  .w-sm-266-px {
    width: 266px;
  }
  .h-sm-266-px {
    height: 266px;
  }
  .w-sm-266-perc {
    width: 266%;;
  }
  .h-sm-266-perc {
    height: 266%;;
  }
  .w-sm-267-px {
    width: 267px;
  }
  .h-sm-267-px {
    height: 267px;
  }
  .w-sm-267-perc {
    width: 267%;;
  }
  .h-sm-267-perc {
    height: 267%;;
  }
  .w-sm-268-px {
    width: 268px;
  }
  .h-sm-268-px {
    height: 268px;
  }
  .w-sm-268-perc {
    width: 268%;;
  }
  .h-sm-268-perc {
    height: 268%;;
  }
  .w-sm-269-px {
    width: 269px;
  }
  .h-sm-269-px {
    height: 269px;
  }
  .w-sm-269-perc {
    width: 269%;;
  }
  .h-sm-269-perc {
    height: 269%;;
  }
  .w-sm-270-px {
    width: 270px;
  }
  .h-sm-270-px {
    height: 270px;
  }
  .w-sm-270-perc {
    width: 270%;;
  }
  .h-sm-270-perc {
    height: 270%;;
  }
  .w-sm-271-px {
    width: 271px;
  }
  .h-sm-271-px {
    height: 271px;
  }
  .w-sm-271-perc {
    width: 271%;;
  }
  .h-sm-271-perc {
    height: 271%;;
  }
  .w-sm-272-px {
    width: 272px;
  }
  .h-sm-272-px {
    height: 272px;
  }
  .w-sm-272-perc {
    width: 272%;;
  }
  .h-sm-272-perc {
    height: 272%;;
  }
  .w-sm-273-px {
    width: 273px;
  }
  .h-sm-273-px {
    height: 273px;
  }
  .w-sm-273-perc {
    width: 273%;;
  }
  .h-sm-273-perc {
    height: 273%;;
  }
  .w-sm-274-px {
    width: 274px;
  }
  .h-sm-274-px {
    height: 274px;
  }
  .w-sm-274-perc {
    width: 274%;;
  }
  .h-sm-274-perc {
    height: 274%;;
  }
  .w-sm-275-px {
    width: 275px;
  }
  .h-sm-275-px {
    height: 275px;
  }
  .w-sm-275-perc {
    width: 275%;;
  }
  .h-sm-275-perc {
    height: 275%;;
  }
  .w-sm-276-px {
    width: 276px;
  }
  .h-sm-276-px {
    height: 276px;
  }
  .w-sm-276-perc {
    width: 276%;;
  }
  .h-sm-276-perc {
    height: 276%;;
  }
  .w-sm-277-px {
    width: 277px;
  }
  .h-sm-277-px {
    height: 277px;
  }
  .w-sm-277-perc {
    width: 277%;;
  }
  .h-sm-277-perc {
    height: 277%;;
  }
  .w-sm-278-px {
    width: 278px;
  }
  .h-sm-278-px {
    height: 278px;
  }
  .w-sm-278-perc {
    width: 278%;;
  }
  .h-sm-278-perc {
    height: 278%;;
  }
  .w-sm-279-px {
    width: 279px;
  }
  .h-sm-279-px {
    height: 279px;
  }
  .w-sm-279-perc {
    width: 279%;;
  }
  .h-sm-279-perc {
    height: 279%;;
  }
  .w-sm-280-px {
    width: 280px;
  }
  .h-sm-280-px {
    height: 280px;
  }
  .w-sm-280-perc {
    width: 280%;;
  }
  .h-sm-280-perc {
    height: 280%;;
  }
  .w-sm-281-px {
    width: 281px;
  }
  .h-sm-281-px {
    height: 281px;
  }
  .w-sm-281-perc {
    width: 281%;;
  }
  .h-sm-281-perc {
    height: 281%;;
  }
  .w-sm-282-px {
    width: 282px;
  }
  .h-sm-282-px {
    height: 282px;
  }
  .w-sm-282-perc {
    width: 282%;;
  }
  .h-sm-282-perc {
    height: 282%;;
  }
  .w-sm-283-px {
    width: 283px;
  }
  .h-sm-283-px {
    height: 283px;
  }
  .w-sm-283-perc {
    width: 283%;;
  }
  .h-sm-283-perc {
    height: 283%;;
  }
  .w-sm-284-px {
    width: 284px;
  }
  .h-sm-284-px {
    height: 284px;
  }
  .w-sm-284-perc {
    width: 284%;;
  }
  .h-sm-284-perc {
    height: 284%;;
  }
  .w-sm-285-px {
    width: 285px;
  }
  .h-sm-285-px {
    height: 285px;
  }
  .w-sm-285-perc {
    width: 285%;;
  }
  .h-sm-285-perc {
    height: 285%;;
  }
  .w-sm-286-px {
    width: 286px;
  }
  .h-sm-286-px {
    height: 286px;
  }
  .w-sm-286-perc {
    width: 286%;;
  }
  .h-sm-286-perc {
    height: 286%;;
  }
  .w-sm-287-px {
    width: 287px;
  }
  .h-sm-287-px {
    height: 287px;
  }
  .w-sm-287-perc {
    width: 287%;;
  }
  .h-sm-287-perc {
    height: 287%;;
  }
  .w-sm-288-px {
    width: 288px;
  }
  .h-sm-288-px {
    height: 288px;
  }
  .w-sm-288-perc {
    width: 288%;;
  }
  .h-sm-288-perc {
    height: 288%;;
  }
  .w-sm-289-px {
    width: 289px;
  }
  .h-sm-289-px {
    height: 289px;
  }
  .w-sm-289-perc {
    width: 289%;;
  }
  .h-sm-289-perc {
    height: 289%;;
  }
  .w-sm-290-px {
    width: 290px;
  }
  .h-sm-290-px {
    height: 290px;
  }
  .w-sm-290-perc {
    width: 290%;;
  }
  .h-sm-290-perc {
    height: 290%;;
  }
  .w-sm-291-px {
    width: 291px;
  }
  .h-sm-291-px {
    height: 291px;
  }
  .w-sm-291-perc {
    width: 291%;;
  }
  .h-sm-291-perc {
    height: 291%;;
  }
  .w-sm-292-px {
    width: 292px;
  }
  .h-sm-292-px {
    height: 292px;
  }
  .w-sm-292-perc {
    width: 292%;;
  }
  .h-sm-292-perc {
    height: 292%;;
  }
  .w-sm-293-px {
    width: 293px;
  }
  .h-sm-293-px {
    height: 293px;
  }
  .w-sm-293-perc {
    width: 293%;;
  }
  .h-sm-293-perc {
    height: 293%;;
  }
  .w-sm-294-px {
    width: 294px;
  }
  .h-sm-294-px {
    height: 294px;
  }
  .w-sm-294-perc {
    width: 294%;;
  }
  .h-sm-294-perc {
    height: 294%;;
  }
  .w-sm-295-px {
    width: 295px;
  }
  .h-sm-295-px {
    height: 295px;
  }
  .w-sm-295-perc {
    width: 295%;;
  }
  .h-sm-295-perc {
    height: 295%;;
  }
  .w-sm-296-px {
    width: 296px;
  }
  .h-sm-296-px {
    height: 296px;
  }
  .w-sm-296-perc {
    width: 296%;;
  }
  .h-sm-296-perc {
    height: 296%;;
  }
  .w-sm-297-px {
    width: 297px;
  }
  .h-sm-297-px {
    height: 297px;
  }
  .w-sm-297-perc {
    width: 297%;;
  }
  .h-sm-297-perc {
    height: 297%;;
  }
  .w-sm-298-px {
    width: 298px;
  }
  .h-sm-298-px {
    height: 298px;
  }
  .w-sm-298-perc {
    width: 298%;;
  }
  .h-sm-298-perc {
    height: 298%;;
  }
  .w-sm-299-px {
    width: 299px;
  }
  .h-sm-299-px {
    height: 299px;
  }
  .w-sm-299-perc {
    width: 299%;;
  }
  .h-sm-299-perc {
    height: 299%;;
  }
  .w-sm-300-px {
    width: 300px;
  }
  .h-sm-300-px {
    height: 300px;
  }
  .w-sm-300-perc {
    width: 300%;;
  }
  .h-sm-300-perc {
    height: 300%;;
  }
}
@media (min-width: 768px) {
  [class*="w-xl-"], [class*="w-lg-"] {
    width: initial;
  }
  [class*="h-xl-"], [class*="h-lg-"] {
    height: initial;
  }
  .w-md-1-px {
    width: 1px;
  }
  .h-md-1-px {
    height: 1px;
  }
  .w-md-1-perc {
    width: 1%;;
  }
  .h-md-1-perc {
    height: 1%;;
  }
  .w-md-2-px {
    width: 2px;
  }
  .h-md-2-px {
    height: 2px;
  }
  .w-md-2-perc {
    width: 2%;;
  }
  .h-md-2-perc {
    height: 2%;;
  }
  .w-md-3-px {
    width: 3px;
  }
  .h-md-3-px {
    height: 3px;
  }
  .w-md-3-perc {
    width: 3%;;
  }
  .h-md-3-perc {
    height: 3%;;
  }
  .w-md-4-px {
    width: 4px;
  }
  .h-md-4-px {
    height: 4px;
  }
  .w-md-4-perc {
    width: 4%;;
  }
  .h-md-4-perc {
    height: 4%;;
  }
  .w-md-5-px {
    width: 5px;
  }
  .h-md-5-px {
    height: 5px;
  }
  .w-md-5-perc {
    width: 5%;;
  }
  .h-md-5-perc {
    height: 5%;;
  }
  .w-md-6-px {
    width: 6px;
  }
  .h-md-6-px {
    height: 6px;
  }
  .w-md-6-perc {
    width: 6%;;
  }
  .h-md-6-perc {
    height: 6%;;
  }
  .w-md-7-px {
    width: 7px;
  }
  .h-md-7-px {
    height: 7px;
  }
  .w-md-7-perc {
    width: 7%;;
  }
  .h-md-7-perc {
    height: 7%;;
  }
  .w-md-8-px {
    width: 8px;
  }
  .h-md-8-px {
    height: 8px;
  }
  .w-md-8-perc {
    width: 8%;;
  }
  .h-md-8-perc {
    height: 8%;;
  }
  .w-md-9-px {
    width: 9px;
  }
  .h-md-9-px {
    height: 9px;
  }
  .w-md-9-perc {
    width: 9%;;
  }
  .h-md-9-perc {
    height: 9%;;
  }
  .w-md-10-px {
    width: 10px;
  }
  .h-md-10-px {
    height: 10px;
  }
  .w-md-10-perc {
    width: 10%;;
  }
  .h-md-10-perc {
    height: 10%;;
  }
  .w-md-11-px {
    width: 11px;
  }
  .h-md-11-px {
    height: 11px;
  }
  .w-md-11-perc {
    width: 11%;;
  }
  .h-md-11-perc {
    height: 11%;;
  }
  .w-md-12-px {
    width: 12px;
  }
  .h-md-12-px {
    height: 12px;
  }
  .w-md-12-perc {
    width: 12%;;
  }
  .h-md-12-perc {
    height: 12%;;
  }
  .w-md-13-px {
    width: 13px;
  }
  .h-md-13-px {
    height: 13px;
  }
  .w-md-13-perc {
    width: 13%;;
  }
  .h-md-13-perc {
    height: 13%;;
  }
  .w-md-14-px {
    width: 14px;
  }
  .h-md-14-px {
    height: 14px;
  }
  .w-md-14-perc {
    width: 14%;;
  }
  .h-md-14-perc {
    height: 14%;;
  }
  .w-md-15-px {
    width: 15px;
  }
  .h-md-15-px {
    height: 15px;
  }
  .w-md-15-perc {
    width: 15%;;
  }
  .h-md-15-perc {
    height: 15%;;
  }
  .w-md-16-px {
    width: 16px;
  }
  .h-md-16-px {
    height: 16px;
  }
  .w-md-16-perc {
    width: 16%;;
  }
  .h-md-16-perc {
    height: 16%;;
  }
  .w-md-17-px {
    width: 17px;
  }
  .h-md-17-px {
    height: 17px;
  }
  .w-md-17-perc {
    width: 17%;;
  }
  .h-md-17-perc {
    height: 17%;;
  }
  .w-md-18-px {
    width: 18px;
  }
  .h-md-18-px {
    height: 18px;
  }
  .w-md-18-perc {
    width: 18%;;
  }
  .h-md-18-perc {
    height: 18%;;
  }
  .w-md-19-px {
    width: 19px;
  }
  .h-md-19-px {
    height: 19px;
  }
  .w-md-19-perc {
    width: 19%;;
  }
  .h-md-19-perc {
    height: 19%;;
  }
  .w-md-20-px {
    width: 20px;
  }
  .h-md-20-px {
    height: 20px;
  }
  .w-md-20-perc {
    width: 20%;;
  }
  .h-md-20-perc {
    height: 20%;;
  }
  .w-md-21-px {
    width: 21px;
  }
  .h-md-21-px {
    height: 21px;
  }
  .w-md-21-perc {
    width: 21%;;
  }
  .h-md-21-perc {
    height: 21%;;
  }
  .w-md-22-px {
    width: 22px;
  }
  .h-md-22-px {
    height: 22px;
  }
  .w-md-22-perc {
    width: 22%;;
  }
  .h-md-22-perc {
    height: 22%;;
  }
  .w-md-23-px {
    width: 23px;
  }
  .h-md-23-px {
    height: 23px;
  }
  .w-md-23-perc {
    width: 23%;;
  }
  .h-md-23-perc {
    height: 23%;;
  }
  .w-md-24-px {
    width: 24px;
  }
  .h-md-24-px {
    height: 24px;
  }
  .w-md-24-perc {
    width: 24%;;
  }
  .h-md-24-perc {
    height: 24%;;
  }
  .w-md-25-px {
    width: 25px;
  }
  .h-md-25-px {
    height: 25px;
  }
  .w-md-25-perc {
    width: 25%;;
  }
  .h-md-25-perc {
    height: 25%;;
  }
  .w-md-26-px {
    width: 26px;
  }
  .h-md-26-px {
    height: 26px;
  }
  .w-md-26-perc {
    width: 26%;;
  }
  .h-md-26-perc {
    height: 26%;;
  }
  .w-md-27-px {
    width: 27px;
  }
  .h-md-27-px {
    height: 27px;
  }
  .w-md-27-perc {
    width: 27%;;
  }
  .h-md-27-perc {
    height: 27%;;
  }
  .w-md-28-px {
    width: 28px;
  }
  .h-md-28-px {
    height: 28px;
  }
  .w-md-28-perc {
    width: 28%;;
  }
  .h-md-28-perc {
    height: 28%;;
  }
  .w-md-29-px {
    width: 29px;
  }
  .h-md-29-px {
    height: 29px;
  }
  .w-md-29-perc {
    width: 29%;;
  }
  .h-md-29-perc {
    height: 29%;;
  }
  .w-md-30-px {
    width: 30px;
  }
  .h-md-30-px {
    height: 30px;
  }
  .w-md-30-perc {
    width: 30%;;
  }
  .h-md-30-perc {
    height: 30%;;
  }
  .w-md-31-px {
    width: 31px;
  }
  .h-md-31-px {
    height: 31px;
  }
  .w-md-31-perc {
    width: 31%;;
  }
  .h-md-31-perc {
    height: 31%;;
  }
  .w-md-32-px {
    width: 32px;
  }
  .h-md-32-px {
    height: 32px;
  }
  .w-md-32-perc {
    width: 32%;;
  }
  .h-md-32-perc {
    height: 32%;;
  }
  .w-md-33-px {
    width: 33px;
  }
  .h-md-33-px {
    height: 33px;
  }
  .w-md-33-perc {
    width: 33%;;
  }
  .h-md-33-perc {
    height: 33%;;
  }
  .w-md-34-px {
    width: 34px;
  }
  .h-md-34-px {
    height: 34px;
  }
  .w-md-34-perc {
    width: 34%;;
  }
  .h-md-34-perc {
    height: 34%;;
  }
  .w-md-35-px {
    width: 35px;
  }
  .h-md-35-px {
    height: 35px;
  }
  .w-md-35-perc {
    width: 35%;;
  }
  .h-md-35-perc {
    height: 35%;;
  }
  .w-md-36-px {
    width: 36px;
  }
  .h-md-36-px {
    height: 36px;
  }
  .w-md-36-perc {
    width: 36%;;
  }
  .h-md-36-perc {
    height: 36%;;
  }
  .w-md-37-px {
    width: 37px;
  }
  .h-md-37-px {
    height: 37px;
  }
  .w-md-37-perc {
    width: 37%;;
  }
  .h-md-37-perc {
    height: 37%;;
  }
  .w-md-38-px {
    width: 38px;
  }
  .h-md-38-px {
    height: 38px;
  }
  .w-md-38-perc {
    width: 38%;;
  }
  .h-md-38-perc {
    height: 38%;;
  }
  .w-md-39-px {
    width: 39px;
  }
  .h-md-39-px {
    height: 39px;
  }
  .w-md-39-perc {
    width: 39%;;
  }
  .h-md-39-perc {
    height: 39%;;
  }
  .w-md-40-px {
    width: 40px;
  }
  .h-md-40-px {
    height: 40px;
  }
  .w-md-40-perc {
    width: 40%;;
  }
  .h-md-40-perc {
    height: 40%;;
  }
  .w-md-41-px {
    width: 41px;
  }
  .h-md-41-px {
    height: 41px;
  }
  .w-md-41-perc {
    width: 41%;;
  }
  .h-md-41-perc {
    height: 41%;;
  }
  .w-md-42-px {
    width: 42px;
  }
  .h-md-42-px {
    height: 42px;
  }
  .w-md-42-perc {
    width: 42%;;
  }
  .h-md-42-perc {
    height: 42%;;
  }
  .w-md-43-px {
    width: 43px;
  }
  .h-md-43-px {
    height: 43px;
  }
  .w-md-43-perc {
    width: 43%;;
  }
  .h-md-43-perc {
    height: 43%;;
  }
  .w-md-44-px {
    width: 44px;
  }
  .h-md-44-px {
    height: 44px;
  }
  .w-md-44-perc {
    width: 44%;;
  }
  .h-md-44-perc {
    height: 44%;;
  }
  .w-md-45-px {
    width: 45px;
  }
  .h-md-45-px {
    height: 45px;
  }
  .w-md-45-perc {
    width: 45%;;
  }
  .h-md-45-perc {
    height: 45%;;
  }
  .w-md-46-px {
    width: 46px;
  }
  .h-md-46-px {
    height: 46px;
  }
  .w-md-46-perc {
    width: 46%;;
  }
  .h-md-46-perc {
    height: 46%;;
  }
  .w-md-47-px {
    width: 47px;
  }
  .h-md-47-px {
    height: 47px;
  }
  .w-md-47-perc {
    width: 47%;;
  }
  .h-md-47-perc {
    height: 47%;;
  }
  .w-md-48-px {
    width: 48px;
  }
  .h-md-48-px {
    height: 48px;
  }
  .w-md-48-perc {
    width: 48%;;
  }
  .h-md-48-perc {
    height: 48%;;
  }
  .w-md-49-px {
    width: 49px;
  }
  .h-md-49-px {
    height: 49px;
  }
  .w-md-49-perc {
    width: 49%;;
  }
  .h-md-49-perc {
    height: 49%;;
  }
  .w-md-50-px {
    width: 50px;
  }
  .h-md-50-px {
    height: 50px;
  }
  .w-md-50-perc {
    width: 50%;;
  }
  .h-md-50-perc {
    height: 50%;;
  }
  .w-md-51-px {
    width: 51px;
  }
  .h-md-51-px {
    height: 51px;
  }
  .w-md-51-perc {
    width: 51%;;
  }
  .h-md-51-perc {
    height: 51%;;
  }
  .w-md-52-px {
    width: 52px;
  }
  .h-md-52-px {
    height: 52px;
  }
  .w-md-52-perc {
    width: 52%;;
  }
  .h-md-52-perc {
    height: 52%;;
  }
  .w-md-53-px {
    width: 53px;
  }
  .h-md-53-px {
    height: 53px;
  }
  .w-md-53-perc {
    width: 53%;;
  }
  .h-md-53-perc {
    height: 53%;;
  }
  .w-md-54-px {
    width: 54px;
  }
  .h-md-54-px {
    height: 54px;
  }
  .w-md-54-perc {
    width: 54%;;
  }
  .h-md-54-perc {
    height: 54%;;
  }
  .w-md-55-px {
    width: 55px;
  }
  .h-md-55-px {
    height: 55px;
  }
  .w-md-55-perc {
    width: 55%;;
  }
  .h-md-55-perc {
    height: 55%;;
  }
  .w-md-56-px {
    width: 56px;
  }
  .h-md-56-px {
    height: 56px;
  }
  .w-md-56-perc {
    width: 56%;;
  }
  .h-md-56-perc {
    height: 56%;;
  }
  .w-md-57-px {
    width: 57px;
  }
  .h-md-57-px {
    height: 57px;
  }
  .w-md-57-perc {
    width: 57%;;
  }
  .h-md-57-perc {
    height: 57%;;
  }
  .w-md-58-px {
    width: 58px;
  }
  .h-md-58-px {
    height: 58px;
  }
  .w-md-58-perc {
    width: 58%;;
  }
  .h-md-58-perc {
    height: 58%;;
  }
  .w-md-59-px {
    width: 59px;
  }
  .h-md-59-px {
    height: 59px;
  }
  .w-md-59-perc {
    width: 59%;;
  }
  .h-md-59-perc {
    height: 59%;;
  }
  .w-md-60-px {
    width: 60px;
  }
  .h-md-60-px {
    height: 60px;
  }
  .w-md-60-perc {
    width: 60%;;
  }
  .h-md-60-perc {
    height: 60%;;
  }
  .w-md-61-px {
    width: 61px;
  }
  .h-md-61-px {
    height: 61px;
  }
  .w-md-61-perc {
    width: 61%;;
  }
  .h-md-61-perc {
    height: 61%;;
  }
  .w-md-62-px {
    width: 62px;
  }
  .h-md-62-px {
    height: 62px;
  }
  .w-md-62-perc {
    width: 62%;;
  }
  .h-md-62-perc {
    height: 62%;;
  }
  .w-md-63-px {
    width: 63px;
  }
  .h-md-63-px {
    height: 63px;
  }
  .w-md-63-perc {
    width: 63%;;
  }
  .h-md-63-perc {
    height: 63%;;
  }
  .w-md-64-px {
    width: 64px;
  }
  .h-md-64-px {
    height: 64px;
  }
  .w-md-64-perc {
    width: 64%;;
  }
  .h-md-64-perc {
    height: 64%;;
  }
  .w-md-65-px {
    width: 65px;
  }
  .h-md-65-px {
    height: 65px;
  }
  .w-md-65-perc {
    width: 65%;;
  }
  .h-md-65-perc {
    height: 65%;;
  }
  .w-md-66-px {
    width: 66px;
  }
  .h-md-66-px {
    height: 66px;
  }
  .w-md-66-perc {
    width: 66%;;
  }
  .h-md-66-perc {
    height: 66%;;
  }
  .w-md-67-px {
    width: 67px;
  }
  .h-md-67-px {
    height: 67px;
  }
  .w-md-67-perc {
    width: 67%;;
  }
  .h-md-67-perc {
    height: 67%;;
  }
  .w-md-68-px {
    width: 68px;
  }
  .h-md-68-px {
    height: 68px;
  }
  .w-md-68-perc {
    width: 68%;;
  }
  .h-md-68-perc {
    height: 68%;;
  }
  .w-md-69-px {
    width: 69px;
  }
  .h-md-69-px {
    height: 69px;
  }
  .w-md-69-perc {
    width: 69%;;
  }
  .h-md-69-perc {
    height: 69%;;
  }
  .w-md-70-px {
    width: 70px;
  }
  .h-md-70-px {
    height: 70px;
  }
  .w-md-70-perc {
    width: 70%;;
  }
  .h-md-70-perc {
    height: 70%;;
  }
  .w-md-71-px {
    width: 71px;
  }
  .h-md-71-px {
    height: 71px;
  }
  .w-md-71-perc {
    width: 71%;;
  }
  .h-md-71-perc {
    height: 71%;;
  }
  .w-md-72-px {
    width: 72px;
  }
  .h-md-72-px {
    height: 72px;
  }
  .w-md-72-perc {
    width: 72%;;
  }
  .h-md-72-perc {
    height: 72%;;
  }
  .w-md-73-px {
    width: 73px;
  }
  .h-md-73-px {
    height: 73px;
  }
  .w-md-73-perc {
    width: 73%;;
  }
  .h-md-73-perc {
    height: 73%;;
  }
  .w-md-74-px {
    width: 74px;
  }
  .h-md-74-px {
    height: 74px;
  }
  .w-md-74-perc {
    width: 74%;;
  }
  .h-md-74-perc {
    height: 74%;;
  }
  .w-md-75-px {
    width: 75px;
  }
  .h-md-75-px {
    height: 75px;
  }
  .w-md-75-perc {
    width: 75%;;
  }
  .h-md-75-perc {
    height: 75%;;
  }
  .w-md-76-px {
    width: 76px;
  }
  .h-md-76-px {
    height: 76px;
  }
  .w-md-76-perc {
    width: 76%;;
  }
  .h-md-76-perc {
    height: 76%;;
  }
  .w-md-77-px {
    width: 77px;
  }
  .h-md-77-px {
    height: 77px;
  }
  .w-md-77-perc {
    width: 77%;;
  }
  .h-md-77-perc {
    height: 77%;;
  }
  .w-md-78-px {
    width: 78px;
  }
  .h-md-78-px {
    height: 78px;
  }
  .w-md-78-perc {
    width: 78%;;
  }
  .h-md-78-perc {
    height: 78%;;
  }
  .w-md-79-px {
    width: 79px;
  }
  .h-md-79-px {
    height: 79px;
  }
  .w-md-79-perc {
    width: 79%;;
  }
  .h-md-79-perc {
    height: 79%;;
  }
  .w-md-80-px {
    width: 80px;
  }
  .h-md-80-px {
    height: 80px;
  }
  .w-md-80-perc {
    width: 80%;;
  }
  .h-md-80-perc {
    height: 80%;;
  }
  .w-md-81-px {
    width: 81px;
  }
  .h-md-81-px {
    height: 81px;
  }
  .w-md-81-perc {
    width: 81%;;
  }
  .h-md-81-perc {
    height: 81%;;
  }
  .w-md-82-px {
    width: 82px;
  }
  .h-md-82-px {
    height: 82px;
  }
  .w-md-82-perc {
    width: 82%;;
  }
  .h-md-82-perc {
    height: 82%;;
  }
  .w-md-83-px {
    width: 83px;
  }
  .h-md-83-px {
    height: 83px;
  }
  .w-md-83-perc {
    width: 83%;;
  }
  .h-md-83-perc {
    height: 83%;;
  }
  .w-md-84-px {
    width: 84px;
  }
  .h-md-84-px {
    height: 84px;
  }
  .w-md-84-perc {
    width: 84%;;
  }
  .h-md-84-perc {
    height: 84%;;
  }
  .w-md-85-px {
    width: 85px;
  }
  .h-md-85-px {
    height: 85px;
  }
  .w-md-85-perc {
    width: 85%;;
  }
  .h-md-85-perc {
    height: 85%;;
  }
  .w-md-86-px {
    width: 86px;
  }
  .h-md-86-px {
    height: 86px;
  }
  .w-md-86-perc {
    width: 86%;;
  }
  .h-md-86-perc {
    height: 86%;;
  }
  .w-md-87-px {
    width: 87px;
  }
  .h-md-87-px {
    height: 87px;
  }
  .w-md-87-perc {
    width: 87%;;
  }
  .h-md-87-perc {
    height: 87%;;
  }
  .w-md-88-px {
    width: 88px;
  }
  .h-md-88-px {
    height: 88px;
  }
  .w-md-88-perc {
    width: 88%;;
  }
  .h-md-88-perc {
    height: 88%;;
  }
  .w-md-89-px {
    width: 89px;
  }
  .h-md-89-px {
    height: 89px;
  }
  .w-md-89-perc {
    width: 89%;;
  }
  .h-md-89-perc {
    height: 89%;;
  }
  .w-md-90-px {
    width: 90px;
  }
  .h-md-90-px {
    height: 90px;
  }
  .w-md-90-perc {
    width: 90%;;
  }
  .h-md-90-perc {
    height: 90%;;
  }
  .w-md-91-px {
    width: 91px;
  }
  .h-md-91-px {
    height: 91px;
  }
  .w-md-91-perc {
    width: 91%;;
  }
  .h-md-91-perc {
    height: 91%;;
  }
  .w-md-92-px {
    width: 92px;
  }
  .h-md-92-px {
    height: 92px;
  }
  .w-md-92-perc {
    width: 92%;;
  }
  .h-md-92-perc {
    height: 92%;;
  }
  .w-md-93-px {
    width: 93px;
  }
  .h-md-93-px {
    height: 93px;
  }
  .w-md-93-perc {
    width: 93%;;
  }
  .h-md-93-perc {
    height: 93%;;
  }
  .w-md-94-px {
    width: 94px;
  }
  .h-md-94-px {
    height: 94px;
  }
  .w-md-94-perc {
    width: 94%;;
  }
  .h-md-94-perc {
    height: 94%;;
  }
  .w-md-95-px {
    width: 95px;
  }
  .h-md-95-px {
    height: 95px;
  }
  .w-md-95-perc {
    width: 95%;;
  }
  .h-md-95-perc {
    height: 95%;;
  }
  .w-md-96-px {
    width: 96px;
  }
  .h-md-96-px {
    height: 96px;
  }
  .w-md-96-perc {
    width: 96%;;
  }
  .h-md-96-perc {
    height: 96%;;
  }
  .w-md-97-px {
    width: 97px;
  }
  .h-md-97-px {
    height: 97px;
  }
  .w-md-97-perc {
    width: 97%;;
  }
  .h-md-97-perc {
    height: 97%;;
  }
  .w-md-98-px {
    width: 98px;
  }
  .h-md-98-px {
    height: 98px;
  }
  .w-md-98-perc {
    width: 98%;;
  }
  .h-md-98-perc {
    height: 98%;;
  }
  .w-md-99-px {
    width: 99px;
  }
  .h-md-99-px {
    height: 99px;
  }
  .w-md-99-perc {
    width: 99%;;
  }
  .h-md-99-perc {
    height: 99%;;
  }
  .w-md-100-px {
    width: 100px;
  }
  .h-md-100-px {
    height: 100px;
  }
  .w-md-100-perc {
    width: 100%;;
  }
  .h-md-100-perc {
    height: 100%;;
  }
}
@media (min-width: 992px) {
  [class*="w-xl-"] {
    width: initial;
  }
  [class*="h-xl-"] {
    height: initial;
  }
  .w-lg-1-px {
    width: 1px;
  }
  .h-lg-1-px {
    height: 1px;
  }
  .w-lg-1-perc {
    width: 1%;;
  }
  .h-lg-1-perc {
    height: 1%;;
  }
  .w-lg-2-px {
    width: 2px;
  }
  .h-lg-2-px {
    height: 2px;
  }
  .w-lg-2-perc {
    width: 2%;;
  }
  .h-lg-2-perc {
    height: 2%;;
  }
  .w-lg-3-px {
    width: 3px;
  }
  .h-lg-3-px {
    height: 3px;
  }
  .w-lg-3-perc {
    width: 3%;;
  }
  .h-lg-3-perc {
    height: 3%;;
  }
  .w-lg-4-px {
    width: 4px;
  }
  .h-lg-4-px {
    height: 4px;
  }
  .w-lg-4-perc {
    width: 4%;;
  }
  .h-lg-4-perc {
    height: 4%;;
  }
  .w-lg-5-px {
    width: 5px;
  }
  .h-lg-5-px {
    height: 5px;
  }
  .w-lg-5-perc {
    width: 5%;;
  }
  .h-lg-5-perc {
    height: 5%;;
  }
  .w-lg-6-px {
    width: 6px;
  }
  .h-lg-6-px {
    height: 6px;
  }
  .w-lg-6-perc {
    width: 6%;;
  }
  .h-lg-6-perc {
    height: 6%;;
  }
  .w-lg-7-px {
    width: 7px;
  }
  .h-lg-7-px {
    height: 7px;
  }
  .w-lg-7-perc {
    width: 7%;;
  }
  .h-lg-7-perc {
    height: 7%;;
  }
  .w-lg-8-px {
    width: 8px;
  }
  .h-lg-8-px {
    height: 8px;
  }
  .w-lg-8-perc {
    width: 8%;;
  }
  .h-lg-8-perc {
    height: 8%;;
  }
  .w-lg-9-px {
    width: 9px;
  }
  .h-lg-9-px {
    height: 9px;
  }
  .w-lg-9-perc {
    width: 9%;;
  }
  .h-lg-9-perc {
    height: 9%;;
  }
  .w-lg-10-px {
    width: 10px;
  }
  .h-lg-10-px {
    height: 10px;
  }
  .w-lg-10-perc {
    width: 10%;;
  }
  .h-lg-10-perc {
    height: 10%;;
  }
  .w-lg-11-px {
    width: 11px;
  }
  .h-lg-11-px {
    height: 11px;
  }
  .w-lg-11-perc {
    width: 11%;;
  }
  .h-lg-11-perc {
    height: 11%;;
  }
  .w-lg-12-px {
    width: 12px;
  }
  .h-lg-12-px {
    height: 12px;
  }
  .w-lg-12-perc {
    width: 12%;;
  }
  .h-lg-12-perc {
    height: 12%;;
  }
  .w-lg-13-px {
    width: 13px;
  }
  .h-lg-13-px {
    height: 13px;
  }
  .w-lg-13-perc {
    width: 13%;;
  }
  .h-lg-13-perc {
    height: 13%;;
  }
  .w-lg-14-px {
    width: 14px;
  }
  .h-lg-14-px {
    height: 14px;
  }
  .w-lg-14-perc {
    width: 14%;;
  }
  .h-lg-14-perc {
    height: 14%;;
  }
  .w-lg-15-px {
    width: 15px;
  }
  .h-lg-15-px {
    height: 15px;
  }
  .w-lg-15-perc {
    width: 15%;;
  }
  .h-lg-15-perc {
    height: 15%;;
  }
  .w-lg-16-px {
    width: 16px;
  }
  .h-lg-16-px {
    height: 16px;
  }
  .w-lg-16-perc {
    width: 16%;;
  }
  .h-lg-16-perc {
    height: 16%;;
  }
  .w-lg-17-px {
    width: 17px;
  }
  .h-lg-17-px {
    height: 17px;
  }
  .w-lg-17-perc {
    width: 17%;;
  }
  .h-lg-17-perc {
    height: 17%;;
  }
  .w-lg-18-px {
    width: 18px;
  }
  .h-lg-18-px {
    height: 18px;
  }
  .w-lg-18-perc {
    width: 18%;;
  }
  .h-lg-18-perc {
    height: 18%;;
  }
  .w-lg-19-px {
    width: 19px;
  }
  .h-lg-19-px {
    height: 19px;
  }
  .w-lg-19-perc {
    width: 19%;;
  }
  .h-lg-19-perc {
    height: 19%;;
  }
  .w-lg-20-px {
    width: 20px;
  }
  .h-lg-20-px {
    height: 20px;
  }
  .w-lg-20-perc {
    width: 20%;;
  }
  .h-lg-20-perc {
    height: 20%;;
  }
  .w-lg-21-px {
    width: 21px;
  }
  .h-lg-21-px {
    height: 21px;
  }
  .w-lg-21-perc {
    width: 21%;;
  }
  .h-lg-21-perc {
    height: 21%;;
  }
  .w-lg-22-px {
    width: 22px;
  }
  .h-lg-22-px {
    height: 22px;
  }
  .w-lg-22-perc {
    width: 22%;;
  }
  .h-lg-22-perc {
    height: 22%;;
  }
  .w-lg-23-px {
    width: 23px;
  }
  .h-lg-23-px {
    height: 23px;
  }
  .w-lg-23-perc {
    width: 23%;;
  }
  .h-lg-23-perc {
    height: 23%;;
  }
  .w-lg-24-px {
    width: 24px;
  }
  .h-lg-24-px {
    height: 24px;
  }
  .w-lg-24-perc {
    width: 24%;;
  }
  .h-lg-24-perc {
    height: 24%;;
  }
  .w-lg-25-px {
    width: 25px;
  }
  .h-lg-25-px {
    height: 25px;
  }
  .w-lg-25-perc {
    width: 25%;;
  }
  .h-lg-25-perc {
    height: 25%;;
  }
  .w-lg-26-px {
    width: 26px;
  }
  .h-lg-26-px {
    height: 26px;
  }
  .w-lg-26-perc {
    width: 26%;;
  }
  .h-lg-26-perc {
    height: 26%;;
  }
  .w-lg-27-px {
    width: 27px;
  }
  .h-lg-27-px {
    height: 27px;
  }
  .w-lg-27-perc {
    width: 27%;;
  }
  .h-lg-27-perc {
    height: 27%;;
  }
  .w-lg-28-px {
    width: 28px;
  }
  .h-lg-28-px {
    height: 28px;
  }
  .w-lg-28-perc {
    width: 28%;;
  }
  .h-lg-28-perc {
    height: 28%;;
  }
  .w-lg-29-px {
    width: 29px;
  }
  .h-lg-29-px {
    height: 29px;
  }
  .w-lg-29-perc {
    width: 29%;;
  }
  .h-lg-29-perc {
    height: 29%;;
  }
  .w-lg-30-px {
    width: 30px;
  }
  .h-lg-30-px {
    height: 30px;
  }
  .w-lg-30-perc {
    width: 30%;;
  }
  .h-lg-30-perc {
    height: 30%;;
  }
  .w-lg-31-px {
    width: 31px;
  }
  .h-lg-31-px {
    height: 31px;
  }
  .w-lg-31-perc {
    width: 31%;;
  }
  .h-lg-31-perc {
    height: 31%;;
  }
  .w-lg-32-px {
    width: 32px;
  }
  .h-lg-32-px {
    height: 32px;
  }
  .w-lg-32-perc {
    width: 32%;;
  }
  .h-lg-32-perc {
    height: 32%;;
  }
  .w-lg-33-px {
    width: 33px;
  }
  .h-lg-33-px {
    height: 33px;
  }
  .w-lg-33-perc {
    width: 33%;;
  }
  .h-lg-33-perc {
    height: 33%;;
  }
  .w-lg-34-px {
    width: 34px;
  }
  .h-lg-34-px {
    height: 34px;
  }
  .w-lg-34-perc {
    width: 34%;;
  }
  .h-lg-34-perc {
    height: 34%;;
  }
  .w-lg-35-px {
    width: 35px;
  }
  .h-lg-35-px {
    height: 35px;
  }
  .w-lg-35-perc {
    width: 35%;;
  }
  .h-lg-35-perc {
    height: 35%;;
  }
  .w-lg-36-px {
    width: 36px;
  }
  .h-lg-36-px {
    height: 36px;
  }
  .w-lg-36-perc {
    width: 36%;;
  }
  .h-lg-36-perc {
    height: 36%;;
  }
  .w-lg-37-px {
    width: 37px;
  }
  .h-lg-37-px {
    height: 37px;
  }
  .w-lg-37-perc {
    width: 37%;;
  }
  .h-lg-37-perc {
    height: 37%;;
  }
  .w-lg-38-px {
    width: 38px;
  }
  .h-lg-38-px {
    height: 38px;
  }
  .w-lg-38-perc {
    width: 38%;;
  }
  .h-lg-38-perc {
    height: 38%;;
  }
  .w-lg-39-px {
    width: 39px;
  }
  .h-lg-39-px {
    height: 39px;
  }
  .w-lg-39-perc {
    width: 39%;;
  }
  .h-lg-39-perc {
    height: 39%;;
  }
  .w-lg-40-px {
    width: 40px;
  }
  .h-lg-40-px {
    height: 40px;
  }
  .w-lg-40-perc {
    width: 40%;;
  }
  .h-lg-40-perc {
    height: 40%;;
  }
  .w-lg-41-px {
    width: 41px;
  }
  .h-lg-41-px {
    height: 41px;
  }
  .w-lg-41-perc {
    width: 41%;;
  }
  .h-lg-41-perc {
    height: 41%;;
  }
  .w-lg-42-px {
    width: 42px;
  }
  .h-lg-42-px {
    height: 42px;
  }
  .w-lg-42-perc {
    width: 42%;;
  }
  .h-lg-42-perc {
    height: 42%;;
  }
  .w-lg-43-px {
    width: 43px;
  }
  .h-lg-43-px {
    height: 43px;
  }
  .w-lg-43-perc {
    width: 43%;;
  }
  .h-lg-43-perc {
    height: 43%;;
  }
  .w-lg-44-px {
    width: 44px;
  }
  .h-lg-44-px {
    height: 44px;
  }
  .w-lg-44-perc {
    width: 44%;;
  }
  .h-lg-44-perc {
    height: 44%;;
  }
  .w-lg-45-px {
    width: 45px;
  }
  .h-lg-45-px {
    height: 45px;
  }
  .w-lg-45-perc {
    width: 45%;;
  }
  .h-lg-45-perc {
    height: 45%;;
  }
  .w-lg-46-px {
    width: 46px;
  }
  .h-lg-46-px {
    height: 46px;
  }
  .w-lg-46-perc {
    width: 46%;;
  }
  .h-lg-46-perc {
    height: 46%;;
  }
  .w-lg-47-px {
    width: 47px;
  }
  .h-lg-47-px {
    height: 47px;
  }
  .w-lg-47-perc {
    width: 47%;;
  }
  .h-lg-47-perc {
    height: 47%;;
  }
  .w-lg-48-px {
    width: 48px;
  }
  .h-lg-48-px {
    height: 48px;
  }
  .w-lg-48-perc {
    width: 48%;;
  }
  .h-lg-48-perc {
    height: 48%;;
  }
  .w-lg-49-px {
    width: 49px;
  }
  .h-lg-49-px {
    height: 49px;
  }
  .w-lg-49-perc {
    width: 49%;;
  }
  .h-lg-49-perc {
    height: 49%;;
  }
  .w-lg-50-px {
    width: 50px;
  }
  .h-lg-50-px {
    height: 50px;
  }
  .w-lg-50-perc {
    width: 50%;;
  }
  .h-lg-50-perc {
    height: 50%;;
  }
  .w-lg-51-px {
    width: 51px;
  }
  .h-lg-51-px {
    height: 51px;
  }
  .w-lg-51-perc {
    width: 51%;;
  }
  .h-lg-51-perc {
    height: 51%;;
  }
  .w-lg-52-px {
    width: 52px;
  }
  .h-lg-52-px {
    height: 52px;
  }
  .w-lg-52-perc {
    width: 52%;;
  }
  .h-lg-52-perc {
    height: 52%;;
  }
  .w-lg-53-px {
    width: 53px;
  }
  .h-lg-53-px {
    height: 53px;
  }
  .w-lg-53-perc {
    width: 53%;;
  }
  .h-lg-53-perc {
    height: 53%;;
  }
  .w-lg-54-px {
    width: 54px;
  }
  .h-lg-54-px {
    height: 54px;
  }
  .w-lg-54-perc {
    width: 54%;;
  }
  .h-lg-54-perc {
    height: 54%;;
  }
  .w-lg-55-px {
    width: 55px;
  }
  .h-lg-55-px {
    height: 55px;
  }
  .w-lg-55-perc {
    width: 55%;;
  }
  .h-lg-55-perc {
    height: 55%;;
  }
  .w-lg-56-px {
    width: 56px;
  }
  .h-lg-56-px {
    height: 56px;
  }
  .w-lg-56-perc {
    width: 56%;;
  }
  .h-lg-56-perc {
    height: 56%;;
  }
  .w-lg-57-px {
    width: 57px;
  }
  .h-lg-57-px {
    height: 57px;
  }
  .w-lg-57-perc {
    width: 57%;;
  }
  .h-lg-57-perc {
    height: 57%;;
  }
  .w-lg-58-px {
    width: 58px;
  }
  .h-lg-58-px {
    height: 58px;
  }
  .w-lg-58-perc {
    width: 58%;;
  }
  .h-lg-58-perc {
    height: 58%;;
  }
  .w-lg-59-px {
    width: 59px;
  }
  .h-lg-59-px {
    height: 59px;
  }
  .w-lg-59-perc {
    width: 59%;;
  }
  .h-lg-59-perc {
    height: 59%;;
  }
  .w-lg-60-px {
    width: 60px;
  }
  .h-lg-60-px {
    height: 60px;
  }
  .w-lg-60-perc {
    width: 60%;;
  }
  .h-lg-60-perc {
    height: 60%;;
  }
  .w-lg-61-px {
    width: 61px;
  }
  .h-lg-61-px {
    height: 61px;
  }
  .w-lg-61-perc {
    width: 61%;;
  }
  .h-lg-61-perc {
    height: 61%;;
  }
  .w-lg-62-px {
    width: 62px;
  }
  .h-lg-62-px {
    height: 62px;
  }
  .w-lg-62-perc {
    width: 62%;;
  }
  .h-lg-62-perc {
    height: 62%;;
  }
  .w-lg-63-px {
    width: 63px;
  }
  .h-lg-63-px {
    height: 63px;
  }
  .w-lg-63-perc {
    width: 63%;;
  }
  .h-lg-63-perc {
    height: 63%;;
  }
  .w-lg-64-px {
    width: 64px;
  }
  .h-lg-64-px {
    height: 64px;
  }
  .w-lg-64-perc {
    width: 64%;;
  }
  .h-lg-64-perc {
    height: 64%;;
  }
  .w-lg-65-px {
    width: 65px;
  }
  .h-lg-65-px {
    height: 65px;
  }
  .w-lg-65-perc {
    width: 65%;;
  }
  .h-lg-65-perc {
    height: 65%;;
  }
  .w-lg-66-px {
    width: 66px;
  }
  .h-lg-66-px {
    height: 66px;
  }
  .w-lg-66-perc {
    width: 66%;;
  }
  .h-lg-66-perc {
    height: 66%;;
  }
  .w-lg-67-px {
    width: 67px;
  }
  .h-lg-67-px {
    height: 67px;
  }
  .w-lg-67-perc {
    width: 67%;;
  }
  .h-lg-67-perc {
    height: 67%;;
  }
  .w-lg-68-px {
    width: 68px;
  }
  .h-lg-68-px {
    height: 68px;
  }
  .w-lg-68-perc {
    width: 68%;;
  }
  .h-lg-68-perc {
    height: 68%;;
  }
  .w-lg-69-px {
    width: 69px;
  }
  .h-lg-69-px {
    height: 69px;
  }
  .w-lg-69-perc {
    width: 69%;;
  }
  .h-lg-69-perc {
    height: 69%;;
  }
  .w-lg-70-px {
    width: 70px;
  }
  .h-lg-70-px {
    height: 70px;
  }
  .w-lg-70-perc {
    width: 70%;;
  }
  .h-lg-70-perc {
    height: 70%;;
  }
  .w-lg-71-px {
    width: 71px;
  }
  .h-lg-71-px {
    height: 71px;
  }
  .w-lg-71-perc {
    width: 71%;;
  }
  .h-lg-71-perc {
    height: 71%;;
  }
  .w-lg-72-px {
    width: 72px;
  }
  .h-lg-72-px {
    height: 72px;
  }
  .w-lg-72-perc {
    width: 72%;;
  }
  .h-lg-72-perc {
    height: 72%;;
  }
  .w-lg-73-px {
    width: 73px;
  }
  .h-lg-73-px {
    height: 73px;
  }
  .w-lg-73-perc {
    width: 73%;;
  }
  .h-lg-73-perc {
    height: 73%;;
  }
  .w-lg-74-px {
    width: 74px;
  }
  .h-lg-74-px {
    height: 74px;
  }
  .w-lg-74-perc {
    width: 74%;;
  }
  .h-lg-74-perc {
    height: 74%;;
  }
  .w-lg-75-px {
    width: 75px;
  }
  .h-lg-75-px {
    height: 75px;
  }
  .w-lg-75-perc {
    width: 75%;;
  }
  .h-lg-75-perc {
    height: 75%;;
  }
  .w-lg-76-px {
    width: 76px;
  }
  .h-lg-76-px {
    height: 76px;
  }
  .w-lg-76-perc {
    width: 76%;;
  }
  .h-lg-76-perc {
    height: 76%;;
  }
  .w-lg-77-px {
    width: 77px;
  }
  .h-lg-77-px {
    height: 77px;
  }
  .w-lg-77-perc {
    width: 77%;;
  }
  .h-lg-77-perc {
    height: 77%;;
  }
  .w-lg-78-px {
    width: 78px;
  }
  .h-lg-78-px {
    height: 78px;
  }
  .w-lg-78-perc {
    width: 78%;;
  }
  .h-lg-78-perc {
    height: 78%;;
  }
  .w-lg-79-px {
    width: 79px;
  }
  .h-lg-79-px {
    height: 79px;
  }
  .w-lg-79-perc {
    width: 79%;;
  }
  .h-lg-79-perc {
    height: 79%;;
  }
  .w-lg-80-px {
    width: 80px;
  }
  .h-lg-80-px {
    height: 80px;
  }
  .w-lg-80-perc {
    width: 80%;;
  }
  .h-lg-80-perc {
    height: 80%;;
  }
  .w-lg-81-px {
    width: 81px;
  }
  .h-lg-81-px {
    height: 81px;
  }
  .w-lg-81-perc {
    width: 81%;;
  }
  .h-lg-81-perc {
    height: 81%;;
  }
  .w-lg-82-px {
    width: 82px;
  }
  .h-lg-82-px {
    height: 82px;
  }
  .w-lg-82-perc {
    width: 82%;;
  }
  .h-lg-82-perc {
    height: 82%;;
  }
  .w-lg-83-px {
    width: 83px;
  }
  .h-lg-83-px {
    height: 83px;
  }
  .w-lg-83-perc {
    width: 83%;;
  }
  .h-lg-83-perc {
    height: 83%;;
  }
  .w-lg-84-px {
    width: 84px;
  }
  .h-lg-84-px {
    height: 84px;
  }
  .w-lg-84-perc {
    width: 84%;;
  }
  .h-lg-84-perc {
    height: 84%;;
  }
  .w-lg-85-px {
    width: 85px;
  }
  .h-lg-85-px {
    height: 85px;
  }
  .w-lg-85-perc {
    width: 85%;;
  }
  .h-lg-85-perc {
    height: 85%;;
  }
  .w-lg-86-px {
    width: 86px;
  }
  .h-lg-86-px {
    height: 86px;
  }
  .w-lg-86-perc {
    width: 86%;;
  }
  .h-lg-86-perc {
    height: 86%;;
  }
  .w-lg-87-px {
    width: 87px;
  }
  .h-lg-87-px {
    height: 87px;
  }
  .w-lg-87-perc {
    width: 87%;;
  }
  .h-lg-87-perc {
    height: 87%;;
  }
  .w-lg-88-px {
    width: 88px;
  }
  .h-lg-88-px {
    height: 88px;
  }
  .w-lg-88-perc {
    width: 88%;;
  }
  .h-lg-88-perc {
    height: 88%;;
  }
  .w-lg-89-px {
    width: 89px;
  }
  .h-lg-89-px {
    height: 89px;
  }
  .w-lg-89-perc {
    width: 89%;;
  }
  .h-lg-89-perc {
    height: 89%;;
  }
  .w-lg-90-px {
    width: 90px;
  }
  .h-lg-90-px {
    height: 90px;
  }
  .w-lg-90-perc {
    width: 90%;;
  }
  .h-lg-90-perc {
    height: 90%;;
  }
  .w-lg-91-px {
    width: 91px;
  }
  .h-lg-91-px {
    height: 91px;
  }
  .w-lg-91-perc {
    width: 91%;;
  }
  .h-lg-91-perc {
    height: 91%;;
  }
  .w-lg-92-px {
    width: 92px;
  }
  .h-lg-92-px {
    height: 92px;
  }
  .w-lg-92-perc {
    width: 92%;;
  }
  .h-lg-92-perc {
    height: 92%;;
  }
  .w-lg-93-px {
    width: 93px;
  }
  .h-lg-93-px {
    height: 93px;
  }
  .w-lg-93-perc {
    width: 93%;;
  }
  .h-lg-93-perc {
    height: 93%;;
  }
  .w-lg-94-px {
    width: 94px;
  }
  .h-lg-94-px {
    height: 94px;
  }
  .w-lg-94-perc {
    width: 94%;;
  }
  .h-lg-94-perc {
    height: 94%;;
  }
  .w-lg-95-px {
    width: 95px;
  }
  .h-lg-95-px {
    height: 95px;
  }
  .w-lg-95-perc {
    width: 95%;;
  }
  .h-lg-95-perc {
    height: 95%;;
  }
  .w-lg-96-px {
    width: 96px;
  }
  .h-lg-96-px {
    height: 96px;
  }
  .w-lg-96-perc {
    width: 96%;;
  }
  .h-lg-96-perc {
    height: 96%;;
  }
  .w-lg-97-px {
    width: 97px;
  }
  .h-lg-97-px {
    height: 97px;
  }
  .w-lg-97-perc {
    width: 97%;;
  }
  .h-lg-97-perc {
    height: 97%;;
  }
  .w-lg-98-px {
    width: 98px;
  }
  .h-lg-98-px {
    height: 98px;
  }
  .w-lg-98-perc {
    width: 98%;;
  }
  .h-lg-98-perc {
    height: 98%;;
  }
  .w-lg-99-px {
    width: 99px;
  }
  .h-lg-99-px {
    height: 99px;
  }
  .w-lg-99-perc {
    width: 99%;;
  }
  .h-lg-99-perc {
    height: 99%;;
  }
  .w-lg-100-px {
    width: 100px;
  }
  .h-lg-100-px {
    height: 100px;
  }
  .w-lg-100-perc {
    width: 100%;;
  }
  .h-lg-100-perc {
    height: 100%;;
  }
}
@media (min-width: 1200px) {
  .w-xl-1-px {
    width: 1px;
  }
  .h-xl-1-px {
    height: 1px;
  }
  .w-xl-1-perc {
    width: 1%;;
  }
  .h-xl-1-perc {
    height: 1%;;
  }
  .w-xl-2-px {
    width: 2px;
  }
  .h-xl-2-px {
    height: 2px;
  }
  .w-xl-2-perc {
    width: 2%;;
  }
  .h-xl-2-perc {
    height: 2%;;
  }
  .w-xl-3-px {
    width: 3px;
  }
  .h-xl-3-px {
    height: 3px;
  }
  .w-xl-3-perc {
    width: 3%;;
  }
  .h-xl-3-perc {
    height: 3%;;
  }
  .w-xl-4-px {
    width: 4px;
  }
  .h-xl-4-px {
    height: 4px;
  }
  .w-xl-4-perc {
    width: 4%;;
  }
  .h-xl-4-perc {
    height: 4%;;
  }
  .w-xl-5-px {
    width: 5px;
  }
  .h-xl-5-px {
    height: 5px;
  }
  .w-xl-5-perc {
    width: 5%;;
  }
  .h-xl-5-perc {
    height: 5%;;
  }
  .w-xl-6-px {
    width: 6px;
  }
  .h-xl-6-px {
    height: 6px;
  }
  .w-xl-6-perc {
    width: 6%;;
  }
  .h-xl-6-perc {
    height: 6%;;
  }
  .w-xl-7-px {
    width: 7px;
  }
  .h-xl-7-px {
    height: 7px;
  }
  .w-xl-7-perc {
    width: 7%;;
  }
  .h-xl-7-perc {
    height: 7%;;
  }
  .w-xl-8-px {
    width: 8px;
  }
  .h-xl-8-px {
    height: 8px;
  }
  .w-xl-8-perc {
    width: 8%;;
  }
  .h-xl-8-perc {
    height: 8%;;
  }
  .w-xl-9-px {
    width: 9px;
  }
  .h-xl-9-px {
    height: 9px;
  }
  .w-xl-9-perc {
    width: 9%;;
  }
  .h-xl-9-perc {
    height: 9%;;
  }
  .w-xl-10-px {
    width: 10px;
  }
  .h-xl-10-px {
    height: 10px;
  }
  .w-xl-10-perc {
    width: 10%;;
  }
  .h-xl-10-perc {
    height: 10%;;
  }
  .w-xl-11-px {
    width: 11px;
  }
  .h-xl-11-px {
    height: 11px;
  }
  .w-xl-11-perc {
    width: 11%;;
  }
  .h-xl-11-perc {
    height: 11%;;
  }
  .w-xl-12-px {
    width: 12px;
  }
  .h-xl-12-px {
    height: 12px;
  }
  .w-xl-12-perc {
    width: 12%;;
  }
  .h-xl-12-perc {
    height: 12%;;
  }
  .w-xl-13-px {
    width: 13px;
  }
  .h-xl-13-px {
    height: 13px;
  }
  .w-xl-13-perc {
    width: 13%;;
  }
  .h-xl-13-perc {
    height: 13%;;
  }
  .w-xl-14-px {
    width: 14px;
  }
  .h-xl-14-px {
    height: 14px;
  }
  .w-xl-14-perc {
    width: 14%;;
  }
  .h-xl-14-perc {
    height: 14%;;
  }
  .w-xl-15-px {
    width: 15px;
  }
  .h-xl-15-px {
    height: 15px;
  }
  .w-xl-15-perc {
    width: 15%;;
  }
  .h-xl-15-perc {
    height: 15%;;
  }
  .w-xl-16-px {
    width: 16px;
  }
  .h-xl-16-px {
    height: 16px;
  }
  .w-xl-16-perc {
    width: 16%;;
  }
  .h-xl-16-perc {
    height: 16%;;
  }
  .w-xl-17-px {
    width: 17px;
  }
  .h-xl-17-px {
    height: 17px;
  }
  .w-xl-17-perc {
    width: 17%;;
  }
  .h-xl-17-perc {
    height: 17%;;
  }
  .w-xl-18-px {
    width: 18px;
  }
  .h-xl-18-px {
    height: 18px;
  }
  .w-xl-18-perc {
    width: 18%;;
  }
  .h-xl-18-perc {
    height: 18%;;
  }
  .w-xl-19-px {
    width: 19px;
  }
  .h-xl-19-px {
    height: 19px;
  }
  .w-xl-19-perc {
    width: 19%;;
  }
  .h-xl-19-perc {
    height: 19%;;
  }
  .w-xl-20-px {
    width: 20px;
  }
  .h-xl-20-px {
    height: 20px;
  }
  .w-xl-20-perc {
    width: 20%;;
  }
  .h-xl-20-perc {
    height: 20%;;
  }
  .w-xl-21-px {
    width: 21px;
  }
  .h-xl-21-px {
    height: 21px;
  }
  .w-xl-21-perc {
    width: 21%;;
  }
  .h-xl-21-perc {
    height: 21%;;
  }
  .w-xl-22-px {
    width: 22px;
  }
  .h-xl-22-px {
    height: 22px;
  }
  .w-xl-22-perc {
    width: 22%;;
  }
  .h-xl-22-perc {
    height: 22%;;
  }
  .w-xl-23-px {
    width: 23px;
  }
  .h-xl-23-px {
    height: 23px;
  }
  .w-xl-23-perc {
    width: 23%;;
  }
  .h-xl-23-perc {
    height: 23%;;
  }
  .w-xl-24-px {
    width: 24px;
  }
  .h-xl-24-px {
    height: 24px;
  }
  .w-xl-24-perc {
    width: 24%;;
  }
  .h-xl-24-perc {
    height: 24%;;
  }
  .w-xl-25-px {
    width: 25px;
  }
  .h-xl-25-px {
    height: 25px;
  }
  .w-xl-25-perc {
    width: 25%;;
  }
  .h-xl-25-perc {
    height: 25%;;
  }
  .w-xl-26-px {
    width: 26px;
  }
  .h-xl-26-px {
    height: 26px;
  }
  .w-xl-26-perc {
    width: 26%;;
  }
  .h-xl-26-perc {
    height: 26%;;
  }
  .w-xl-27-px {
    width: 27px;
  }
  .h-xl-27-px {
    height: 27px;
  }
  .w-xl-27-perc {
    width: 27%;;
  }
  .h-xl-27-perc {
    height: 27%;;
  }
  .w-xl-28-px {
    width: 28px;
  }
  .h-xl-28-px {
    height: 28px;
  }
  .w-xl-28-perc {
    width: 28%;;
  }
  .h-xl-28-perc {
    height: 28%;;
  }
  .w-xl-29-px {
    width: 29px;
  }
  .h-xl-29-px {
    height: 29px;
  }
  .w-xl-29-perc {
    width: 29%;;
  }
  .h-xl-29-perc {
    height: 29%;;
  }
  .w-xl-30-px {
    width: 30px;
  }
  .h-xl-30-px {
    height: 30px;
  }
  .w-xl-30-perc {
    width: 30%;;
  }
  .h-xl-30-perc {
    height: 30%;;
  }
  .w-xl-31-px {
    width: 31px;
  }
  .h-xl-31-px {
    height: 31px;
  }
  .w-xl-31-perc {
    width: 31%;;
  }
  .h-xl-31-perc {
    height: 31%;;
  }
  .w-xl-32-px {
    width: 32px;
  }
  .h-xl-32-px {
    height: 32px;
  }
  .w-xl-32-perc {
    width: 32%;;
  }
  .h-xl-32-perc {
    height: 32%;;
  }
  .w-xl-33-px {
    width: 33px;
  }
  .h-xl-33-px {
    height: 33px;
  }
  .w-xl-33-perc {
    width: 33%;;
  }
  .h-xl-33-perc {
    height: 33%;;
  }
  .w-xl-34-px {
    width: 34px;
  }
  .h-xl-34-px {
    height: 34px;
  }
  .w-xl-34-perc {
    width: 34%;;
  }
  .h-xl-34-perc {
    height: 34%;;
  }
  .w-xl-35-px {
    width: 35px;
  }
  .h-xl-35-px {
    height: 35px;
  }
  .w-xl-35-perc {
    width: 35%;;
  }
  .h-xl-35-perc {
    height: 35%;;
  }
  .w-xl-36-px {
    width: 36px;
  }
  .h-xl-36-px {
    height: 36px;
  }
  .w-xl-36-perc {
    width: 36%;;
  }
  .h-xl-36-perc {
    height: 36%;;
  }
  .w-xl-37-px {
    width: 37px;
  }
  .h-xl-37-px {
    height: 37px;
  }
  .w-xl-37-perc {
    width: 37%;;
  }
  .h-xl-37-perc {
    height: 37%;;
  }
  .w-xl-38-px {
    width: 38px;
  }
  .h-xl-38-px {
    height: 38px;
  }
  .w-xl-38-perc {
    width: 38%;;
  }
  .h-xl-38-perc {
    height: 38%;;
  }
  .w-xl-39-px {
    width: 39px;
  }
  .h-xl-39-px {
    height: 39px;
  }
  .w-xl-39-perc {
    width: 39%;;
  }
  .h-xl-39-perc {
    height: 39%;;
  }
  .w-xl-40-px {
    width: 40px;
  }
  .h-xl-40-px {
    height: 40px;
  }
  .w-xl-40-perc {
    width: 40%;;
  }
  .h-xl-40-perc {
    height: 40%;;
  }
  .w-xl-41-px {
    width: 41px;
  }
  .h-xl-41-px {
    height: 41px;
  }
  .w-xl-41-perc {
    width: 41%;;
  }
  .h-xl-41-perc {
    height: 41%;;
  }
  .w-xl-42-px {
    width: 42px;
  }
  .h-xl-42-px {
    height: 42px;
  }
  .w-xl-42-perc {
    width: 42%;;
  }
  .h-xl-42-perc {
    height: 42%;;
  }
  .w-xl-43-px {
    width: 43px;
  }
  .h-xl-43-px {
    height: 43px;
  }
  .w-xl-43-perc {
    width: 43%;;
  }
  .h-xl-43-perc {
    height: 43%;;
  }
  .w-xl-44-px {
    width: 44px;
  }
  .h-xl-44-px {
    height: 44px;
  }
  .w-xl-44-perc {
    width: 44%;;
  }
  .h-xl-44-perc {
    height: 44%;;
  }
  .w-xl-45-px {
    width: 45px;
  }
  .h-xl-45-px {
    height: 45px;
  }
  .w-xl-45-perc {
    width: 45%;;
  }
  .h-xl-45-perc {
    height: 45%;;
  }
  .w-xl-46-px {
    width: 46px;
  }
  .h-xl-46-px {
    height: 46px;
  }
  .w-xl-46-perc {
    width: 46%;;
  }
  .h-xl-46-perc {
    height: 46%;;
  }
  .w-xl-47-px {
    width: 47px;
  }
  .h-xl-47-px {
    height: 47px;
  }
  .w-xl-47-perc {
    width: 47%;;
  }
  .h-xl-47-perc {
    height: 47%;;
  }
  .w-xl-48-px {
    width: 48px;
  }
  .h-xl-48-px {
    height: 48px;
  }
  .w-xl-48-perc {
    width: 48%;;
  }
  .h-xl-48-perc {
    height: 48%;;
  }
  .w-xl-49-px {
    width: 49px;
  }
  .h-xl-49-px {
    height: 49px;
  }
  .w-xl-49-perc {
    width: 49%;;
  }
  .h-xl-49-perc {
    height: 49%;;
  }
  .w-xl-50-px {
    width: 50px;
  }
  .h-xl-50-px {
    height: 50px;
  }
  .w-xl-50-perc {
    width: 50%;;
  }
  .h-xl-50-perc {
    height: 50%;;
  }
  .w-xl-51-px {
    width: 51px;
  }
  .h-xl-51-px {
    height: 51px;
  }
  .w-xl-51-perc {
    width: 51%;;
  }
  .h-xl-51-perc {
    height: 51%;;
  }
  .w-xl-52-px {
    width: 52px;
  }
  .h-xl-52-px {
    height: 52px;
  }
  .w-xl-52-perc {
    width: 52%;;
  }
  .h-xl-52-perc {
    height: 52%;;
  }
  .w-xl-53-px {
    width: 53px;
  }
  .h-xl-53-px {
    height: 53px;
  }
  .w-xl-53-perc {
    width: 53%;;
  }
  .h-xl-53-perc {
    height: 53%;;
  }
  .w-xl-54-px {
    width: 54px;
  }
  .h-xl-54-px {
    height: 54px;
  }
  .w-xl-54-perc {
    width: 54%;;
  }
  .h-xl-54-perc {
    height: 54%;;
  }
  .w-xl-55-px {
    width: 55px;
  }
  .h-xl-55-px {
    height: 55px;
  }
  .w-xl-55-perc {
    width: 55%;;
  }
  .h-xl-55-perc {
    height: 55%;;
  }
  .w-xl-56-px {
    width: 56px;
  }
  .h-xl-56-px {
    height: 56px;
  }
  .w-xl-56-perc {
    width: 56%;;
  }
  .h-xl-56-perc {
    height: 56%;;
  }
  .w-xl-57-px {
    width: 57px;
  }
  .h-xl-57-px {
    height: 57px;
  }
  .w-xl-57-perc {
    width: 57%;;
  }
  .h-xl-57-perc {
    height: 57%;;
  }
  .w-xl-58-px {
    width: 58px;
  }
  .h-xl-58-px {
    height: 58px;
  }
  .w-xl-58-perc {
    width: 58%;;
  }
  .h-xl-58-perc {
    height: 58%;;
  }
  .w-xl-59-px {
    width: 59px;
  }
  .h-xl-59-px {
    height: 59px;
  }
  .w-xl-59-perc {
    width: 59%;;
  }
  .h-xl-59-perc {
    height: 59%;;
  }
  .w-xl-60-px {
    width: 60px;
  }
  .h-xl-60-px {
    height: 60px;
  }
  .w-xl-60-perc {
    width: 60%;;
  }
  .h-xl-60-perc {
    height: 60%;;
  }
  .w-xl-61-px {
    width: 61px;
  }
  .h-xl-61-px {
    height: 61px;
  }
  .w-xl-61-perc {
    width: 61%;;
  }
  .h-xl-61-perc {
    height: 61%;;
  }
  .w-xl-62-px {
    width: 62px;
  }
  .h-xl-62-px {
    height: 62px;
  }
  .w-xl-62-perc {
    width: 62%;;
  }
  .h-xl-62-perc {
    height: 62%;;
  }
  .w-xl-63-px {
    width: 63px;
  }
  .h-xl-63-px {
    height: 63px;
  }
  .w-xl-63-perc {
    width: 63%;;
  }
  .h-xl-63-perc {
    height: 63%;;
  }
  .w-xl-64-px {
    width: 64px;
  }
  .h-xl-64-px {
    height: 64px;
  }
  .w-xl-64-perc {
    width: 64%;;
  }
  .h-xl-64-perc {
    height: 64%;;
  }
  .w-xl-65-px {
    width: 65px;
  }
  .h-xl-65-px {
    height: 65px;
  }
  .w-xl-65-perc {
    width: 65%;;
  }
  .h-xl-65-perc {
    height: 65%;;
  }
  .w-xl-66-px {
    width: 66px;
  }
  .h-xl-66-px {
    height: 66px;
  }
  .w-xl-66-perc {
    width: 66%;;
  }
  .h-xl-66-perc {
    height: 66%;;
  }
  .w-xl-67-px {
    width: 67px;
  }
  .h-xl-67-px {
    height: 67px;
  }
  .w-xl-67-perc {
    width: 67%;;
  }
  .h-xl-67-perc {
    height: 67%;;
  }
  .w-xl-68-px {
    width: 68px;
  }
  .h-xl-68-px {
    height: 68px;
  }
  .w-xl-68-perc {
    width: 68%;;
  }
  .h-xl-68-perc {
    height: 68%;;
  }
  .w-xl-69-px {
    width: 69px;
  }
  .h-xl-69-px {
    height: 69px;
  }
  .w-xl-69-perc {
    width: 69%;;
  }
  .h-xl-69-perc {
    height: 69%;;
  }
  .w-xl-70-px {
    width: 70px;
  }
  .h-xl-70-px {
    height: 70px;
  }
  .w-xl-70-perc {
    width: 70%;;
  }
  .h-xl-70-perc {
    height: 70%;;
  }
  .w-xl-71-px {
    width: 71px;
  }
  .h-xl-71-px {
    height: 71px;
  }
  .w-xl-71-perc {
    width: 71%;;
  }
  .h-xl-71-perc {
    height: 71%;;
  }
  .w-xl-72-px {
    width: 72px;
  }
  .h-xl-72-px {
    height: 72px;
  }
  .w-xl-72-perc {
    width: 72%;;
  }
  .h-xl-72-perc {
    height: 72%;;
  }
  .w-xl-73-px {
    width: 73px;
  }
  .h-xl-73-px {
    height: 73px;
  }
  .w-xl-73-perc {
    width: 73%;;
  }
  .h-xl-73-perc {
    height: 73%;;
  }
  .w-xl-74-px {
    width: 74px;
  }
  .h-xl-74-px {
    height: 74px;
  }
  .w-xl-74-perc {
    width: 74%;;
  }
  .h-xl-74-perc {
    height: 74%;;
  }
  .w-xl-75-px {
    width: 75px;
  }
  .h-xl-75-px {
    height: 75px;
  }
  .w-xl-75-perc {
    width: 75%;;
  }
  .h-xl-75-perc {
    height: 75%;;
  }
  .w-xl-76-px {
    width: 76px;
  }
  .h-xl-76-px {
    height: 76px;
  }
  .w-xl-76-perc {
    width: 76%;;
  }
  .h-xl-76-perc {
    height: 76%;;
  }
  .w-xl-77-px {
    width: 77px;
  }
  .h-xl-77-px {
    height: 77px;
  }
  .w-xl-77-perc {
    width: 77%;;
  }
  .h-xl-77-perc {
    height: 77%;;
  }
  .w-xl-78-px {
    width: 78px;
  }
  .h-xl-78-px {
    height: 78px;
  }
  .w-xl-78-perc {
    width: 78%;;
  }
  .h-xl-78-perc {
    height: 78%;;
  }
  .w-xl-79-px {
    width: 79px;
  }
  .h-xl-79-px {
    height: 79px;
  }
  .w-xl-79-perc {
    width: 79%;;
  }
  .h-xl-79-perc {
    height: 79%;;
  }
  .w-xl-80-px {
    width: 80px;
  }
  .h-xl-80-px {
    height: 80px;
  }
  .w-xl-80-perc {
    width: 80%;;
  }
  .h-xl-80-perc {
    height: 80%;;
  }
  .w-xl-81-px {
    width: 81px;
  }
  .h-xl-81-px {
    height: 81px;
  }
  .w-xl-81-perc {
    width: 81%;;
  }
  .h-xl-81-perc {
    height: 81%;;
  }
  .w-xl-82-px {
    width: 82px;
  }
  .h-xl-82-px {
    height: 82px;
  }
  .w-xl-82-perc {
    width: 82%;;
  }
  .h-xl-82-perc {
    height: 82%;;
  }
  .w-xl-83-px {
    width: 83px;
  }
  .h-xl-83-px {
    height: 83px;
  }
  .w-xl-83-perc {
    width: 83%;;
  }
  .h-xl-83-perc {
    height: 83%;;
  }
  .w-xl-84-px {
    width: 84px;
  }
  .h-xl-84-px {
    height: 84px;
  }
  .w-xl-84-perc {
    width: 84%;;
  }
  .h-xl-84-perc {
    height: 84%;;
  }
  .w-xl-85-px {
    width: 85px;
  }
  .h-xl-85-px {
    height: 85px;
  }
  .w-xl-85-perc {
    width: 85%;;
  }
  .h-xl-85-perc {
    height: 85%;;
  }
  .w-xl-86-px {
    width: 86px;
  }
  .h-xl-86-px {
    height: 86px;
  }
  .w-xl-86-perc {
    width: 86%;;
  }
  .h-xl-86-perc {
    height: 86%;;
  }
  .w-xl-87-px {
    width: 87px;
  }
  .h-xl-87-px {
    height: 87px;
  }
  .w-xl-87-perc {
    width: 87%;;
  }
  .h-xl-87-perc {
    height: 87%;;
  }
  .w-xl-88-px {
    width: 88px;
  }
  .h-xl-88-px {
    height: 88px;
  }
  .w-xl-88-perc {
    width: 88%;;
  }
  .h-xl-88-perc {
    height: 88%;;
  }
  .w-xl-89-px {
    width: 89px;
  }
  .h-xl-89-px {
    height: 89px;
  }
  .w-xl-89-perc {
    width: 89%;;
  }
  .h-xl-89-perc {
    height: 89%;;
  }
  .w-xl-90-px {
    width: 90px;
  }
  .h-xl-90-px {
    height: 90px;
  }
  .w-xl-90-perc {
    width: 90%;;
  }
  .h-xl-90-perc {
    height: 90%;;
  }
  .w-xl-91-px {
    width: 91px;
  }
  .h-xl-91-px {
    height: 91px;
  }
  .w-xl-91-perc {
    width: 91%;;
  }
  .h-xl-91-perc {
    height: 91%;;
  }
  .w-xl-92-px {
    width: 92px;
  }
  .h-xl-92-px {
    height: 92px;
  }
  .w-xl-92-perc {
    width: 92%;;
  }
  .h-xl-92-perc {
    height: 92%;;
  }
  .w-xl-93-px {
    width: 93px;
  }
  .h-xl-93-px {
    height: 93px;
  }
  .w-xl-93-perc {
    width: 93%;;
  }
  .h-xl-93-perc {
    height: 93%;;
  }
  .w-xl-94-px {
    width: 94px;
  }
  .h-xl-94-px {
    height: 94px;
  }
  .w-xl-94-perc {
    width: 94%;;
  }
  .h-xl-94-perc {
    height: 94%;;
  }
  .w-xl-95-px {
    width: 95px;
  }
  .h-xl-95-px {
    height: 95px;
  }
  .w-xl-95-perc {
    width: 95%;;
  }
  .h-xl-95-perc {
    height: 95%;;
  }
  .w-xl-96-px {
    width: 96px;
  }
  .h-xl-96-px {
    height: 96px;
  }
  .w-xl-96-perc {
    width: 96%;;
  }
  .h-xl-96-perc {
    height: 96%;;
  }
  .w-xl-97-px {
    width: 97px;
  }
  .h-xl-97-px {
    height: 97px;
  }
  .w-xl-97-perc {
    width: 97%;;
  }
  .h-xl-97-perc {
    height: 97%;;
  }
  .w-xl-98-px {
    width: 98px;
  }
  .h-xl-98-px {
    height: 98px;
  }
  .w-xl-98-perc {
    width: 98%;;
  }
  .h-xl-98-perc {
    height: 98%;;
  }
  .w-xl-99-px {
    width: 99px;
  }
  .h-xl-99-px {
    height: 99px;
  }
  .w-xl-99-perc {
    width: 99%;;
  }
  .h-xl-99-perc {
    height: 99%;;
  }
  .w-xl-100-px {
    width: 100px;
  }
  .h-xl-100-px {
    height: 100px;
  }
  .w-xl-100-perc {
    width: 100%;;
  }
  .h-xl-100-perc {
    height: 100%;;
  }
}
.kt-block-spacer hr {
  opacity: 1 !important;
}
.wpforms-submit {
  background: #02A6E1 !important;
  color: #fff !important;
  border-top-left-radius: 22px !important;
  border-top-right-radius: 22px !important;
  border-bottom-right-radius: 22px !important;
  border-bottom-left-radius: 22px !important;
  border: 2px solid #02A6E1 !important;
  box-shadow: none !important;
  cursor: pointer !important;
  font-size: 1.125rem !important;
  padding: 0.4em 1em !important;
  transition: all 0.3s ease-in-out !important;
  outline: none !important;
}
.wpforms-submit:focus {
  outline: none !important;
  box-shadow: none !important;
}
.text-white > * {
  color: #fff !important;
}
.text-white > *:any-link {
  color: #fff;
}
.text-decoration-none > * {
  text-decoration: none !important;
}
.text-decoration-none > *:any-link {
  text-decoration: none !important;
}
.dogs > [class*="col"] > a figure:not(.no-photo), .dogs > [class*="col"] > div figure:not(.no-photo) {
  height: 220px;
  position: relative;
  background-color: #000;
}
.dogs > [class*="col"] > a figure:not(.no-photo) img, .dogs > [class*="col"] > div figure:not(.no-photo) img {
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: 50% 50%;
}
.dogs > [class*="col"] > a figure.no-photo, .dogs > [class*="col"] > div figure.no-photo {
  height: 220px;
  position: relative;
  background-color: #000;
}
.dogs > [class*="col"] > a figure.no-photo img, .dogs > [class*="col"] > div figure.no-photo img {
  width: 100%;
  height: 100%;
  object-fit: scale-down;
  object-position: 50% 50%;
}
.dogs > [class*="col"] > a header, .dogs > [class*="col"] > div header {
  line-height: 1.2;
}

/* lbwps-styles-photoswipe5-main */
.pswp{--pswp-bg:#000;--pswp-placeholder-bg:#222;--pswp-root-z-index:100000;--pswp-preloader-color:rgba(79, 79, 79, 0.4);--pswp-preloader-color-secondary:rgba(255, 255, 255, 0.9);--pswp-icon-color:#fff;--pswp-icon-color-secondary:#4f4f4f;--pswp-icon-stroke-color:#4f4f4f;--pswp-icon-stroke-width:2px;--pswp-error-text-color:var(--pswp-icon-color)}.pswp{position:fixed;top:0;left:0;width:100%;height:100%;z-index:var(--pswp-root-z-index);display:none;touch-action:none;outline:0;opacity:.003;contain:layout style size;-webkit-tap-highlight-color:rgba(0,0,0,0)}.pswp:focus{outline:0}.pswp *{box-sizing:border-box}.pswp img{max-width:none}.pswp--open{display:block}.pswp,.pswp__bg{transform:translateZ(0);will-change:opacity}.pswp__bg{opacity:.005;background:var(--pswp-bg)}.pswp,.pswp__scroll-wrap{overflow:hidden}.pswp__scroll-wrap,.pswp__bg,.pswp__container,.pswp__item,.pswp__content,.pswp__img,.pswp__zoom-wrap{position:absolute;top:0;left:0;width:100%;height:100%}.pswp__img,.pswp__zoom-wrap{width:auto;height:auto}.pswp--click-to-zoom.pswp--zoom-allowed .pswp__img{cursor:-webkit-zoom-in;cursor:-moz-zoom-in;cursor:zoom-in}.pswp--click-to-zoom.pswp--zoomed-in .pswp__img{cursor:move;cursor:-webkit-grab;cursor:-moz-grab;cursor:grab}.pswp--click-to-zoom.pswp--zoomed-in .pswp__img:active{cursor:-webkit-grabbing;cursor:-moz-grabbing;cursor:grabbing}.pswp--no-mouse-drag.pswp--zoomed-in .pswp__img,.pswp--no-mouse-drag.pswp--zoomed-in .pswp__img:active,.pswp__img{cursor:-webkit-zoom-out;cursor:-moz-zoom-out;cursor:zoom-out}.pswp__container,.pswp__img,.pswp__button,.pswp__counter{-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.pswp__item{z-index:1;overflow:hidden}.pswp__hidden{display:none!important}.pswp__content{pointer-events:none}.pswp__content>*{pointer-events:auto}.pswp__error-msg-container{display:grid}.pswp__error-msg{margin:auto;font-size:1em;line-height:1;color:var(--pswp-error-text-color)}.pswp .pswp__hide-on-close{opacity:.005;will-change:opacity;transition:opacity var(--pswp-transition-duration) cubic-bezier(.4,0,.22,1);z-index:10}.pswp--ui-visible .pswp__hide-on-close{opacity:1}.pswp__button{position:relative;display:block;width:50px;height:60px;padding:0;margin:0;overflow:hidden;cursor:pointer;background:none;border:0;box-shadow:none;opacity:.85;-webkit-appearance:none;-webkit-touch-callout:none}.pswp--ui-visible .pswp__button:hover,.pswp--ui-visible .pswp__button:active,.pswp--ui-visible .pswp__button:focus{transition:none;padding:0;background:none;border:0;box-shadow:none;opacity:1}.pswp__button:disabled{opacity:.3;cursor:auto}.pswp__icn{fill:var(--pswp-icon-color);color:var(--pswp-icon-color-secondary)}.pswp__icn{position:absolute;top:14px;left:9px;width:32px;height:32px;overflow:hidden;pointer-events:none}.pswp__icn-shadow{stroke:var(--pswp-icon-stroke-color);stroke-width:var(--pswp-icon-stroke-width);fill:none}.pswp__icn:focus{outline:0}div.pswp__img--placeholder,.pswp__img--with-bg{background:var(--pswp-placeholder-bg)}.pswp__top-bar{position:absolute;left:0;top:0;width:100%;height:60px;display:flex;flex-direction:row;justify-content:flex-end;z-index:10;pointer-events:none!important}.pswp__top-bar>*{pointer-events:auto;will-change:opacity}.pswp__button--close{margin-right:6px}.pswp__button--arrow{position:absolute;top:0;width:75px;height:100px;top:50%;margin-top:-50px}.pswp__button--arrow:disabled{display:none;cursor:default}.pswp__button--arrow .pswp__icn{top:50%;margin-top:-30px;width:60px;height:60px;background:none;border-radius:0}.pswp--one-slide .pswp__button--arrow{display:none}.pswp--touch .pswp__button--arrow{visibility:hidden}.pswp--has_mouse .pswp__button--arrow{visibility:visible}.pswp__button--arrow--prev{right:auto;left:0}.pswp__button--arrow--next{right:0}.pswp__button--arrow--next .pswp__icn{left:auto;right:14px;transform:scale(-1,1)}.pswp__button--zoom{display:none}.pswp--zoom-allowed .pswp__button--zoom{display:block}.pswp--zoomed-in .pswp__zoom-icn-bar-v{display:none}.pswp__preloader{position:relative;overflow:hidden;width:50px;height:60px;margin-right:auto}.pswp__preloader .pswp__icn{opacity:0;transition:opacity 0.2s linear;animation:pswp-clockwise 600ms linear infinite}.pswp__preloader--active .pswp__icn{opacity:.85}@keyframes pswp-clockwise{0%{transform:rotate(0deg)}100%{transform:rotate(360deg)}}.pswp__counter{height:30px;margin:15px 0 0 20px;font-size:14px;line-height:30px;color:var(--pswp-icon-color);text-shadow:1px 1px 3px var(--pswp-icon-color-secondary);opacity:.85}.pswp--one-slide .pswp__counter{display:none}.pswp__dynamic-caption{color:#ccc;position:absolute;width:100%;left:0;top:0;transition:opacity 120ms linear!important;line-height:1.5em}.pswp__dynamic-caption--aside,.pswp__dynamic-caption--below{opacity:1!important}.pswp-caption-content{display:none}.pswp__dynamic-caption a{color:#ccc}.pswp__dynamic-caption--faded{opacity:0!important}.pswp__dynamic-caption--aside{width:auto;max-width:300px;padding:20px 15px 20px 20px;margin-top:70px}.pswp__dynamic-caption--below{width:auto;max-width:700px;padding:15px 0 0}.pswp__dynamic-caption--on-hor-edge{padding-left:15px;padding-right:15px}.pswp__dynamic-caption--mobile{width:100%;top:auto;right:0;bottom:0;background:rgba(0,0,0,.5);padding:10px 15px}.pswp__caption,.pswp__caption__exif{padding-bottom:.5em}.pswp__caption__exif_camera{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0ibTQsNWwzLDBsMiwtMmw2LDBsMiwybDMsMGEyLDIgMCAwIDEgMiwybDAsMTJhMiwyIDAgMCAxIC0yLDJsLTE2LDBhMiwyIDAgMCAxIC0yLC0ybDAsLTEyYTIsMiAwIDAgMSAyLC0ybTgsM2E1LDUgMCAwIDAgLTUsNWE1LDUgMCAwIDAgNSw1YTUsNSAwIDAgMCA1LC01YTUsNSAwIDAgMCAtNSwtNW0wLDJhMywzIDAgMCAxIDMsM2EzLDMgMCAwIDEgLTMsM2EzLDMgMCAwIDEgLTMsLTNhMywzIDAgMCAxIDMsLTN6Ii8+PC9zdmc+)}.pswp__caption__exif_lens{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDMwMCAzMDAiPjxwYXRoIGZpbGw9IiNjY2NjY2MiIGQ9Ik0yOTMuNzUsNTYuMjVIMjc1VjM3LjVjMC0zLjQ1Ni0yLjc5NC02LjI1LTYuMjUtNi4yNWgtMTAwYy0zLjQ1NiwwLTYuMjUsMi43OTQtNi4yNSw2LjI1djMxLjI1SDE1MFY2Mi41IGMwLTMuNDU2LTIuNzk0LTYuMjUtNi4yNS02LjI1aC04Ny41Yy0zLjQ1NiwwLTYuMjUsMi43OTQtNi4yNSw2LjI1djYuMjVINi4yNUMyLjc5NCw2OC43NSwwLDcxLjU0NCwwLDc1djE1MCBjMCwzLjQ1NiwyLjc5NCw2LjI1LDYuMjUsNi4yNUg1MHY2LjI1YzAsMy40NTYsMi43OTQsNi4yNSw2LjI1LDYuMjVoODcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1di02LjI1aDEyLjV2MzEuMjUgYzAsMy40NTYsMi43OTQsNi4yNSw2LjI1LDYuMjVoMTAwYzMuNDU2LDAsNi4yNS0yLjc5NCw2LjI1LTYuMjV2LTE4Ljc1aDE4Ljc1YzMuNDU2LDAsNi4yNS0yLjc5NCw2LjI1LTYuMjV2LTE3NSBDMzAwLDU5LjA0NCwyOTcuMjA2LDU2LjI1LDI5My43NSw1Ni4yNXogTTEyLjUsMjE4Ljc1VjgxLjI1SDUwdjEzNy41SDEyLjV6IE0xMzcuNSwyMzEuMjVoLTc1VjIyNVY3NXYtNi4yNWg3NVYyMzEuMjV6IE0xNTAsMjE4Ljc1VjgxLjI1aDEyLjV2MTM3LjVIMTUweiBNMjYyLjUsMjU2LjI1SDE3NVY0My43NWg4Ny41VjYyLjV2MTc1VjI1Ni4yNXogTTI4Ny41LDIzMS4yNUgyNzVWNjguNzVoMTIuNVYyMzEuMjV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDY4Ljc1SDIwMGMtMy40NTYsMC02LjI1LDIuNzk0LTYuMjUsNi4yNXMyLjc5NCw2LjI1LDYuMjUsNi4yNWgzNy41YzMuNDU2LDAsNi4yNS0yLjc5NCw2LjI1LTYuMjUgUzI0MC45NTYsNjguNzUsMjM3LjUsNjguNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDkzLjc1SDIwMGMtMy40NTYsMC02LjI1LDIuNzk0LTYuMjUsNi4yNXMyLjc5NCw2LjI1LDYuMjUsNi4yNWgzNy41YzMuNDU2LDAsNi4yNS0yLjc5NCw2LjI1LTYuMjUgUzI0MC45NTYsOTMuNzUsMjM3LjUsOTMuNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDExOC43NUgyMDBjLTMuNDU2LDAtNi4yNSwyLjc5NC02LjI1LDYuMjVzMi43OTQsNi4yNSw2LjI1LDYuMjVoMzcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1IFMyNDAuOTU2LDExOC43NSwyMzcuNSwxMTguNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDE0My43NUgyMDBjLTMuNDU2LDAtNi4yNSwyLjc5NC02LjI1LDYuMjVzMi43OTQsNi4yNSw2LjI1LDYuMjVoMzcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1IFMyNDAuOTU2LDE0My43NSwyMzcuNSwxNDMuNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDE2OC43NUgyMDBjLTMuNDU2LDAtNi4yNSwyLjc5NC02LjI1LDYuMjVzMi43OTQsNi4yNSw2LjI1LDYuMjVoMzcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1IFMyNDAuOTU2LDE2OC43NSwyMzcuNSwxNjguNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDE5My43NUgyMDBjLTMuNDU2LDAtNi4yNSwyLjc5NC02LjI1LDYuMjVzMi43OTQsNi4yNSw2LjI1LDYuMjVoMzcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1IFMyNDAuOTU2LDE5My43NSwyMzcuNSwxOTMuNzV6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgZD0iTTIzNy41LDIxOC43NUgyMDBjLTMuNDU2LDAtNi4yNSwyLjc5NC02LjI1LDYuMjVzMi43OTQsNi4yNSw2LjI1LDYuMjVoMzcuNWMzLjQ1NiwwLDYuMjUtMi43OTQsNi4yNS02LjI1IFMyNDAuOTU2LDIxOC43NSwyMzcuNSwyMTguNzV6Ii8+PHJlY3QgZmlsbD0iI2NjY2NjYyIgeD0iNzUiIHk9IjgxLjI1IiB3aWR0aD0iNTAiIGhlaWdodD0iMTIuNSIvPjxyZWN0IGZpbGw9IiNjY2NjY2MiIHg9Ijc1IiB5PSIxMDYuMjUiIHdpZHRoPSI1MCIgaGVpZ2h0PSIxMi41Ii8+PHJlY3QgZmlsbD0iI2NjY2NjYyIgeD0iNzUiIHk9IjEzMS4yNSIgd2lkdGg9IjUwIiBoZWlnaHQ9IjEyLjUiLz48cmVjdCBmaWxsPSIjY2NjY2NjIiB4PSI3NSIgeT0iMTU2LjI1IiB3aWR0aD0iNTAiIGhlaWdodD0iMTIuNSIvPjxyZWN0IGZpbGw9IiNjY2NjY2MiIHg9Ijc1IiB5PSIxODEuMjUiIHdpZHRoPSI1MCIgaGVpZ2h0PSIxMi41Ii8+PHJlY3QgZmlsbD0iI2NjY2NjYyIgeD0iNzUiIHk9IjIwNi4yNSIgd2lkdGg9IjUwIiBoZWlnaHQ9IjEyLjUiLz48L3N2Zz4=)}.pswp__caption__exif_focal{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0Ij48cGF0aCBmaWxsPSIjY2NjY2NjIiBkPSJNMTIgNi41YzMuNzkgMCA3LjE3IDIuMTMgOC44MiA1LjUtMS42NSAzLjM3LTUuMDIgNS41LTguODIgNS41UzQuODMgMTUuMzcgMy4xOCAxMkM0LjgzIDguNjMgOC4yMSA2LjUgMTIgNi41bTAtMkM3IDQuNSAyLjczIDcuNjEgMSAxMmMxLjczIDQuMzkgNiA3LjUgMTEgNy41czkuMjctMy4xMSAxMS03LjVjLTEuNzMtNC4zOS02LTcuNS0xMS03LjV6bTAgNWMxLjM4IDAgMi41IDEuMTIgMi41IDIuNXMtMS4xMiAyLjUtMi41IDIuNS0yLjUtMS4xMi0yLjUtMi41IDEuMTItMi41IDIuNS0yLjVtMC0yYy0yLjQ4IDAtNC41IDIuMDItNC41IDQuNXMyLjAyIDQuNSA0LjUgNC41IDQuNS0yLjAyIDQuNS00LjUtMi4wMi00LjUtNC41LTQuNXoiPjwvcGF0aD48L3N2Zz4K)}.pswp__caption__exif_shutter{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0Ij48cGF0aCBmaWxsPSIjY2NjY2NjIiBkPSJNMTUgMUg5djJoNlYxem00LjAzIDYuMzlsMS40Mi0xLjQyYy0uNDMtLjUxLS45LS45OS0xLjQxLTEuNDFsLTEuNDIgMS40MkMxNi4wNyA0Ljc0IDE0LjEyIDQgMTIgNGMtNC45NyAwLTkgNC4wMy05IDlzNC4wMiA5IDkgOSA5LTQuMDMgOS05YzAtMi4xMi0uNzQtNC4wNy0xLjk3LTUuNjF6TTEyIDIwYy0zLjg3IDAtNy0zLjEzLTctN3MzLjEzLTcgNy03IDcgMy4xMyA3IDctMy4xMyA3LTcgN3ptLS4zMi01SDYuMzVjLjU3IDEuNjIgMS44MiAyLjkyIDMuNDEgMy41NmwtLjExLS4wNiAyLjAzLTMuNXptNS45Ny00Yy0uNTctMS42LTEuNzgtMi44OS0zLjM0LTMuNTRMMTIuMjYgMTFoNS4zOXptLTcuMDQgNy44M2MuNDUuMTEuOTEuMTcgMS4zOS4xNyAxLjM0IDAgMi41Ny0uNDUgMy41Ny0xLjE5bC0yLjExLTMuOS0yLjg1IDQuOTJ6TTcuNTUgOC45OUM2LjU5IDEwLjA1IDYgMTEuNDYgNiAxM2MwIC4zNC4wNC42Ny4wOSAxaDQuNzJMNy41NSA4Ljk5em04Ljc5IDguMTRDMTcuMzcgMTYuMDYgMTggMTQuNiAxOCAxM2MwLS4zNC0uMDQtLjY3LS4wOS0xaC00LjM0bDIuNzcgNS4xM3ptLTMuMDEtOS45OEMxMi45IDcuMDYgMTIuNDYgNyAxMiA3Yy0xLjQgMC0yLjY5LjQ5LTMuNzEgMS4yOWwyLjMyIDMuNTYgMi43Mi00Ljd6Ij48L3BhdGg+PC9zdmc+Cg==)}.pswp__caption__exif_fstop{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0Ij48cGF0aCBmaWxsPSIjY2NjY2NjIiBkPSJNOS40IDEwLjVsNC43Ny04LjI2QzEzLjQ3IDIuMDkgMTIuNzUgMiAxMiAyYy0yLjQgMC00LjYuODUtNi4zMiAyLjI1bDMuNjYgNi4zNS4wNi0uMXpNMjEuNTQgOWMtLjkyLTIuOTItMy4xNS01LjI2LTYtNi4zNEwxMS44OCA5aDkuNjZ6bS4yNiAxaC03LjQ5bC4yOS41IDQuNzYgOC4yNUMyMSAxNi45NyAyMiAxNC42MSAyMiAxMmMwLS42OS0uMDctMS4zNS0uMi0yek04LjU0IDEybC0zLjktNi43NUMzLjAxIDcuMDMgMiA5LjM5IDIgMTJjMCAuNjkuMDcgMS4zNS4yIDJoNy40OWwtMS4xNS0yem0tNi4wOCAzYy45MiAyLjkyIDMuMTUgNS4yNiA2IDYuMzRMMTIuMTIgMTVIMi40NnptMTEuMjcgMGwtMy45IDYuNzZjLjcuMTUgMS40Mi4yNCAyLjE3LjI0IDIuNCAwIDQuNi0uODUgNi4zMi0yLjI1bC0zLjY2LTYuMzUtLjkzIDEuNnoiPjwvcGF0aD48L3N2Zz4=)}.pswp__caption__exif_iso{padding-left:1.5em;padding-right:.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0Ij48cGF0aCBmaWxsPSIjY2NjY2NjIiBkPSJNMTkgM0g1Yy0xLjEgMC0yIC45LTIgMnYxNGMwIDEuMS45IDIgMiAyaDE0YzEuMSAwIDItLjkgMi0yVjVjMC0xLjEtLjktMi0yLTJ6TTUuNSA3LjVoMnYtMkg5djJoMlY5SDl2Mkg3LjVWOWgtMlY3LjV6TTE5IDE5SDVMMTkgNXYxNHptLTItMnYtMS41aC01VjE3aDV6Ij48L3BhdGg+PC9zdmc+Cg==)}.pswp__caption__exif_datetime{padding-left:1.5em;white-space:nowrap;background-position:0 center;background-repeat:no-repeat;background-size:1.2em 1.2em;background-image:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+PHBhdGggZmlsbD0iI2NjY2NjYyIgc3Ryb2tlPSJudWxsIiBpZD0ic3ZnXzIiIGQ9Im0yMC44NDM4MywzLjM5NjkybC0zLjc2NDI0LDBsMCwtMC41NjY2MmMwLC0wLjMxNzIxIC0wLjI1NzI3LC0wLjU3NDQ3IC0wLjU3NDQ3LC0wLjU3NDQ3cy0wLjU3NDQ3LDAuMjU3MjcgLTAuNTc0NDcsMC41NzQ0N2wwLDAuNTY2NjJsLTMuMzU2MTcsMGwwLC0wLjU2NjYyYzAsLTAuMzE3MjEgLTAuMjU3MjcsLTAuNTc0NDcgLTAuNTc0NDcsLTAuNTc0NDdzLTAuNTc0NDcsMC4yNTcyNyAtMC41NzQ0NywwLjU3NDQ3bDAsMC41NjY2MmwtMy4yMTM1MSwwbDAsLTAuNTY2NjJjMCwtMC4zMTcyMSAtMC4yNTcyNywtMC41NzQ0NyAtMC41NzQ0NywtMC41NzQ0N3MtMC41NzQ0NywwLjI1NzI3IC0wLjU3NDQ3LDAuNTc0NDdsMCwwLjU2NjYybC0zLjkwNjgsMGMtMC4zMTcyMSwwIC0wLjU3NDQ3LDAuMjU3MjcgLTAuNTc0NDcsMC41NzQ0N2wwLDEyLjk4MDQyYzAsMC4zMTcyMSAwLjI1NzI3LDAuNTc0NDcgMC41NzQ0NywwLjU3NDQ3bDMuNTI1OTMsMGMwLjU2NDk5LDIuNDE0MTMgMi43MzQwMiw0LjIxNzg4IDUuMzE3ODEsNC4yMTc4OHM0Ljc1MjgxLC0xLjgwMzg1IDUuMzE3ODEsLTQuMjE3ODhsMy41MjU5MywwYzAuMzE3MjEsMCAwLjU3NDQ3LC0wLjI1NzI3IDAuNTc0NDcsLTAuNTc0NDdsMCwtMTIuOTgwNDJjMC4wMDAxLC0wLjMxNzIxIC0wLjI1NzA4LC0wLjU3NDQ3IC0wLjU3NDM4LC0wLjU3NDQ3em0tMTMuNzgwNzYsMS4xNDg5NWwwLDAuNTE5MTNjMCwwLjMxNzIxIDAuMjU3MjcsMC41NzQ0NyAwLjU3NDQ3LDAuNTc0NDdzMC41NzQ0NywtMC4yNTcyNyAwLjU3NDQ3LC0wLjU3NDQ3bDAsLTAuNTE5MTNsMy4yMTM1MSwwbDAsMC41MTkxM2MwLDAuMzE3MjEgMC4yNTcyNywwLjU3NDQ3IDAuNTc0NDcsMC41NzQ0N3MwLjU3NDQ3LC0wLjI1NzI3IDAuNTc0NDcsLTAuNTc0NDdsMCwtMC41MTkxM2wzLjM1NjE3LDBsMCwwLjUxOTEzYzAsMC4zMTcyMSAwLjI1NzI3LDAuNTc0NDcgMC41NzQ0NywwLjU3NDQ3czAuNTc0NDcsLTAuMjU3MjcgMC41NzQ0NywtMC41NzQ0N2wwLC0wLjUxOTEzbDMuMTg5NzYsMGwwLDIuMzQ5MjFsLTE2LjUzODYyLDBsMCwtMi4zNDkyMWwzLjMzMjMzLDB6bTQuOTM2OTMsMTYuMDQ5MzZjLTIuMzc4NTEsMCAtNC4zMTM2MywtMS45MzUxMSAtNC4zMTM2MywtNC4zMTM2M3MxLjkzNTExLC00LjMxMzYzIDQuMzEzNjMsLTQuMzEzNjNzNC4zMTM2MywxLjkzNTAyIDQuMzEzNjMsNC4zMTM2M3MtMS45MzUwMiw0LjMxMzYzIC00LjMxMzYzLDQuMzEzNjN6bTUuNDYwMTgsLTQuMjE3ODhjMC4wMDA1NywtMC4wMzE5OCAwLjAwMjM5LC0wLjA2MzY3IDAuMDAyMzksLTAuMDk1NzVjMCwtMy4wMTIwNiAtMi40NTA1MSwtNS40NjI1NyAtNS40NjI1NywtNS40NjI1N3MtNS40NjI1NywyLjQ1MDUxIC01LjQ2MjU3LDUuNDYyNTdjMCwwLjAzMjA3IDAuMDAxOTEsMC4wNjM3NyAwLjAwMjM5LDAuMDk1NzVsLTIuODA5MTgsMGwwLC04LjMzMzIybDE2LjUzODYyLDBsMCw4LjMzMzIybC0yLjgwOTA4LDB6Ii8+PHBhdGggZmlsbD0iI2NjY2NjYyIgc3Ryb2tlPSJudWxsIiBpZD0ic3ZnXzMiIGQ9Im0xMi41NzQ0NywxNi40MjY1NmwwLC0yLjc3OTExYzAsLTAuMzE3MjEgLTAuMjU3MjcsLTAuNTc0NDcgLTAuNTc0NDcsLTAuNTc0NDdzLTAuNTc0NDcsMC4yNTcyNyAtMC41NzQ0NywwLjU3NDQ3bDAsMy4wMTcxNGMwLDAuMTUyMzMgMC4wNjA1MSwwLjI5ODQ0IDAuMTY4MjMsMC40MDYyNWwxLjMyMDMzLDEuMzIwNDNjMC4xMTIyMSwwLjExMjEyIDAuMjU5MTgsMC4xNjgyMyAwLjQwNjI1LDAuMTY4MjNjMC4xNDY5NywwIDAuMjk0MDMsLTAuMDU2MTEgMC40MDYyNSwtMC4xNjgyM2MwLjIyNDMzLC0wLjIyNDMzIDAuMjI0MzMsLTAuNTg4MDcgMCwtMC44MTI0bC0xLjE1MjExLC0xLjE1MjN6Ii8+PC9zdmc+Cg==)}.pswp__dynamic-caption--overlay{position:absolute!important;bottom:0;top:initial;text-align:center;background:rgba(0,0,0,.7);padding-top:.5em}